Don't use std::filesystem; it makes life harder on Windows with its wide

strings.

.clang-format

@@ -0,0 +1,44 @@
+---
+AccessModifierOffset: -4
+AlignAfterOpenBracket: DontAlign
+AlignArrayOfStructures: Left
+AlignEscapedNewlines: Left
+AllowAllArgumentsOnNextLine: 'true'
+AllowAllConstructorInitializersOnNextLine: 'false'
+AllowAllParametersOfDeclarationOnNextLine: 'true'
+AllowShortBlocksOnASingleLine: 'true'
+AllowShortCaseLabelsOnASingleLine: 'false'
+AllowShortFunctionsOnASingleLine: Empty
+AllowShortIfStatementsOnASingleLine: Never
+AllowShortLambdasOnASingleLine: None
+AllowShortLoopsOnASingleLine: 'false'
+AlwaysBreakAfterDefinitionReturnType: None
+AlwaysBreakAfterReturnType: None
+AlwaysBreakBeforeMultilineStrings: 'true'
+AlwaysBreakTemplateDeclarations: 'Yes'
+BinPackArguments: 'false'
+BinPackParameters: 'false'
+BreakBeforeBraces: Allman
+BreakConstructorInitializers: 'AfterColon'
+BreakInheritanceList: AfterColon
+BreakStringLiterals: 'true'
+ColumnLimit: '80'
+ConstructorInitializerAllOnOneLineOrOnePerLine: 'true'
+FixNamespaceComments: 'false'
+IncludeBlocks: Preserve
+IndentCaseLabels: 'true'
+IndentWidth: '4'
+IndentWrappedFunctionNames: 'false'
+KeepEmptyLinesAtTheStartOfBlocks: 'true'
+NamespaceIndentation: All
+PointerAlignment: Left
+ReflowComments: 'true'
+SortIncludes: 'false'
+SortUsingDeclarations: 'true'
+SpaceAfterTemplateKeyword: 'true'
+SpaceBeforeAssignmentOperators: 'true'
+SpaceBeforeCtorInitializerColon: 'false'
+SpaceBeforeInheritanceColon: 'true'
+SpaceBeforeParens: ControlStatements
+SpaceInEmptyParentheses: 'false'
+...

.github/workflows/ccpp.yml

@@ -2,28 +2,48 @@ name: C/C++ CI
 
 on: [push]
 
+concurrency: 
+  group: environment-${{ github.head_ref }}
+  cancel-in-progress: true
+
 jobs:
   build-linux:
-    runs-on: ubuntu-latest
+    runs-on: ubuntu-22.04
     steps:
-    - uses: actions/checkout@v1
+    - uses: actions/checkout@v2
       with:
-        fetch-depth: 1
+        repository: 'davidgiven/fluxengine'
+        path: 'fluxengine'
+    - uses: actions/checkout@v2
+      with:
+        repository: 'davidgiven/fluxengine-testdata'
+        path: 'fluxengine-testdata'
     - name: apt
-      run: sudo apt update && sudo apt install libusb-1.0-0-dev libsqlite3-dev ninja-build protobuf-compiler
+      run: sudo apt update && sudo apt install libudev-dev libsqlite3-dev protobuf-compiler libwxgtk3.0-gtk3-dev libfmt-dev
     - name: make
-      run: make
+      run: CXXFLAGS="-Wp,-D_GLIBCXX_ASSERTIONS" make -j2 -C fluxengine
 
-  build-macos:
+  build-macos-current:
     runs-on: macos-latest
     steps:
     - uses: actions/checkout@v2
       with:
-        fetch-depth: 1
+        repository: 'davidgiven/fluxengine'
+        path: 'fluxengine'
+    - uses: actions/checkout@v2
+      with:
+        repository: 'davidgiven/fluxengine-testdata'
+        path: 'fluxengine-testdata'
     - name: brew
-      run: brew install sqlite pkg-config libusb ninja protobuf truncate
+      run: brew install sqlite pkg-config libusb protobuf wxwidgets fmt make coreutils dylibbundler libjpeg
     - name: make
-      run: make
+      run: gmake -j2 -C fluxengine
+
+    - name: Upload build artifacts
+      uses: actions/upload-artifact@v2
+      with:
+        name: ${{ github.event.repository.name }}.${{ github.sha }}
+        path: fluxengine.FluxEngine.pkg
 
   build-windows:
     runs-on: windows-latest
@@ -36,19 +56,47 @@ jobs:
         update: true
         msystem: MINGW32
         install: >-
+          diffutils
           make
-          ninja
+          mingw-w64-i686-fmt
-          mingw-w64-i686-libusb
-          mingw-w64-i686-sqlite3
-          mingw-w64-i686-zlib
           mingw-w64-i686-gcc
-          zip
+          mingw-w64-i686-libusb
+          mingw-w64-i686-pkg-config
           mingw-w64-i686-protobuf
+          mingw-w64-i686-sqlite3
+          mingw-w64-i686-wxWidgets
+          mingw-w64-i686-zlib
+          mingw-w64-i686-nsis
+          zip
           vim
-    - uses: actions/checkout@v1
+    - name: update-protobuf
-      with:
-        fetch-depth: 1
-    - name: build
       run: |
-        make
+         pacman -U --noconfirm https://repo.msys2.org/mingw/mingw32/mingw-w64-i686-protobuf-21.9-1-any.pkg.tar.zst
+    - uses: actions/checkout@v2
+      with:
+        repository: 'davidgiven/fluxengine'
+        path: 'fluxengine'
+    - uses: actions/checkout@v2
+      with:
+        repository: 'davidgiven/fluxengine-testdata'
+        path: 'fluxengine-testdata'
+    - name: build
+      run: make -j2 -C fluxengine
 
+    - name: nsis
+      run: |
+        cd fluxengine
+        strip fluxengine.exe -o fluxengine-stripped.exe
+        strip fluxengine-gui.exe -o fluxengine-gui-stripped.exe
+        makensis -v2 -nocd -dOUTFILE=fluxengine-installer.exe extras/windows-installer.nsi
+
+    - name: zip
+      run: |
+        cd fluxengine
+        zip -9 fluxengine-windows.zip fluxengine.exe fluxengine-gui.exe upgrade-flux-file.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex fluxengine-installer.exe
+
+    - name: Upload build artifacts
+      uses: actions/upload-artifact@v2
+      with:
+        name: ${{ github.event.repository.name }}.${{ github.sha }}
+        path: fluxengine/fluxengine-windows.zip

.github/workflows/release.yml

@@ -1,5 +1,9 @@
 name: Autorelease
 
+concurrency: 
+  group: environment-${{ github.head_ref }}
+  cancel-in-progress: true
+
 on:
   push:
     branches:
@@ -17,33 +21,51 @@ jobs:
         update: true
         msystem: MINGW32
         install: >-
+          diffutils
           make
-          ninja
+          mingw-w64-i686-fmt
-          mingw-w64-i686-libusb
-          mingw-w64-i686-sqlite3
-          mingw-w64-i686-zlib
           mingw-w64-i686-gcc
-          zip
+          mingw-w64-i686-libusb
+          mingw-w64-i686-pkg-config
           mingw-w64-i686-protobuf
+          mingw-w64-i686-sqlite3
+          mingw-w64-i686-wxWidgets
+          mingw-w64-i686-zlib
+          mingw-w64-i686-nsis
+          zip
           vim
-    - uses: actions/checkout@v2
+    - uses: actions/checkout@v3
-      with:
+
-        fetch-depth: 1
+    - name: update-protobuf
+      run: |
+         pacman -U --noconfirm https://repo.msys2.org/mingw/mingw32/mingw-w64-i686-protobuf-21.9-1-any.pkg.tar.zst
+
     - name: build
       run: |
-        make
+        make -j2
+
+    - name: nsis
+      run: |
+        strip fluxengine.exe -o fluxengine-stripped.exe
+        strip fluxengine-gui.exe -o fluxengine-gui-stripped.exe
+        makensis -v2 -nocd -dOUTFILE=fluxengine-installer.exe extras/windows-installer.nsi
+
     - name: zip
       run: |
-        zip -9 fluxengine.zip fluxengine.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex
+        zip -9 fluxengine.zip fluxengine.exe fluxengine-gui.exe upgrade-flux-file.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex
+
     - name: date
       run: |
         echo "RELEASE_DATE=$(date --rfc-3339=date)" >> ${GITHUB_ENV}
+
     - name: tag
       uses: EndBug/latest-tag@latest
       with:
         tag-name: dev
+        force-branch: false
       env:
         GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
     - name: delete-old-assets
       uses: mknejp/delete-release-assets@v1
       with:
@@ -51,13 +73,55 @@ jobs:
         tag: dev
         assets: | 
           fluxengine.zip
+          fluxengine-installer.exe
         fail-if-no-assets: false
+
     - name: release
       uses: softprops/action-gh-release@v1
       with:
         name: Development build ${{ env.RELEASE_DATE }}
         files: |
           fluxengine.zip
+          fluxengine-installer.exe
         tag_name: dev
       env:
         GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+  build-macos:
+    runs-on: macos-latest
+    steps:
+    - uses: actions/checkout@v2
+    - name: brew
+      run: brew install sqlite pkg-config libusb protobuf wxwidgets fmt make coreutils dylibbundler libjpeg
+    - name: make
+      run: gmake
+
+    - name: tag
+      uses: EndBug/latest-tag@latest
+      with:
+        tag-name: dev
+        force-branch: false
+      env:
+        GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+    - name: delete-old-assets
+      uses: mknejp/delete-release-assets@v1
+      with:
+        token: ${{ github.token }}
+        tag: dev
+        assets: | 
+          FluxEngine.pkg
+        fail-if-no-assets: false
+
+    - name: release
+      uses: softprops/action-gh-release@v1
+      with:
+        name: Development build ${{ env.RELEASE_DATE }}
+        files: |
+          FluxEngine.pkg
+        tag_name: dev
+      env:
+        GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+
+

.gitignore

@@ -1,2 +1,10 @@
 .obj
 .project
+/.ninja*
+/brother120tool
+/brother120tool-*
+/brother240tool
+/brother240tool-*
+/fluxengine
+/fluxengine-*
+/upgrade-flux-file

FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex

@@ -1,250 +1,250 @@
-:4000000000800020110000004110000041100000064A08B5136843F020031360044B1A6803F53F5302331A6001F028F8E8460040FA46004010B5054C237833B9044B13B163
+:400000000080002011000000A1100000A1100000064A08B5136843F020031360044B1A6803F53F5302331A6001F058F8E8460040FA46004010B5054C237833B9044B13B173
-:400040000448AFF300800123237010BD6881FF1F00000000C8380000084B10B51BB108490848AFF300800848036803B910BD074B002BFBD0BDE81040184700BF0000000041
+:400040000448AFF300800123237010BD6081FF1F00000000F0380000084B10B51BB108490848AFF300800848036803B910BD074B002BFBD0BDE81040184700BF0000000021
-:400080006C81FF1FC8380000C880FF1F000000000A4A0B4B116801310B40002BBEBF03F1FF3363F03F030133136011685368994202BF024B01221A72704700BF8881FF1FBC
+:400080006481FF1FF0380000C880FF1F000000000A4A0B4B116801310B40002BBEBF03F1FF3363F03F030133136011685368994202BF024B01221A72704700BF8081FF1FA4
-:4000C0003F0000800A4A0B4B516801310B40002BBEBF03F1FF3363F03F030133536051681368994202BF024B01221A72704700BF8881FF1F3F000080114BDA68196919B9FD
+:4000C0003F0000800A4A0B4B516801310B40002BBEBF03F1FF3363F03F030133536051681368994202BF024B01221A72704700BF8081FF1F3F000080114BDA68196919B905
-:4001000001221A75597514E09969521A19698A4294BF587D00201875187D094908B1002204E0086982428CBF002201224A75DA689A611B7D13B1002002F046B9704700BF70
+:4001000001221A75597514E09969521A19698A4294BF587D00201875187D094908B1002204E0086982428CBF002201224A75DA689A611B7D13B1002002F082B9704700BF34
-:400140008881FF1F10B5C4B2204601F059F90128FAD110BD08B572B60F4B0F49DA680132DA60DA690132C82A08BF0022DA611A6AD8690132A72A08BF00220A621B6A002B13
+:400140008081FF1F10B5C4B2204601F089F90128FAD110BD08B572B60F4B0F49DA680132DA60DA690132C82A08BF0022DA611A6AD8690132A72A08BF00220A621B6A002BEB
-:400180000CBF02230023002814BF184643F0010002F082FE62B608BD8881FF1F38B50446C5B2284602F0B2F8062002F0CFFA44F00200C0B202F0AAF8062002F0C7FA28460D
+:400180000CBF02230023002814BF184643F0010002F0DAFB62B608BD8081FF1F38B50446C5B2284602F0C4F8062002F099FD44F00200C0B202F0BCF8062002F091FD284602
-:4001C00002F0A4F8BDE83840062002F0A9BA10B5642402F095F828B9FFF7E0FF013CF8D1204610BD012010BD70B5C4B2054620460E4601F005F9012805D0204601F01EFA34
+:4001C00002F0B6F8BDE83840062002F073BD10B5642402F0A7F828B9FFF7E0FF013CF8D1204610BD012010BD70B5C4B2054620460E4601F035F9012805D0204601F04EFAE3
-:400200002846FFF79FFF204601F002F9314605460246204601F0BEF9204601F0F1F80028FAD1284670BD000038B5044D0024285D013402F03BFA402CF9D138BDAC81FF1FCB
+:400200002846FFF79FFF204601F032F9314605460246204601F0EEF9204601F021F90028FAD1284670BD000038B5044D0024285D013402F005FD402CF9D138BDA481FF1F75
-:4002400008B502F055FC002002F05EFC02F070FC02F07AFC80B208BD10B50446012002F06DF8642002F05CFAFFF7EAFF2080002002F064F8642002F053FAFFF7E1FF60809C
+:4002400008B502F0FDF9002002F006FA02F018FA02F022FA80B208BD10B50446012002F07FF8642002F026FDFFF7EAFF2080002002F076F8642002F01DFDFFF7E1FF608047
-:4002800010BD08B502F060FD002002F069FD02F07BFD02F085FD80B208BD10B50446FFF796FF322002F03CFAFFF7EBFF20800120FFF774FF322002F033FAFFF7E2FF6080D2
+:4002800010BD08B502F008FB002002F011FB02F023FB02F02DFB80B208BD10B50446FFF796FF322002F006FDFFF7EBFF20800120FFF774FF322002F0FDFCFFF7E2FF6080A1
-:4002C00010BD0FB400B593B014AB53F8042B402102A8019302F0E0FE02A802F07CF802F086F813B05DF804EB04B0704710B5044601780648FFF7E5FF0420FFF723FF627816
+:4002C00010BD0FB400B593B014AB53F8042B402102A8019302F0F4FE02A802F0BEF802F0C8F813B05DF804EB04B0704710B5044601780648FFF7E5FF0420FFF723FF62787E
-:400300002146BDE81040042001F0D2B8DC38000007B50023ADF804308DF80600032301A88DF80530FFF7E2FF03B05DF804FB000010B5074C94F8643043B1002001F0DAFFEE
+:400300002146BDE81040042001F002B90C3A000007B50023ADF804308DF80600032301A88DF80530FFF7E2FF03B05DF804FB000010B5074C94F8643043B1002001F0ECFF79
-:40034000002002F06DFD002384F8643010BD00BF8881FF1F38B5104D837895F8672004469A4204D0FFF7E4FF002385F86A302368C5F865302279094B1A71A378002B14BF45
+:40034000002002F083F8002384F8643010BD00BF8081FF1F38B5124D837895F8672004469A4204D0FFF7E4FF002385F86A302368C5F8653022790B4B1A71A378002B14BF38
-:400380000220012002F04CFDE07802F043FD2079BDE8384002F07ABD8881FF1FED81FF1F38B50D4C94F8645065B904F16500FFF7D1FF012001F09EFF4FF47A7002F0B0F968
+:400380000220012002F062F8E078B0FA80F0400902F0D4FA2079BDE8384002F0DBBA00BF8081FF1FE581FF1F38B50D4C94F8645065B904F16500FFF7CDFF012001F0ACFF17
-:4003C00084F86A50E368E366012384F86430BDE8384002F0E3B900BF8881FF1FF8B5214C0546FFF7DDFF94F86A3003B15DB91E48FFF767FFFFF7EBFE0120002384F86A007C
+:4003C0004FF47A7002F076FC84F86A50E368E366012384F86430BDE8384002F0A9BC00BF8081FF1FF8B5214C0546FFF7DDFF94F86A3003B15DB91E48FFF763FFFFF7E7FE5C
-:40040000236702F0A3F92A46216F1848FFF759FF144E0027236F9D4216D001F071FF00B13767236F9D4205DD0120FFF7B7FE336F013305E005DA0020FFF7B0FE336F013B0B
+:400400000120002384F86A00236702F069FC2A46216F1848FFF755FF144E0027236F9D4216D001F07FFF00B13767236F9D4205DD0120FFF7B3FE336F013305E005DA002094
-:40044000336702F0ABF9E5E7322002F069F92A2DCCBF0020012002F025FDBDE8F8400448FFF72FBF8881FF1FE9380000F03800000D3900002DE9F04F99B062B602F0F8F947
+:40044000FFF7ACFE336F013B336702F071FCE5E7322002F02FFC2A2DCCBF0020012002F07FFABDE8F8400448FFF72BBF8081FF1F193A0000203A00003D3A00002DE9F04F9B
-:400480009E49042002F01CFA9D4801F045FF9D4802F0E8FC9C4801F079FF02F0C9FB02F09BFA002002F0BCFC01F094FF0221002000F05CFF954C012001F0D4F8002384F890
+:4004800099B062B602F0BEFC9F49042002F0E2FC9E4801F053FF9E4801F084FF9D4801F0B1FF02F06DF902F03FF8002001F0CEFF01F0D2FF0221002000F088FF012001F05D
-:4004C0006730FFF76DFFFFF782FE84F87400FFF72FFF012384F86730FFF762FFFFF777FE84F87500FFF724FF894B94F87400894994F875202546002A14BF0A461A4600286F
+:4004C00001F9954D0321084602F012FC2E462C4602F02EFC95F8643043B1EA6EEB689B1A41F28832934201D9FFF722FF00F0A6FF18B98A48FFF7E5FE04E000F0A5FF0028D3
-:4005000008BF19468448FFF7DCFE0321084602F025F9264602F042F994F8643043B1EA6EEB689B1A41F28832934201D9FFF700FF00F054FF18B97948FFF7C3FE04E000F079
+:40050000F7D134E000F09AFF10B902F011FCF9E78348FFF7D6FE032001F0C0F88148FFF7D0FE002386F86730FFF73EFFFFF74FFE86F87400FFF7FCFE012386F86730FFF701
-:4005400053FF0028F7D10BE000F048FF10B902F025F9F9E77248FFF7B4FE032001F06EF8032000F04DFF0128D4D16E48FFF7F2FE6D490320FFF738FE94F876106B48FFF7F9
+:4005400033FFFFF744FE86F87500FFF7F1FE96F874007549754B96F87520002A14BF0A461A46002808BF19467148FFF7AAFE032000F076FF0128ABD16E48FFF7EBFE6E49CB
-:40058000A0FE94F87630023B142B00F2D683DFE813F01500D4031E00D4032400D4035000D4037600D403D900D403C101D4030803D4032C03D4033303D4034D0303238DF851
+:400580000320FFF731FE94F876106C48FFF799FE94F87630023B142B00F2D783DFE813F01500D5031E00D5032400D5035000D5037600D503DA00D503C201D5030903D50356
-:4005C00020308DF821300F238DF822302AE394F87800FFF703FF564B21E340F2DC57FFF7DFFE00232375E068227D02F0FF012AB9EB681B1ABB42F7DD0B4611E083B100227E
+:4005C0002D03D5033403D5034E0303238DF820308DF8213011238DF822302BE394F87800FFF700FF564B22E340F2DC57FFF7DCFE00232375E068227D02F0FF012AB9EB680B
-:40060000174696F87810F068277594F814E0BEF1000F02D1EB681B1AF7E701329142F3DA07228DF8202004228DF82120ADF82230F8E20220FFF786FD4FF000080DF1200A54
+:400600001B1ABB42F7DD0B4611E083B10022174696F87810F068277594F814E0BEF1000F02D1EB681B1AF7E701329142F3DA07228DF8202004228DF82120ADF82230F9E2BF
-:4006400002F0ACF84FF480790027C9EB0803DA1907F80A200137402FF9D10220FFF772FD3A465146022000F023FFB9F10109EBD108F10108B8F1400FE2D12E4B38E04FF076
+:400640000220FFF77FFD4FF000080DF1200A02F06FFB4FF480790027C9EB0803DA1907F80A200137402FF9D10220FFF76BFD3A465146022000F04CFFB9F10109EBD108F10F
-:40068000010A4FF000080DF1200B02F087F84FF0000959460120FFF7A7FD08EB090300270493049B1BF807203B44DBB29A4209D08DE80C0041463B464A461F48FFF701FEE0
+:400680000108B8F1400FE2D12E4B38E04FF0010A4FF000080DF1200B02F04AFB4FF0000959460120FFF7A0FD08EB090300270493049B1BF807203B44DBB29A4209D08DE89D
-:4006C0004FF0000A0137402FEBD109F10109B9F5807FDED108F10108B8F1400FD5D151461648FFF7EEFDBAF1000F00F01B81144B1B8807A8ADF81C3095E200BF5501000004
+:4006C0000C0041463B464A461F48FFF7FAFD4FF0000A0137402FEBD109F10109B9F5807FDED108F10108B8F1400FD5D151461748FFF7E7FDBAF1000F00F01C81144B1B883D
-:40070000F900000091000000C50000008881FF1F1F3900001B390000223900003A3900004D390000ED81FF1FFE81FF1F57390000CC380000CE380000663900008239000026
+:4007000007A8ADF81C3096E255010000F900000091000000C50000008081FF1F523A0000653A00006F3A00004B3A00004F3A0000823A0000E581FF1FF681FF1F9A3A000052
-:40074000D0380000206FFFF749FE94F8780001F0F5FD94F8780001F0D9FD02F009FCB94BDFF8FC821A78002702F0FB021A701A7842F001021A701A7802F0FE021A701A7880
+:40074000F4380000F6380000A93A0000C53A0000F8380000206FFFF745FE94F8780001F0FFFD94F8780001F0E3FD02F015FCB94BDFF8FC821A78002702F0FB021A701A785F
-:4007800002F0FE021A7002F0F7FB0220FFF7DAFC012141F6FF734FF48042084602F046FB84F8B60001F068FF08F807000137402FF8D1DFF8B0A200270AF195091FFA89F816
+:4007800042F001021A701A7802F0FE021A701A7802F0FE021A7002F003FC0220FFF7D2FC012141F6FF734FF48042084601F0DEFD84F8B60002F02AFA08F807000137402FA7
-:4007C0000137402F14BF3A4600221AF8010F2244062392F82420402101F082FF424646F240419AF8000001F08DFF08F14008402F1FFA88F8E4D196F8793053B196F87C30C8
+:4007C000F8D1DFF8B0A200270AF195091FFA89F80137402F14BF3A4600221AF8010F2244062392F82420402102F044FA424646F24E419AF8000002F04FFA08F14008402FB5
-:40080000336100233375237D002BFCD000233375336100234FF0FF32236062602372236894F8B600234493F8241001F0DDFE94F8B60001F09BFE012194F8B60001F06EFEAA
+:400800001FFA88F8E4D196F8793053B196F87C30336100233375237D002BFCD000233375336100234FF0FF32236062602372236894F8B600234493F8241002F09FF994F82A
-:400840002368002BFCD0002398467360D6F80CA0012701F0A3FFE368B4F87A20CAEB030393420DD367B1042195F8B60001F0C8FE94F8B60001F0D4FE0028F9D107463072CF
+:40084000B60002F05DF9012194F8B60002F030F92368002BFCD0002398467360D6F80CA0012702F065FAE368B4F87A20CAEB030393420DD367B1042195F8B60002F08AF9BC
-:40088000237AFBB96A682B689A4202D1002FE0D118E00220FFF756FC6968402209EB8111022000F005FE6A68674B01321340002BBEBF03F1FF3363F03F03013308F1010820
+:4008800094F8B60002F096F90028F9D107463072237AFBB96A682B689A4202D1002FE0D118E00220FFF74EFC6968402209EB8111022000F02DFE6A68674B01321340002BCA
-:4008C0006360C6E70220277AFFF73CFC00221146022000F0EDFD0220FFF734FCFFB2FFF7A3FC002001F012FD37B15848FFF7E9FC0220FFF70DFD06E0554B08A81B88ADF871
+:4008C000BEBF03F1FF3363F03F03013308F101086360C6E70220277AFFF734FC00221146022000F015FE0220FFF72CFCFFB2FFF79BFC002001F01CFD37B15848FFF7E1FC90
-:400900002030FFF7F3FC227D4146237A5148FFF7D8FC15E25048FFF7D4FCD4F87A7017F03F0701D0032009E2286FFFF757FD95F8780001F003FD95F8780001F0E7FC012054
+:400900000220FFF705FD06E0554B08A81B88ADF82030FFF7EBFC227D4146237A5148FFF7D0FC15E25048FFF7CCFCD4F87A7017F03F0701D0032009E2286FFFF753FD95F83B
-:4009400001F002FD02F014FB444BDFF814811A7842F004021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F003FB01214FF4804341F6FF72084601F0CB
+:40094000780001F00DFD95F8780001F0F1FC012001F098FD02F020FB444BDFF814811A7842F004021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F0BF
-:40098000E9FC85F8B60001F077FE08F807000137402FF8D1DFF8CC90002709F195031FFA83F804930137402F14BF3A46002219F8010F2244052392F82420402101F090FEB2
+:400980000FFB01214FF4804341F6FF72084601F01DFD85F8B60002F039F908F807000137402FF8D1DFF8CC90002709F195031FFA83F804930137402F14BF3A46002219F8F2
-:4009C000414646F2475299F8000001F09BFE08F14008402F1FFA88F8E4D100274FF0FF33376098467360BB463B46D6F87A9037725FEA99190CBF4FF0010A4FF0000A2168C1
+:4009C000010F2244052392F82420402102F052F9414646F2484299F8000002F05DF908F14008402F1FFA88F8E4D100274FF0FF33376098467360BB463B46D6F87A903772EA
-:400A0000114A01310A40002ABCBF02F1FF3262F03F026068B8BF013282426FD02BB1227A002A7AD12A7D002A77D12068049A059302EB8010BAF1000F16D040223F2102F079
+:400A00005FEA99190CBF4FF0010A4FF0000A2168114A01310A40002ABCBF02F1FF3262F03F026068B8BF013282426FD02BB1227A002A7AD12A7D002A77D12068049A059368
-:400A4000F7FA1CE0906400403F0000808C390000D2380000A6390000B939000097650040AC81FF1FAB81FF1F014601370120FFF7BBFBC7EB0903D3F1000A4AEB030A216882
+:400A400002EB8010BAF1000F16D040223F2102F003FB1CE09E6400403F000080CF3A0000FA380000E93A0000FC3A000098640040A481FF1FA381FF1F014601370120FFF7BF
-:400A8000B34A01310A40002ABEBF02F1FF3262F03F02013222606268059B01322ED12A683F2A2BD14FF00008C5F8048001F080FC85F808806B6895F8B6002B4493F82410D9
+:400A8000B3FBC7EB0903D3F1000A4AEB030A2168B34A01310A40002ABEBF02F1FF3262F03F02013222606268059B01322ED12A683F2A2BD14FF00008C5F8048001F0B4FCE9
-:400AC00001F092FD95F8B60001F050FD012195F8B60001F023FD95F87E302B6185F81480237D002BFCD04FF00008012086F8148001F06AFC404601F027FC00E023B1237A54
+:400AC00085F808806B6895F8B6002B4493F8241002F054F895F8B60002F012F8012195F8B60001F0E5FF95F87E302B6185F81480237D002BFCD04FF00008012086F814800D
-:400B00005BB92B7D4BB90123626842453FF477AF0BF1010BD5F8048071E701F04FFC012001F012FC002001F04FFC042194F8B60001F066FD94F8B60001F072FD8046002873
+:400B000001F09EFC404601F0BDFC00E023B1237A5BB92B7D4BB90123626842453FF477AF0BF1010BD5F8048071E701F083FC012001F0A8FC002001F083FC042194F8B6004D
-:400B4000F8D196F8B60001F0FFFC337D327A0293012303920193CDF800A05B463A4649467C48FFF7AEFBC6F81080BAF1000F0BD0FFF75AFB002001F0C9FB237A63B1764854
+:400B400002F028F894F8B60002F034F880460028F8D196F8B60001F0C1FF337D327A0293012303920193CDF800A05B463A4649467C48FFF7A6FBC6F81080BAF1000F0BD0C6
-:400B8000FFF79FFB0220D9E0B945F1D073490120FFF72AFB0137F7E77148FFF792FB714B3DE094F8780001F0C9FB206FFFF716FC6D48FFF786FB94F87930236100232375F8
+:400B8000FFF752FB002001F0D3FB237A63B17648FFF797FB0220D9E0B945F1D073490120FFF722FB0137F7E77148FFF78AFB714B3DE094F8780001F0D3FB206FFFF712FC19
-:400BC000237D002BFCD0012001F0FEFB00233375237D002BFCD0002001F0F6FB002363483361FFF76EFB624B19E0002084F86A00FFF7F4FB5F4B12E094F8743023B195F870
+:400BC0006D48FFF77EFB94F87930236100232375237D002BFCD0012001F032FC00233375237D002BFCD0002001F02AFC002363483361FFF766FB624B19E0002084F86A0088
-:400C000075200AB985F8782094F875201AB113B9012385F878305848FFF79CFB574B1B88ADF8203008A8FFF761FB89E0FFF780FB02F07CF8002002F01FF82A2701F04AFFE9
+:400C0000FFF7F0FB5F4B12E094F8743023B195F875200AB985F8782094F875201AB113B9012385F878305848FFF794FB574B1B88ADF8203008A8FFF759FB89E0FFF778FB0D
-:400C4000002001F0EDFE3A46002108A802F0F0F917238DF820308DF8217001F09FFD002001F048FB002002F0DBF8C82001F058FD0DF12200FFF7F0FA0DF13600FFF70DFB01
+:400C400001F01CFE002001F0BFFD2A2701F0EAFC002001F08DFC3A46002108A802F0FCF917238DF820308DF8217002F061F8002001F052FB002001F0E9FBC82002F01AF8F3
-:400C800001F08CFD012002F0CBF8322001F048FD0DF12600FFF7E0FA0DF13A00FFF7FDFA012001F027FB4FF4967001F039FD01F075FD0DF12E00FFF7CFFA0DF14200FFF71B
+:400C80000DF12200FFF7E8FA0DF13600FFF705FB02F04EF8012001F0D9FB322002F00AF80DF12600FFF7D8FA0DF13A00FFF7F5FA012001F031FB4FF4967001F0FBFF02F041
-:400CC000ECFA002001F016FB4FF4967001F028FD01F064FD022002F0A3F8322001F020FD0DEB0700FFF7B8FA0DF13E00FFF7D5FA012001F0FFFA4FF4967001F011FD01F040
+:400CC00037F80DF12E00FFF7C7FA0DF14200FFF7E4FA002001F020FB4FF4967001F0EAFF02F026F8022001F0B1FB322001F0E2FF0DEB0700FFF7B0FA0DF13E00FFF7CDFAF4
-:400D00004DFD0DF13200FFF7A7FA0DF14600FFF7C4FA002001F0EEFA4FF4967001F000FD01F03CFD002002F07BF8002384F86A3001F07EFF01F050FE74E70120FFF7E8FA91
+:400D0000012001F009FB4FF4967001F0D3FF02F00FF80DF13200FFF79FFA0DF14600FFF7BCFA002001F0F8FA4FF4967001F0C2FF01F0FEFF002001F089FB002384F86A302F
-:400D4000032000F07BFC0E48FFF7BBFAFFF7E2BB3F000080C3390000F33900004092FF1FFD390000D4380000053A0000133A0000D6380000D8380000FE81FF1FDA380000E3
+:400D400001F01EFD01F0F0FB74E70120FFF7E0FA032000F0A3FC0E48FFF7B3FAFFF7B8BB3F000080063B0000363B00003892FF1F403B0000FC380000483B0000563B00000F
-:400D8000203A00002DE9F04172B6884B61221A70A3F5F06301221A801924854A9C7092E803008033062283F8002283E80300522203F580731A707F4B7F4A1B787F4EDBB2FE
+:400D8000FE38000000390000F681FF1F02390000633B00000F4B1A78120616D55878C0B2012814D11B79DBB2042B02D0052B05D07047094A094B5A60282203E0084A074B07
-:400DC000137040F618027E4B00251A8041F2512223F8022C33784FF4F07003F0010343EA450502F0BDF8013C05F003052ED0032DF0D1744B4FF480721A8007221A70724A20
+:400DC0005A60E0221A8000F043BE002070470120704700BF0060004004390000BC92FF1F2C3900002DE9F04172B6884B61221A70A3F5F06301221A801924854A9C7092E807
-:400E0000002548211570917002221D705D7103F8032C0422DA716D4A6D4C13786D4E43F00103137012F8013C062743F0030302F8013C2378012243F0800323705B4B1A70F9
+:400E000003008033062283F8002283E80300522203F580731A707F4B7F4A1B787F4EDBB2137040F618027E4B00251A8041F2512223F8022C33784FF4F07003F0010343EAA4
-:400E4000654A137843F02003137000E0FEE707FB056300219A881868013502F0E9F8072DF5D15E485E4E002550F8041F05F1105303F1480221F0FF074933C9B20B44520042
+:400E4000450502F0A1F8013C05F003052ED0032DF0D1744B4FF480721A8007221A70724A002548211570917002221D705D7103F8032C0422DA716D4A6D4C13786D4E43F060
-:400E80005B0002329A4206D012F802EC12F801CC0EF807C0F5E7B0420D44E5D1514A002313609360136193614F4B504F1A68504BDFF888811A604F4B1A684F4B1A604F4A7B
+:400E80000103137012F8013C062743F0030302F8013C2378012243F0800323705B4B1A70654A137843F02003137000E0FEE707FB056300219A881868013502F0CDF8072D6A
-:400EC000137843F002031370137C43F0020313742378A2F5863243F040032370413A137843F010031370464A464B07CA03C31A80454A2833106843F8250C127903F8212CA9
+:400EC000F5D15E485E4E002550F8041F05F1105303F14A0221F0FF074B33C9B20B4452005B0002329A4206D012F802EC12F801CC0EF807C0F5E7B0420D44E5D1514A002390
-:400F0000424A07CA03C31A80414AE83B07CA03C31A80404A083307CA03C31A803E4A3F4BA2F5616203CBC2F8100EC2F8141E1378042043F008031370394B02F5AA521B78A7
+:400F000013609360136193614F4B504F1A68504BDFF888811A604F4B1A684F4B1A604F4A137843F002031370137C43F0020313742378A2F5863243F040032370413A1378DD
-:400F40003D78DBB298F80060EDB203F007010C321B091170F6B2537045F003033B7046F0030388F800302F4B48221A702E4A402313702E49937013729372082382F81F32BF
+:400F400043F010031370464A464B07CA03C31A80454A2833106843F8250C127903F8212C424A07CA03C31A80414AE83B07CA03C31A80404A083307CA03C31A803E4A3F4B11
-:400F800020220A7048710A72294A0A20137001F0DDFB284B88F8006044223D70264D1A7094E80F0007C52B80BDE8F081004800404C0A00480F010049A1460040254200408F
+:400F8000A2F5616203CBC2F8100EC2F8141E1378042043F008031370394B02F5AA521B783D78DBB298F80060EDB203F007010C321B091170F6B2537045F003033B7046F095
-:400FC000224200400440004006400040A2430040A0430040253A0000E8460040FCFFFF478C00004800760040540A0048F846004020760040580A004828760040035001404D
+:400FC000030388F800302F4B48221A702E4A402313702E49937013729372082382F81F3220220A7048710A72294A0A20137001F077FE284B88F8006044223D70264D1A709B
-:401000000C0A0048C0510040180A0048200A00482C0A0048380A004832510040440A0048CF0100491D51004001590040235B0040585B004076580040B0430040F9460040F2
+:4010000094E80F0007C52B80BDE8F08100480040680A00480F010049A146004025420040224200400440004006400040A2430040A0430040683B0000E8460040FCFFFF47E7
-:4010400008B501F0C9FF03680C2B00D1FEE7FEE7084908B50B68084A1844821A802A01DC086005E001F0B8FF0C2303604FF0FF33184608BDCC80FF1F9093FF1F80B5114817
+:401040009000004800760040700A0048F846004020760040740A00482876004003500140280A0048C0510040340A00483C0A0048480A0048540A004832510040600A004800
-:40108000114B0025C0B1A3F1100192C922460439161BB74204D051F8046F42F8046BF7E7114653F8046C8C1AA64202D041F8045BF9E701381033E5E701F094FFFFF7DAF9D9
+:40108000CF0100491D51004001590040235B0040585B004076580040B0430040F946004008B501F0ADFF03680C2B00D1FEE7FEE7084908B50B68084A1844821A802A01DC75
-:4010C000FEE700BF01000000F43B0000124A134B10B51A60124A134C1368134843F4007313600023032B98BF54F823204FEA830188BF0E4A0133302B4250F3D10C4B1A7814
+:4010C000086005E001F09CFF0C2303604FF0FF33184608BDCC80FF1F8893FF1F80B51148114B0025C0B1A3F1100192C922460439161BB74204D051F8046F42F8046BF7E7E8
-:401100000C4B1A700C4B084A1A60FFF73BFEBDE8104001F0EDB900BF0004FA050CED00E014ED00E0000000000080FF1F41100000BC760040C080FF1F08ED00E0F8B501F042
+:40110000114653F8046C8C1AA64202D041F8045BF9E701381033E5E701F078FFFFF7AEF9FEE700BF01000000FC3C0000124A134B10B51A60124A134C1368134843F4007367
-:4011400017FF4B4A01271378022643F001031370137C484C43F001031374474B02F5E3521F700B3203F8946C1378054603F07F031370002001F0EAFA2378404A03F0F903F2
+:4011400013600023032B98BF54F823204FEA830188BF0E4A0133302B4250F3D10C4B1A780C4B1A700C4B084A1A60FFF73BFEBDE8104001F087BC00BF0004FA050CED00E0A4
-:4011800023701378384603F0DF03137023783B43237001F0DBFA282001F0D8FA384B30461A7802F07F021A701A7802F0BF021A7023783343237001F0C9FA2378314A43F0C6
+:4011800014ED00E0000000000080FF1FA1100000BC760040C080FF1F08ED00E0F8B501F0FBFE4B4A01271378022643F001031370137C484C43F001031374474B02F5E352FA
-:4011C000040323700023137053702F4AFF2199540133092BFBD1284601F0CEFE0721172001F0FCFA2949172001F0EAFA0721182001F0F4FA2649182001F0E2FA0721152033
+:4011C0001F700B3203F8946C1378054603F07F031370002001F084FD2378404A03F0F90323701378384603F0DF03137023783B43237001F075FD282001F072FD384B304610
-:4012000001F0ECFA2349152001F0DAFA0721052001F0E4FA2049052001F0D2FA0721062001F0DCFA1D49062001F0CAFA0721084601F0D4FA1A49072001F0C2FA07210820F8
+:401200001A7802F07F021A701A7802F0BF021A7023783343237001F063FD2378314A43F0040323700023137053702F4AFF2199540133092BFBD1284601F0B2FE07211720E7
-:4012400001F0CCFA1749082001F0BAFA0021162001F0C4FA1449162001F0B2FA07210C2001F0BCFABDE8F84010490C2001F0A8BAA5430040944300409D6000401260004076
+:4012400001F096FD2949172001F084FD0721182001F08EFD2649182001F07CFD0721152001F086FD2349152001F074FD0721052001F07EFD2049052001F06CFD072106201F
-:40128000F851004084600040B592FF1F0B1B000045190000091B00003D1A0000691A0000991A0000D11A0000111B0000851B0000214B224A10B5187000231370204A40209B
+:4012800001F076FD1D49062001F064FD0721084601F06EFD1A49072001F05CFD0721082001F066FD1749082001F054FD0021162001F05EFD1449162001F04CFD07210C2014
-:4012C0001370204A0F2413701F4A13701F4A13701F4A13701F4A13701F4B4FF400021A604FF080721A604FF400121A6020221A601860802018604FF480701860174804702E
+:4012C00001F056FDBDE8F84010490C2001F042BDA5430040944300409D60004012600040F851004084600040AD92FF1F6B1B0000A5190000691B00009D1A0000C91A0000BE
-:401300004FF480001860164B1A70933B19B91A7802F0FE0202E01A7842F001021A70114B03221A70802203F8202C012001F018FE0D4B04221A7010BDD092FF1FD692FF1F39
+:40130000F91A0000311B0000711B0000E51B0000214B224A10B5187000231370204A40201370204A0F2413701F4A13701F4A13701F4A13701F4A13701F4B4FF400021A60B1
-:40134000D492FF1FD592FF1FD192FF1FC092FF1FD392FF1F4893FF1F00E100E09E6000409C600040286000401260004070B5074C054623780E461BB9FFF7E0FE0123237031
+:401340004FF080721A604FF400121A6020221A601860802018604FF480701860174804704FF480001860164B1A70933B19B91A7802F0FE0202E01A7842F001021A70114B50
-:4013800031462846BDE87040FFF792BF8092FF1F0A4A002313700A4A13700A4A13700A4A13700A4A13700A4A13700A4A13700A4B03221A70802203F8202C7047D692FF1F4E
+:4013800003221A70802203F8202C012001F0FCFD0D4B04221A7010BDC892FF1FCE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F00E100E09E6000407A
-:4013C000D492FF1FD592FF1FD192FF1FC092FF1FD392FF1F4893FF1F28600040014B1878704700BFD592FF1F044B1A7802F0FF001AB118780022C0B21A707047D492FF1F52
+:4013C0009C600040286000401260004070B5074C054623780E461BB9FFF7E0FE0123237031462846BDE87040FFF792BF7892FF1F0A4A002313700A4A13700A4A13700A4A81
-:40140000024A0C2303FB002040787047DC92FF1F431E072B0CD8074A064B00010344805C5B7800F00F0043EA0020023880B2704700207047FC5F00401A4A38B50C2303FBA9
+:4014000013700A4A13700A4A13700A4A13700A4B03221A70802203F8202C7047CE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F28600040014B187898
-:4014400000231B79090C13F0800F00F1FF35044619BF8AB24FF480438BB24FF48042032D18D8DFE805F002070C110021084601F01BF80DE00021084600F0FAFF08E0002180
+:40144000704700BFCD92FF1F044B1A7802F0FF001AB118780022C0B21A707047CC92FF1F024A0C2303FB002040787047D492FF1F431E072B0CD8074A064B00010344805C32
-:40148000084600F0D9FF03E00021084600F0B8FF054B1855EDB2072D03D801F0EDF8034B185538BDDC92FF1FAC92FF1FB592FF1F431E072B2DE9F0470446894615465CD857
+:401480005B7800F00F0043EA0020023880B2704700207047FC5F00401A4A38B50C2303FB00231B79090C13F0800F00F1FF35044619BF8AB24FF480438BB24FF48042032DA1
-:4014C0002F4F0C2202FB0072D388DFF8B8A09BB2C3F500739D424FF00C0303FB007388BFD588DB7884BFC5F50075ADB2254A43EA15230601B354B244EBB28AF80130224BD4
+:4014C00018D8DFE805F002070C110021084601F0A1FA0DE00021084601F080FA08E00021084601F05FFA03E00021084601F03EFA054B1855EDB2072D03D801F087FB034B10
-:401500001A5C9846FF2A01D1FFF796FF0C2303FB047200215170B9F1000F28D03DB31B4F385D01F011F811232946FE2218F8040001F0D6F806F5C04278321FFA89F118F8D2
+:40150000185538BDD492FF1FA492FF1FAD92FF1F431E072B2DE9F0470446894615465CD82F4F0C2202FB0072D388DFF8B8A09BB2C3F500739D424FF00C0303FB007388BF8A
-:40154000040001F0DFF8124D18F80410385D01F04BF80121385D00F0E1FF735D43F002037355735D03F0FD037355BDE8F08703FB04746379DBB28AF80230BDE8F08700BFE7
+:40154000D588DB7884BFC5F50075ADB2254A43EA15230601B354B244EBB28AF80130224B1A5C9846FF2A01D1FFF796FF0C2303FB047200215170B9F1000F28D03DB31B4FEB
-:40158000DC92FF1FFC5F0040B592FF1FAC92FF1F706000402DE9F047044615468846002940D0431E072B3FD8FFF732FFA84203D22046FFF72DFF05461D4E335DFF2B03D1DE
+:40158000385D01F0ABFA11232946FE2218F8040001F070FB06F5C04278321FFA89F118F8040001F079FB124D18F80410385D01F0E5FA0121385D01F07BFA735D43F002030D
-:4015C00041462046FFF738FFDFF868A027011AF8040000F0B9FF1223FE222946305D01F07FF807F5C0411FFA88F27831305D01F089F8DFF84490315D1AF8040000F0F4FFE9
+:4015C0007355735D03F0FD037355BDE8F08703FB04746379DBB28AF80230BDE8F08700BFD492FF1FFC5F0040AD92FF1FA492FF1F706000402DE9F047044615468846002945
-:4016000001211AF8040000F089FF17F8093043F0020307F8093017F8093003F0FD0307F8093002E00D4600E000252846BDE8F087B592FF1FAC92FF1F70600040431E072BA7
+:4016000040D0431E072B3FD8FFF732FFA84203D22046FFF72DFF05461D4E335DFF2B03D141462046FFF738FFDFF868A027011AF8040001F053FA1223FE222946305D01F087
-:401640000AD8064A0C2303FB002300225A705A79034BD2B200011A54704700BFDC92FF1FFE5F0040431E072B9FBF024B000108221A547047FE5F004030B51A4A1A491B4D0A
+:4016400019FB07F5C0411FFA88F27831305D01F023FBDFF84490315D1AF8040001F08EFA01211AF8040001F023FA17F8093043F0020307F8093017F8093003F0FD0307F881
-:401680000878138803449BB21380194A00231488D8B2A4B27CB1082B0CD050680078C0B2E85450680133013050601088013880B21080ECE718460B780E4C082B0E4A00D003
+:40168000093002E00D4600E000252846BDE8F087AD92FF1FA492FF1F70600040431E072B0AD8064A0C2303FB002300225A705A79034BD2B200011A54704700BFD492FF1F5D
-:4016C00040B10E4D2B7883F080032B700F232370022301E0022323701370094B1870087030BD00BF4C93FF1F4893FF1F00600040C492FF1FC192FF1FD692FF1FD292FF1FE1
+:4016C000FE5F0040431E072B9FBF024B000108221A547047FE5F004030B51A4A1A491B4D0878138803449BB21380194A00231488D8B2A4B27CB1082B0CD050680078C0B2EC
-:401700004993FF1F074B02221A70074B80221A70064B0F221A70064A00231370054A012013707047D692FF1FD292FF1FC192FF1F4893FF1F4993FF1F30B5164B16491B78E1
+:40170000E85450680133013050601088013880B21080ECE718460B780E4C082B0E4A00D040B10E4D2B7883F080032B700F232370022301E0022323701370094B18700870CA
-:401740000A8803F00F03023BDBB21A4492B20A80124C134A0020118889B279B173B15568215C013BC9B229705168DBB20131516011880130013989B21180ECE7094A1370B3
+:4017400030BD00BF4493FF1F4093FF1F00600040BC92FF1FB992FF1FCE92FF1FCA92FF1F4193FF1F074B02221A70074B80221A70064B0F221A70064A00231370054A012088
-:40178000094A137883F080031370084B0B221A7030BD00BF296000404C93FF1F00600040C492FF1F4993FF1FD292FF1FC192FF1F064A06231370064A01201370054B802273
+:4017800013707047CE92FF1FCA92FF1FB992FF1F4093FF1F4193FF1F30B5164B16491B780A8803F00F03023BDBB21A4492B20A80124C134A0020118889B279B173B155682C
-:4017C0001A70054B00221A70704700BFD692FF1FC192FF1FD292FF1F4993FF1F054B9A683AB19A68044910709A680988518000229A607047C492FF1F4C93FF1F08B5124BAC
+:4017C000215C013BC9B229705168DBB20131516011880130013989B21180ECE7094A1370094A137883F080031370084B0B221A7030BD00BF296000404493FF1F006000400F
-:401800001A78D2B21A701B78DBB21A0602D50F4A137008BD0220FFF7E1FF0D4B1B7803F06003202B05D0402B06D043B900F012FC04E001F0A5FB01E000F046FD10B9034B1C
+:40180000BC92FF1F4193FF1FCA92FF1FB992FF1F064A06231370064A01201370054B80221A70054B00221A70704700BFCE92FF1FB992FF1FCA92FF1F4193FF1F054B9A68E4
-:4018400003221A7008BD00BF28600040C192FF1F0060004008B5084A084B0120197813880B449BB21380064B00221A70FFF7B6FF044B03221A7008BD4C93FF1F4893FF1F1D
+:401840003AB19A68044910709A680988518000229A607047BC92FF1F4493FF1F08B5124B1A78D2B21A701B78DBB21A0602D50F4A137008BD0220FFF7E1FF0D4B1B7803F0CE
-:40188000D692FF1FC192FF1F08B50C4B1B78DBB2042B07D0062B09D0022B0DD1BDE80840FFF7D8BFBDE80840FFF746BF0320FFF795FF034B03221A7008BD00BFD692FF1FCC
+:401880006003202B05D0402B06D043B900F012FC04E001F089FB01E0FFF77CFA10B9034B03221A7008BD00BF28600040B992FF1F0060004008B5084A084B012019781388FA
-:4018C000C192FF1F08B5054B002201201A70FFF785FF034B03221A7008BD00BFD692FF1FC192FF1F08B50A4B1A7832B11A78094942F080020A7000221A70074B00220120D1
+:4018C0000B449BB21380064B00221A70FFF7B6FF044B03221A7008BD4493FF1F4093FF1FCE92FF1FB992FF1F08B50C4B1B78DBB2042B07D0062B09D0022B0DD1BDE8084045
-:401900001A70FFF76BFF054B03221A7008BD00BFC092FF1F08600040D692FF1FC192FF1F074B1B78DBB2042B05D0062B05D0022B05D1FFF7A1BEFFF7C5BFFFF7D3BF70479E
+:40190000FFF7D8BFBDE80840FFF746BF0320FFF795FF034B03221A7008BD00BFCE92FF1FB992FF1F08B5054B002201201A70FFF785FF034B03221A7008BD00BFCE92FF1FCA
-:40194000D692FF1F38B51D4C2378DBB2DD0634D518060AD503F00F03012B2ED1FFF74EFF174B1B78190609D538BD5A0602D5FFF7D7FF03E09D0620D5FFF786FF23781B066B
+:40194000B992FF1F08B50A4B1A7832B11A78094942F080020A7000221A70074B002201201A70FFF76BFF054B03221A7008BD00BFB892FF1F08600040CE92FF1FB992FF1FC0
-:401980001BD4104B1A78104B1B7813430F4A13701278934211D10A4A0849154613782078DBB2000605D41378DBB20B700B7803F00F0328788342F1D138BD38BD2860004067
+:40198000074B1B78DBB2042B05D0062B05D0022B05D1FFF7A1BEFFF7C5BFFFF7D3BF7047CE92FF1F38B51D4C2378DBB2DD0634D518060AD503F00F03012B2ED1FFF74EFF42
-:4019C000C192FF1FD292FF1F4993FF1F29600040054A00231380054A916819B191680B7092685380704700BF4C93FF1FC492FF1F0E4808B503889BB213B9FFF783FE13E0D1
+:4019C000174B1B78190609D538BD5A0602D5FFF7D7FF03E09D0620D5FFF786FF23781B061BD4104B1A78104B1B7813430F4A13701278934211D10A4A0849154613782078EB
-:401A00000B4B02221A700B4B00221A70FFF7E0FF094AD1799379028843EA012392B2934238BF0380FFF728FE012008BDC492FF1FD692FF1FD292FF1F00600040084B012220
+:401A0000DBB2000605D41378DBB20B700B7803F00F0328788342F1D138BD38BD28600040B992FF1FCA92FF1F4193FF1F29600040054A00231380054A916819B191680B701D
-:401A40001A700F3B9B7C074B1A7B02F00302012A1EBFDA7B82F08002DA7301225A7370470B600040DC92FF1F094B02221A700F3B93F82230074B1A7E02F00302012A1EBF0F
+:401A400092685380704700BF4493FF1FBC92FF1F0E4808B503889BB213B9FFF783FE13E00B4B02221A700B4B00221A70FFF7E0FF094AD1799379028843EA012392B2934229
-:401A8000DA7E82F08002DA7601225A76704700BF0B600040DC92FF1F0B4B04221A700F3B93F83230094B93F8242002F00302012A1EBF93F8272082F0800283F827200122E0
+:401A800038BF0380FFF728FE012008BDBC92FF1FCE92FF1FCA92FF1F00600040084B01221A700F3B9B7C074B1A7B02F00302012A1EBFDA7B82F08002DA7301225A73704722
-:401AC00083F82520704700BF0B600040DC92FF1F0B4B08221A700F3B93F84230094B93F8302002F00302012A1EBF93F8332082F0800283F83320012283F83120704700BFF5
+:401AC0000B600040D492FF1F094B02221A700F3B93F82230074B1A7E02F00302012A1EBFDA7E82F08002DA7601225A76704700BF0B600040D492FF1F0B4B04221A700F3B21
-:401B00000B600040DC92FF1F7047FFF741BC0000F0B5184B184E19780C27C9B201234FF0000C31B3CA0720D5144A4FEA031E7244947850782040C5070DD507FB03652C799F
+:401B000093F83230094B93F8242002F00302012A1EBF93F8272082F0800283F82720012283F82520704700BF0B600040D492FF1F0B4B08221A700F3B93F84230094B93F856
-:401B4000240608D5147804F0FE0414706D790C4CEDB204F80E50840706D507FB036425792D0658BF84F801C090700133DBB24908D7E7F0BD9F600040DC92FF1F70600040D5
+:401B4000302002F00302012A1EBF93F8332082F0800283F83320012283F83120704700BF0B600040D492FF1F7047FFF741BC0000F0B5184B184E19780C27C9B201234FF028
-:401B8000FE5F004000F0ACBC70B50446184B88B003AA03F11006154618685968083303C5B3422A46F7D11B782B70FCB12223237001AD03232846637000F08AFE00222046DB
+:401B8000000C31B3CA0720D5144A4FEA031E7244947850782040C5070DD507FB03652C79240608D5147804F0FE0414706D790C4CEDB204F80E50840706D507FB036425795F
-:401BC0001146AB5C08AC04EB131414F8144C03F00F03847008AC234413F8143C0132082AC1700371417100F10400EAD108B070BD4F3A00002DE9F0431C4D01222E460C2093
+:401BC0002D0658BF84F801C090700133DBB24908D7E7F0BD9F600040D492FF1F70600040FE5F004000F032BF70B50446184B88B003AA03F11006154618685968083303C530
-:401C00001F274FF0800E4FF0080C194B00FB02581401234418705F70164998F805902144B9F1000F07D098F8044024064CBF887081F802C001E081F802E000FB0261CC880F
+:401C0000B3422A46F7D11B782B70FCB12223237001AD03232846637001F024F9002220461146AB5C08AC04EB131414F8144C03F00F03847008AC234413F8143C0132082AB1
-:401C40000132E4B29C71CC88092AC4F30724DC71CC88E4B21C71C988C1F307215971D4D1054BFF221A70BDE8F08300BFDC92FF1F70600040FC5F00400A600040064B074A70
+:401C4000C1700371417100F10400EAD108B070BD923B00002DE9F0431C4D01222E460C201F274FF0800E4FF0080C194B00FB02581401234418705F70164998F8059021445B
-:401C80001B7802EBC30253681A7C824286BF03EBC003586900207047D092FF1FB03A00002DE9F84F424B1A78002A7ED01878414D0138C0B2FFF7E2FFA8463F4AC368147810
+:401C8000B9F1000F07D098F8044024064CBF887081F802C001E081F802E000FB0261CC880132E4B29C71CC88092AC4F30724DC71CC88E4B21C71C988C1F307215971D4D1CB
-:401CC000007ADFF800C1E4B203EBC0000C2600274FF0010E834268D01A78A24263D11CF80420597891425ED19A7893F8039002F07F0206FB02FA05EB0A01CF7093F802B01E
+:401CC000054BFF221A70BDE8F08300BFD492FF1F70600040FC5F00400A600040064B074A1B7802EBC30253681A7C824286BF03EBC003586900207047C892FF1FB83B000044
-:401D000009F0030981F804B093F803B005F80AB0B3F804A0A1F808A093F902A0BAF1000F0BDAB9F1010F0CBF4FF007094FF00D0981F8059081F801E009E0B9F1010F0CBF20
+:401D00002DE9F84F424B1A78002A7ED01878414D0138C0B2FFF7E2FFA8463F4AC3681478007ADFF800C1E4B203EBC0000C2600274FF0010E834268D01A78A24263D11CF829
-:401D40004FF005094FF0090981F805904F704FEA02191A4906FB0282494481F802E0B2F808A0CAF3072A81F800A0B2F808A05FFA8AFA81F801A0B2F806A011495FFA8AFAAB
+:401D40000420597891425ED19A7893F8039002F07F0206FB02FA05EB0A01CF7093F802B009F0030981F804B093F803B005F80AB0B3F804A0A1F808A093F902A0BAF1000FB6
-:401D8000494481F806A0B2F80690C9F3072981F80790B2F806905FFA89F981F80490D288C2F307224A71083394E7BDE8F88F00BFD592FF1FDC92FF1FD192FF1FFC5F004052
+:401D80000BDAB9F1010F0CBF4FF007094FF00D0981F8059081F801E009E0B9F1010F0CBF4FF005094FF0090981F805904F704FEA02191A4906FB0282494481F802E0B2F806
-:401DC00070600040C292FF1F08B5064B18780138C0B2FFF753FF20B143681B7900EBC300406908BDD592FF1F00212DE9F84F0B464E4E0C2707FB01F4013132190929335553
+:401DC00008A0CAF3072A81F800A0B2F808A05FFA8AFA81F801A0B2F806A011495FFA8AFA494481F806A0B2F80690C9F3072981F80790B2F806905FFA89F981F80490D288FA
-:401E00004FF000059370494CD3701381937253705371EFD118B1464B1D70464B1D70464B1A78002A7FD0187801250138C0B2FFF725FFA8464368DFF8F8E0DB790C2713F0B5
+:401E0000C2F307224A71083394E7BDE8F88F00BFCD92FF1FD492FF1FC992FF1FFC5F004070600040BA92FF1F08B5064B18780138C0B2FFF753FF20B143681B7900EBC3008A
-:401E4000400F3E4B4FF0000C1A7814BF42F0010202F0FE021A70027AD20007FB0541C36803EB02094B4531D093F802A00AF07F06AE4229D10E89B3F804B0B6B25E4538BF50
+:401E4000406908BDCD92FF1F00212DE9F84F0B464E4E0C2707FB01F401313219092933554FF000059370494CD3701381937253705371EFD118B1464B1D70464B1D70464B16
-:401E8000A1F808B01E7893F801B01EF80660B3451AD181F804A0DE780E7093F902A0DE78BAF1000F06F0030607DA012E0CBF07260D264E7181F8018006E0012E0CBF052673
+:401E80001A78002A7FD0187801250138C0B2FFF725FFA8464368DFF8F8E0DB790C2713F0400F3E4B4FF0000C1A7814BF42F0010202F0FE021A70027AD20007FB0541C368D0
-:401EC00009264E7181F801C00833CBE70135092DC3D1C1680A328B1C0A440C200833934209D013F8081C13F80A5C01F07F0100FB01418D72F2E7FFF767FF114B01211860E6
+:401EC00003EB02094B4531D093F802A00AF07F06AE4229D10E89B3F804B0B6B25E4538BFA1F808B01E7893F801B01EF80660B3451AD181F804A0DE780E7093F902A0DE78D3
-:401F000000230C2000FB0142D3801289013113449BB203F00102134409299BB2F2D1BDE8F84FFFF767BEBDE8F88F00BFDC92FF1FC292FF1F4A93FF1FD592FF1FD392FF1FCE
+:401F0000BAF1000F06F0030607DA012E0CBF07260D264E7181F8018006E0012E0CBF052609264E7181F801C00833CBE70135092DC3D1C1680A328B1C0A440C20083393423E
-:401F4000D892FF1F114B1B7903F07F035A1E072A19D80F490C2202FB031291781B0141F0010191700021D170517841F002015170127912F0800F074A1A4414BF8D238923CF
+:401F400009D013F8081C13F80A5C01F07F0100FB01418D72F2E7FFF767FF114B0121186000230C2000FB0142D3801289013113449BB203F00102134409299BB2F2D1BDE88B
-:401F80009370FFF715BC0020704700BF00600040DC92FF1FFC5F004030B4194B1A7902F07F02531E072B27D8164B0C2404FB02339978154D01F0FE0199700021D970294600
+:401F8000F84FFFF767BEBDE8F88F00BFD492FF1FBA92FF1F4293FF1FCD92FF1FCB92FF1FD092FF1F114B1B7903F07F035A1E072A19D80F490C2202FB031291781B0141F08E
-:401FC0001201505D114400F07F0050555A7802F0FD025A701A795B78120605D5012B01D18C7006E00D2303E0012B0CBF082309238B7030BCFFF7DCBB002030BC704700BF9C
+:401FC000010191700021D170517841F002015170127912F0800F074A1A4414BF8D2389239370FFF715BC0020704700BF00600040D492FF1FFC5F004030B4194B1A7902F0D8
-:4020000000600040DC92FF1FFC5F004010B50D4B0D4C21791878C9B20138C0B2FFF72EFE43681B798B4201D2012909D8074A0848535CDBB24354A3780120DBB2535410BD56
+:402000007F02531E072B27D8164B0C2404FB02339978154D01F0FE0199700021D97029461201505D114400F07F0050555A7802F0FD025A701A795B78120605D5012B01D167
-:40204000002010BDD592FF1F00600040C292FF1F4A93FF1F38B58A4A8A4C13780021DBB221801806517840F18D800A2900F20581DFE811F05D000301030103010301030167
+:402040008C7006E00D2303E0012B0CBF082309238B7030BCFFF7DCBB002030BC704700BF00600040D492FF1FFC5F004010B50D4B0D4C21791878C9B20138C0B2FFF72EFE80
-:402080000B0003017E0003018200D3787C49012B09D17D4B1A787D4B03EBC2035B685B686360122310E0CB78022B12D18878FFF7E5FD002800F0E180436863606368DA7885
+:4020800043681B798B4201D2012909D8074A0848535CDBB24354A3780120DBB2535410BD002010BDCD92FF1F00600040BA92FF1F4293FF1F38B5874A874C13780021DBB254
-:4020C00063689B7843EA02232380BDE83840FFF78FBCCB78032B26D16D4B00228878D5B2854209D3664A91786A4AEE2908BF1346634A917881B106E0187801320028F1D025
+:4020C00021801806517840F188800A2900F20081DFE811F05800FE00FE00FE00FE00FE000B00FE007900FE007D00D3787949012B09D17A4B1A787A4B03EBC2035B685B68FE
-:4021000018780344EAE764499278097C914203D16248FFF739FD614B1A78002A00F0AD801A78228018E0BDE8384000F029BF13F0030313D0022B40F0A0802380504B0C21C4
+:402100006360122310E0CB78022B12D18878FFF7E5FD002800F0DC80436863606368DA7863689B7843EA02232380BDE83840FFF78FBCCB78032B21D16A4B00228878D5B29B
-:402140001B7903F07F02564B01FB02339A78554BD2B21A7000225A706360B6E702222280514A11784F4AC9B2117053706260ACE7012323804D4BEFE70123238013794C4AC4
+:40214000854203D3634A92783AB910E0187801320028F7D018780344F0E75E4A62499278097C914203D16148FFF73EFD5F4B1A78002A00F0AD801A78228018E0BDE8384099
-:402180001344E9E701390A2977D8DFE801F037764F76067676760A7620009378454ADBB25AE0937803F0FF0153B9404B1A7891425FD01970404B01201870FFF715FE58E082
+:4021800000F012BF13F0030313D0022B40F0A0802380504B0C211B7903F07F02544B01FB02339A78534BD2B21A7000225A706360BBE702222280504A11784E4AC9B2117026
-:4021C000481EC0B2FFF75AFD0028EED155E0FFF71DFF002851D02A4A384913791279DBB2D2B20A70364A3249D25CCB5C9A4240D0314B01221A70FFF753FD3AE003F00303EE
+:4021C00053706260B1E7012323804C4BEFE70123238013794A4A1344E9E701390A2977D8DFE801F037764F76067676760A7620009378444ADBB25AE0937803F0FF0153B928
-:40220000012B2BD009D3022B37D11D4B9B78002B33D1BDE83840FFF7BFBE194B9B78012B2BD1214A137803F0FD0315E003F00303012B13D008D3022B1FD1114B9B78E3B9A4
+:402200003E4B1A7891425FD019703F4B01201870FFF71AFE58E0481EC0B2FFF75FFD0028EED155E0FFF722FF002851D0294A374913791279DBB2D2B20A70354A3049D25C1E
-:40224000BDE83840FFF77EBE0D4B9B78012B14D1154A137843F0020313700AE0084B1A795AB998781B791749DBB2CA5C22EA0002CA54BDE83840FFF79BBA002038BD00BFEC
+:40224000CB5C9A4240D0304B01221A70FFF758FD3AE003F00303012B2BD009D3022B37D11C4B9B78002B33D1BDE83840FFF7C4BE184B9B78012B2BD11F4A137803F0FD03CA
-:4022800000600040C492FF1FD092FF1FB03A0000143B00009C3A0000873B00006893FF1FDC92FF1F8192FF1FD392FF1FD592FF1FC292FF1FC092FF1FD492FF1FD192FF1FF4
+:4022800015E003F00303012B13D008D3022B1FD1104B9B78E3B9BDE83840FFF783BE0D4B9B78012B14D1144A137843F0020313700AE0084B1A795AB998781B791549DBB239
-:4022C0004A93FF1FD792FF1F074B1A78120609D55B78012B06D1054B054A5A6012781A80FFF786BB0020704700600040C492FF1F743A0000014B1870704700BF76650040FA
+:4022C000CA5C22EA0002CA54BDE83840FFF7A0BA002038BD00600040BC92FF1FC892FF1FB83B00001C3C00008F3C00006093FF1FD492FF1F7992FF1FCB92FF1FCD92FF1FBA
-:40230000014B1878704700BF67640040014B1870704700BF77640040064A0123136002F688321268E0211064034A1170A2F540721360704780E100E000E400E0014B187039
+:40230000BA92FF1FB892FF1FCC92FF1FC992FF1F4293FF1FCF92FF1F014B1870704700BF72640040014B1878704700BF68650040014B1870704700BF7A650040064A0123C8
-:40234000704700BF74640040014B1870704700BF7565004073B515461E460B4C05230022019200920A4601461846237000F064F932462946207800F01FF90221207800F0B7
+:40234000136002F688321268E0211064034A1170A2F540721360704780E100E000E400E0014B1870704700BF7A64004073B515461E460B4C04230022019200920A46014658
-:4023800009F9207802B070BDD080FF1F064A0423136002F688321268E0219064034A1170A2F202321360704780E100E002E400E0014B04221A60704700E100E0014B04228E
+:402380001846237000F022FC32462946207800F0DDFB0221207800F0C7FB207802B070BDD080FF1F074A0223136002F688321268E0215064044A11706FF440710A44136017
-:4023C0001A60704780E100E0014B1870704700BF74650040704738B505460078012428B100F066FD285D0134E4B2F8E738BD08B50D2000F05DFDBDE808400A2000F058BDDC
+:4023C000704700BF80E100E001E400E073B515461E460B4C05230022019200920A4601461846237000F0F2FB32462946207800F0ADFB0221207800F097FB207802B070BD84
-:40240000F7B516461F460B4C00230325019300930A4601462846257000F00EF93A463146207800F0C9F80221207800F0B3F8207803B0F0BDE080FF1FF7B516461F460B4C05
+:40240000D180FF1F064A0423136002F688321268E0219064034A1170A2F202321360704780E100E002E400E0014B04221A60704700E100E0014B04221A60704780E100E013
-:4024400000230225019300930A4601462846257000F0F2F83A463146207800F0ADF82946207800F097F8207803B0F0BDE180FF1FF7B516461F460B4C002301250193009322
+:40244000014B1870704700BF7B650040014B1870704700BF73640040704738B505460078012428B100F038FD285D0134E4B2F8E738BD08B50D2000F02FFDBDE808400A20C6
-:402480000A4601462846257000F0D6F83A463146207800F091F80221207800F07BF8207803B0F0BDE280FF1F73B515461E460B4C0023019300930A4601461846237000F026
+:4024800000F02ABD014B1870704700BF7865004010B500F081FD204A044613780A2043F002031370137C43F00203137412F80A3C43F0010302F80A3C937943F0010393712B
-:4024C000BBF832462946207800F076F80221207800F060F8207802B070BD00BFE380FF1F024B1878C0F38010704700BF8F450040074A7F23802113705170064A013BDBB2F7
+:4024C00002F5AB52137843F003031370134B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222183B1A70094A137843F0AA
-:4025000002F80839002BF9D1034A1370704700BFE480FF1FF87B00400078004017280FD8084B0001C25C11B142F0200201E002F0DF02C254C25C42F00102C2540020704780
+:402500000803137000F0ECFB064B10222046BDE810401A6000F044BDAB4300400E5900402F5B004080E200E008B500F035FD0F4A137803F0FE031370A2F5AA521D3A13785D
-:40254000012070471070004017280BD8064B0001C25C02F0FE02C254C25C02F0DF02C25400207047012070471070004017280DD8074900010B4603441A7942F004021A7150
+:4025400003F0FD031370137C03F0FD03137412F80A3C03F0FE0302F80A3C937903F0FE039371BDE8084000F01BBD00BF08590040044A137803F03F0343EA8010C0B2107082
-:40258000435C43F00103435400207047012070471070004017280BD8064A0001835C490003F0F10301F00E011943815400207047012070471070004041F6FF73994208BFD2
+:40258000704700BF08590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A8042F210734B4341F2E4
-:4025C0004FF400519A4208BF4FF4005217289FBFC00000F1804000F5EC4081809ABFC280002001207047000017289FBF034B00011954002088BF0120704700BF197000402C
+:4025C000883103F6C41393FBF1F305490B60054B1A8070470A590040A43B00004A93FF1F4C93FF1F5093FF1F08B5102000F036FA0721042000F0BCFB0749042000F0AAFB02
-:4026000017289FBF054B00011A5C01F007019DBF1143195400200120704700BF1470004017289FBF034B0001185C00F0070088BFFF20704714700040172810B51AD8C000B7
+:40260000064A0C20137843F006031370FFF7BCFF034B00221A8008BDE1260000095900404893FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040FFF72ABF7B92FF1FA6
-:4026400001F07F0100F1804441EAC21204F5EC44D2B222709DF8082003F00F0343EA0213DBB263709DF80C30002003F00F03A370E07010BD012010BD10B500F079FC0A4A00
+:40264000044B1A7802F0FB021A701A7842F001021A7070470859004010B5084B1C7814F0010403D10028F9D0002404E0204600F037FB024B1B78204610BD00BF09590040D9
-:402680005378182B0AD91478013B5370E30003F1804303F5F0431B78137000E0FF2400F06BFC204610BD00BFE480FF1F030610B5044611D400F05CFC084AE300117803F1FE
+:40268000034A044B1B881088181A00B2704700BF5093FF1FA25B00400E4A13881BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107300B203FB00F20223F1
-:4026C000804303F5F04319705378147001335370BDE8104000F050BC10BD00BFE480FF1F30B504060CD411F4704509D1C40004F1804404F5F0442180A270E370284630BDB0
+:4026C00091FBF3F30028D8BF5B42134493FBF1F000B270474A93FF1F4C93FF1F4893FF1F7047000010B500F057FC214A044613780A2043F001031370137C43F001031374BC
-:40270000012030BD03065FBFC00000F1804000F5F04081805ABFC280002001207047000038B50446084DB4F5004F05D9286800F017FCA4F50044F6E7034B58686043BDE875
+:4027000012F80A3C43F0020302F80A3C937943F00203937102F5AA521832137843F003031370144B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CBE
-:40274000384000F00DBC00BFEC80FF1F024B1B7A584300F005BC00BFEC80FF1F0E4B00F003001A78490102F0FC02104318701A7801F0600142F080021A701A7802F07F024E
+:40274000CE2203F8062CA3F597530222123B1A70094A137843F00803137000F0C1FA074B08222046BDE810401A6000F019BC00BFAB43004006590040275B004080E200E0CF
-:402780001A701A7802F09F020A431A701A7842F010021A70704700BF83430040014B01221A70704784430040044B00F00F021B6853F8220043F82210704700BF08ED00E008
+:4027800008B500F009FC0F4A137803F0FE031370A2F5AA52153A137803F0FE031370137C03F0FE03137412F80A3C03F0FD0302F80A3C937903F0FD039371BDE8084000F0BB
-:4027C000054A00F01F00126800F1100352F8230042F82310704700BF08ED00E000F01F0000F16040490100F56440C9B2017070470F4B10B50F4900240F205C609C60DC60F4
+:4027C000EFBB00BF00590040044A137803F03F0343EA8010C0B21070704700BF00590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF095
-:402800001C615C61FFF7D0FF0B4A136843F0040313600A4B4FF47A72DB68B3FBF2F3084A1360084B4FF400421C60C3F8E82010BD8492FF1F9D28000010E000E0EC80FF1FC6
+:40280000000298BF33F910100A4B88BF11461A8042F210734B4341F2883103F6C41393FBF1F305490B60054B1A80704702590040AE3B00005693FF1F5C93FF1F5493FF1FFC
-:4028400014E000E018E000E0024A136843F002031360704710E000E008B5FFF7F5FF034A136843F00103136008BD00BF10E000E010B5054CA3691BB9FFF7BAFF0123A36179
+:4028400008B5102000F014F90721032000F090FA0749032000F07EFA064A0C20137843F006031370FFF7BCFF034B00221A8008BD39290000015900405893FF1F10B5054C6D
-:40288000BDE81040FFF7E8BF8492FF1F024B1868C0F30040704700BF10E000E038B5FFF7F5FF012808D1054D002455F8243003B198470134052CF8D138BD00BF8892FF1FAE
+:4028800023781BB9FFF7DCFF01232370BDE81040FFF728BF7C92FF1F044B1A7802F0FB021A701A7842F001021A7070470059004010B5084B1C7814F0010403D10028F9D0AE
-:4028C000024B03EB80035868596070478492FF1F134B144A1B78DBB20360127843EA0223114A0360127843EA0243104A0360127843EA026303600E4B0E4A1B78DBB2436031
+:4028C000002404E0204600F00BFA024B1B78204610BD00BF01590040034A044B1B881088181A00B2704700BF5493FF1FA05B00400E4A13881BB223B111880A2309B25943E7
-:40290000127843EA02230C4A4360127843EA02430A4A4360127843EA02634360704700BF0301004904010049EC46004002010049010100490001004905010049060100490D
+:4029000001E00B4B19680B4B1B88C01A42F2107300B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F000B270475693FF1F5C93FF1F5893FF1F70470000014B1870E9
-:4029400010B500F015FB204A044613780A2043F002031370137C43F00203137412F80A3C43F0010302F80A3C937943F00103937102F5AB52137843F003031370134B18223F
+:40294000704700BF7B640040014B1870704700BF7F640040014B1870704700BF7C640040014B1870704700BF7E640040F7B516461F460B4C00230325019300930A460146B2
-:402980001A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222183B1A70094A137843F008031370FFF7CAFE064B10222046BDE8DE
+:402980002846257000F022F93A463146207800F0DDF80221207800F0C7F8207803B0F0BDE080FF1FF7B516461F460B4C00230225019300930A4601462846257000F006F917
-:4029C00010401A6000F0D8BAAB4300400E5900402F5B004080E200E008B500F0C9FA0F4A137803F0FE031370A2F5AA521D3A137803F0FD031370137C03F0FD03137412F8E1
+:4029C0003A463146207800F0C1F82946207800F0ABF8207803B0F0BDE180FF1FF7B516461F460B4C00230125019300930A4601462846257000F0EAF83A463146207800F06F
-:402A00000A3C03F0FE0302F80A3C937903F0FE039371BDE8084000F0AFBA00BF08590040044A137803F03F0343EA8010C0B21070704700BF08590040082804D00A280CBF9D
+:402A0000A5F80221207800F08FF8207803B0F0BDE280FF1F73B515461E460B4C0023019300930A4601461846237000F0CFF832462946207800F08AF80221207800F074F880
-:402A40008223C22300E0422308380E4AC0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A8042F210734B4341F2883103F6C41393FBF1F305490B60054B33
+:402A4000207802B070BD00BFE380FF1F024B1878C0F38010704700BF8F450040034A00F0F800137803431370704700BF02410040034A00F0F800137803431370704700BF74
-:402A80001A8070470A590040603A00005293FF1F5493FF1F5893FF1F08B5102000F0A6F907210420FFF79AFE07490420FFF788FE064A0C20137843F006031370FFF7BCFFBA
+:402A800006410040074A7F23802113705170064A013BDBB202F80839002BF9D1034A1370704700BFE480FF1FF87B00400078004017280FD8084B0001C25C11B142F020028D
-:402AC000034B00221A8008BD912B0000095900405093FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040FFF72ABFA092FF1F044B1A7802F0FB021A701A7842F0010256
+:402AC00001E002F0DF02C254C25C42F00102C25400207047012070471070004017280BD8064B0001C25C02F0FE02C254C25C02F0DF02C25400207047012070471070004024
-:402B00001A7070470859004010B5084B1C7814F0010403D10028F9D0002404E02046FFF715FE024B1B78204610BD00BF09590040034A044B1B881088181A00B2704700BF1D
+:402B000017280DD8074900010B4603441A7942F004021A71435C43F00103435400207047012070471070004017280BD8064A0001835C490003F0F10301F00E0119438154A3
-:402B40005893FF1FA25B00400E4A13881BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107300B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F0C1
+:402B400000207047012070471070004041F6FF73994208BF4FF400519A4208BF4FF4005217289FBFC00000F1804000F5EC4081809ABFC280002001207047000017289FBF6F
-:402B800000B270475293FF1F5493FF1F5093FF1F7047000010B500F0EBF9214A044613780A2043F001031370137C43F00103137412F80A3C43F0020302F80A3C937943F0DB
+:402B8000034B00011954002088BF0120704700BF1970004017289FBF054B00011A5C01F007019DBF1143195400200120704700BF1470004017289FBF034B0001185C00F04D
-:402BC0000203937102F5AA521832137843F003031370144B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222123B1A7067
+:402BC000070088BFFF20704714700040172810B51AD8C00001F07F0100F1804441EAC21204F5EC44D2B222709DF8082003F00F0343EA0213DBB263709DF80C30002003F08B
-:402C0000094A137843F008031370FFF79FFD074B08222046BDE810401A6000F0ADB900BFAB43004006590040275B004080E200E008B500F09DF90F4A137803F0FE0313708E
+:402C00000F03A370E07010BD012010BD10B500F0C3F90A4A5378182B0AD91478013B5370E30003F1804303F5F0431B78137000E0FF2400F0B5F9204610BD00BFE480FF1F33
-:402C4000A2F5AA52153A137803F0FE031370137C03F0FE03137412F80A3C03F0FD0302F80A3C937903F0FD039371BDE8084000F083B900BF00590040044A137803F03F0361
+:402C4000030610B5044611D400F0A6F9084AE300117803F1804303F5F04319705378147001335370BDE8104000F09AB910BD00BFE480FF1F30B504060CD411F4704509D1B0
-:402C800043EA8010C0B21070704700BF00590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A80AE
+:402C8000C40004F1804404F5F0442180A270E370284630BD012030BD03065FBFC00000F1804000F5F04081805ABFC280002001207047000038B50446084DB4F5004F05D988
-:402CC00042F210734B4341F2883103F6C41393FBF1F305490B60054B1A807047025900406A3A00005E93FF1F6493FF1F5C93FF1F08B5102000F084F807210320FFF76EFD92
+:402CC000286800F061F9A4F50044F6E7034B58686043BDE8384000F057B900BFEC80FF1F024B1B7A584300F04FB900BFEC80FF1F0E4B00F003001A78490102F0FC02104300
-:402D000007490320FFF75CFD064A0C20137843F006031370FFF7BCFF034B00221A8008BDE92D0000015900406093FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040C8
+:402D000018701A7801F0600142F080021A701A7802F07F021A701A7802F09F020A431A701A7842F010021A70704700BF83430040014B01221A70704784430040044B00F08C
-:402D4000FFF728BFA192FF1F044B1A7802F0FB021A701A7842F001021A7070470059004010B5084B1C7814F0010403D10028F9D0002404E02046FFF7E9FC024B1B78204621
+:402D40000F021B6853F8220043F82210704700BF08ED00E0054A00F01F00126800F1100352F8230042F82310704700BF08ED00E000F01F0000F16040490100F56440C9B29B
-:402D800010BD00BF01590040034A044B1B881088181A00B2704700BF5C93FF1FA05B00400E4A13881BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107381
+:402D8000017070470F4B10B50F4900240F205C609C60DC601C615C61FFF7D0FF0B4A136843F0040313600A4B4FF47A72DB68B3FBF2F3084A1360084B4FF400421C60C3F883
-:402DC00000B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F000B270475E93FF1F6493FF1F6093FF1F70470000034A00F0F800137803431370704700BF02410040A1
+:402DC000E82010BD8092FF1F312E000010E000E0EC80FF1F14E000E018E000E0024A136843F002031360704710E000E008B5FFF7F5FF034A136843F00103136008BD00BFD3
-:402E0000034A00F0F800137803431370704700BF06410040014B1870704700BF72640040014B1870704700BF7864004073B515461E460B4C04230022019200920A46014603
+:402E000010E000E010B5054CA3691BB9FFF7BAFF0123A361BDE81040FFF7E8BF8092FF1F024B1868C0F30040704700BF10E000E038B5FFF7F5FF012808D1054D002455F891
-:402E400018462370FFF7F8FB324629462078FFF7B3FB02212078FFF79DFB207802B070BDFC80FF1F074A0223136002F688321268E0215064044A11706FF440710A4413608D
+:402E4000243003B198470134052CF8D138BD00BF8492FF1F024B03EB80035868596070478092FF1F134B144A1B78DBB20360127843EA0223114A0360127843EA0243104A07
-:402E8000704700BF80E100E001E400E0014B1870704700BF75640040014B1870704700BF76640040014B1870704700BF79640040FEB5494652465B460EB407462449096800
+:402E80000360127843EA026303600E4B0E4A1B78DBB24360127843EA02230C4A4360127843EA02430A4A4360127843EA02634360704700BF0301004904010049EC460040B2
-:402EC0008A46244A12682448022100F071F8030020480068C018204900F06AF8143883460121C9430C460125002600F041F8814651460B7823400B705846013000F030F81C
+:402EC000020100490101004900010049050100490601004900000000FEB5494652465B460EB40746244909688A46244A12682448022100F071F8030020480068C018204936
-:402F00003800F04028400B78234003430B70584600F026F80136072EF2D9002001300138013001200B78234003430B705846043000F016F8484600F01FF800BF00BF00BF12
+:402F000000F06AF8143883460121C9430C460125002600F041F8814651460B7823400B705846013000F030F83800F04028400B78234003430B70584600F026F80136072E00
-:402F40000EBC894692469B46FEBD00BFAFF30080D480FF1FF880FF1F00C20100000000000230800803D000BF01380046FCD17047EFF3108072B6704780F31088704700BF77
+:402F4000F2D9002001300138013001200B78234003430B705846043000F016F8484600F01FF800BF00BF00BF0EBC894692469B46FEBD00BFAFF30080D480FF1FF880FF1F6B
-:402F8000094A137803F00303012B0AD0022B09D113790C2103F07F02044B01FB02339B7A00E013790020704700600040DC92FF1F002902D0B0FBF1F0704708B14FF0FF3097
+:402F800000C20100000000000230800803D000BF01380046FCD17047EFF3108072B6704780F31088704700BF094A137803F00303012B0AD0022B09D113790C2103F07F021C
-:402FC00000F008B80029F8D00246B0FBF1F000FB11217047704700BF014B1868704700BF6081FF1F0E4B70B51E460E4C0025E41AA410A54204D056F8253098470135F8E75C
+:402FC000044B01FB02339B7A00E013790020704700600040D492FF1F002902D0B0FBF1F0704708B14FF0FF3000F008B80029F8D00246B0FBF1F000FB11217047704700BFA1
-:4030000000F0DEFD084B094C1E46E41AA4100025A54204D056F8253098470135F8E770BDCC3B0000CC3B0000CC3B0000D43B000003460244934202D003F8011BFAE770475A
+:40300000014B1868704700BF5C81FF1F0E4B70B51E460E4C0025E41AA410A54204D056F8253098470135F8E700F04EFE084B094C1E46E41AA4100025A54204D056F8253071
-:4030400030B5141E05469BB0184604DA8B232B604FF0FF301DE04FF40273ADF80C300CBF234604F1FF33029305934FF6FF7300910491ADF80E3002461E9B6946284600F0D4
+:4030400098470135F8E770BDD43C0000D43C0000D43C0000DC3C000003460244934202D003F8011BFAE7704730B5141E05469BB0184604DA8B232B604FF0FF301DE04FF432
-:4030800073F8431CBCBF8B232B6014B1009B00221A701BB030BD000007B5009313460A46014603480068FFF7CBFF03B05DF804FB6081FF1F2DE9F0478E6882469E420C46D9
+:403080000273ADF80C300CBF234604F1FF33029305934FF6FF7300910491ADF80E3002461E9B6946284600F073F8431CBCBF8B232B6014B1009B00221A701BB030BD000022
-:4030C000914698463ED88A8912F4906F3AD02568096902236F1A656905EB450595FBF3F57B1C43449D4238BF1D4653050FD5294600F04AFB064698B13A46216900F0D2FA24
+:4030C00007B5009313460A46014603480068FFF7CBFF03B05DF804FB5C81FF1F2DE9F0478E6882469E420C46914698463ED88A8912F4906F3AD02568096902236F1A656977
-:40310000A38923F4906343F08003A38113E02A4600F098FB064670B92169504600F0E8FA0C23CAF80030A3894FF0FF3043F04003A381BDE8F08726613E44266046466561E0
+:4031000005EB450595FBF3F57B1C43449D4238BF1D4653050FD5294600F04AFB064698B13A46216900F0D2FAA38923F4906343F08003A38113E02A4600F098FB064670B9E0
-:40314000ED1BA560464528BF464649463246206800F0B3FAA36800209B1BA36023681E442660BDE8F08700002DE9F04F9DB003938B8980461C060D4616460DD50B695BB958
+:403140002169504600F0E8FA0C23CAF80030A3894FF0FF3043F04003A381BDE8F08726613E44266046466561ED1BA560464528BF464649463246206800F0B3FAA3680020A9
-:40318000402100F001FB2860286118B90C23C8F80030CDE040236B610023099320238DF82930DFF89CB130238DF82A3037463C4614F8013B1BB9B7EB060910D003E0252BD0
+:403180009B1BA36023681E442660BDE8F08700002DE9F04F9DB003938B8980461C060D4616460DD50B695BB9402100F001FB2860286118B90C23C8F80030CDE040236B6150
-:4031C000F9D02746F3E74B46324629464046FFF771FF013000F0A780099B4B4409933B78002B00F0A08000234FF0FF3204930793059206938DF853301A93012605222178C6
+:4031C0000023099320238DF82930DFF89CB130238DF82A3037463C4614F8013B1BB9B7EB060910D003E0252BF9D02746F3E74B46324629464046FFF771FF013000F0A780FE
-:403200004E4800F041FA671C049B38B14B4A3C46801A06FA00F018430490EFE7D90644BF20228DF853201A0744BF2B228DF8532022782A2A03D0079A00210A200BE0039AA2
+:40320000099B4B4409933B78002B00F0A08000234FF0FF3204930793059206938DF853301A930126052221784E4800F041FA671C049B38B14B4A3C46801A06FA00F0184379
-:40324000111D12680391002A10DA524243F00200079204900BE027463B780134303B092B03D800FB02320121F5E701B107923B782E2B1ED17B782A2B0AD1039B02371A1DAA
+:403240000490EFE7D90644BF20228DF853201A0744BF2B228DF8532022782A2A03D0079A00210A200BE0039A111D12680391002A10DA524243F00200079204900BE027468C
-:403280001B680392002BB8BF4FF0FF33059310E0002319460593781C0A2407463A780130303A092A03D804FB01210123F5E703B1059103223978224800F0E6F940B1402309
+:403280003B780134303B092B03D800FB02320121F5E701B107923B782E2B1ED17B782A2B0AD1039B02371A1D1B680392002BB8BF4FF0FF33059310E0002319460593781CA7
-:4032C000CBEB000003FA00F0049B013718430490397806221B487E1C8DF8281000F0D4F988B1194B33B9039B073323F007030833039314E003AB00932A46144B04A940468F
+:4032C0000A2407463A780130303A092A03D804FB01210123F5E703B1059103223978224800F0E6F940B14023CBEB000003FA00F0049B013718430490397806221B487E1CEB
-:40330000AFF3008007E003AB00932A460F4B04A9404600F093F8B0F1FF3F824603D0099B5344099342E7AB895B0601D4099801E04FF0FF301DB0BDE8F08F00BF9B3B000071
+:403300008DF8281000F0D4F988B1194B33B9039B073323F007030833039314E003AB00932A46144B04A94046AFF3008007E003AB00932A460F4B04A9404600F093F8B0F12A
-:40334000A13B0000A53B000000000000B53000002DE9F04791461F460A698B6806469342B8BF1346C9F8003091F843200C46DDF8208012B10133C9F800302368990642BF15
+:40334000FF3F824603D0099B5344099342E7AB895B0601D4099801E04FF0FF301DB0BDE8F08F00BFA33C0000A93C0000AD3C000000000000DD3000002DE9F04791461F4627
-:40338000D9F800300233C9F80030256815F0060510D104F1190A07E00123524639463046C04701301AD00135E368D9F800209B1A9D42F1DB94F843302268003318BF01230D
+:403380000A698B6806469342B8BF1346C9F8003091F843200C46DDF8208012B10133C9F800302368990642BFD9F800300233C9F80030256815F0060510D104F1190A07E05B
-:4033C00092060FD5E118302081F843005A1C94F845102244023382F8431003E04FF0FF30BDE8F08704F1430239463046C0470130F4D02268D9F80050E36802F00602042AD7
+:4033C0000123524639463046C04701301AD00135E368D9F800209B1A9D42F1DB94F843302268003318BF012392060FD5E118302081F843005A1C94F845102244023382F884
-:4034000008BF5D1B2269A3680CBF25EAE57500259342C4BF9B1AED184FF000091A344D4509D00123224639463046C0470130D5D009F10109F3E70020BDE8F0872DE9F0438A
+:40340000431003E04FF0FF30BDE8F08704F1430239463046C0470130F4D02268D9F80050E36802F00602042A08BF5D1B2269A3680CBF25EAE57500259342C4BF9B1AED1843
-:4034400017460A7E85B06E2A984606460C460C9B01F1430E00F0AE8011D8632A22D009D8002A00F0BB80582A40F0CA8081F84520834955E0642A1ED0692A1CD0C0E0732A65
+:403440004FF000091A344D4509D00123224639463046C0470130D5D009F10109F3E70020BDE8F0872DE9F04317460A7E85B06E2A984606460C460C9B01F1430E00F0AE8054
-:4034800000F0B08009D86F2A2ED0702A40F0B8800A6842F020020A603EE0752A24D0782A3AD0ADE01A6801F14205111D1960136884F84230A8E021681A6811F0800F02D098
+:4034800011D8632A22D009D8002A00F0BB80582A40F0CA8081F84520834955E0642A1ED0692A1CD0C0E0732A00F0B08009D86F2A2ED0702A40F0B8800A6842F020020A6091
-:4034C000111D196008E011F0400F02F10401196002D0B2F9003000E01368002B3CDA2D225B4284F8432037E021681A6811F0800F02D0111D196007E011F0400F02F104010E
+:4034C0003EE0752A24D0782A3AD0ADE01A6801F14205111D1960136884F84230A8E021681A6811F0800F02D0111D196008E011F0400F02F10401196002D0B2F9003000E045
-:40350000196001D0138800E01368227E5C496F2A14BF0A2208221BE078225A4984F845202268186812F0800F00F104051D6003D1550601D5038800E00368D00744BF42F032
+:403500001368002B3CDA2D225B4284F8432037E021681A6811F0800F02D0111D196007E011F0400F02F10401196001D0138800E01368227E5C496F2A14BF0A2208221BE068
-:40354000200222601BB9226822F0200222601022002084F8430001E049490A226568002DA56008DB206820F0040020602BB9002D7DD175460CE0002B79D07546B3FBF2F020
+:4035400078225A4984F845202268186812F0800F00F104051D6003D1550601D5038800E00368D00744BF42F0200222601BB9226822F0200222601022002084F8430001E08A
-:4035800002FB1033CB5C05F8013D03460028F5D1082A0BD12368DA0708D5236962689A42DEBF302305F8013C05F1FF35C5EB0E0323612EE008681A6810F0800F496903D0FC
+:4035800049490A226568002DA56008DB206820F0040020602BB9002D7DD175460CE0002B79D07546B3FBF2F002FB1033CB5C05F8013D03460028F5D1082A0BD12368DA0737
-:4035C000101D1860136808E010F0400F02F104001860136801D0198000E0196000232361754616E01A68111D1960156800216268284600F049F808B1401B6060636804E0BC
+:4035C00008D5236962689A42DEBF302305F8013C05F1FF35C5EB0E0323612EE008681A6810F0800F496903D0101D1860136808E010F0400F02F104001860136801D0198064
-:4036000004F1420584F8422001232361002384F84330CDF800803B4603AA21463046FFF797FE013002D14FF0FF3026E023692A4639463046C0470130F5D023689B0710D563
+:4036000000E0196000232361754616E01A68111D1960156800216268284600F049F808B1401B6060636804E004F1420584F8422001232361002384F84330CDF800803B468C
-:40364000002504F1190907E001234A4639463046C0470130E7D00135E368039A9B1A9D42F2DBE068039B9842B8BF184605E00B7804F1420584F842308AE705B0BDE8F083AB
+:4036400003AA21463046FFF797FE013002D14FF0FF3026E023692A4639463046C0470130F5D023689B0710D5002504F1190907E001234A4639463046C0470130E7D00135CC
-:403680004F3A0000AC3B000010B5C9B202449042034605D01C7801308C42F8D1184610BD002010BD10B5431E0A44914204D011F8014B03F8014FF8E710BD884210B501EBCE
+:40368000E368039A9B1A9D42F2DBE068039B9842B8BF184605E00B7804F1420584F842308AE705B0BDE8F083923B0000B43C000010B5C9B202449042034605D01C78013064
-:4036C000020301D8421E0BE09842FBD28118D21AD34204D013F8014D01F8014DF8E710BD994204D011F8014B02F8014FF8E710BD38B50546002944D051F8043C0C1F002BF2
+:4036C0008C42F8D1184610BD002010BD10B5431E0A44914204D011F8014B03F8014FF8E710BD884210B501EB020301D8421E0BE09842FBD28118D21AD34204D013F8014DA2
-:40370000B8BFE41800F0D4F81E4A1368114613B96360146030E0A3420DD92268A018834201BF18685B681218226063600C6023E0A24203D813465A68002AF9D118681918DB
+:4037000001F8014DF8E710BD994204D011F8014B02F8014FF8E710BD38B50546002944D051F8043C0C1F002BB8BFE41800F0D4F81E4A1368114613B96360146030E0A342E7
-:40374000A1420BD12168014458188242196013D110685268014419605A600DE002D90C232B6009E021686018824201BF106852680918216062605C602846BDE8384000F0C4
+:403740000DD92268A018834201BF18685B681218226063600C6023E0A24203D813465A68002AF9D118681918A1420BD12168014458188242196013D11068526801441960EE
-:4037800098B838BDA892FF1F70B5CD1C25F0030508350C2D38BF0C25002D064601DBA94202D90C23336046E000F082F8234B1C681A462146A1B10B685B1B0ED40B2B03D94E
+:403780005A600DE002D90C232B6009E021686018824201BF106852680918216062605C602846BDE8384000F098B838BDA092FF1F70B5CD1C25F0030508350C2D38BF0C2534
-:4037C0000B60CC18CD501EE08C420BBF63684B681360636018BF0C4615E00C464968E9E7174C23681BB9304600F052F820602946304600F04DF8431C18D0C41C24F00304D4
+:4037C000002D064601DBA94202D90C23336046E000F082F8234B1C681A462146A1B10B685B1B0ED40B2B03D90B60CC18CD501EE08C420BBF63684B681360636018BF0C4695
-:40380000A0420DD12560304600F053F804F10B00231D20F00700C31A0ED05A42E25070BD211A304600F034F80130EBD10C233360304600F03EF8002070BD00BFA892FF1F09
+:4038000015E00C464968E9E7174C23681BB9304600F052F820602946304600F04DF8431C18D0C41C24F00304A0420DD12560304600F053F804F10B00231D20F00700C31A48
-:40384000A492FF1FF8B5074615460E4621B91146BDE8F840FFF798BF1AB9FFF749FF2846F8BD00F027F885420ED929463846FFF78BFF044650B131462A46FFF713FF3146E1
+:403840000ED05A42E25070BD211A304600F034F80130EBD10C233360304600F03EF8002070BD00BFA092FF1F9C92FF1FF8B5074615460E4621B91146BDE8F840FFF798BFAB
-:403880003846FFF735FF01E03046F8BD2046F8BD38B5064C0023054608462360FDF7D8FB431C02D1236803B12B6038BD8C93FF1F7047704751F8040C0028BEBF091851F8F0
+:403880001AB9FFF749FF2846F8BD00F027F885420ED929463846FFF78BFF044650B131462A46FFF713FF31463846FFF735FF01E03046F8BD2046F8BD38B5064C002305467D
-:4038C000043CC0180438704700000000050209020B020D020F021102130215027265706C792030782530327800686F6D696E6700626567696E6E696E67207365656B2066CB
+:4038C00008462360FDF7F4FB431C02D1236803B12B6038BD8493FF1F7047704751F8040C0028BEBF091851F8043CC0180438704700000000050209020B020D020F021102BB
-:40390000726F6D20256420746F2025640066696E6973686564207365656B00796573006E6F00647269766520303A20257320647269766520313A2025730057616974696E5F
+:403900001302150228000000000104000100000000000000000157494E55534200003030303031000000000000000000E0000000000105000100D6000000070000002A0075
-:403940006720666F72205553422E2E2E0055534220726561647900636F6D6D616E6420307825303278006661696C2025642B25642B2564203D3D2025642C206E6F7420254E
+:4039400044006500760069006300650049006E0074006500720066006100630065004700550049004400730000009E0000007B00330064003200370035006300660065004E
-:4039800064007061737365643D256400756E64657272756E206166746572202564207061636B65747300636F756E743D256420693D256420643D256400636D645F77726997
+:403980002D0035003400330035002D0034006400640035002D0061006300630061002D003900660062003900390035006500320066003600330038007D0000007B00330058
-:4039C000746500703D25642063723D25642063773D256420663D256420773D256420696E6465783D256420756E64657272756E3D256400756E64657272756E21007375635E
+:4039C00064003200370035006300660065002D0035003400330035002D0034006400640035002D0061006300630061002D00390066006200390039003500650032006600B4
-:403A0000636573730073746172742065726173696E670073746F702065726173696E670069646C6500005100401000405100403000000001400010001401400008004001A3
+:403A00003600330038007D00000000007265706C792030782530327800686F6D696E6700626567696E6E696E67207365656B2066726F6D20256420746F2025640066696E14
-:403A400040000A004C0140000200500140200030313233343536373839414243444546000001000000040000001000010000000400000010280000000001040001000000C2
+:403A40006973686564207365656B00796573006E6F0057616974696E6720666F72205553422E2E2E00555342207265616479005363616E6E696E67206472697665732E2E1C
-:403A800000000000000157494E5553420000303030303100000000000000000012034D005300460054003100300030000100000001000000B83A000001000000873B0000A5
+:403A80002E00647269766520303A20257320647269766520313A20257300636F6D6D616E6420307825303278006661696C2025642B25642B2564203D3D2025642C206E6F40
-:403AC000000000000000000001000000D03A000001000000593B000004000000F23A0000000000000000000000000000F03A0000FF00000001024000FF00000082024000C7
+:403AC00074202564007061737365643D256400756E64657272756E206166746572202564207061636B65747300636F756E743D256420693D256420643D256400636D645FEF
-:403B0000FF00000003034000FF00000084034000FF00020304030904160346006C007500780045006E00670069006E0065002A0343006F0077006C00610072006B00200034
+:403B0000777269746500703D25642063723D25642063773D256420663D256420773D256420696E6465783D256420756E64657272756E3D256400756E64657272756E210015
-:403B400054006500630068006E006F006C006F0067006900650073000009022E0001010080320904000004FF00000107050102400000070582024000000705030340000AE8
+:403B4000737563636573730073746172742065726173696E670073746F702065726173696E670069646C650000510040100040510040300000000140001000140140000858
-:403B80000705840340000A12010002FF0001080912006E0100020180014300232D302B2000686C4C0065666745464700303132333435363738396162636465660000000069
+:403B800000400140000A004C01400002005001402000303132333435363738394142434445460000000100000004000000100001000000040000001001000000C03B000072
-:403BC000F8B500BFF8BC08BC9E46704759000000CD100000F8B500BFF8BC08BC9E46704735000000F83B0000C880FF1FA00000002812000000000000000000009093FF1FA8
+:403BC000010000008F3C0000000000000000000001000000D83B000001000000613C000004000000FA3B0000000000000000000000000000F83B0000FF0000000102400099
-:403C0000FF000000675000400C00000007000000FFFFFFFF7F8000003F0000000000007D00FA0000400000000090D003FF0000000000000000000000000000000000000028
+:403C0000FF00000082024000FF00000003034000FF00000084034000FF00020304030904160346006C007500780045006E00670069006E0065002A0343006F0077006C00CE
-:403C400000000000000000000000000000000000993B0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000070
+:403C4000610072006B00200054006500630068006E006F006C006F0067006900650073000009022E0001010080320904000004FF00000107050102400000070582024000E5
-:403C8000000000000000000000000000000000000081FF1F000000000000000000000000000000000000000000000000000000000000000000000000000000000000000065
+:403C8000000705030340000A0705840340000A12010002FF0001080912006E0100020180014300232D302B2000686C4C00656667454647003031323334353637383961629E
-:403CC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C4
+:403CC0006364656600000000F8B500BFF8BC08BC9E467047590000002D110000F8B500BFF8BC08BC9E46704735000000003D0000C880FF1F980000002812000000000000F3
-:403D00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000083
+:403D0000000000008893FF1FFFFF0000675000400C00000007000000FFFFFFFF7F8000003F0000000000007D00FA0000400000000090D003000000000000000000000000EE
-:403D40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000043
+:403D40000000000000000000000000000000000000000000A13C00000000000000000000000000000000000000000000000000000000000000000000000000000000000066
-:403D80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000003
+:403D80000000000000000000000000000000000000000000FC80FF1F0000000000000000000000000000000000000000000000000000000000000000000000000000000069
 :403DC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C3
 :403E00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000082
 :403E40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000042
@@ -4098,48 +4098,48 @@
 :40FF80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000041
 :40FFC0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000001
 :0200000480007A
-:400000000145004009520040015B00400165004047000140380101404E0201404703014046040140440501404C060140490701402C08014031090140040B0140030D014075
+:400000000145004008520040015B004001650040020101402C0201402D0301400F0501400B0701406308014056090140570A01404A0B0140500C01404A0D0140480E014042
-:400040006C14014057150140591601404B17014011190140071B01400B400140104101400C4201400F43014002440140054501400A4601400B4701400C480140104901404C
+:40004000390F01400415014004170140671801404B190140361A0140471B01400D40014010410140134201400D43014004440140064501400A460140084701400B48014097
-:40008000174C01400C4D014006500140045101407E02080409021082110218021904601561137C402721240A02E40303040E0520064107C00A840B900E840F901001120693
+:4000800010490140144C01400C4D014006500140045101407E02080109441180180219016009610A7C402721290AE204E6080F011001150126012E012F013001310138026A
-:4000C00013901684179019011A841B481C081DFC1E221F0221C122182324268427902B9C2CE72E10300733E0351F36F83A023B084204460E480449FF4AFF4BFF4F83580B46
+:4000C00039023E013F01580459045B045F01810883048C018D0E910194029701A404AD04AE04AF0AB004B102B301B402B50CB601B802B908BE51BF04D608D804D909DB0401
-:40010000590B5A045B045C995D095F01868088028A8190E7921094019686980F9A409C0F9E20A2E0A618A804AA81AE80B207B4F8D80BDC09DF010022022003010524084089
+:40010000DC90DD90DF01020208080C02100213081540170818081A801B801C80200821012210231026012A802C02300233043708388039023D405840600268026B0C6D4004
-:4001400009080A080B400C420D200E2010021108130215801610172119011A011C241E201F0C210422082308284029042B88312032643301382039883A013B804240528017
+:40014000782088028B109840B040C001C214C4A5CA18CC43CE19D608D808DE04E208E68080088201928094809C289E80A201A602B044B380B404B610E604EA01EE44804068
-:400180005A215B4A600461016218634278027C028280C06FC2FFC4FDCA07CC0FCE0FD001D60FD80FDE8103140404050806110710081F0A800C010E1E0FE4101F124015102D
+:40018000842094809C209E80A602AA40E211E608EA01EE0C00800121020403020403052106FC0704080109210A020B080C040E100F4010FF11011404152F162019201A0495
-:4001C00016E0178218021A111B141C1F1E20211023212408261127142B142D1F2F4032F0330F360F37F03A083B80580B590B5B045C995F018203830884618608873088204C
+:4001C0001B011C041D211EF91F0E220224042608271028042A402B2F2D0F2E02311F336034FF39083A0C3E104003450C470E481149FF4AFF4BFF50045609581859045A044E
-:4002000089108A508B828DC78E108F2892109304961C97C49A109B04A061A110A204A341A440A630A704AB04AC7CAE02AF04B01FB30FB460B5F4BB08D80BD90BDB04DC99FF
+:400200005B045C995D995F0162C081028407850186388702880189048C028D048E04902091049208940895029610983F99029C089D049E30A105A503A704A802A902AA0417
-:40024000DF01012A02200301040805400708081009080B8C0C420E200F04104211081504180819221A0C1B011C221D4C1E211F4820042218242025442731285029402B8839
+:40024000AC3FAD02B43FB507B63FBF10D608D804D904DB04DC09DD90DF010010010803010490050909240A420C030E020F24100A15081602172119401A021B501E101F107B
-:400280002C022E042F883204331134103508380439813A103D8C3E016230680269806A806D4078027C029308942096E897809C029D249F61A403A50CA620A781AA01AB0889
+:400280002120242025052603272029982B402C022F18300831803202332035983701388039013B183C803D113E0447084F0856085A805F4062806302670269806B026C0881
-:4002C000C0EFC2FEC42DCAFFCC67CEDFDE81E208021004400620080C0C010E0210081101140818051A081C04200828202AC02CE02F0130603280341E3501360138203E40ED
+:4002C0006D116E846F21759076467F01814087018E08908094209581971499049C019DC99E449F03A382A408A682A729C0F7C2FFC4F3CA7FCCFFCEFFD040D618D818DE1080
-:400300005608580459045B045C995D905F0181608209842487108A128B108F10903F93039407950197089B1C9D40A036A209A310A710A82DA901AA12AB04AC40AD7CAF0220
+:40030000E210EA01EE0C0101041205010624084209800A100B200C040D700F80107011081201130414061508170219071A081B081D801E601F102140221023802404250F16
-:40034000B11FB238B440B540B607B720BE10D608D80BD90BDB04DC99DD90DF01000201280302040A070409980B800C020E20104212081550170119281A401B401E201FA0A5
+:4003400027F028042B0F2C802D01300F320F348035FF3670380A3B0C3E103F105804590A5B045C995F01824185F186418704888089208A018B118CF18E0291F1924E930218
-:4003800022102662274828022C022E052F043302364237283C203D803F0558805D80600267016B026D106F017C0287208B848F4091409205930496409B209C029F48A0124A
+:40038000954096419711980199109A149BE19F0EA1F1A308A580A641A711A801AA28B00FB10FB3F0B4F0BA02BB02D80BD90BDB04DC99DF010108020203080510076208017B
-:4003C000A140A208A620A780AD01AE08C07FC23FC4DBCAF8CCF1CEF0D618D818DE80E208E408EA040104020F0440068008700A800C800E200F0110011106130114081602E9
+:4003C00009200A220D020E1410021240131414081508188819041A221B821C801D121F1021282501277029892B082D022F103008314033213608376238A039013A043E1454
-:40040000170218011C0F1EF0200124072608288029052A102B022C082E04310736FF3E403F01580459045B045F018001811C820283E18402852087C0880489828B218C0248
+:4004000068026D407A107E80800481408D108F019108921495809702980899029D109F72A218A440A509A701A809B340B408B502B640C0F7C27FC46FCACFCCFFCE6FDE8298
-:400440008D088F10900491FF940495089710980599029C049D04A002A1FCA402A520A740A802AC03AE04AF02B007B3FCB503BB20BE01D804D904DB04DC90DF010081012440
+:40044000E401E8F0EC20EE40020103C4070808050A020B040C380D200F82101011C7120813181602170418081A301B041F302520274128042B042C062E012F043020320715
-:4004800004450520084009080A080B810C080D010E020F041008120113861544172219011C0220042114222C23282740280229012B202D1030083180321033023705396892
+:40048000330F341837F43B083E04580459085B045C995F0182108303840285628604870489208A108B508DFC8E108F0192039420964097809A109B1C9C409E209F10A07C22
-:4004C0003A013D82588068066C016D806F048004810184048F0191109220940A9780980299209B019C409F04A401A598A702A880A980AF02C0FFC2FFC4FFCA2BCCCFCE9F8E
+:4004C000A162A201A308A61CA710A940AA10AB30AC02AE08AF10B01FB11FB360B460B780D808D908DC99DF0100A001800204036004020706081009080A800B010C080E8878
-:40050000D608E24CE402E605EA04EC02EE0C06010B0410041304160119021C022101240829042C013001310232043304340236083701380239083E553F45560858045904A9
+:400500001218134215401608180419201A841B201C081EA02105220923112504268429922A242D802E102F20301031083350340136883722380439823B103D0A3E203F4070
-:400540005B045D905F0183018A029501A401AC02B401B501B602B880B920BE50BF10D804D904DB04DF01030804080D800F50100212101410154019101A021E2A1F022210BD
+:40054000611062106D406F047B037F028A08900292509508968297129C019D329F62A018A444A501A690A721C0DFC27FC4CFCA7FCCFECEFFDE18E020E208EA8000020120A4
-:40058000250226882C802F083308372138023F10584059105DA45E01645266106A406C076D406F09800282C085808608890293409980AF40C022C2B0C4A5CAA0CCA2CE2157
+:40058000024803C004C20502062407440A030B900E9011FC129013011690170318201AC01B901E901F9020FC21C222012328269027902A9C2B9C2F90321F331F34E037E015
-:4005C000D6FCD8F0EA04EE0C9980E208E448EA049980B180E208018002200608070108280B100C020D210E2C1028110F1434152117081828192F1C101E021F2F202821210D
+:4005C0003A203B80420647E0482049FF4AFF4BFF4F83580859085A045B045C995D095F0180E28208861088E28A049210942096D09A03A0FCA201A440A630A880AA30AE1C91
-:40060000230224022740282829212B042C202D212E012F0E321F336035803620371F39083E443F1040524720482049FF4AFF4BFF4D204EF05110580459045A045B045C9038
+:40060000B2E0B41FD808DB04DC09DF01009001C6032005260610072009010A140B420D200E100F40121013121548171218101A241B101C201D201E101F0820022204230148
-:400640005D095F01610862406340648066406740800F810183028503861087FC88208A018B048C208DFF8E0290039302942395809608970499049A409B209D049E2F9FF9AF
+:4006400029862B08300131103204335039043B1148054A0252015AAA6120628263206A406C097B037F0282018610C07FC27FC4FECA0FCC0FCE07D204D60FD80FDE188A02E6
-:40068000A023A104A20CA308A423A504A604A740A82FA904AB10AF02B060B3FFB460B61FB822BF04D804D904DB04DC09DF01012202200301040205040608070209880A04D5
+:40068000A602E604EE02A602B680E401EE020010022003020406063807040802090C0A040BF10C080D0C0F20100813081408150C17101808190C1B401C081F0221802204B3
-:4006C0000B800C080D800E48118012081305144015051610171019881C401D401E041F602118228023112410284129082A102D202E402F6030083240331234013680372A63
+:4006C000230C250327FC281A29012A202B022DFF2E01303F31FF3E013F01580459045B045F0181238280830C842286CC870188308A028B2F8CC88D0F9123924894C8952367
-:40070000381039423A083C063D803F1041104980510159025A0269806C016D806F0285018D409004914592C2930494429604979199249A089B3B9D40A009A180A22CA548B8
+:40070000970898D499239B049CC89F10A0C8A120A302A4C8A52FA802AB40AC80AE01B080B261B31FB41FB560B760B808B9A0BE11C046C620C808C9FFCAFFCBFFCD20CEF004
-:40074000A722AC02B704C0FFC2FFC47FCAFFCCFFCEFFD004D208E402E808EE1200FF01880403054606FC07B8080C09880A100C0C0EF10F0112081510160417A0180C198849
+:40074000D110D804D904DA04DB04DC99DD09DF01E108E240E340E480E640E7400010010803820490050909080A420B040E020F941002110A120415401721184019181C80B4
-:400780001A401C011D421E021F04218822022480259A260C2720280C29882A202E022F0431C132FF333F35C137C139A23E043F04580459045B045C905F01800282058521EF
+:40078000218C2314274029182A022D4A2F0830083361350436413720381039413A043D013F9440404A085010584059205F806C026D4082409080910192029410950896C023
-:4007C000870288028C0291279403950896049B389D049F01A118A340A706AC02AF01B006B107B310B401B560B708BE10BF40C006C5ECC803C9FFCAFFCBFFD004D601D8046C
+:4007C000971C99049A069B219D099F08A008A105A2C1A3E6A442A580A708B340B610C0FFC2FFC4DFCAF7CCFFCEFFD001D204D61CEE120008060209020D01100411041202D8
-:40080000D904DA04DB04DC99DD09DF01E2C00020010203020406056007100A200C010D800E040F1013801542172819131D042003218022D5240425102605278128102901DB
+:4008000018041F04220428012C063006310132013302340835043A023E143F055608580459045B045C995D905F0181028405881090019236930198019C319E0AAC05AD012B
-:400840002A802D202E402F603180321433023680372838043C043D803F11481049104B0264016701684869476A406C02728873068410860194419546978799209B2C9F827A
+:40084000B00CB102B210B420B501B603BE04BF11D608D804D904DB04DC09DD90DF0101080240051809200A400E820F08100811401280154019231A501C101D101E821F0E2C
-:40088000A228A448A598A601A722AB40B002B481C0FBC2F4C4F1CAFBCC7FCEF2D204E220E604EA4082108A018E048F029222960197109D209F20A214A302B080B104B6017C
+:4008800020402120220827882F02300232803601382039803F0158205A805F40600862406701680869806F0180408210844887408B018E4090209140941096409708982064
-:4008C000E220EA10EC808F209F20AF10B211B520E412EE021B011F083240330836843B408140C630CCF0CE10E62030803204358037083A023D408480914096809740A6046A
+:4008C00099089C409D239F88A002A280A304A608A708B020B410C06CC2DAC48BCA10CC89CE8CD61CD81CE001E622EE021B011F083140330836843B4083408540C630CCF07B
-:40090000AE80AF01CCF0CE60E210508057208580968897409D809E02A604AB08D460E210EA20832284808E02968097409E02A480A620A720AA24AE04E230E620EC80EE30D9
+:40090000CE10E220E61030803204364037043A083F80848088029740A340A604AE80AF01CCF0CE60E2105004570880049002960897409A049E089F04A002A120A644A80182
-:400940001501C4045D828740B101D605EE011B04850287108D8097809D82A480A880C608E4020B880C800F108A109798A480A740AB44AF04C20FE404262080018A01974061
+:40094000AA04B520D460E680EA80EE208E08900297409A049E08A002A120A640AA04AB0CAE04EA80EEB014407008C404DC0160808740A408B040D802EA011B0482209780E6
-:40098000A280A302A620AA40B680C820E620EE8052805302551070017E0190029202A110A280A302AF40B510D4E0DC80DE20EE40052008040E020F801F1053805610588014
+:400980009940B008B140B480C608E809EC040B880F4197899940A220AB05AF04C20F24088004900297409A04A002A120AE40C820E480EE4050015120560470027F018301EC
-:4009C00063028E208F809A109D20A740B120C001C20DC601D407D602E002E402EA04762084809A209C80AF10B004B301B601DE04E801EA08EE01010109010B010D011101C4
+:4009C00090029A04A002A120AF40D4E0DC80DE20E620EE40070208080D010E021F10520854085940622095029940A220AF40B101C001C20DC601D407D802EA04800887021E
-:400A00001B0100FF01AB020211050000BF0000A09F001F000000000000000000100000004000000000000000C0000000FF0000B847004700000100008000000282008200DC
+:400A00008E019B02A201A408AF10B008B608E208EA01EC02010109010D010F0111011D0100FF01AB02021105BF0000A09F001F0000000000000000001000000040000000B7
-:400A400000000000000707000700000027001801270018010004000000050000000000000000000000000000000000000000000000000000000000000000000000000000D8
+:400A400000000000C0000000FF0000B84700470000010000800000008000800000000000000707000700000027001801270018010004000000050000000000000000000052
 :400A80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000036
 :400AC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F6
 :400B000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B5
@@ -4615,12 +4615,12 @@
 :0200000490105A
 :04000000BC90ACAF55
 :0200000490303A
-:02000000FEBF41
+:0200000021B02D
 :0200000490402A
 :4000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C0
 :400040000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000080
 :400080000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000040
 :4000C0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000
 :0200000490501A
-:0C00000000012E16106900002E300F28A1
+:0C00000000012E16106900002E3032198D
 :00000001FF

FluxEngine.cydsn/FluxEngine.cydwr

@@ -816,7 +816,7 @@
     <Group key="v1">
       <Data key="cy_boot" value="cy_boot_v6_10" />
       <Data key="Em_EEPROM_Dynamic" value="Em_EEPROM_Dynamic_v2_20" />
-      <Data key="LIN_Dynamic" value="LIN_Dynamic_v5_0" />
+      <Data key="LIN_Dynamic" value="LIN_Dynamic_v6_0" />
     </Group>
   </Group>
   <Data key="DataVersionKey" value="2" />

FluxEngine.cydsn/Sampler/Sampler.v

@@ -23,36 +23,49 @@ module Sampler (
 
 reg [5:0] counter;
 
-reg index_q;
-reg rdata_q;
-
 reg index_edge;
 reg rdata_edge;
 
 reg req_toggle;
 
+reg rdata_toggle;
+reg old_rdata_toggle;
+
+reg index_toggle;
+reg old_index_toggle;
+
+always @(posedge rdata)
+begin
+    rdata_toggle <= ~rdata_toggle;
+end
+
+always @(posedge index)
+begin
+    index_toggle <= ~index_toggle;
+end
+
 always @(posedge sampleclock)
 begin
     if (reset)
     begin
+        old_rdata_toggle <= 0;
+        old_index_toggle <= 0;
+        
         index_edge <= 0;
         rdata_edge <= 0;
-        index_q <= 0;
-        rdata_q <= 0;
         counter <= 0;
         req_toggle <= 0;
     end
     else
     begin
-        /* Both index and rdata are active high -- positive-going edges
+        /* If data_toggle or index_toggle have changed state, this means that they've
-         * indicate the start of an index pulse and read pulse, respectively.
+         * gone high since the last sampleclock. */
-         */
          
-        index_edge <= index && !index_q;
+        index_edge <= index_toggle != old_index_toggle;
-        index_q <= index;
+        old_index_toggle <= index_toggle;
         
-        rdata_edge <= rdata && !rdata_q;
+        rdata_edge <= rdata_toggle != old_rdata_toggle;
-        rdata_q <= rdata;
+        old_rdata_toggle <= rdata_toggle;
         
         if (rdata_edge || index_edge || (counter == 6'h3f)) begin
             opcode <= { rdata_edge, index_edge, counter };

FluxEngine.cydsn/main.c

@@ -147,7 +147,7 @@ static void set_drive_flags(struct set_drive_frame* flags)
     
     current_drive_flags = *flags;
     DRIVESELECT_REG_Write(flags->drive ? 2 : 1); /* select drive 1 or 0 */
-    DENSITY_REG_Write(flags->high_density); /* density bit */
+    DENSITY_REG_Write(!flags->high_density); /* double density bit */
     INDEX_REG_Write(flags->index_mode);
 }
 
@@ -221,7 +221,7 @@ static int usb_read(int ep, uint8_t buffer[FRAME_SIZE])
 static void cmd_get_version(struct any_frame* f)
 {
     DECLARE_REPLY_FRAME(struct version_frame, F_FRAME_GET_VERSION_REPLY);
-    r.version = FLUXENGINE_VERSION;
+    r.version = FLUXENGINE_PROTOCOL_VERSION;
     send_reply((struct any_frame*) &r);
 }
 
@@ -905,7 +905,6 @@ int main(void)
     USBFS_Start(0, USBFS_DWR_VDDD_OPERATION);
     USBFS_DisableOutEP(FLUXENGINE_DATA_OUT_EP_NUM);
     
-    detect_drives();
     CyWdtStart(CYWDT_1024_TICKS, CYWDT_LPMODE_DISABLED);
     
     for (;;)
@@ -926,6 +925,8 @@ int main(void)
                 CyWdtClear();
             print("USB ready");
             USBFS_EnableOutEP(FLUXENGINE_CMD_OUT_EP_NUM);
+            print("Scanning drives...");
+            detect_drives();
         }
         
         if (USBFS_GetEPState(FLUXENGINE_CMD_OUT_EP_NUM) == USBFS_OUT_BUFFER_FULL)
@@ -937,3 +938,75 @@ int main(void)
         }
     }
 }
+
+const uint8_t USBFS_MSOS_CONFIGURATION_DESCR[USBFS_MSOS_CONF_DESCR_LENGTH] = {
+/*  Length of the descriptor 4 bytes       */   0x28u, 0x00u, 0x00u, 0x00u,
+/*  Version of the descriptor 2 bytes      */   0x00u, 0x01u,
+/*  wIndex - Fixed:INDEX_CONFIG_DESCRIPTOR */   0x04u, 0x00u,
+/*  bCount - Count of device functions.    */   0x01u,
+/*  Reserved : 7 bytes                     */   0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u,
+/*  bFirstInterfaceNumber                  */   0x00u,
+/*  Reserved                               */   0x01u,
+/*  compatibleId - "WINUSB\0\0"            */   'W', 'I', 'N', 'U', 'S', 'B', 0, 0,
+/*  subcompatibleID - "00001\0\0"          */   '0', '0', '0', '0', '1',
+                                                0x00u, 0x00u, 0x00u,
+/*  Reserved : 6 bytes                     */   0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u
+};
+
+const uint8_t USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[224] = {
+    /* Length; 4 bytes       */   224, 0, 0, 0,
+    /* Version; 2 bytes      */   0x00, 0x01, /* 1.0 */
+    /* wIndex                */   0x05, 0x00,
+    /* Number of sections    */   0x01, 0x00,
+    /* Property section size */   214, 0, 0, 0,
+    /* Property data type    */   0x07, 0x00, 0x00, 0x00, /* 7 = REG_MULTI_SZ Unicode */
+    /* Property name length  */   42, 0,
+    /* Property name         */   'D', 0, 'e', 0, 'v', 0, 'i', 0, 'c', 0, 'e', 0,
+                                  'I', 0, 'n', 0, 't', 0, 'e', 0, 'r', 0, 'f', 0,
+                                  'a', 0, 'c', 0, 'e', 0, 'G', 0, 'U', 0, 'I', 0,
+                                  'D', 0, 's', 0, 0,   0,
+    /* Property data length  */   158, 0, 0, 0,
+    /* GUID #1 data          */   '{', 0, '3', 0, 'd', 0, '2', 0, '7', 0, '5', 0,
+                                  'c', 0, 'f', 0, 'e', 0, '-', 0, '5', 0, '4', 0,
+                                  '3', 0, '5', 0, '-', 0, '4', 0, 'd', 0, 'd', 0,
+                                  '5', 0, '-', 0, 'a', 0, 'c', 0, 'c', 0, 'a', 0,
+                                  '-', 0, '9', 0, 'f', 0, 'b', 0, '9', 0, '9', 0,
+                                  '5', 0, 'e', 0, '2', 0, 'f', 0, '6', 0, '3', 0,
+                                  '8', 0, '}', 0, '\0', 0,
+    /* GUID #2 data          */   '{', 0, '3', 0, 'd', 0, '2', 0, '7', 0, '5', 0,
+                                  'c', 0, 'f', 0, 'e', 0, '-', 0, '5', 0, '4', 0,
+                                  '3', 0, '5', 0, '-', 0, '4', 0, 'd', 0, 'd', 0,
+                                  '5', 0, '-', 0, 'a', 0, 'c', 0, 'c', 0, 'a', 0,
+                                  '-', 0, '9', 0, 'f', 0, 'b', 0, '9', 0, '9', 0,
+                                  '5', 0, 'e', 0, '2', 0, 'f', 0, '6', 0, '3', 0,
+                                  '8', 0, '}', 0, '\0', 0, '\0', 0
+};
+
+uint8 USBFS_HandleVendorRqst(void)
+{
+    if (!(USBFS_bmRequestTypeReg & USBFS_RQST_DIR_D2H))
+        return false;
+
+    switch (USBFS_bRequestReg)
+    {
+        case USBFS_GET_EXTENDED_CONFIG_DESCRIPTOR:
+            switch (USBFS_wIndexLoReg)
+            {
+                case 4:
+                    USBFS_currentTD.pData = (volatile uint8 *) &USBFS_MSOS_CONFIGURATION_DESCR[0u];
+                    USBFS_currentTD.count = USBFS_MSOS_CONFIGURATION_DESCR[0u];
+                    return USBFS_InitControlRead();
+                    
+                case 5:
+                    USBFS_currentTD.pData = (volatile uint8 *) &USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[0u];
+                    USBFS_currentTD.count = USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[0u];
+                    return USBFS_InitControlRead();
+            }
+
+        default:
+            break;
+    }
+
+    return true;
+}
+

FluxEngine.cydsn/patcher.vbs

@@ -1,18 +0,0 @@
-const READ = 1
-const WRITE = 2
-
-filename = "Generated_Source\PSoC5\USBFS_descr.c"
-set fso = CreateObject("Scripting.FileSystemObject")
-
-set file = fso.OpenTextFile(filename, READ)
-text = file.ReadAll
-file.Close
-
-set r = New RegExp
-r.MultiLine = True
-r.Pattern = "/\* +compatibleID.*\n.*"
-text = r.replace(text, "'W', 'I', 'N', 'U', 'S', 'B', 0, 0,")
-
-set file = fso.CreateTextFile(filename, True)
-file.Write text
-file.Close

Makefile

@@ -1,66 +1,299 @@
-PACKAGES = zlib sqlite3 libusb-1.0 protobuf
+#Special Windows settings.
-
-export CFLAGS = -x c++ --std=gnu++2a -ffunction-sections -fdata-sections \
-	-Wno-deprecated-enum-enum-conversion \
-	-Wno-deprecated-enum-float-conversion
-export LDFLAGS = -pthread
-
-export COPTFLAGS = -Os
-export LDOPTFLAGS = -Os
-
-export CDBGFLAGS = -O0 -g
-export LDDBGFLAGS = -O0 -g
 
 ifeq ($(OS), Windows_NT)
-export PROTOC = /mingw32/bin/protoc
+	MINGWBIN = /mingw32/bin
-export CXX = /mingw32/bin/g++
+	CCPREFIX = $(MINGWBIN)/
-export AR = /mingw32/bin/ar rc
+	LUA = $(MINGWBIN)/lua
-export RANLIB = /mingw32/bin/ranlib
+	PKG_CONFIG = $(MINGWBIN)/pkg-config
-export STRIP = /mingw32/bin/strip
+	WX_CONFIG = /usr/bin/sh $(MINGWBIN)/wx-config --static=yes
-export CFLAGS += -I/mingw32/include/libusb-1.0 -I/mingw32/include
+	PROTOC = $(MINGWBIN)/protoc
-export LDFLAGS +=
+	PLATFORM = WINDOWS
-export LIBS += -L/mingw32/lib -static -lz -lsqlite3 -lusb-1.0 -lprotobuf
+	LDFLAGS += \
-export EXTENSION = .exe
+		-static
-else
+	CXXFLAGS += \
+		-std=c++17 \
+		-fext-numeric-literals \
+		-Wno-deprecated-enum-float-conversion \
+		-Wno-deprecated-enum-enum-conversion
 
-packages-exist = $(shell pkg-config --exists $(PACKAGES) && echo yes)
+#Required to get the gcc run - time libraries on the path.
-ifneq ($(packages-exist),yes)
+	export PATH := $(PATH):$(MINGWBIN)
-$(warning These pkg-config packages are installed: $(shell pkg-config --list-all | sort | awk '{print $$1}'))
+	EXT ?= .exe
-$(error You must have these pkg-config packages installed: $(PACKAGES))
 endif
 
-export PROTOC = protoc
+#Special OSX settings.
-export CXX = g++
-export AR = ar rc
-export RANLIB = ranlib
-export STRIP = strip
-export CFLAGS += $(shell pkg-config --cflags $(PACKAGES))
-export LDFLAGS +=
-export LIBS += $(shell pkg-config --libs $(PACKAGES))
-export EXTENSION =
 
 ifeq ($(shell uname),Darwin)
-AR = ar rcS
+	PLATFORM = OSX
-RANLIB += -c -no_warning_for_no_symbols
+	LDFLAGS += \
+		-framework IOKit \
+		-framework Foundation
 endif
 
+#Check the Make version.
+
+
+ifeq ($(findstring 4.,$(MAKE_VERSION)),)
+$(error You need GNU Make 4.x for this (if you're on OSX, use gmake).)
 endif
-export XXD = xxd
 
-CFLAGS += -Ilib -Idep/fmt -Iarch
+#Normal settings.
 
-export OBJDIR = .obj
+OBJDIR ?= .obj
+CCPREFIX ?=
+LUA ?= lua
+CC ?= $(CCPREFIX)gcc
+CXX ?= $(CCPREFIX)g++
+AR ?= $(CCPREFIX)ar
+PKG_CONFIG ?= pkg-config
+WX_CONFIG ?= wx-config
+PROTOC ?= protoc
+CFLAGS ?= -g -O3
+CXXFLAGS += -std=c++17
+LDFLAGS ?=
+PLATFORM ?= UNIX
+TESTS ?= yes
+EXT ?=
+DESTDIR ?=
+PREFIX ?= /usr/local
+BINDIR ?= $(PREFIX)/bin
 
-all: .obj/build.ninja
+CFLAGS += \
-	@ninja -f .obj/build.ninja -k 0
+	-Iarch \
-	@if command -v cscope > /dev/null; then cscope -bRq; fi
+	-Ilib \
+	-I. \
+	-I$(OBJDIR)/arch \
+	-I$(OBJDIR)/lib \
+	-I$(OBJDIR) \
+	-Wno-deprecated-declarations \
+
+LDFLAGS += \
+	-lz \
+	-lfmt
+
+.SUFFIXES:
+.DELETE_ON_ERROR:
+
+define nl
+
+endef
+
+empty :=
+space := $(empty) $(empty)
+
+use-library = $(eval $(use-library-impl))
+define use-library-impl
+$1: $(call $3_LIB)
+$1: private LDFLAGS += $(call $3_LDFLAGS)
+$2: private CFLAGS += $(call $3_CFLAGS)
+endef
+
+use-pkgconfig = $(eval $(use-pkgconfig-impl))
+define use-pkgconfig-impl
+ifneq ($(strip $(shell $(PKG_CONFIG) $3; echo $$?)),0)
+$$(error Missing required pkg-config dependency: $3)
+endif
+
+$(1): private LDFLAGS += $(shell $(PKG_CONFIG) --libs $(3))
+$(2): private CFLAGS += $(shell $(PKG_CONFIG) --cflags $(3))
+endef
+
+.PHONY: all binaries tests clean install install-bin
+all: binaries tests docs
+
+PROTOS = \
+	arch/aeslanier/aeslanier.proto \
+	arch/agat/agat.proto \
+	arch/amiga/amiga.proto \
+	arch/apple2/apple2.proto \
+	arch/brother/brother.proto \
+	arch/c64/c64.proto \
+	arch/f85/f85.proto \
+	arch/fb100/fb100.proto \
+	arch/ibm/ibm.proto \
+	arch/macintosh/macintosh.proto \
+	arch/micropolis/micropolis.proto \
+	arch/mx/mx.proto \
+	arch/northstar/northstar.proto \
+	arch/rolandd20/rolandd20.proto \
+	arch/smaky6/smaky6.proto \
+	arch/tids990/tids990.proto \
+	arch/victor9k/victor9k.proto \
+	arch/zilogmcz/zilogmcz.proto \
+	lib/common.proto \
+	lib/config.proto \
+	lib/decoders/decoders.proto \
+	lib/drive.proto \
+	lib/encoders/encoders.proto \
+	lib/fl2.proto \
+	lib/fluxsink/fluxsink.proto \
+	lib/fluxsource/fluxsource.proto \
+	lib/imagereader/imagereader.proto \
+	lib/imagewriter/imagewriter.proto \
+	lib/layout.proto \
+	lib/usb/usb.proto \
+	lib/vfs/vfs.proto \
+	tests/testproto.proto \
+
+PROTO_HDRS = $(patsubst %.proto, $(OBJDIR)/%.pb.h, $(PROTOS))
+PROTO_SRCS = $(patsubst %.proto, $(OBJDIR)/%.pb.cc, $(PROTOS))
+PROTO_OBJS = $(patsubst %.cc, %.o, $(PROTO_SRCS))
+PROTO_CFLAGS = $(shell $(PKG_CONFIG) --cflags protobuf)
+$(PROTO_SRCS): | $(PROTO_HDRS)
+$(PROTO_OBJS): CFLAGS += $(PROTO_CFLAGS)
+PROTO_LIB = $(OBJDIR)/libproto.a
+$(PROTO_LIB): $(PROTO_OBJS)
+PROTO_LDFLAGS = $(shell $(PKG_CONFIG) --libs protobuf) -pthread
+.PRECIOUS: $(PROTO_HDRS) $(PROTO_SRCS)
+
+include dep/agg/build.mk
+include dep/libusbp/build.mk
+include dep/stb/build.mk
+include dep/emu/build.mk
+include dep/fatfs/build.mk
+include dep/adflib/build.mk
+include dep/hfsutils/build.mk
+include scripts/build.mk
+
+include lib/build.mk
+include arch/build.mk
+include src/build.mk
+include src/gui/build.mk
+include tools/build.mk
+include tests/build.mk
+
+do-encodedecodetest = $(eval $(do-encodedecodetest-impl))
+define do-encodedecodetest-impl
+
+tests: $(OBJDIR)/$1$$(subst $$(space),_,$3).flux.encodedecode
+$(OBJDIR)/$1$$(subst $$(space),_,$3).flux.encodedecode: scripts/encodedecodetest.sh $(FLUXENGINE_BIN) $2
+	@mkdir -p $(dir $$@)
+	@echo ENCODEDECODETEST $1 flux $(FLUXENGINE_BIN) $2 $3
+	@scripts/encodedecodetest.sh $1 flux $(FLUXENGINE_BIN) $2 $3 > $$@
+
+tests: $(OBJDIR)/$1$$(subst $$(space),_,$3).scp.encodedecode
+$(OBJDIR)/$1$$(subst $$(space),_,$3).scp.encodedecode: scripts/encodedecodetest.sh $(FLUXENGINE_BIN) $2
+	@mkdir -p $(dir $$@)
+	@echo ENCODEDECODETEST $1 scp $(FLUXENGINE_BIN) $2 $3
+	@scripts/encodedecodetest.sh $1 scp $(FLUXENGINE_BIN) $2 $3 > $$@
+
+endef
+
+$(call do-encodedecodetest,agat,,--drive.tpi=96)
+$(call do-encodedecodetest,amiga,,--drive.tpi=135)
+$(call do-encodedecodetest,apple2,,--140 --drive.tpi=96)
+$(call do-encodedecodetest,atarist,,--360 --drive.tpi=135)
+$(call do-encodedecodetest,atarist,,--370 --drive.tpi=135)
+$(call do-encodedecodetest,atarist,,--400 --drive.tpi=135)
+$(call do-encodedecodetest,atarist,,--410 --drive.tpi=135)
+$(call do-encodedecodetest,atarist,,--720 --drive.tpi=135)
+$(call do-encodedecodetest,atarist,,--740 --drive.tpi=135)
+$(call do-encodedecodetest,atarist,,--800 --drive.tpi=135)
+$(call do-encodedecodetest,atarist,,--820 --drive.tpi=135)
+$(call do-encodedecodetest,bk)
+$(call do-encodedecodetest,brother,,--120 --drive.tpi=135)
+$(call do-encodedecodetest,brother,,--240 --drive.tpi=135)
+$(call do-encodedecodetest,commodore,scripts/commodore1541_test.textpb,--171 --drive.tpi=96)
+$(call do-encodedecodetest,commodore,scripts/commodore1541_test.textpb,--192 --drive.tpi=96)
+$(call do-encodedecodetest,commodore,,--800 --drive.tpi=135)
+$(call do-encodedecodetest,commodore,,--1620 --drive.tpi=135)
+$(call do-encodedecodetest,hplif,,--264 --drive.tpi=135)
+$(call do-encodedecodetest,hplif,,--616 --drive.tpi=135)
+$(call do-encodedecodetest,hplif,,--770 --drive.tpi=135)
+$(call do-encodedecodetest,ibm,,--1200 --drive.tpi=96)
+$(call do-encodedecodetest,ibm,,--1232 --drive.tpi=96)
+$(call do-encodedecodetest,ibm,,--1440 --drive.tpi=135)
+$(call do-encodedecodetest,ibm,,--1680 --drive.tpi=135)
+$(call do-encodedecodetest,ibm,,--180 --drive.tpi=96)
+$(call do-encodedecodetest,ibm,,--160 --drive.tpi=96)
+$(call do-encodedecodetest,ibm,,--320 --drive.tpi=96)
+$(call do-encodedecodetest,ibm,,--360 --drive.tpi=96)
+$(call do-encodedecodetest,ibm,,--720_96 --drive.tpi=96)
+$(call do-encodedecodetest,ibm,,--720_135 --drive.tpi=135)
+$(call do-encodedecodetest,mac,scripts/mac400_test.textpb,--400 --drive.tpi=135)
+$(call do-encodedecodetest,mac,scripts/mac800_test.textpb,--800 --drive.tpi=135)
+$(call do-encodedecodetest,n88basic,,--drive.tpi=96)
+$(call do-encodedecodetest,rx50,,--drive.tpi=96)
+$(call do-encodedecodetest,tids990,,--drive.tpi=48)
+$(call do-encodedecodetest,victor9k,,--612 --drive.tpi=96)
+$(call do-encodedecodetest,victor9k,,--1224 --drive.tpi=96)
+
+do-corpustest = $(eval $(do-corpustest-impl))
+define do-corpustest-impl
+
+tests: $(OBJDIR)/corpustest/$2
+$(OBJDIR)/corpustest/$2: $(FLUXENGINE_BIN) \
+		../fluxengine-testdata/data/$1 ../fluxengine-testdata/data/$2
+	@mkdir -p $(OBJDIR)/corpustest
+	@echo CORPUSTEST $1 $2 $3
+	@$(FLUXENGINE_BIN) read $3 -s ../fluxengine-testdata/data/$1 -o $$@ > $$@.log
+	@cmp $$@ ../fluxengine-testdata/data/$2
+
+endef
+
+ifneq ($(wildcard ../fluxengine-testdata/data),)
+
+$(call do-corpustest,amiga.flux,amiga.adf,amiga --drive.tpi=135)
+$(call do-corpustest,atarist360.flux,atarist360.st,atarist --360 --drive.tpi=135)
+$(call do-corpustest,atarist720.flux,atarist720.st,atarist --720 --drive.tpi=135)
+$(call do-corpustest,brother120.flux,brother120.img,brother --120 --drive.tpi=135)
+$(call do-corpustest,cmd-fd2000.flux,cmd-fd2000.img,commodore --1620 --drive.tpi=135)
+$(call do-corpustest,ibm1232.flux,ibm1232.img,ibm --1232 --drive.tpi=96)
+$(call do-corpustest,ibm1440.flux,ibm1440.img,ibm --1440 --drive.tpi=135)
+$(call do-corpustest,mac800.flux,mac800.dsk,mac --800 --drive.tpi=135)
+$(call do-corpustest,micropolis315.flux,micropolis315.img,micropolis --315 --drive.tpi=100)
+$(call do-corpustest,northstar87-synthetic.flux,northstar87-synthetic.nsi,northstar --87 --drive.tpi=48)
+$(call do-corpustest,northstar175-synthetic.flux,northstar175-synthetic.nsi,northstar --175 --drive.tpi=48)
+$(call do-corpustest,northstar350-synthetic.flux,northstar350-synthetic.nsi,northstar --350 --drive.tpi=48)
+$(call do-corpustest,victor9k_ss.flux,victor9k_ss.img,victor9k --612 --drive.tpi=96)
+$(call do-corpustest,victor9k_ds.flux,victor9k_ds.img,victor9k --1224 --drive.tpi=96)
+
+endif
+
+$(OBJDIR)/%.a:
+	@mkdir -p $(dir $@)
+	@echo AR $@
+	@$(AR) rc $@ $^
+
+%.exe:
+	@mkdir -p $(dir $@)
+	@echo LINK $@
+	@$(CXX) -o $@ $(filter %.o,$^) $(filter %.a,$^) $(LDFLAGS) $(filter %.a,$^) $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.cpp
+	@mkdir -p $(dir $@)
+	@echo CXX $<
+	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.o: %.cc
+	@mkdir -p $(dir $@)
+	@echo CXX $<
+	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.o: $(OBJDIR)/%.cc
+	@mkdir -p $(dir $@)
+	@echo CXX $<
+	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.o: %.c
+	@mkdir -p $(dir $@)
+	@echo CC $<
+	@$(CC) $(CFLAGS) $(CFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.pb.h: %.proto
+	@mkdir -p $(dir $@)
+	@echo PROTOC $@
+	@$(PROTOC) -I. --cpp_out=$(OBJDIR) $<
 
 clean:
-	@echo CLEAN
+	rm -rf $(OBJDIR)
-	@rm -rf $(OBJDIR)
 
-.obj/build.ninja: mkninja.sh Makefile
+install: install-bin # install-man install-docs ...
-	@echo MKNINJA $@
-	@mkdir -p $(OBJDIR)
-	@sh $< > $@
 
+install-bin: fluxengine$(EXT) fluxengine-gui$(EXT) brother120tool$(EXT) brother240tool$(EXT) upgrade-flux-file$(EXT)
+	install -d "$(DESTDIR)$(BINDIR)"
+	for target in $^; do \
+		install $$target "$(DESTDIR)$(BINDIR)/$$target"; \
+	done
+
+-include $(OBJS:%.o=%.d)

README.md

@@ -2,12 +2,17 @@ FluxEngine
 ==========
 
 (If you're reading this on GitHub, the formatting's a bit messed up. [Try the
-version on cowlark.com instead.](http://cowlark.com/fluxengine/)
+version on cowlark.com instead.](http://cowlark.com/fluxengine/))
 
-**Breaking news!** As of 2021-05-21, the command line environment has changed
+**Breaking news!** As of 2022-09-09, there's new [filesystem
-_substantially_ (to make it more consistent and flexible, and allow some new
+support](doc/filesystem.md). Read (and sometimes write) files directly from
-backend features like multi-format IBM scheme disks, which are popular with
+(and to) your disks, with eight different file systems! It works in the GUI,
-CP/M). If things don't work the way you expect, please check the documentation.
+too, which is available for Linux (and other Unix clones), Windows and OSX. See
+the details below.
+
+<div style="text-align: center">
+<a href="doc/screenshot.jpg"><img src="doc/screenshot.jpg" style="width:60%" alt="screenshot of the GUI in action"></a>
+</div>
 
 What?
 -----
@@ -30,18 +35,13 @@ Don't believe me? Watch the demo reel!
 </div>
 
 **New!** The FluxEngine client software now works with
-[GreaseWeazle](https://github.com/keirf/Greaseweazle/wiki) hardware. So, if you
+[Greaseweazle](https://github.com/keirf/Greaseweazle/wiki) hardware. So, if you
 can't find a PSoC5 development kit, or don't want to use the Cypress Windows
 tools for programming it, you can use one of these instead. Very nearly all
-FluxEngine features are available with the GreaseWeazle and it works out-of-the
+FluxEngine features are available with the Greaseweazle and it works out-of-the
-box. See the [dedicated GreaseWeazle documentation page](doc/greaseweazle.md)
+box. See the [dedicated Greaseweazle documentation page](doc/greaseweazle.md)
 for more information.
 
-**Important note.** On 2020-04-02 I changed the bytecode format (and firmware).
-Flux files will need to be upgraded with `fluxengine upgradefluxfile`. The new
-format should be more reliable and use way, way less bandwidth. Sorry for the
-inconvenience.
-
 Where?
 ------
 
@@ -65,71 +65,83 @@ following friendly articles:
   - [Using a FluxEngine](doc/using.md) ∾ what to do with your new hardware ∾
     flux files and image files ∾ knowing what you're doing
 
-  - [Using GreaseWeazle hardware with the FluxEngine client
+  - [Using Greaseweazle hardware with the FluxEngine client
-	software](doc/greaseweazle.md) ∾ what works ∾ what doesn't work ∾ where to
+    software](doc/greaseweazle.md) ∾ what works ∾ what doesn't work ∾ where to
-	go for help
+    go for help
 
+  - [Configuring for your drive](doc/drives.md) ∾ but I don't have a 80 track
+    drive! ∾ reading and writing 40 track disks ∾ Shugart and Apple II
+
+  - [Direct filesystem access](doc/filesystem.md) ∾ imaging files is a pain
+    ∾ accessing files directly ∾ features and limitation ∾ it works on disk
+    images too, you say?
+    
   - [Troubleshooting dubious disks](doc/problems.md) ∾ it's not an exact
-	science ∾ the sector map ∾ clock detection and the histogram
+    science ∾ the sector map ∾ clock detection and the histogram
 
-  - [Checking your drive](doc/driveresponse.md) ∾ you can't do that with that ∾
+  - [Disk densities](doc/driveresponse.md) ∾ what's the difference between an HD
-	measuring your drive's ability to work with exotic formats
+    and DD disk? ∾ you can't do that with that ∾ measuring your drive's ability to
+    work with exotic formats ∾ I think my drive is broken
 
 Which?
 ------
 
 The current support state is as follows.
 
-Dinosaurs (🦖) have yet to be observed in real life --- I've written the
+Dinosaurs (🦖) have yet to be observed in real life --- I've written the encoder
-decoder based on Kryoflux (or other) dumps I've found. I don't (yet) have
+and/or decoder based on Kryoflux (or other) dumps I've found. I don't (yet) have
-real, physical disks in my hand to test the capture process.
+real, physical disks in my hand to test the capture process, or hardware to
+verify that written disks work.
 
-Unicorns (🦄) are completely real --- this means that I've read actual,
+Unicorns (🦄) are completely real --- this means that I've read actual, physical
-physical disks with these formats and so know they work (or had reports from
+disks with these formats and/or written real, physical disks and then used them
-people who've had it work).
+on real hardware, and so know they work (or had reports from people who've had
+it work).
 
-### Old disk formats
+If a filesystem is listed, this means that FluxEngine natively supports that
+particular filesystem and can read (and sometimes write, support varies) files
+directly from disks, flux files or disk images. Some formats have multiple
+choices because they can store multiple types of file system.
 
-| Format                                    | Read? | Write? | Notes |
+<!-- FORMATSSTART -->
-|:------------------------------------------|:-----:|:------:|-------|
+<!-- This section is automatically generated. Do not edit. -->
-| [IBM PC compatible](doc/disk-ibm.md)      |  🦄   |   🦄   | and compatibles (like the Atari ST) |
+
-| [Acorn ADFS](doc/disk-acornadfs.md)       |  🦄   |   🦖*  | single- and double- sided           |
+| Profile | Format | Read? | Write? | Filesystem? |
-| [Acorn DFS](doc/disk-acorndfs.md)         |  🦄   |   🦖*  |                                     |
+|:--------|:-------|:-----:|:------:|:------------|
-| [Ampro Little Board](doc/disk-ampro.md)   |  🦖   |   🦖*  |                                     |
+| [`acornadfs`](doc/disk-acornadfs.md) | Acorn ADFS: BBC Micro, Archimedes | 🦖 |  |  |
-| [Apple II DOS 3.3](doc/disk-apple2.md)    |  🦄   |        | doesn't do logical sector remapping |
+| [`acorndfs`](doc/disk-acorndfs.md) | Acorn DFS: Acorn Atom, BBC Micro series | 🦄 |  | ACORNDFS  |
-| [Amiga](doc/disk-amiga.md)                |  🦄   |   🦄   |                                     |
+| [`aeslanier`](doc/disk-aeslanier.md) | AES Lanier "No Problem": 616kB 5.25" 77-track SSDD hard sectored | 🦖 |  |  |
-| [Commodore 64 1541/1581](doc/disk-c64.md) |  🦄   |   🦄   | and probably the other formats      |
+| [`agat`](doc/disk-agat.md) | Agat: 840kB 5.25" 80-track DS | 🦖 | 🦖 |  |
-| [Brother 120kB](doc/disk-brother.md)      |  🦄   |   🦖   |                                     |
+| [`amiga`](doc/disk-amiga.md) | Amiga: 880kB 3.5" DSDD | 🦄 | 🦄 | AMIGAFFS  |
-| [Brother 240kB](doc/disk-brother.md)      |  🦄   |   🦄   |                                     |
+| [`ampro`](doc/disk-ampro.md) | Ampro Little Board: CP/M | 🦖 |  | CPMFS  |
-| [Brother FB-100](doc/disk-fb100.md)       |  🦖   |        | Tandy Model 100, Husky Hunter, knitting machines |
+| [`apple2`](doc/disk-apple2.md) | Apple II: Prodos, Appledos, and CP/M | 🦄 | 🦄 | APPLEDOS CPMFS PRODOS  |
-| [Macintosh 800kB](doc/disk-macintosh.md)  |  🦄   |   🦄   | and probably the 400kB too          |
+| [`atarist`](doc/disk-atarist.md) | Atari ST: Almost PC compatible | 🦄 | 🦄 |  |
-| [TRS-80](doc/disk-trs80.md)               |  🦖   |   🦖*  | a minor variation of the IBM scheme |
+| [`bk`](doc/disk-bk.md) | BK: 800kB 5.25"/3.5" 80-track 10-sector DSDD | 🦖 | 🦖 |  |
+| [`brother`](doc/disk-brother.md) | Brother word processors: GCR family | 🦄 | 🦄 | BROTHER120 FATFS  |
+| [`commodore`](doc/disk-commodore.md) | Commodore: 1541, 1581, 8050 and variations | 🦄 | 🦄 | CBMFS  |
+| [`eco1`](doc/disk-eco1.md) | VDS Eco1: CP/M; 1210kB 77-track mixed format DSHD | 🦖 |  | CPMFS  |
+| [`epsonpf10`](doc/disk-epsonpf10.md) | Epson PF-10: CP/M; 3.5" 40-track DSDD | 🦖 |  | CPMFS  |
+| [`f85`](doc/disk-f85.md) | Durango F85: 461kB 5.25" 77-track SS | 🦖 |  |  |
+| [`fb100`](doc/disk-fb100.md) | Brother FB-100: 100kB 3.5" 40-track SSSD | 🦖 |  |  |
+| [`hplif`](doc/disk-hplif.md) | Hewlett-Packard LIF: a variety of disk formats used by HP | 🦄 | 🦄 | LIF  |
+| [`ibm`](doc/disk-ibm.md) | IBM PC: Generic PC 3.5"/5.25" disks | 🦄 | 🦄 | FATFS  |
+| [`icl30`](doc/disk-icl30.md) | ICL Model 30: CP/M; 263kB 35-track DSSD | 🦖 |  | CPMFS  |
+| [`mac`](doc/disk-mac.md) | Macintosh: 400kB/800kB 3.5" GCR | 🦄 | 🦄 | MACHFS  |
+| [`micropolis`](doc/disk-micropolis.md) | Micropolis: 100tpi MetaFloppy disks | 🦄 | 🦄 |  |
+| [`mx`](doc/disk-mx.md) | DVK MX: Soviet-era PDP-11 clone | 🦖 |  |  |
+| [`n88basic`](doc/disk-n88basic.md) | N88-BASIC: PC8800/PC98 5.25" 77-track 26-sector DSHD | 🦄 | 🦄 |  |
+| [`northstar`](doc/disk-northstar.md) | Northstar: 5.25" hard sectored | 🦄 | 🦄 |  |
+| [`psos`](doc/disk-psos.md) | pSOS: 800kB DSDD with PHILE | 🦄 | 🦄 | PHILE  |
+| [`rolandd20`](doc/disk-rolandd20.md) | Roland D20: 3.5" electronic synthesiser disks | 🦖 |  |  |
+| [`rx50`](doc/disk-rx50.md) | Digital RX50: 400kB 5.25" 80-track 10-sector SSDD | 🦖 | 🦖 |  |
+| [`smaky6`](doc/disk-smaky6.md) | Smaky 6: 308kB 5.25" 77-track 16-sector SSDD, hard sectored | 🦖 |  | SMAKY6  |
+| [`tids990`](doc/disk-tids990.md) | Texas Instruments DS990: 1126kB 8" DSSD | 🦖 | 🦖 |  |
+| [`tiki`](doc/disk-tiki.md) | Tiki 100: CP/M |  |  | CPMFS  |
+| [`victor9k`](doc/disk-victor9k.md) | Victor 9000 / Sirius One: 1224kB 5.25" DSDD GCR | 🦖 | 🦖 |  |
+| [`zilogmcz`](doc/disk-zilogmcz.md) | Zilog MCZ: 320kB 8" 77-track SSSD hard-sectored | 🦖 |  | ZDOS  |
 {: .datatable }
 
-`*`: these formats are variations of the generic IBM format, and since the
+<!-- FORMATSEND -->
-IBM writer is completely generic, it should be configurable for these
-formats... theoretically. I don't have the hardware to try it.
-
-### Even older disk formats
-
-These formats are for particularly old, weird architectures, even by the
-standards of floppy disks. They've largely been implemented from single flux
-files with no access to physical hardware. Typically the reads were pretty
-bad and I've had to make a number of guesses as to how things work. They do,
-at least, check the CRC so what data's there is probably good.
-
-| Format                                   | Read? | Write? | Notes |
-|:-----------------------------------------|:-----:|:------:|-------|
-| [AES Superplus / No Problem](doc/disk-aeslanier.md) |  🦖   | | hard sectors! |
-| [Durango F85](doc/disk-durangof85.md)    |  🦖   |        | 5.25" |
-| [DVK MX](doc/disk-mx.md)                 |  🦖   |        | Soviet PDP-11 clone |
-| [VDS Eco1](doc/disk-eco1.md)             |  🦖   |        | 8" mixed format |
-| [Micropolis](doc/disk-micropolis.md)     |  🦄   |        | Micropolis 100tpi drives |
-| [Northstar(doc/disk-northstar.md)        |  🦖   |   🦖   | 5.25" hard sectors |
-| [TI DS990 FD1000](doc/disk-tids990.md)   |  🦄   |  🦄    | 8" |
-| [Victor 9000](doc/disk-victor9k.md)      |  🦖   |        | 8" |
-| [Zilog MCZ](doc/disk-zilogmcz.md)        |  🦖   |        | 8" _and_ hard sectors |
-{: .datatable }
 
 ### Notes
 
@@ -146,7 +158,7 @@ at least, check the CRC so what data's there is probably good.
     There hasn't been a lot of demand for this yet; if you have a pressing
     need to write weird disks, [please
     ask](https://github.com/davidgiven/fluxengine/issues/new). I haven't
-    implement write support for PC disks because they're boring and I'm lazy,
+    implemented write support for PC disks because they're boring and I'm lazy,
     and also because they vary so much that figuring out how to specify them
     is hard.
 
@@ -200,17 +212,12 @@ There may or may not be anything interesting there.
 License
 -------
 
-Everything here _except the contents of the `dep` directory_ is © 2019 David
+Everything here _except the contents of the `dep` directory_ is © 2022 The
-Given and is licensed under the MIT open source license. Please see
+FluxEngine Authors (mostly me, David Given; see the VCS history for the other
+people) and is licensed under the MIT open source license. Please see
 [COPYING](COPYING) for the full text. The tl;dr is: you can do what you like
 with it provided you don't claim you wrote it.
 
-As an exception, `dep/fmt` contains a copy of [fmt](http://fmtlib.net),
-maintained by Victor Zverovich (`vitaut <https://github.com/vitaut>`) and
-Jonathan Müller (`foonathan <https://github.com/foonathan>`) with
-contributions from many other people. It is licensed under the terms of the
-BSD license. Please see the contents of the directory for the full text.
-
 As an exception, `dep/emu` contains parts of the OpenBSD C library
 code, maintained by Todd Miller and William A. Rowe (and probably others). It is licensed
 under the terms of the 3-clause BSD license. Please see the contents of the
@@ -228,5 +235,28 @@ text.
 
 As an exception, `dep/snowhouse` contains the snowhouse assertion library,
 taken from https://github.com/banditcpp/snowhouse. It is Boost Standard License
-1.0 licensed. Please see the contents of the directory for the full text.
+1.0 licensed. Please see the contents of the directory for the full text. Note
+that this is only used during the build and no code ends up in the output
+binaries.
 
+As an exception, `dep/libusbp` contains the libusbp library, taken from
+https://github.com/pololu/libusbp. It is MIT licensed. Please see the contents
+of the directory for the full text.
+
+As an exception, `dep/fatfs` contains the fatfs library, taken from
+http://elm-chan.org/fsw/ff/00index_e.html. It is single-clause BSD licensed.
+Please see the contents of the directory for the full text.
+
+As an exception, `dep/adflib` contains the adflib library, written by Laurent
+Clevy et al, taken from https://github.com/lclevy/ADFlib. It is GPL 2.0
+licensed. Please see the contents of the directory for the full text.
+
+As an exception, `dep/hfsutils` contains a partial copy of the hfsutils
+package, written by Robert Leslie et al, taken from
+https://www.mars.org/home/rob/proj/hfs. It is GPL 2.0 licensed. Please see the
+contents of the directory for the full text.
+
+__Important:__ Because of all these exceptions, if you distribute the
+FluxEngine package as a whole, you must comply with the terms of _all_ of the
+licensing terms. This means that __effectively the FluxEngine package is
+distributable under the terms of the GPL 2.0__.

arch/aeslanier/aeslanier.h

@@ -2,9 +2,10 @@
 #define AESLANIER_H
 
 #define AESLANIER_RECORD_SEPARATOR 0x55555122
-#define AESLANIER_SECTOR_LENGTH    256
+#define AESLANIER_SECTOR_LENGTH 256
-#define AESLANIER_RECORD_SIZE      (AESLANIER_SECTOR_LENGTH + 5)
+#define AESLANIER_RECORD_SIZE (AESLANIER_SECTOR_LENGTH + 5)
 
-extern std::unique_ptr<AbstractDecoder> createAesLanierDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createAesLanierDecoder(
+    const DecoderProto& config);
 
 #endif

arch/aeslanier/decoder.cc

@@ -11,69 +11,54 @@
 
 static const FluxPattern SECTOR_PATTERN(32, AESLANIER_RECORD_SEPARATOR);
 
-/* This is actually M2FM, rather than MFM, but it our MFM/FM decoder copes fine with it. */
+/* This is actually M2FM, rather than MFM, but it our MFM/FM decoder copes fine
+ * with it. */
 
-static Bytes reverse_bits(const Bytes& input)
+class AesLanierDecoder : public Decoder
-{
-    Bytes output;
-    ByteWriter bw(output);
-
-    for (uint8_t b : input)
-        bw.write_8(reverse_bits(b));
-    return output;
-}
-
-class AesLanierDecoder : public AbstractDecoder
 {
 public:
-	AesLanierDecoder(const DecoderProto& config):
+    AesLanierDecoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		_sector->clock = _fmr->seekToPattern(SECTOR_PATTERN);
+        return seekToPattern(SECTOR_PATTERN);
-		if (_fmr->eof() || !_sector->clock)
+    }
-			return UNKNOWN_RECORD;
-		return SECTOR_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		/* Skip ID mark. */
+        /* Skip ID mark (we know it's a AESLANIER_RECORD_SEPARATOR). */
 
-		readRawBits(16);
+        readRawBits(16);
 
-		const auto& rawbits = readRawBits(AESLANIER_RECORD_SIZE*16);
+        const auto& rawbits = readRawBits(AESLANIER_RECORD_SIZE * 16);
-		const auto& bytes = decodeFmMfm(rawbits).slice(0, AESLANIER_RECORD_SIZE);
+        const auto& bytes =
-		const auto& reversed = reverse_bits(bytes);
+            decodeFmMfm(rawbits).slice(0, AESLANIER_RECORD_SIZE);
+        const auto& reversed = bytes.reverseBits();
 
-		_sector->logicalTrack = reversed[1];
+        _sector->logicalTrack = reversed[1];
-		_sector->logicalSide = 0;
+        _sector->logicalSide = 0;
-		_sector->logicalSector = reversed[2];
+        _sector->logicalSector = reversed[2];
 
-		/* Check header 'checksum' (which seems far too simple to mean much). */
+        /* Check header 'checksum' (which seems far too simple to mean much). */
 
-		{
+        {
-			uint8_t wanted = reversed[3];
+            uint8_t wanted = reversed[3];
-			uint8_t got = reversed[1] + reversed[2];
+            uint8_t got = reversed[1] + reversed[2];
-			if (wanted != got)
+            if (wanted != got)
-				return;
+                return;
-		}
+        }
 
-		/* Check data checksum, which also includes the header and is
+        /* Check data checksum, which also includes the header and is
-			* significantly better. */
+         * significantly better. */
 
-		_sector->data = reversed.slice(1, AESLANIER_SECTOR_LENGTH);
+        _sector->data = reversed.slice(1, AESLANIER_SECTOR_LENGTH);
-		uint16_t wanted = reversed.reader().seek(0x101).read_le16();
+        uint16_t wanted = reversed.reader().seek(0x101).read_le16();
-		uint16_t got = crc16ref(MODBUS_POLY_REF, _sector->data);
+        uint16_t got = crc16ref(MODBUS_POLY_REF, _sector->data);
-		_sector->status = (wanted == got) ? Sector::OK : Sector::BAD_CHECKSUM;
+        _sector->status = (wanted == got) ? Sector::OK : Sector::BAD_CHECKSUM;
-	}
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createAesLanierDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createAesLanierDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new AesLanierDecoder(config));
+    return std::unique_ptr<Decoder>(new AesLanierDecoder(config));
 }
-
-

arch/agat/agat.cc

@@ -0,0 +1,20 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "agat.h"
+#include "bytes.h"
+#include "fmt/format.h"
+
+uint8_t agatChecksum(const Bytes& bytes)
+{
+    uint16_t checksum = 0;
+
+    for (uint8_t b : bytes)
+    {
+        if (checksum > 0xff)
+            checksum = (checksum + 1) & 0xff;
+
+        checksum += b;
+    }
+
+    return checksum & 0xff;
+}

arch/agat/agat.h

@@ -0,0 +1,19 @@
+#ifndef AGAT_H
+#define AGAT_H
+
+#define AGAT_SECTOR_SIZE 256
+
+static constexpr uint64_t SECTOR_ID = 0x8924555549111444;
+static constexpr uint64_t DATA_ID = 0x8924555514444911;
+
+class Encoder;
+class EncoderProto;
+class Decoder;
+class DecoderProto;
+
+extern std::unique_ptr<Decoder> createAgatDecoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createAgatEncoder(const EncoderProto& config);
+
+extern uint8_t agatChecksum(const Bytes& bytes);
+
+#endif

arch/agat/agat.proto

@@ -0,0 +1,19 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message AgatDecoderProto {}
+
+message AgatEncoderProto {
+	optional double target_clock_period_us = 1
+		[default=2.00, (help)="Data clock period of target format."];
+	optional double target_rotational_period_ms = 2
+		[default=200.0, (help)="Rotational period of target format."];
+	optional int32 post_index_gap_bytes = 3
+		[default=40, (help)="Post-index gap before first sector header."];
+	optional int32 pre_sector_gap_bytes = 4
+		[default=11, (help)="Gap before each sector header."];
+	optional int32 pre_data_gap_bytes = 5
+		[default=2, (help)="Gap before each sector data record."];
+}
+

arch/agat/decoder.cc

@@ -0,0 +1,89 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "agat.h"
+#include "crc.h"
+#include "fluxmap.h"
+#include "decoders/fluxmapreader.h"
+#include "sector.h"
+#include "bytes.h"
+#include "fmt/format.h"
+#include <string.h>
+
+// clang-format off
+/*
+ * data:    X  X  X  X   X  X  X  X   X  -  -  X   -  X  -  X   -  X  X  -   X  -  X  -  = 0xff956a
+ * flux:   01 01 01 01  01 01 01 01  01 00 10 01  00 01 00 01  00 01 01 00  01 00 01 00  = 0x555549111444
+ * 
+ * data:    X  X  X  X   X  X  X  X   -  X  X  -   X  -  X  -   X  -  -  X   -  X  -  X  = 0xff6a95
+ * flux:   01 01 01 01  01 01 01 01  00 01 01 00  01 00 01 00  01 00 10 01  00 01 00 01  = 0x555514444911
+ *
+ * Each pattern is prefixed with this one:
+ *
+ * data:          -  -   -  X   -  -   X  - = 0x12
+ * flux:    (10) 10 10  10 01  00 10  01 00 = 0xa924
+ * magic:   (10) 10 00  10 01  00 10  01 00 = 0x8924
+ *                  ^
+ *
+ * This seems to be generated by emitting A4 in MFM and then a single 0 bit to
+ * shift it out of phase, so the data bits become clock bits and vice versa.
+ *
+ *           X - X - - X - -  = 0xA4
+ *          0100010010010010  = MFM encoded
+ *           1000100100100100 = with trailing zero
+ *            - - - X - - X - = effective bitstream = 0x12
+ */
+// clang-format on
+
+static const FluxPattern SECTOR_PATTERN(64, SECTOR_ID);
+static const FluxPattern DATA_PATTERN(64, DATA_ID);
+
+static const FluxMatchers ALL_PATTERNS = {&SECTOR_PATTERN, &DATA_PATTERN};
+
+class AgatDecoder : public Decoder
+{
+public:
+    AgatDecoder(const DecoderProto& config): Decoder(config) {}
+
+    nanoseconds_t advanceToNextRecord() override
+    {
+        return seekToPattern(ALL_PATTERNS);
+    }
+
+    void decodeSectorRecord() override
+    {
+        if (readRaw64() != SECTOR_ID)
+            return;
+
+        auto bytes = decodeFmMfm(readRawBits(64)).slice(0, 4);
+        if (bytes[3] != 0x5a)
+            return;
+
+        _sector->logicalTrack = bytes[1] >> 1;
+        _sector->logicalSector = bytes[2];
+        _sector->logicalSide = bytes[1] & 1;
+        _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+    }
+
+    void decodeDataRecord() override
+    {
+        if (readRaw64() != DATA_ID)
+            return;
+
+        Bytes bytes = decodeFmMfm(readRawBits((AGAT_SECTOR_SIZE + 2) * 16))
+                          .slice(0, AGAT_SECTOR_SIZE + 2);
+
+        if (bytes[AGAT_SECTOR_SIZE + 1] != 0x5a)
+            return;
+
+        _sector->data = bytes.slice(0, AGAT_SECTOR_SIZE);
+        uint8_t wantChecksum = bytes[AGAT_SECTOR_SIZE];
+        uint8_t gotChecksum = agatChecksum(_sector->data);
+        _sector->status =
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
+};
+
+std::unique_ptr<Decoder> createAgatDecoder(const DecoderProto& config)
+{
+    return std::unique_ptr<Decoder>(new AgatDecoder(config));
+}

arch/agat/encoder.cc

@@ -0,0 +1,118 @@
+#include "lib/globals.h"
+#include "lib/decoders/decoders.h"
+#include "lib/encoders/encoders.h"
+#include "agat.h"
+#include "lib/crc.h"
+#include "lib/readerwriter.h"
+#include "lib/image.h"
+#include "lib/layout.h"
+#include "arch/agat/agat.pb.h"
+#include "lib/encoders/encoders.pb.h"
+
+class AgatEncoder : public Encoder
+{
+public:
+    AgatEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.agat())
+    {
+    }
+
+private:
+    void writeRawBits(uint64_t data, int width)
+    {
+        _cursor += width;
+        _lastBit = data & 1;
+        for (int i = 0; i < width; i++)
+        {
+            unsigned pos = _cursor - i - 1;
+            if (pos < _bits.size())
+                _bits[pos] = data & 1;
+            data >>= 1;
+        }
+    }
+
+    void writeBytes(const Bytes& bytes)
+    {
+        encodeMfm(_bits, _cursor, bytes, _lastBit);
+    }
+
+    void writeByte(uint8_t byte)
+    {
+        Bytes b;
+        b.writer().write_8(byte);
+        writeBytes(b);
+    }
+
+    void writeFillerRawBytes(int count, uint16_t byte)
+    {
+        for (int i = 0; i < count; i++)
+            writeRawBits(byte, 16);
+    };
+
+    void writeFillerBytes(int count, uint8_t byte)
+    {
+        Bytes b{byte};
+        for (int i = 0; i < count; i++)
+            writeBytes(b);
+    };
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        auto trackLayout = Layout::getLayoutOfTrack(
+            trackInfo->logicalTrack, trackInfo->logicalSide);
+
+        double clockRateUs = _config.target_clock_period_us() / 2.0;
+        int bitsPerRevolution =
+            (_config.target_rotational_period_ms() * 1000.0) / clockRateUs;
+        _bits.resize(bitsPerRevolution);
+        _cursor = 0;
+
+        writeFillerRawBytes(_config.post_index_gap_bytes(), 0xaaaa);
+
+        for (const auto& sector : sectors)
+        {
+            /* Header */
+
+            writeFillerRawBytes(_config.pre_sector_gap_bytes(), 0xaaaa);
+            writeRawBits(SECTOR_ID, 64);
+            writeByte(0x5a);
+            writeByte((sector->logicalTrack << 1) | sector->logicalSide);
+            writeByte(sector->logicalSector);
+            writeByte(0x5a);
+
+            /* Data */
+
+            writeFillerRawBytes(_config.pre_data_gap_bytes(), 0xaaaa);
+            auto data = sector->data.slice(0, AGAT_SECTOR_SIZE);
+            writeRawBits(DATA_ID, 64);
+            writeBytes(data);
+            writeByte(agatChecksum(data));
+            writeByte(0x5a);
+        }
+
+        if (_cursor >= _bits.size())
+            error("track data overrun");
+        fillBitmapTo(_bits, _cursor, _bits.size(), {true, false});
+
+        auto fluxmap = std::make_unique<Fluxmap>();
+        fluxmap->appendBits(_bits,
+            calculatePhysicalClockPeriod(_config.target_clock_period_us() * 1e3,
+                _config.target_rotational_period_ms() * 1e6));
+        return fluxmap;
+    }
+
+private:
+    const AgatEncoderProto& _config;
+    uint32_t _cursor;
+    bool _lastBit;
+    std::vector<bool> _bits;
+};
+
+std::unique_ptr<Encoder> createAgatEncoder(const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new AgatEncoder(config));
+}

arch/amiga/amiga.cc

@@ -18,61 +18,61 @@ uint32_t amigaChecksum(const Bytes& bytes)
 
 static uint8_t everyother(uint16_t x)
 {
-	                  /* aabb ccdd eeff gghh */
+    /* aabb ccdd eeff gghh */
-	x &= 0x6666;      /* 0ab0 0cd0 0ef0 0gh0 */
+    x &= 0x6666; /* 0ab0 0cd0 0ef0 0gh0 */
-	x >>= 1;          /* 00ab 00cd 00ef 00gh */
+    x >>= 1;     /* 00ab 00cd 00ef 00gh */
-	x |= x << 2;      /* abab cdcd efef ghgh */
+    x |= x << 2; /* abab cdcd efef ghgh */
-	x &= 0x3c3c;      /* 00ab cd00 00ef gh00 */
+    x &= 0x3c3c; /* 00ab cd00 00ef gh00 */
-	x >>= 2;          /* 0000 abcd 0000 efgh */
+    x >>= 2;     /* 0000 abcd 0000 efgh */
-	x |= x >> 4;      /* 0000 abcd abcd efgh */
+    x |= x >> 4; /* 0000 abcd abcd efgh */
-	return x;
+    return x;
 }
 
 Bytes amigaInterleave(const Bytes& input)
 {
-	Bytes output;
+    Bytes output;
-	ByteWriter bw(output);
+    ByteWriter bw(output);
 
-	/* Write all odd bits. (Numbering starts at 0...) */
+    /* Write all odd bits. (Numbering starts at 0...) */
 
-	{
+    {
-		ByteReader br(input);
+        ByteReader br(input);
-		while (!br.eof())
+        while (!br.eof())
-		{
+        {
-			uint16_t x = br.read_be16();
+            uint16_t x = br.read_be16();
-			x &= 0xaaaa;       /* a0b0 c0d0 e0f0 g0h0 */
+            x &= 0xaaaa;       /* a0b0 c0d0 e0f0 g0h0 */
-			x |= x >> 1;       /* aabb ccdd eeff gghh */
+            x |= x >> 1;       /* aabb ccdd eeff gghh */
-			x = everyother(x); /* 0000 0000 abcd efgh */
+            x = everyother(x); /* 0000 0000 abcd efgh */
-			bw.write_8(x);
+            bw.write_8(x);
-		}
+        }
-	}
+    }
 
-	/* Write all even bits. */
+    /* Write all even bits. */
 
-	{
+    {
-		ByteReader br(input);
+        ByteReader br(input);
-		while (!br.eof())
+        while (!br.eof())
-		{
+        {
-			uint16_t x = br.read_be16();
+            uint16_t x = br.read_be16();
-			x &= 0x5555;       /* 0a0b 0c0d 0e0f 0g0h */
+            x &= 0x5555;       /* 0a0b 0c0d 0e0f 0g0h */
-			x |= x << 1;       /* aabb ccdd eeff gghh */
+            x |= x << 1;       /* aabb ccdd eeff gghh */
-			x = everyother(x); /* 0000 0000 abcd efgh */
+            x = everyother(x); /* 0000 0000 abcd efgh */
-			bw.write_8(x);
+            bw.write_8(x);
-		}
+        }
-	}
+    }
 
-	return output;
+    return output;
 }
 
 Bytes amigaDeinterleave(const uint8_t*& input, size_t len)
 {
     assert(!(len & 1));
     const uint8_t* odds = &input[0];
-    const uint8_t* evens = &input[len/2];
+    const uint8_t* evens = &input[len / 2];
     Bytes output;
     ByteWriter bw(output);
 
-    for (size_t i=0; i<len/2; i++)
+    for (size_t i = 0; i < len / 2; i++)
     {
         uint8_t o = *odds++;
         uint8_t e = *evens++;
@@ -81,11 +81,15 @@ Bytes amigaDeinterleave(const uint8_t*& input, size_t len)
          * http://graphics.stanford.edu/~seander/bithacks.html#InterleaveBMN
          */
         uint16_t result =
-            (((e * 0x0101010101010101ULL & 0x8040201008040201ULL)
+            (((e * 0x0101010101010101ULL & 0x8040201008040201ULL) *
-                * 0x0102040810204081ULL >> 49) & 0x5555) |
+                     0x0102040810204081ULL >>
-            (((o * 0x0101010101010101ULL & 0x8040201008040201ULL)
+                 49) &
-                * 0x0102040810204081ULL >> 48) & 0xAAAA);
+                0x5555) |
-        
+            (((o * 0x0101010101010101ULL & 0x8040201008040201ULL) *
+                     0x0102040810204081ULL >>
+                 48) &
+                0xAAAA);
+
         bw.write_be16(result);
     }
 
@@ -95,6 +99,6 @@ Bytes amigaDeinterleave(const uint8_t*& input, size_t len)
 
 Bytes amigaDeinterleave(const Bytes& input)
 {
-	const uint8_t* ptr = input.cbegin();
+    const uint8_t* ptr = input.cbegin();
-	return amigaDeinterleave(ptr, input.size());
+    return amigaDeinterleave(ptr, input.size());
 }

arch/amiga/amiga.h

@@ -7,10 +7,10 @@
 
 #define AMIGA_TRACKS_PER_DISK 80
 #define AMIGA_SECTORS_PER_TRACK 11
-#define AMIGA_RECORD_SIZE 0x21f
+#define AMIGA_RECORD_SIZE 0x21c
 
-extern std::unique_ptr<AbstractDecoder> createAmigaDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createAmigaDecoder(const DecoderProto& config);
-extern std::unique_ptr<AbstractEncoder> createAmigaEncoder(const EncoderProto& config);
+extern std::unique_ptr<Encoder> createAmigaEncoder(const EncoderProto& config);
 
 extern uint32_t amigaChecksum(const Bytes& bytes);
 extern Bytes amigaInterleave(const Bytes& input);

arch/amiga/decoder.cc

@@ -11,75 +11,74 @@
 #include <string.h>
 #include <algorithm>
 
-/* 
+/*
  * Amiga disks use MFM but it's not quite the same as IBM MFM. They only use
  * a single type of record with a different marker byte.
- * 
+ *
  * See the big comment in the IBM MFM decoder for the gruesome details of how
  * MFM works.
  */
-         
+
 static const FluxPattern SECTOR_PATTERN(48, AMIGA_SECTOR_RECORD);
 
-class AmigaDecoder : public AbstractDecoder
+class AmigaDecoder : public Decoder
 {
 public:
-	AmigaDecoder(const DecoderProto& config):
+    AmigaDecoder(const DecoderProto& config):
-		AbstractDecoder(config),
+        Decoder(config),
-		_config(config.amiga())
+        _config(config.amiga())
-	{}
+    {
+    }
 
-    RecordType advanceToNextRecord() override
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		_sector->clock = _fmr->seekToPattern(SECTOR_PATTERN);
+        return seekToPattern(SECTOR_PATTERN);
-		if (_fmr->eof() || !_sector->clock)
+    }
-			return UNKNOWN_RECORD;
-		return SECTOR_RECORD;
-	}
 
     void decodeSectorRecord() override
-	{
+    {
-		const auto& rawbits = readRawBits(AMIGA_RECORD_SIZE*16);
+        if (readRaw48() != AMIGA_SECTOR_RECORD)
-		if (rawbits.size() < (AMIGA_RECORD_SIZE*16))
+            return;
-			return;
-		const auto& rawbytes = toBytes(rawbits).slice(0, AMIGA_RECORD_SIZE*2);
-		const auto& bytes = decodeFmMfm(rawbits).slice(0, AMIGA_RECORD_SIZE);
 
-		const uint8_t* ptr = bytes.begin() + 3;
+        const auto& rawbits = readRawBits(AMIGA_RECORD_SIZE * 16);
+        if (rawbits.size() < (AMIGA_RECORD_SIZE * 16))
+            return;
+        const auto& rawbytes = toBytes(rawbits).slice(0, AMIGA_RECORD_SIZE * 2);
+        const auto& bytes = decodeFmMfm(rawbits).slice(0, AMIGA_RECORD_SIZE);
 
-		Bytes header = amigaDeinterleave(ptr, 4);
+        const uint8_t* ptr = bytes.begin();
-		Bytes recoveryinfo = amigaDeinterleave(ptr, 16);
 
-		_sector->logicalTrack = header[1] >> 1;
+        Bytes header = amigaDeinterleave(ptr, 4);
-		_sector->logicalSide = header[1] & 1;
+        Bytes recoveryinfo = amigaDeinterleave(ptr, 16);
-		_sector->logicalSector = header[2];
 
-		uint32_t wantedheaderchecksum = amigaDeinterleave(ptr, 4).reader().read_be32();
+        _sector->logicalTrack = header[1] >> 1;
-		uint32_t gotheaderchecksum = amigaChecksum(rawbytes.slice(6, 40));
+        _sector->logicalSide = header[1] & 1;
-		if (gotheaderchecksum != wantedheaderchecksum)
+        _sector->logicalSector = header[2];
-			return;
 
-		uint32_t wanteddatachecksum = amigaDeinterleave(ptr, 4).reader().read_be32();
+        uint32_t wantedheaderchecksum =
-		uint32_t gotdatachecksum = amigaChecksum(rawbytes.slice(62, 1024));
+            amigaDeinterleave(ptr, 4).reader().read_be32();
+        uint32_t gotheaderchecksum = amigaChecksum(rawbytes.slice(0, 40));
+        if (gotheaderchecksum != wantedheaderchecksum)
+            return;
 
-		Bytes data;
+        uint32_t wanteddatachecksum =
-		data.writer().append(amigaDeinterleave(ptr, 512)).append(recoveryinfo);
+            amigaDeinterleave(ptr, 4).reader().read_be32();
-		_sector->data = data;
+        uint32_t gotdatachecksum = amigaChecksum(rawbytes.slice(56, 1024));
-		_sector->status = (gotdatachecksum == wanteddatachecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-	}
 
-	std::set<unsigned> requiredSectors(unsigned cylinder, unsigned head) const override
+        Bytes data;
-	{
+        data.writer().append(amigaDeinterleave(ptr, 512)).append(recoveryinfo);
-		static std::set<unsigned> sectors = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10 };
+        _sector->data = data;
-		return sectors;
+        _sector->status = (gotdatachecksum == wanteddatachecksum)
-	}
+                              ? Sector::OK
+                              : Sector::BAD_CHECKSUM;
+    }
 
 private:
-	const AmigaDecoderProto& _config;
+    const AmigaDecoderProto& _config;
+    nanoseconds_t _clock;
 };
 
-std::unique_ptr<AbstractDecoder> createAmigaDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createAmigaDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new AmigaDecoder(config));
+    return std::unique_ptr<Decoder>(new AmigaDecoder(config));
 }
-

arch/amiga/encoder.cc

@@ -3,7 +3,7 @@
 #include "encoders/encoders.h"
 #include "amiga.h"
 #include "crc.h"
-#include "writer.h"
+#include "readerwriter.h"
 #include "image.h"
 #include "arch/amiga/amiga.pb.h"
 #include "lib/encoders/encoders.pb.h"
@@ -12,151 +12,138 @@ static bool lastBit;
 
 static int charToInt(char c)
 {
-	if (isdigit(c))
+    if (isdigit(c))
-		return c - '0';
+        return c - '0';
-	return 10 + tolower(c) - 'a';
+    return 10 + tolower(c) - 'a';
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
 {
-	for (bool bit : src)
+    for (bool bit : src)
-	{
+    {
-		if (cursor < bits.size())
+        if (cursor < bits.size())
-			lastBit = bits[cursor++] = bit;
+            lastBit = bits[cursor++] = bit;
-	}
+    }
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
 {
-	cursor += width;
+    cursor += width;
-	lastBit = data & 1;
+    lastBit = data & 1;
-	for (int i=0; i<width; i++)
+    for (int i = 0; i < width; i++)
-	{
+    {
-		unsigned pos = cursor - i - 1;
+        unsigned pos = cursor - i - 1;
-		if (pos < bits.size())
+        if (pos < bits.size())
-			bits[pos] = data & 1;
+            bits[pos] = data & 1;
-		data >>= 1;
+        data >>= 1;
-	}
+    }
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
 {
-	ByteReader br(bytes);
+    ByteReader br(bytes);
-	BitReader bitr(br);
+    BitReader bitr(br);
 
-	while (!bitr.eof())
+    while (!bitr.eof())
-	{
+    {
-		if (cursor < bits.size())
+        if (cursor < bits.size())
-			bits[cursor++] = bitr.get();
+            bits[cursor++] = bitr.get();
-	}
+    }
 }
 
-static void write_sector(std::vector<bool>& bits, unsigned& cursor, const std::shared_ptr<Sector>& sector)
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
 {
-	if ((sector->data.size() != 512) && (sector->data.size() != 528))
+    if ((sector->data.size() != 512) && (sector->data.size() != 528))
-		Error() << "unsupported sector size --- you must pick 512 or 528";
+        error("unsupported sector size --- you must pick 512 or 528");
 
-	uint32_t checksum = 0;
+    uint32_t checksum = 0;
 
-	auto write_interleaved_bytes = [&](const Bytes& bytes)
+    auto write_interleaved_bytes = [&](const Bytes& bytes)
-	{
+    {
-		Bytes interleaved = amigaInterleave(bytes);
+        Bytes interleaved = amigaInterleave(bytes);
-		Bytes mfm = encodeMfm(interleaved, lastBit);
+        Bytes mfm = encodeMfm(interleaved, lastBit);
-		checksum ^= amigaChecksum(mfm);
+        checksum ^= amigaChecksum(mfm);
-		checksum &= 0x55555555;
+        checksum &= 0x55555555;
-		write_bits(bits, cursor, mfm);
+        write_bits(bits, cursor, mfm);
-	};
+    };
 
-	auto write_interleaved_word = [&](uint32_t word)
+    auto write_interleaved_word = [&](uint32_t word)
-	{
+    {
-		Bytes b(4);
+        Bytes b(4);
-		b.writer().write_be32(word);
+        b.writer().write_be32(word);
-		write_interleaved_bytes(b);
+        write_interleaved_bytes(b);
-	};
+    };
 
-    write_bits(bits, cursor, AMIGA_SECTOR_RECORD, 6*8);
+    write_bits(bits, cursor, 0xaaaa, 2 * 8);
+    write_bits(bits, cursor, AMIGA_SECTOR_RECORD, 6 * 8);
 
-	checksum = 0;
+    checksum = 0;
-	Bytes header = 
+    Bytes header = {0xff, /* Amiga 1.0 format byte */
-		{
+        (uint8_t)((sector->logicalTrack << 1) | sector->logicalSide),
-			0xff, /* Amiga 1.0 format byte */
+        (uint8_t)sector->logicalSector,
-			(uint8_t) ((sector->logicalTrack<<1) | sector->logicalSide),
+        (uint8_t)(AMIGA_SECTORS_PER_TRACK - sector->logicalSector)};
-			(uint8_t) sector->logicalSector,
+    write_interleaved_bytes(header);
-			(uint8_t) (AMIGA_SECTORS_PER_TRACK - sector->logicalSector)
+    Bytes recoveryInfo(16);
-		};
+    if (sector->data.size() == 528)
-	write_interleaved_bytes(header);
+        recoveryInfo = sector->data.slice(512, 16);
-	Bytes recoveryInfo(16);
+    write_interleaved_bytes(recoveryInfo);
-	if (sector->data.size() == 528)
+    write_interleaved_word(checksum);
-		recoveryInfo = sector->data.slice(512, 16);
-	write_interleaved_bytes(recoveryInfo);
-	write_interleaved_word(checksum);
 
-	Bytes data = sector->data.slice(0, 512);
+    Bytes data = sector->data.slice(0, 512);
-	write_interleaved_word(amigaChecksum(encodeMfm(amigaInterleave(data), lastBit)));
+    write_interleaved_word(
-	write_interleaved_bytes(data);
+        amigaChecksum(encodeMfm(amigaInterleave(data), lastBit)));
+    write_interleaved_bytes(data);
 }
 
-class AmigaEncoder : public AbstractEncoder
+class AmigaEncoder : public Encoder
 {
 public:
-	AmigaEncoder(const EncoderProto& config):
+    AmigaEncoder(const EncoderProto& config):
-		AbstractEncoder(config),
+        Encoder(config),
-		_config(config.amiga()) {}
+        _config(config.amiga())
+    {
+    }
 
 public:
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
+    {
+        /* Number of bits for one nominal revolution of a real 200ms Amiga disk.
+         */
+        int bitsPerRevolution = 200e3 / _config.clock_rate_us();
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
 
-		if ((physicalTrack >= 0) && (physicalTrack < AMIGA_TRACKS_PER_DISK))
+        fillBitmapTo(bits,
-		{
+            cursor,
-			for (int sectorId=0; sectorId<AMIGA_SECTORS_PER_TRACK; sectorId++)
+            _config.post_index_gap_ms() * 1000 / _config.clock_rate_us(),
-			{
+            {true, false});
-				const auto& sector = image.get(physicalTrack, physicalSide, sectorId);
+        lastBit = false;
-				if (sector)
-					sectors.push_back(sector);
-			}
-		}
 
-		return sectors;
+        for (const auto& sector : sectors)
-	}
+            write_sector(bits, cursor, sector);
 
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
+        if (cursor >= bits.size())
-			const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
+            error("track data overrun");
-	{
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
-		if ((physicalTrack < 0) || (physicalTrack >= AMIGA_TRACKS_PER_DISK))
-			return std::unique_ptr<Fluxmap>();
 
-		int bitsPerRevolution = 200000.0 / _config.clock_rate_us();
+        auto fluxmap = std::make_unique<Fluxmap>();
-		std::vector<bool> bits(bitsPerRevolution);
+        fluxmap->appendBits(bits,
-		unsigned cursor = 0;
+            calculatePhysicalClockPeriod(_config.clock_rate_us() * 1e3, 200e6));
-
+        return fluxmap;
-		fillBitmapTo(bits, cursor, _config.post_index_gap_ms() * 1000 / _config.clock_rate_us(), { true, false });
+    }
-		lastBit = false;
-
-		for (int sectorId=0; sectorId<AMIGA_SECTORS_PER_TRACK; sectorId++)
-		{
-			const auto& sectorData = image.get(physicalTrack, physicalSide, sectorId);
-			if (sectorData)
-				write_sector(bits, cursor, sectorData);
-		}
-
-		if (cursor >= bits.size())
-			Error() << "track data overrun";
-		fillBitmapTo(bits, cursor, bits.size(), { true, false });
-
-		std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		fluxmap->appendBits(bits, _config.clock_rate_us()*1e3);
-		return fluxmap;
-	}
 
 private:
-	const AmigaEncoderProto& _config;
+    const AmigaEncoderProto& _config;
 };
 
-std::unique_ptr<AbstractEncoder> createAmigaEncoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createAmigaEncoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new AmigaEncoder(config));
+    return std::unique_ptr<Encoder>(new AmigaEncoder(config));
 }
-
-

arch/apple2/apple2.h

@@ -1,13 +1,19 @@
 #ifndef APPLE2_H
 #define APPLE2_H
 
-#define APPLE2_SECTOR_RECORD   0xd5aa96
+#include <memory.h>
-#define APPLE2_DATA_RECORD     0xd5aaad
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
 
-#define APPLE2_SECTOR_LENGTH   256
+#define APPLE2_SECTOR_RECORD 0xd5aa96
+#define APPLE2_DATA_RECORD 0xd5aaad
+
+#define APPLE2_SECTOR_LENGTH 256
 #define APPLE2_ENCODED_SECTOR_LENGTH 342
 
-extern std::unique_ptr<AbstractDecoder> createApple2Decoder(const DecoderProto& config);
+#define APPLE2_SECTORS 16
+
+extern std::unique_ptr<Decoder> createApple2Decoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createApple2Encoder(const EncoderProto& config);
 
 #endif
-

arch/apple2/apple2.proto

@@ -1,4 +1,22 @@
 syntax = "proto2";
 
-message Apple2DecoderProto {}
+import "lib/common.proto";
 
+message Apple2DecoderProto {
+	optional uint32 side_one_track_offset = 1
+		[ default = 0, (help) = "offset to apply to track numbers on side 1" ];
+}
+
+message Apple2EncoderProto
+{
+    /* 245kHz. */
+    optional double clock_period_us = 1
+        [ default = 4, (help) = "clock rate on the real device" ];
+    
+    /* Apple II disk drives spin at 300rpm. */
+    optional double rotational_period_ms = 2
+        [ default = 200.0, (help) = "rotational period on the real device" ];
+
+	optional uint32 side_one_track_offset = 3
+		[ default = 0, (help) = "offset to apply to track numbers on side 1" ];
+}

arch/apple2/decoder.cc

@@ -5,6 +5,8 @@
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "apple2.h"
+#include "arch/apple2/apple2.pb.h"
+#include "lib/decoders/decoders.pb.h"
 #include "bytes.h"
 #include "fmt/format.h"
 #include <string.h>
@@ -12,22 +14,25 @@
 
 const FluxPattern SECTOR_RECORD_PATTERN(24, APPLE2_SECTOR_RECORD);
 const FluxPattern DATA_RECORD_PATTERN(24, APPLE2_DATA_RECORD);
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
 static int decode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
+    case gcr:                \
-		#include "data_gcr.h"
+        return data;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
 
-/* This is extremely inspired by the MESS implementation, written by Nathan Woods
+/* This is extremely inspired by the MESS implementation, written by Nathan
- * and R. Belmont: https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp
+ * Woods and R. Belmont:
+ * https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp
  */
 static Bytes decode_crazy_data(const uint8_t* inp, Sector::Status& status)
 {
@@ -47,9 +52,11 @@ static Bytes decode_crazy_data(const uint8_t* inp, Sector::Status& status)
         {
             /* 3 * 2 bit */
             output[i + 0] = ((checksum >> 1) & 0x01) | ((checksum << 1) & 0x02);
-            output[i + 86] = ((checksum >> 3) & 0x01) | ((checksum >> 1) & 0x02);
+            output[i + 86] =
+                ((checksum >> 3) & 0x01) | ((checksum >> 1) & 0x02);
             if ((i + 172) < APPLE2_SECTOR_LENGTH)
-                output[i + 172] = ((checksum >> 5) & 0x01) | ((checksum >> 3) & 0x02);
+                output[i + 172] =
+                    ((checksum >> 5) & 0x01) | ((checksum >> 3) & 0x02);
         }
     }
 
@@ -64,63 +71,105 @@ static uint8_t combine(uint16_t word)
     return word & (word >> 7);
 }
 
-class Apple2Decoder : public AbstractDecoder
+class Apple2Decoder : public Decoder
 {
 public:
-	Apple2Decoder(const DecoderProto& config):
+    Apple2Decoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_RECORD_PATTERN)
-			return RecordType::SECTOR_RECORD;
-		if (matcher == &DATA_RECORD_PATTERN)
-			return RecordType::DATA_RECORD;
-		return RecordType::UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		/* Skip ID (as we know it's a APPLE2_SECTOR_RECORD). */
+        if (readRaw24() != APPLE2_SECTOR_RECORD)
-		readRawBits(24);
+            return;
 
-		/* Read header. */
+        /* Read header. */
 
-		auto header = toBytes(readRawBits(8*8)).slice(0, 8);
+        auto header = toBytes(readRawBits(8 * 8)).slice(0, 8);
-		ByteReader br(header);
+        ByteReader br(header);
 
-		uint8_t volume = combine(br.read_be16());
+        uint8_t volume = combine(br.read_be16());
-		_sector->logicalTrack = combine(br.read_be16());
+        _sector->logicalTrack = combine(br.read_be16());
-		_sector->logicalSector = combine(br.read_be16());
+        _sector->logicalSide = _sector->physicalSide;
-		uint8_t checksum = combine(br.read_be16());
+        _sector->logicalSector = combine(br.read_be16());
-		if (checksum == (volume ^ _sector->logicalTrack ^ _sector->logicalSector))
+        uint8_t checksum = combine(br.read_be16());
-			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
-	}
 
-    void decodeDataRecord()
+        // If the checksum is correct, upgrade the sector from MISSING
-	{
+        // to DATA_MISSING in anticipation of its data record
-		/* Check ID. */
+        if (checksum ==
+            (volume ^ _sector->logicalTrack ^ _sector->logicalSector))
+            _sector->status =
+                Sector::DATA_MISSING; /* unintuitive but correct */
 
-		Bytes bytes = toBytes(readRawBits(3*8)).slice(0, 3);
+        if (_sector->logicalSide == 1)
-		if (bytes.reader().read_be24() != APPLE2_DATA_RECORD)
+            _sector->logicalTrack -= _config.apple2().side_one_track_offset();
-			return;
 
-		/* Read and decode data. */
+        /* Sanity check. */
 
-		unsigned recordLength = APPLE2_ENCODED_SECTOR_LENGTH + 2;
+        if (_sector->logicalTrack > 100)
-		bytes = toBytes(readRawBits(recordLength*8)).slice(0, recordLength);
+        {
+            _sector->status = Sector::MISSING;
+            return;
+        }
+    }
 
-		_sector->status = Sector::BAD_CHECKSUM;
+    void decodeDataRecord() override
-		_sector->data = decode_crazy_data(&bytes[0], _sector->status);
+    {
-	}
+        /* Check ID. */
+
+        if (readRaw24() != APPLE2_DATA_RECORD)
+            return;
+
+        // Sometimes there's a 1-bit gap between APPLE2_DATA_RECORD and
+        // the data itself.  This has been seen on real world disks
+        // such as the Apple II Operating System Kit from Apple2Online.
+        // However, I haven't seen it described in any of the various
+        // references.
+        //
+        // This extra '0' bit would not affect the real disk interface,
+        // as it was a '1' reaching the top bit of a shift register
+        // that triggered a byte to be available, but it affects the
+        // way the data is read here.
+        //
+        // While the floppies tested only seemed to need this applied
+        // to the first byte of the data record, applying it
+        // consistently to all of them doesn't seem to hurt, and
+        // simplifies the code.
+
+        /* Read and decode data. */
+
+        auto readApple8 = [&]()
+        {
+            auto result = 0;
+            while ((result & 0x80) == 0)
+            {
+                auto b = readRawBits(1);
+                if (b.empty())
+                    break;
+                result = (result << 1) | b[0];
+            }
+            return result;
+        };
+
+        constexpr unsigned recordLength = APPLE2_ENCODED_SECTOR_LENGTH + 2;
+        uint8_t bytes[recordLength];
+        for (auto& byte : bytes)
+        {
+            byte = readApple8();
+        }
+
+        // Upgrade the sector from MISSING to BAD_CHECKSUM.
+        // If decode_crazy_data succeeds, it upgrades the sector to
+        // OK.
+        _sector->status = Sector::BAD_CHECKSUM;
+        _sector->data = decode_crazy_data(&bytes[0], _sector->status);
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createApple2Decoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createApple2Decoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new Apple2Decoder(config));
+    return std::unique_ptr<Decoder>(new Apple2Decoder(config));
 }
-
-

arch/apple2/encoder.cc

@@ -0,0 +1,192 @@
+#include "globals.h"
+#include "arch/apple2/apple2.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "sector.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "fmt/format.h"
+#include "lib/encoders/encoders.pb.h"
+#include <ctype.h>
+#include "bytes.h"
+
+static int encode_data_gcr(uint8_t data)
+{
+    switch (data)
+    {
+#define GCR_ENTRY(gcr, data) \
+    case data:               \
+        return gcr;
+#include "data_gcr.h"
+#undef GCR_ENTRY
+    }
+    return -1;
+}
+
+class Apple2Encoder : public Encoder
+{
+public:
+    Apple2Encoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.apple2())
+    {
+    }
+
+private:
+    const Apple2EncoderProto& _config;
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        int bitsPerRevolution =
+            (_config.rotational_period_ms() * 1e3) / _config.clock_period_us();
+
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+        for (const auto& sector : sectors)
+            writeSector(bits, cursor, *sector);
+
+        if (cursor >= bits.size())
+            error("track data overrun by {} bits", cursor - bits.size());
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(bits,
+            calculatePhysicalClockPeriod(_config.clock_period_us() * 1e3,
+                _config.rotational_period_ms() * 1e6));
+        return fluxmap;
+    }
+
+private:
+    uint8_t volume_id = 254;
+
+    /* This is extremely inspired by the MESS implementation, written by Nathan
+     * Woods and R. Belmont:
+     * https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp
+     * as well as Understanding the Apple II (1983) Chapter 9
+     * https://archive.org/details/Understanding_the_Apple_II_1983_Quality_Software/page/n230/mode/1up?view=theater
+     */
+
+    void writeSector(
+        std::vector<bool>& bits, unsigned& cursor, const Sector& sector) const
+    {
+        if ((sector.status == Sector::OK) or
+            (sector.status == Sector::BAD_CHECKSUM))
+        {
+            auto write_bit = [&](bool val)
+            {
+                if (cursor <= bits.size())
+                {
+                    bits[cursor] = val;
+                }
+                cursor++;
+            };
+
+            auto write_bits = [&](uint32_t bits, int width)
+            {
+                for (int i = width; i--;)
+                {
+                    write_bit(bits & (1u << i));
+                }
+            };
+
+            auto write_gcr44 = [&](uint8_t value)
+            {
+                write_bits((value << 7) | value | 0xaaaa, 16);
+            };
+
+            auto write_gcr6 = [&](uint8_t value)
+            {
+                write_bits(encode_data_gcr(value), 8);
+            };
+
+            // The special "FF40" sequence is used to synchronize the receiving
+            // shift register. It's written as "1111 1111 00"; FF indicates the
+            // 8 consecutive 1-bits, while "40" indicates the total number of
+            // microseconds.
+            auto write_ff40 = [&](int n = 1)
+            {
+                for (; n--;)
+                {
+                    write_bits(0xff << 2, 10);
+                }
+            };
+
+            // There is data to encode to disk.
+            if ((sector.data.size() != APPLE2_SECTOR_LENGTH))
+                error("unsupported sector size {} --- you must pick 256",
+                    sector.data.size());
+
+            // Write address syncing leader : A sequence of "FF40"s; 5 of them
+            // are said to suffice to synchronize the decoder.
+            // "FF40" indicates that the actual data written is "1111
+            // 1111 00" i.e., 8 1s and a total of 40 microseconds
+            //
+            // In standard formatting, the first logical sector apparently gets
+            // extra padding.
+            write_ff40(sector.logicalSector == 0 ? 32 : 8);
+
+            int track = sector.logicalTrack;
+            if (sector.logicalSide == 1)
+                track += _config.side_one_track_offset();
+
+            // Write address field: APPLE2_SECTOR_RECORD + sector identifier +
+            // DE AA EB
+            write_bits(APPLE2_SECTOR_RECORD, 24);
+            write_gcr44(volume_id);
+            write_gcr44(track);
+            write_gcr44(sector.logicalSector);
+            write_gcr44(volume_id ^ track ^ sector.logicalSector);
+            write_bits(0xDEAAEB, 24);
+
+            // Write data syncing leader: FF40 + APPLE2_DATA_RECORD + sector
+            // data + sum + DE AA EB (+ mystery bits cut off of the scan?)
+            write_ff40(8);
+            write_bits(APPLE2_DATA_RECORD, 24);
+
+            // Convert the sector data to GCR, append the checksum, and write it
+            // out
+            constexpr auto TWOBIT_COUNT =
+                0x56; // Size of the 'twobit' area at the start of the GCR data
+            uint8_t checksum = 0;
+            for (int i = 0; i < APPLE2_ENCODED_SECTOR_LENGTH; i++)
+            {
+                int value;
+                if (i >= TWOBIT_COUNT)
+                {
+                    value = sector.data[i - TWOBIT_COUNT] >> 2;
+                }
+                else
+                {
+                    uint8_t tmp = sector.data[i];
+                    value = ((tmp & 1) << 1) | ((tmp & 2) >> 1);
+
+                    tmp = sector.data[i + TWOBIT_COUNT];
+                    value |= ((tmp & 1) << 3) | ((tmp & 2) << 1);
+
+                    if (i + 2 * TWOBIT_COUNT < APPLE2_SECTOR_LENGTH)
+                    {
+                        tmp = sector.data[i + 2 * TWOBIT_COUNT];
+                        value |= ((tmp & 1) << 5) | ((tmp & 2) << 3);
+                    }
+                }
+                checksum ^= value;
+                // assert(checksum & ~0x3f == 0);
+                write_gcr6(checksum);
+                checksum = value;
+            }
+            if (sector.status == Sector::BAD_CHECKSUM)
+                checksum ^= 0x3f;
+            write_gcr6(checksum);
+            write_bits(0xDEAAEB, 24);
+        }
+    }
+};
+
+std::unique_ptr<Encoder> createApple2Encoder(const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new Apple2Encoder(config));
+}

arch/brother/brother.h

@@ -3,17 +3,19 @@
 
 /* Brother word processor format (or at least, one of them) */
 
-#define BROTHER_SECTOR_RECORD            0xFFFFFD57
+#define BROTHER_SECTOR_RECORD 0xFFFFFD57
-#define BROTHER_DATA_RECORD              0xFFFFFDDB
+#define BROTHER_DATA_RECORD 0xFFFFFDDB
-#define BROTHER_DATA_RECORD_PAYLOAD      256
+#define BROTHER_DATA_RECORD_PAYLOAD 256
-#define BROTHER_DATA_RECORD_CHECKSUM     3
+#define BROTHER_DATA_RECORD_CHECKSUM 3
 #define BROTHER_DATA_RECORD_ENCODED_SIZE 415
 
-#define BROTHER_TRACKS_PER_240KB_DISK    78
+#define BROTHER_TRACKS_PER_240KB_DISK 78
-#define BROTHER_TRACKS_PER_120KB_DISK    39
+#define BROTHER_TRACKS_PER_120KB_DISK 39
-#define BROTHER_SECTORS_PER_TRACK        12
+#define BROTHER_SECTORS_PER_TRACK 12
 
-extern std::unique_ptr<AbstractDecoder> createBrotherDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createBrotherDecoder(
-extern std::unique_ptr<AbstractEncoder> createBrotherEncoder(const EncoderProto& config);
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createBrotherEncoder(
+    const EncoderProto& config);
 
 #endif

arch/brother/brother.proto

@@ -12,9 +12,7 @@ message BrotherEncoderProto {
 	optional double post_index_gap_ms = 2 [default = 1.0];
 	optional double sector_spacing_ms = 3 [default = 16.2];
 	optional double post_header_spacing_ms = 4 [default = 0.69];
-	optional string sector_skew = 5 [default = "05a3816b4927"];
 
 	optional BrotherFormat format = 6 [default = BROTHER240];
-	optional int32 bias = 7 [default = 0];
 }
 

arch/brother/data_gcr.h

@@ -1,13 +1,13 @@
-GCR_ENTRY(0x55, 0) // 00000
+GCR_ENTRY(0x55, 0)  // 00000
-GCR_ENTRY(0x57, 1) // 00001
+GCR_ENTRY(0x57, 1)  // 00001
-GCR_ENTRY(0x5b, 2) // 00010
+GCR_ENTRY(0x5b, 2)  // 00010
-GCR_ENTRY(0x5d, 3) // 00011
+GCR_ENTRY(0x5d, 3)  // 00011
-GCR_ENTRY(0x5f, 4) // 00100 
+GCR_ENTRY(0x5f, 4)  // 00100
-GCR_ENTRY(0x6b, 5) // 00101
+GCR_ENTRY(0x6b, 5)  // 00101
-GCR_ENTRY(0x6d, 6) // 00110
+GCR_ENTRY(0x6d, 6)  // 00110
-GCR_ENTRY(0x6f, 7) // 00111
+GCR_ENTRY(0x6f, 7)  // 00111
-GCR_ENTRY(0x75, 8) // 01000
+GCR_ENTRY(0x75, 8)  // 01000
-GCR_ENTRY(0x77, 9) // 01001
+GCR_ENTRY(0x77, 9)  // 01001
 GCR_ENTRY(0x7b, 10) // 01010
 GCR_ENTRY(0x7d, 11) // 01011
 GCR_ENTRY(0x7f, 12) // 01100
@@ -30,4 +30,3 @@ GCR_ENTRY(0xef, 28) // 11100
 GCR_ENTRY(0xf5, 29) // 11101
 GCR_ENTRY(0xf7, 30) // 11110
 GCR_ENTRY(0xfb, 31) // 11111
-

arch/brother/decoder.cc

@@ -1,5 +1,4 @@
 #include "globals.h"
-#include "sql.h"
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "decoders/decoders.h"
@@ -12,7 +11,8 @@
 
 const FluxPattern SECTOR_RECORD_PATTERN(32, BROTHER_SECTOR_RECORD);
 const FluxPattern DATA_RECORD_PATTERN(32, BROTHER_DATA_RECORD);
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
 static std::vector<uint8_t> outputbuffer;
 
@@ -33,91 +33,89 @@ static int decode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
+    case gcr:                \
-		#include "data_gcr.h"
+        return data;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
 
 static int decode_header_gcr(uint16_t word)
 {
-	switch (word)
+    switch (word)
-	{
+    {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
+    case gcr:                \
-		#include "header_gcr.h"
+        return data;
-		#undef GCR_ENTRY
+#include "header_gcr.h"
-	}                       
+#undef GCR_ENTRY
-	return -1;             
+    }
+    return -1;
 }
 
-class BrotherDecoder : public AbstractDecoder
+class BrotherDecoder : public Decoder
 {
 public:
-    BrotherDecoder(const DecoderProto& config):
+    BrotherDecoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_RECORD_PATTERN)
-			return RecordType::SECTOR_RECORD;
-		if (matcher == &DATA_RECORD_PATTERN)
-			return RecordType::DATA_RECORD;
-		return RecordType::UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		readRawBits(32);
+        if (readRaw32() != BROTHER_SECTOR_RECORD)
-		const auto& rawbits = readRawBits(32);
+            return;
-		const auto& bytes = toBytes(rawbits).slice(0, 4);
 
-		ByteReader br(bytes);
+        const auto& rawbits = readRawBits(32);
-		_sector->logicalTrack = decode_header_gcr(br.read_be16());
+        const auto& bytes = toBytes(rawbits).slice(0, 4);
-		_sector->logicalSector = decode_header_gcr(br.read_be16());
 
-		/* Sanity check the values read; there's no header checksum and
+        ByteReader br(bytes);
-			* occasionally we get garbage due to bit errors. */
+        _sector->logicalTrack = decode_header_gcr(br.read_be16());
-		if (_sector->logicalSector > 11)
+        _sector->logicalSector = decode_header_gcr(br.read_be16());
-			return;
-		if (_sector->logicalTrack > 79)
-			return;
 
-		_sector->status = Sector::DATA_MISSING;
+        /* Sanity check the values read; there's no header checksum and
-	}
+         * occasionally we get garbage due to bit errors. */
-	
+        if (_sector->logicalSector > 11)
-    void decodeDataRecord()
+            return;
-	{
+        if (_sector->logicalTrack > 79)
-		readRawBits(32);
+            return;
 
-		const auto& rawbits = readRawBits(BROTHER_DATA_RECORD_ENCODED_SIZE*8);
+        _sector->status = Sector::DATA_MISSING;
-		const auto& rawbytes = toBytes(rawbits).slice(0, BROTHER_DATA_RECORD_ENCODED_SIZE);
+    }
 
-		Bytes bytes;
+    void decodeDataRecord() override
-		ByteWriter bw(bytes);
+    {
-		BitWriter bitw(bw);
+        if (readRaw32() != BROTHER_DATA_RECORD)
-		for (uint8_t b : rawbytes)
+            return;
-		{
-			uint32_t nibble = decode_data_gcr(b);
-			bitw.push(nibble, 5);
-		}
-		bitw.flush();
 
-		_sector->data = bytes.slice(0, BROTHER_DATA_RECORD_PAYLOAD);
+        const auto& rawbits = readRawBits(BROTHER_DATA_RECORD_ENCODED_SIZE * 8);
-		uint32_t realCrc = crcbrother(_sector->data);
+        const auto& rawbytes =
-		uint32_t wantCrc = bytes.reader().seek(BROTHER_DATA_RECORD_PAYLOAD).read_be24();
+            toBytes(rawbits).slice(0, BROTHER_DATA_RECORD_ENCODED_SIZE);
-		_sector->status = (realCrc == wantCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+
-	}
+        Bytes bytes;
+        ByteWriter bw(bytes);
+        BitWriter bitw(bw);
+        for (uint8_t b : rawbytes)
+        {
+            uint32_t nibble = decode_data_gcr(b);
+            bitw.push(nibble, 5);
+        }
+        bitw.flush();
+
+        _sector->data = bytes.slice(0, BROTHER_DATA_RECORD_PAYLOAD);
+        uint32_t realCrc = crcbrother(_sector->data);
+        uint32_t wantCrc =
+            bytes.reader().seek(BROTHER_DATA_RECORD_PAYLOAD).read_be24();
+        _sector->status =
+            (realCrc == wantCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createBrotherDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createBrotherDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new BrotherDecoder(config));
+    return std::unique_ptr<Decoder>(new BrotherDecoder(config));
 }
-
-

arch/brother/encoder.cc

@@ -3,210 +3,152 @@
 #include "encoders/encoders.h"
 #include "brother.h"
 #include "crc.h"
-#include "writer.h"
+#include "readerwriter.h"
 #include "image.h"
 #include "arch/brother/brother.pb.h"
 #include "lib/encoders/encoders.pb.h"
 
 static int encode_header_gcr(uint16_t word)
 {
-	switch (word)
+    switch (word)
-	{
+    {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case data: return gcr;
+    case data:               \
-		#include "header_gcr.h"
+        return gcr;
-		#undef GCR_ENTRY
+#include "header_gcr.h"
-	}                       
+#undef GCR_ENTRY
-	return -1;             
+    }
+    return -1;
 }
 
 static int encode_data_gcr(uint8_t data)
 {
-	switch (data)
+    switch (data)
-	{
+    {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case data: return gcr;
+    case data:               \
-		#include "data_gcr.h"
+        return gcr;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
-	}                       
+#undef GCR_ENTRY
-	return -1;             
+    }
+    return -1;
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint32_t data, int width)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint32_t data, int width)
 {
-	cursor += width;
+    cursor += width;
-	for (int i=0; i<width; i++)
+    for (int i = 0; i < width; i++)
-	{
+    {
-		unsigned pos = cursor - i - 1;
+        unsigned pos = cursor - i - 1;
-		if (pos < bits.size())
+        if (pos < bits.size())
-			bits[pos] = data & 1;
+            bits[pos] = data & 1;
-		data >>= 1;
+        data >>= 1;
-	}
+    }
 }
 
-static void write_sector_header(std::vector<bool>& bits, unsigned& cursor,
+static void write_sector_header(
-		int track, int sector)
+    std::vector<bool>& bits, unsigned& cursor, int track, int sector)
 {
-	write_bits(bits, cursor, 0xffffffff, 31);
+    write_bits(bits, cursor, 0xffffffff, 31);
-	write_bits(bits, cursor, BROTHER_SECTOR_RECORD, 32);
+    write_bits(bits, cursor, BROTHER_SECTOR_RECORD, 32);
-	write_bits(bits, cursor, encode_header_gcr(track), 16);
+    write_bits(bits, cursor, encode_header_gcr(track), 16);
-	write_bits(bits, cursor, encode_header_gcr(sector), 16);
+    write_bits(bits, cursor, encode_header_gcr(sector), 16);
-	write_bits(bits, cursor, encode_header_gcr(0x2f), 16);
+    write_bits(bits, cursor, encode_header_gcr(0x2f), 16);
 }
 
-static void write_sector_data(std::vector<bool>& bits, unsigned& cursor, const Bytes& data)
+static void write_sector_data(
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& data)
 {
-	write_bits(bits, cursor, 0xffffffff, 32);
+    write_bits(bits, cursor, 0xffffffff, 32);
-	write_bits(bits, cursor, BROTHER_DATA_RECORD, 32);
+    write_bits(bits, cursor, BROTHER_DATA_RECORD, 32);
 
-	uint16_t fifo = 0;
+    uint16_t fifo = 0;
-	int width = 0;
+    int width = 0;
 
-	if (data.size() != BROTHER_DATA_RECORD_PAYLOAD)
+    if (data.size() != BROTHER_DATA_RECORD_PAYLOAD)
-		Error() << "unsupported sector size";
+        error("unsupported sector size");
 
-	auto write_byte = [&](uint8_t byte)
+    auto write_byte = [&](uint8_t byte)
-	{
+    {
-		fifo |= (byte << (8 - width));
+        fifo |= (byte << (8 - width));
-		width += 8;
+        width += 8;
 
-		while (width >= 5)
+        while (width >= 5)
-		{
+        {
-			uint8_t quintet = fifo >> 11;
+            uint8_t quintet = fifo >> 11;
-			fifo <<= 5;
+            fifo <<= 5;
-			width -= 5;
+            width -= 5;
 
-			write_bits(bits, cursor, encode_data_gcr(quintet), 8);
+            write_bits(bits, cursor, encode_data_gcr(quintet), 8);
-		}
+        }
-	};
+    };
 
-	for (uint8_t byte : data)
+    for (uint8_t byte : data)
-		write_byte(byte);
+        write_byte(byte);
 
-	uint32_t realCrc = crcbrother(data);
+    uint32_t realCrc = crcbrother(data);
-	write_byte(realCrc>>16);
+    write_byte(realCrc >> 16);
-	write_byte(realCrc>>8);
+    write_byte(realCrc >> 8);
-	write_byte(realCrc);
+    write_byte(realCrc);
-	write_byte(0x58); /* magic */
+    write_byte(0x58); /* magic */
     write_byte(0xd4);
     while (width != 0)
         write_byte(0);
 }
 
-static int charToInt(char c)
+class BrotherEncoder : public Encoder
-{
-	if (isdigit(c))
-		return c - '0';
-	return 10 + tolower(c) - 'a';
-}
-
-class BrotherEncoder : public AbstractEncoder
 {
 public:
-	BrotherEncoder(const EncoderProto& config):
+    BrotherEncoder(const EncoderProto& config):
-		AbstractEncoder(config),
+        Encoder(config),
-		_config(config.brother())
+        _config(config.brother())
-	{}
+    {
+    }
 
 public:
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
+    {
+        int bitsPerRevolution = 200000.0 / _config.clock_rate_us();
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
 
-		int logicalTrack;
+        int sectorCount = 0;
-		if (physicalSide != 0)
+        for (const auto& sectorData : sectors)
-			return sectors;
-		physicalTrack -= _config.bias();
-		switch (_config.format())
-		{
-			case BROTHER120:
-				if ((physicalTrack < 0) || (physicalTrack >= (BROTHER_TRACKS_PER_120KB_DISK*2))
-						|| (physicalTrack & 1))
-					return sectors;
-				logicalTrack = physicalTrack/2;
-				break;
-
-			case BROTHER240:
-				if ((physicalTrack < 0) || (physicalTrack >= BROTHER_TRACKS_PER_240KB_DISK))
-					return sectors;
-				logicalTrack = physicalTrack;
-				break;
-		}
-
-        for (int sectorId=0; sectorId<BROTHER_SECTORS_PER_TRACK; sectorId++)
         {
-            const auto& sector = image.get(logicalTrack, 0, sectorId);
+            double headerMs = _config.post_index_gap_ms() +
-            if (sector)
+                              sectorCount * _config.sector_spacing_ms();
-                sectors.push_back(sector);
+            unsigned headerCursor = headerMs * 1e3 / _config.clock_rate_us();
-		}
+            double dataMs = headerMs + _config.post_header_spacing_ms();
+            unsigned dataCursor = dataMs * 1e3 / _config.clock_rate_us();
 
-		return sectors;
+            fillBitmapTo(bits, cursor, headerCursor, {true, false});
-	}
+            write_sector_header(bits,
+                cursor,
+                sectorData->logicalTrack,
+                sectorData->logicalSector);
+            fillBitmapTo(bits, cursor, dataCursor, {true, false});
+            write_sector_data(bits, cursor, sectorData->data);
 
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
+            sectorCount++;
-			const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
+        }
-	{
-		int logicalTrack;
-		if (physicalSide != 0)
-			return std::unique_ptr<Fluxmap>();
-		physicalTrack -= _config.bias();
-		switch (_config.format())
-		{
-			case BROTHER120:
-				if ((physicalTrack < 0) || (physicalTrack >= (BROTHER_TRACKS_PER_120KB_DISK*2))
-						|| (physicalTrack & 1))
-					return std::unique_ptr<Fluxmap>();
-				logicalTrack = physicalTrack/2;
-				break;
 
-			case BROTHER240:
+        if (cursor >= bits.size())
-				if ((physicalTrack < 0) || (physicalTrack >= BROTHER_TRACKS_PER_240KB_DISK))
+            error("track data overrun");
-					return std::unique_ptr<Fluxmap>();
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
-				logicalTrack = physicalTrack;
-				break;
-		}
 
-		int bitsPerRevolution = 200000.0 / _config.clock_rate_us();
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		const std::string& skew = _config.sector_skew();
+        fluxmap->appendBits(bits, _config.clock_rate_us() * 1e3);
-		std::vector<bool> bits(bitsPerRevolution);
+        return fluxmap;
-		unsigned cursor = 0;
+    }
-
-		for (int sectorCount=0; sectorCount<BROTHER_SECTORS_PER_TRACK; sectorCount++)
-		{
-			int sectorId = charToInt(skew.at(sectorCount));
-			double headerMs = _config.post_index_gap_ms() + sectorCount*_config.sector_spacing_ms();
-			unsigned headerCursor = headerMs*1e3 / _config.clock_rate_us();
-			double dataMs = headerMs + _config.post_header_spacing_ms();
-			unsigned dataCursor = dataMs*1e3 / _config.clock_rate_us();
-
-			const auto& sectorData = image.get(logicalTrack, 0, sectorId);
-
-			fillBitmapTo(bits, cursor, headerCursor, { true, false });
-			write_sector_header(bits, cursor, logicalTrack, sectorId);
-			fillBitmapTo(bits, cursor, dataCursor, { true, false });
-			write_sector_data(bits, cursor, sectorData->data);
-		}
-
-		if (cursor >= bits.size())
-			Error() << "track data overrun";
-		fillBitmapTo(bits, cursor, bits.size(), { true, false });
-
-		// The pre-index gap is not normally reported.
-		// std::cerr << "pre-index gap " << 200.0 - (double)cursor*clockRateUs/1e3 << std::endl;
-		
-		std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		fluxmap->appendBits(bits, _config.clock_rate_us()*1e3);
-		return fluxmap;
-	}
 
 private:
-	const BrotherEncoderProto& _config;
+    const BrotherEncoderProto& _config;
-
 };
 
-std::unique_ptr<AbstractEncoder> createBrotherEncoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createBrotherEncoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new BrotherEncoder(config));
+    return std::unique_ptr<Encoder>(new BrotherEncoder(config));
 }
-
-

arch/brother/header_gcr.h

@@ -76,4 +76,3 @@ GCR_ENTRY(0x6BAB, 74)
 GCR_ENTRY(0xAD5F, 75)
 GCR_ENTRY(0xDBED, 76)
 GCR_ENTRY(0x55BB, 77)
-

arch/build.mk

@@ -0,0 +1,43 @@
+LIBARCH_SRCS = \
+	arch/aeslanier/decoder.cc \
+	arch/agat/agat.cc \
+	arch/agat/decoder.cc \
+	arch/agat/encoder.cc \
+	arch/amiga/amiga.cc \
+	arch/amiga/decoder.cc \
+	arch/amiga/encoder.cc \
+	arch/apple2/decoder.cc \
+	arch/apple2/encoder.cc \
+	arch/brother/decoder.cc \
+	arch/brother/encoder.cc \
+	arch/c64/c64.cc \
+	arch/c64/decoder.cc \
+	arch/c64/encoder.cc \
+	arch/f85/decoder.cc \
+	arch/fb100/decoder.cc \
+	arch/ibm/decoder.cc \
+	arch/ibm/encoder.cc \
+	arch/macintosh/decoder.cc \
+	arch/macintosh/encoder.cc \
+	arch/micropolis/decoder.cc \
+	arch/micropolis/encoder.cc \
+	arch/mx/decoder.cc \
+	arch/northstar/decoder.cc \
+	arch/northstar/encoder.cc \
+	arch/rolandd20/decoder.cc \
+	arch/smaky6/decoder.cc \
+	arch/tids990/decoder.cc \
+	arch/tids990/encoder.cc \
+	arch/victor9k/decoder.cc \
+	arch/victor9k/encoder.cc \
+	arch/zilogmcz/decoder.cc \
+
+LIBARCH_OBJS = $(patsubst %.cc, $(OBJDIR)/%.o, $(LIBARCH_SRCS))
+OBJS += $(LIBARCH_OBJS)
+$(LIBARCH_SRCS): | $(PROTO_HDRS)
+$(LIBARCH_SRCS): CFLAGS += $(PROTO_CFLAGS)
+LIBARCH_LIB = $(OBJDIR)/libarch.a
+LIBARCH_LDFLAGS =
+$(LIBARCH_LIB): $(LIBARCH_OBJS)
+
+$(call use-pkgconfig, $(LIBARCH_LIB), $(LIBARCH_OBJS), fmt)

arch/c64/c64.cc

@@ -0,0 +1,28 @@
+#include "globals.h"
+#include "c64.h"
+
+/*
+ *   Track   Sectors/track   # Sectors   Storage in Bytes   Clock rate
+ *   -----   -------------   ---------   ----------------   ----------
+ *    1-17        21            357           7820             3.25
+ *   18-24        19            133           7170             3.5
+ *   25-30        18            108           6300             3.75
+ *   31-40(*)     17             85           6020             4
+ *                              ---
+ *                              683 (for a 35 track image)
+ *
+ * The clock rate is normalised for a 200ms drive.
+ */
+
+nanoseconds_t clockPeriodForC64Track(unsigned track)
+{
+    constexpr double b = 8.0;
+
+    if (track < 17)
+        return 26.0 / b;
+    if (track < 24)
+        return 28.0 / b;
+    if (track < 30)
+        return 30.0 / b;
+    return 32.0 / b;
+}

arch/c64/c64.h

@@ -4,11 +4,11 @@
 #include "decoders/decoders.h"
 #include "encoders/encoders.h"
 
-#define C64_SECTOR_RECORD    0xffd49
+#define C64_SECTOR_RECORD 0xffd49
-#define C64_DATA_RECORD      0xffd57
+#define C64_DATA_RECORD 0xffd57
-#define C64_SECTOR_LENGTH    256
+#define C64_SECTOR_LENGTH 256
 
-/* Source: http://www.unusedino.de/ec64/technical/formats/g64.html 
+/* Source: http://www.unusedino.de/ec64/technical/formats/g64.html
    1. Header sync       FF FF FF FF FF (40 'on' bits, not GCR)
    2. Header info       52 54 B5 29 4B 7A 5E 95 55 55 (10 GCR bytes)
    3. Header gap        55 55 55 55 55 55 55 55 55 (9 bytes, never read)
@@ -17,17 +17,21 @@
    6. Inter-sector gap  55 55 55 55...55 55 (4 to 12 bytes, never read)
    1. Header sync       (SYNC for the next sector)
 */
-#define C64_HEADER_DATA_SYNC        0xFF
+#define C64_HEADER_DATA_SYNC 0xFF
-#define C64_HEADER_BLOCK_ID         0x08
+#define C64_HEADER_BLOCK_ID 0x08
-#define C64_DATA_BLOCK_ID           0x07
+#define C64_DATA_BLOCK_ID 0x07
-#define C64_HEADER_GAP              0x55
+#define C64_HEADER_GAP 0x55
-#define C64_INTER_SECTOR_GAP        0x55
+#define C64_INTER_SECTOR_GAP 0x55
-#define C64_PADDING                 0x0F
+#define C64_PADDING 0x0F
 
-#define C64_TRACKS_PER_DISK         40
+#define C64_TRACKS_PER_DISK 40
-#define C64_BAM_TRACK               17
+#define C64_BAM_TRACK 17
 
-extern std::unique_ptr<AbstractDecoder> createCommodore64Decoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createCommodore64Decoder(
-extern std::unique_ptr<AbstractEncoder> createCommodore64Encoder(const EncoderProto& config);
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createCommodore64Encoder(
+    const EncoderProto& config);
+
+extern nanoseconds_t clockPeriodForC64Track(unsigned track);
 
 #endif

arch/c64/c64.proto

@@ -7,7 +7,5 @@ message Commodore64DecoderProto {}
 message Commodore64EncoderProto {
 	optional double post_index_gap_us = 1 [default=0.0,
 		(help) = "post-index gap before first sector header."];
-	optional double clock_compensation_factor = 2 [default=1.0,
-		(help) = "scale the output clock by this much."];
 }
 

arch/c64/decoder.cc

@@ -13,16 +13,18 @@
 
 const FluxPattern SECTOR_RECORD_PATTERN(20, C64_SECTOR_RECORD);
 const FluxPattern DATA_RECORD_PATTERN(20, C64_DATA_RECORD);
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
 static int decode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
+    case gcr:                \
-		#include "data_gcr.h"
+        return data;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
@@ -37,11 +39,11 @@ static Bytes decode(const std::vector<bool>& bits)
     while (ii != bits.end())
     {
         uint8_t inputfifo = 0;
-        for (size_t i=0; i<5; i++)
+        for (size_t i = 0; i < 5; i++)
         {
             if (ii == bits.end())
                 break;
-            inputfifo = (inputfifo<<1) | *ii++;
+            inputfifo = (inputfifo << 1) | *ii++;
         }
 
         bitw.push(decode_data_gcr(inputfifo), 4);
@@ -51,56 +53,50 @@ static Bytes decode(const std::vector<bool>& bits)
     return output;
 }
 
-class Commodore64Decoder : public AbstractDecoder
+class Commodore64Decoder : public Decoder
 {
 public:
-	Commodore64Decoder(const DecoderProto& config):
+    Commodore64Decoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_RECORD_PATTERN)
-			return RecordType::SECTOR_RECORD;
-		if (matcher == &DATA_RECORD_PATTERN)
-			return RecordType::DATA_RECORD;
-		return RecordType::UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		readRawBits(20);
+        if (readRaw20() != C64_SECTOR_RECORD)
+            return;
 
-		const auto& bits = readRawBits(5*10);
+        const auto& bits = readRawBits(5 * 10);
-		const auto& bytes = decode(bits).slice(0, 5);
+        const auto& bytes = decode(bits).slice(0, 5);
 
-		uint8_t checksum = bytes[0];
+        uint8_t checksum = bytes[0];
-		_sector->logicalSector = bytes[1];
+        _sector->logicalSector = bytes[1];
-		_sector->logicalSide = 0;
+        _sector->logicalSide = 0;
-		_sector->logicalTrack = bytes[2] - 1;
+        _sector->logicalTrack = bytes[2] - 1;
-		if (checksum == xorBytes(bytes.slice(1, 4)))
+        if (checksum == xorBytes(bytes.slice(1, 4)))
-			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+            _sector->status =
-	}
+                Sector::DATA_MISSING; /* unintuitive but correct */
+    }
 
-    void decodeDataRecord()
+    void decodeDataRecord() override
-	{
+    {
-		readRawBits(20);
+        if (readRaw20() != C64_DATA_RECORD)
+            return;
 
-		const auto& bits = readRawBits(259*10);
+        const auto& bits = readRawBits(259 * 10);
-		const auto& bytes = decode(bits).slice(0, 259);
+        const auto& bytes = decode(bits).slice(0, 259);
 
-		_sector->data = bytes.slice(0, C64_SECTOR_LENGTH);
+        _sector->data = bytes.slice(0, C64_SECTOR_LENGTH);
-		uint8_t gotChecksum = xorBytes(_sector->data);
+        uint8_t gotChecksum = xorBytes(_sector->data);
-		uint8_t wantChecksum = bytes[256];
+        uint8_t wantChecksum = bytes[256];
-		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+        _sector->status =
-	}
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createCommodore64Decoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createCommodore64Decoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new Commodore64Decoder(config));
+    return std::unique_ptr<Decoder>(new Commodore64Decoder(config));
 }
-
-

arch/c64/encoder.cc

@@ -4,158 +4,101 @@
 #include "c64.h"
 #include "crc.h"
 #include "sector.h"
-#include "writer.h"
+#include "readerwriter.h"
 #include "image.h"
 #include "fmt/format.h"
 #include "arch/c64/c64.pb.h"
 #include "lib/encoders/encoders.pb.h"
+#include "lib/layout.h"
 #include <ctype.h>
 #include "bytes.h"
 
 static bool lastBit;
 
-static double clockRateUsForTrack(unsigned track)
-{
-    /*
-     * Track   # Sectors/Track Speed Zone  bits/rotation       
-     * 1 – 17          21          3       61,538.4
-     * 18 – 24         19          2       57,142.8
-     * 25 – 30         18          1       53,333.4
-     * 31 – 35         17          0       50,000.0
-    */
-    if (track < 17)
-        return 200000.0/61538.4;
-    if (track < 24)
-        return 200000.0/57142.8;
-    if (track < 30)
-        return 200000.0/53333.4;
-    return 200000.0/50000.0;
-
-}
-
-static unsigned sectorsForTrack(unsigned track)
-{
-    /*
-     * Track   Sectors/track   # Sectors   Storage in Bytes
-     *   -----   -------------   ---------   ----------------
-     *    1-17        21            357           7820
-     *   18-24        19            133           7170
-     *   25-30        18            108           6300
-     *   31-40(*)     17             85           6020
-     *                              ---
-     *                              683 (for a 35 track image)
-     */
-    if (track < 17)
-        return 21;
-    if (track < 24)
-        return 19;
-    if (track < 30)
-        return 18;
-    return 17;
-}
-
 static int encode_data_gcr(uint8_t data)
 {
     switch (data)
     {
-        #define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-            case data: return gcr;
+    case data:               \
-        #include "data_gcr.h"
+        return gcr;
-        #undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
 {
-    for (bool bit : src)  //Range-based for loop
+    for (bool bit : src) // Range-based for loop
     {
         if (cursor < bits.size())
             bits[cursor++] = bit;
     }
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
 {
     cursor += width;
-    for (int i=0; i<width; i++)
+    for (int i = 0; i < width; i++)
     {
-        unsigned pos = cursor - i - 1;              
+        unsigned pos = cursor - i - 1;
         if (pos < bits.size())
             bits[pos] = data & 1;
         data >>= 1;
     }
 }
 
-void bindump(std::ostream& stream, std::vector<bool>& buffer)
-{
-    size_t pos = 0;
-
-    while ((pos < buffer.size()) and (pos <520))
-    {
-        stream << fmt::format("{:5d} : ", pos);
-        for (int i=0; i<40; i++)
-        {
-            if ((pos+i) < buffer.size())
-                stream << fmt::format("{:01b}", (buffer[pos+i]));
-            else
-                stream << "-- ";
-            if ((((pos + i + 1) % 8) == 0) and i != 0)
-                stream << "  ";
-
-        }
-        stream << std::endl;
-        pos += 40;
-    }
-}
 static std::vector<bool> encode_data(uint8_t input)
 {
     /*
-    * Four 8-bit data bytes are converted to four 10-bit GCR bytes at a time by
+     * Four 8-bit data bytes are converted to four 10-bit GCR bytes at a time by
-    * the 1541 DOS.  RAM is only an 8-bit storage device though. This hardware
+     * the 1541 DOS.  RAM is only an 8-bit storage device though. This hardware
-    * limitation prevents a 10-bit GCR byte from being stored in a single
+     * limitation prevents a 10-bit GCR byte from being stored in a single
-    * memory location. Four 10-bit GCR bytes total 40 bits - a number evenly
+     * memory location. Four 10-bit GCR bytes total 40 bits - a number evenly
-    * divisible by our overriding 8-bit constraint. Commodore sub- divides the
+     * divisible by our overriding 8-bit constraint. Commodore sub- divides the
-    * 40 GCR bits into five 8-bit bytes to solve this dilemma. This explains
+     * 40 GCR bits into five 8-bit bytes to solve this dilemma. This explains
-    * why four 8-bit data bytes are converted to GCR form at a time. The
+     * why four 8-bit data bytes are converted to GCR form at a time. The
-    * following step by step example demonstrates how this bit manipulation is
+     * following step by step example demonstrates how this bit manipulation is
-    * performed by the DOS.
+     * performed by the DOS.
-    *
+     *
-    * STEP 1. Four 8-bit Data Bytes
+     * STEP 1. Four 8-bit Data Bytes
-    * $08 $10 $00 $12
+     * $08 $10 $00 $12
-    *
+     *
-    * STEP 2. Hexadecimal to Binary Conversion
+     * STEP 2. Hexadecimal to Binary Conversion
-    * 1. Binary Equivalents
+     * 1. Binary Equivalents
-    * $08       $10         $00         $12
+     * $08       $10         $00         $12
-    * 00001000  00010000    00000000    00010010
+     * 00001000  00010000    00000000    00010010
-    *
+     *
-    * STEP 3. Binary to GCR Conversion
+     * STEP 3. Binary to GCR Conversion
-    * 1. Four 8-bit Data Bytes
+     * 1. Four 8-bit Data Bytes
-    * 00001000 00010000 00000000 00010010
+     * 00001000 00010000 00000000 00010010
-    * 2. High and Low Nybbles
+     * 2. High and Low Nybbles
-    * 0000 1000 0001 0000 0000 0000 0001 0010
+     * 0000 1000 0001 0000 0000 0000 0001 0010
-    * 3. High and Low Nybble GCR Equivalents
+     * 3. High and Low Nybble GCR Equivalents
-    * 01010 01001 01011 01010 01010 01010 01011 10010
+     * 01010 01001 01011 01010 01010 01010 01011 10010
-    * 4. Four 10-bit GCR Bytes
+     * 4. Four 10-bit GCR Bytes
-    * 0101001001 0101101010 0101001010 0101110010
+     * 0101001001 0101101010 0101001010 0101110010
-    *
+     *
-    * STEP 4. 10-bit GCR to 8-bit GCR Conversion
+     * STEP 4. 10-bit GCR to 8-bit GCR Conversion
-    *   1. Concatenate Four 10-bit GCR Bytes
+     *   1. Concatenate Four 10-bit GCR Bytes
-    *   0101001001010110101001010010100101110010
+     *   0101001001010110101001010010100101110010
-    *   2. Five 8-bit Subdivisions
+     *   2. Five 8-bit Subdivisions
-    *   01010010 01010110 10100101 00101001 01110010
+     *   01010010 01010110 10100101 00101001 01110010
-    *
+     *
-    * STEP 5. Binary to Hexadecimal Conversion
+     * STEP 5. Binary to Hexadecimal Conversion
-    * 1. Hexadecimal Equivalents
+     * 1. Hexadecimal Equivalents
-    *   01010010    01010110    10100101    00101001    01110010
+     *   01010010    01010110    10100101    00101001    01110010
-    *   $52         $56         $A5         $29         $72
+     *   $52         $56         $A5         $29         $72
-    *
+     *
-    * STEP 6. Four 8-bit Data Bytes are Recorded as Five 8-bit GCR Bytes
+     * STEP 6. Four 8-bit Data Bytes are Recorded as Five 8-bit GCR Bytes
-    *   $08 $10 $00 $12
+     *   $08 $10 $00 $12
-    *
+     *
-    * are recorded as
+     * are recorded as
-    *   $52 $56 $A5 $29 $72
+     *   $52 $56 $A5 $29 $72
-    */
+     */
 
     std::vector<bool> output(10, false);
     uint8_t hi = 0;
@@ -163,124 +106,109 @@ static std::vector<bool> encode_data(uint8_t input)
     uint8_t lo_GCR = 0;
     uint8_t hi_GCR = 0;
 
-    //Convert the byte in high and low nibble
+    // Convert the byte in high and low nibble
-    lo = input >> 4; //get the lo nibble shift the bits 4 to the right          
+    lo = input >> 4; // get the lo nibble shift the bits 4 to the right
-    hi = input & 15; //get the hi nibble bij masking the lo bits (00001111)     
+    hi = input & 15; // get the hi nibble bij masking the lo bits (00001111)
 
-
+    lo_GCR = encode_data_gcr(lo); // example value: 0000   GCR = 01010
-    lo_GCR = encode_data_gcr(lo);   //example value: 0000   GCR = 01010
+    hi_GCR = encode_data_gcr(hi); // example value: 1000   GCR = 01001
-    hi_GCR = encode_data_gcr(hi);   //example value: 1000   GCR = 01001
+    // output = [0,1,2,3,4,5,6,7,8,9]
-    //output = [0,1,2,3,4,5,6,7,8,9]
+    // value  = [0,1,0,1,0,0,1,0,0,1]
-    //value  = [0,1,0,1,0,0,1,0,0,1]
+    //           01010 01001
-    //          01010 01001
 
     int b = 4;
     for (int i = 0; i < 10; i++)
     {
-        if (i < 5) //01234
+        if (i < 5)                        // 01234
-        {       //i = 0 op 
+        {                                 // i = 0 op
-            output[4-i] = (lo_GCR & 1); //01010
+            output[4 - i] = (lo_GCR & 1); // 01010
 
-            //01010 -> & 00001 -> 00000 output[4] = 0
+            // 01010 -> & 00001 -> 00000 output[4] = 0
-            //00101 -> & 00001 -> 00001 output[3] = 1
+            // 00101 -> & 00001 -> 00001 output[3] = 1
-            //00010 -> & 00001 -> 00000 output[2] = 0
+            // 00010 -> & 00001 -> 00000 output[2] = 0
-            //00001 -> & 00001 -> 00001 output[1] = 1
+            // 00001 -> & 00001 -> 00001 output[1] = 1
-            //00000 -> & 00001 -> 00000 output[0] = 0
+            // 00000 -> & 00001 -> 00000 output[0] = 0
             lo_GCR >>= 1;
-        } else  
+        }
+        else
         {
-            output[i+b] = (hi_GCR & 1); //01001
+            output[i + b] = (hi_GCR & 1); // 01001
-            //01001 -> & 00001 -> 00001 output[9] = 1
+            // 01001 -> & 00001 -> 00001 output[9] = 1
-            //00100 -> & 00001 -> 00000 output[8] = 0
+            // 00100 -> & 00001 -> 00000 output[8] = 0
-            //00010 -> & 00001 -> 00000 output[7] = 0
+            // 00010 -> & 00001 -> 00000 output[7] = 0
-            //00001 -> & 00001 -> 00001 output[6] = 1
+            // 00001 -> & 00001 -> 00001 output[6] = 1
-            //00000 -> & 00001 -> 00000 output[5] = 0
+            // 00000 -> & 00001 -> 00000 output[5] = 0
             hi_GCR >>= 1;
-            b = b-2;
+            b = b - 2;
         }
     }
     return output;
 }
 
-class Commodore64Encoder : public AbstractEncoder
+class Commodore64Encoder : public Encoder
 {
 public:
-	Commodore64Encoder(const EncoderProto& config):
+    Commodore64Encoder(const EncoderProto& config):
-        AbstractEncoder(config),
+        Encoder(config),
-		_config(config.c64())
+        _config(config.c64())
-	{}
+    {
+    }
 
 public:
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
-
-        if (physicalSide == 0)
-        {
-            int logicalTrack = physicalTrack / 2;
-            unsigned numSectors = sectorsForTrack(logicalTrack);
-            for (int sectorId=0; sectorId<numSectors; sectorId++)
-            {
-                const auto& sector = image.get(logicalTrack, 0, sectorId);
-                if (sector)
-                    sectors.push_back(sector);
-            }
-        }
-
-		return sectors;
-	}
-
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
-            const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
     {
-        /* The format ID Character # 1 and # 2 are in the .d64 image only present
+        /* The format ID Character # 1 and # 2 are in the .d64 image only
-         * in track 18 sector zero which contains the BAM info in byte 162 and 163.
+         * present in track 18 sector zero which contains the BAM info in byte
-         * it is written in every header of every sector and track. headers are not
+         * 162 and 163. it is written in every header of every sector and track.
-         * stored in a d64 disk image so we have to get it from track 18 which
+         * headers are not stored in a d64 disk image so we have to get it from
-         * contains the BAM.
+         * track 18 which contains the BAM.
-        */
+         */
 
-        if (physicalSide != 0)
+        const auto& sectorData = image.get(
-            return std::unique_ptr<Fluxmap>();
+            C64_BAM_TRACK, 0, 0); // Read de BAM to get the DISK ID bytes
-
-        const auto& sectorData = image.get(C64_BAM_TRACK*2, 0, 0); //Read de BAM to get the DISK ID bytes
         if (sectorData)
         {
             ByteReader br(sectorData->data);
-            br.seek(162); //goto position of the first Disk ID Byte
+            br.seek(162); // goto position of the first Disk ID Byte
             _formatByte1 = br.read_8();
             _formatByte2 = br.read_8();
         }
         else
             _formatByte1 = _formatByte2 = 0;
-        
-        int logicalTrack = physicalTrack / 2;
-        double clockRateUs = clockRateUsForTrack(logicalTrack) * _config.clock_compensation_factor();
 
+        double clockRateUs = clockPeriodForC64Track(trackInfo->logicalTrack);
         int bitsPerRevolution = 200000.0 / clockRateUs;
 
         std::vector<bool> bits(bitsPerRevolution);
         unsigned cursor = 0;
 
-        fillBitmapTo(bits, cursor, _config.post_index_gap_us() / clockRateUs, { true, false });
+        fillBitmapTo(bits,
+            cursor,
+            _config.post_index_gap_us() / clockRateUs,
+            {true, false});
         lastBit = false;
 
         for (const auto& sector : sectors)
             writeSector(bits, cursor, sector);
 
         if (cursor >= bits.size())
-            Error() << fmt::format("track data overrun by {} bits", cursor - bits.size());
+            error("track data overrun by {} bits", cursor - bits.size());
-        fillBitmapTo(bits, cursor, bits.size(), { true, false });
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
 
         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-        fluxmap->appendBits(bits, clockRateUs*1e3);
+        fluxmap->appendBits(
+            bits, calculatePhysicalClockPeriod(clockRateUs * 1e3, 200e6));
         return fluxmap;
     }
 
 private:
-	void writeSector(std::vector<bool>& bits, unsigned& cursor, const std::shared_ptr<Sector>& sector) const
+    void writeSector(std::vector<bool>& bits,
+        unsigned& cursor,
+        std::shared_ptr<const Sector> sector) const
     {
-        /* Source: http://www.unusedino.de/ec64/technical/formats/g64.html 
+        /* Source: http://www.unusedino.de/ec64/technical/formats/g64.html
          * 1. Header sync       FF FF FF FF FF (40 'on' bits, not GCR)
          * 2. Header info       52 54 B5 29 4B 7A 5E 95 55 55 (10 GCR bytes)
          * 3. Header gap        55 55 55 55 55 55 55 55 55 (9 bytes, never read)
@@ -288,23 +216,26 @@ private:
          * 5. Data block        55...4A (325 GCR bytes)
          * 6. Inter-sector gap  55 55 55 55...55 55 (4 to 12 bytes, never read)
          * 1. Header sync       (SYNC for the next sector)
-        */
+         */
-        if ((sector->status == Sector::OK) or (sector->status == Sector::BAD_CHECKSUM))
+        if ((sector->status == Sector::OK) or
+            (sector->status == Sector::BAD_CHECKSUM))
         {
             // There is data to encode to disk.
             if ((sector->data.size() != C64_SECTOR_LENGTH))
-                Error() << fmt::format("unsupported sector size {} --- you must pick 256", sector->data.size());    
+                error("unsupported sector size {} --- you must pick 256",
+                    sector->data.size());
 
             // 1. Write header Sync (not GCR)
-            for (int i=0; i<6; i++)
+            for (int i = 0; i < 6; i++)
-                write_bits(bits, cursor, C64_HEADER_DATA_SYNC, 1*8); /* sync */
+                write_bits(
+                    bits, cursor, C64_HEADER_DATA_SYNC, 1 * 8); /* sync */
 
             // 2. Write Header info 10 GCR bytes
             /*
-             * The 10 byte header info (#2) is GCR encoded and must be decoded  to
+             * The 10 byte header info (#2) is GCR encoded and must be decoded
-             * it's normal 8 bytes to be understood. Once decoded, its breakdown is
+             * to it's normal 8 bytes to be understood. Once decoded, its
-             * as follows:
+             * breakdown is as follows:
-             * 
+             *
              * Byte $00 - header block ID           ($08)
              *   01 - header block checksum 16  (EOR of $02-$05)
              *   02 - Sector
@@ -313,11 +244,14 @@ private:
              *   05 - Format ID byte #1
              *   06-07 - $0F ("off" bytes)
              */
-            uint8_t encodedTrack = ((sector->logicalTrack) + 1); // C64 track numbering starts with 1. Fluxengine with 0.
+            uint8_t encodedTrack =
+                ((sector->logicalTrack) +
+                    1); // C64 track numbering starts with 1. Fluxengine with 0.
             uint8_t encodedSector = sector->logicalSector;
             // uint8_t formatByte1 = C64_FORMAT_ID_BYTE1;
             // uint8_t formatByte2 = C64_FORMAT_ID_BYTE2;
-            uint8_t headerChecksum = (encodedTrack ^ encodedSector ^ _formatByte1 ^ _formatByte2);
+            uint8_t headerChecksum =
+                (encodedTrack ^ encodedSector ^ _formatByte1 ^ _formatByte2);
             write_bits(bits, cursor, encode_data(C64_HEADER_BLOCK_ID));
             write_bits(bits, cursor, encode_data(headerChecksum));
             write_bits(bits, cursor, encode_data(encodedSector));
@@ -328,22 +262,26 @@ private:
             write_bits(bits, cursor, encode_data(C64_PADDING));
 
             // 3. Write header GAP not GCR
-            for (int i=0; i<9; i++)
+            for (int i = 0; i < 9; i++)
-                write_bits(bits, cursor, C64_HEADER_GAP, 1*8); /* header gap */
+                write_bits(
+                    bits, cursor, C64_HEADER_GAP, 1 * 8); /* header gap */
 
             // 4. Write Data sync not GCR
-            for (int i=0; i<6; i++)
+            for (int i = 0; i < 6; i++)
-                write_bits(bits, cursor, C64_HEADER_DATA_SYNC, 1*8); /* sync */
+                write_bits(
+                    bits, cursor, C64_HEADER_DATA_SYNC, 1 * 8); /* sync */
 
             // 5. Write data block 325 GCR bytes
             /*
-             * The 325 byte data block (#5) is GCR encoded and must be  decoded  to  its
+             * The 325 byte data block (#5) is GCR encoded and must be  decoded
-             * normal 260 bytes to be understood. The data block is made up of the following:
+             * to  its normal 260 bytes to be understood. The data block is made
-             * 
+             * up of the following:
+             *
              * Byte    $00 - data block ID ($07)
              *      01-100 - 256 bytes data
              *      101 - data block checksum (EOR of $01-100)
-             *      102-103 - $00 ("off" bytes, to make the sector size a multiple of 5)
+             *      102-103 - $00 ("off" bytes, to make the sector size a
+             * multiple of 5)
              */
 
             write_bits(bits, cursor, encode_data(C64_DATA_BLOCK_ID));
@@ -353,29 +291,28 @@ private:
             for (i = 0; i < C64_SECTOR_LENGTH; i++)
             {
                 uint8_t val = br.read_8();
-                write_bits(bits, cursor, encode_data(val));     
+                write_bits(bits, cursor, encode_data(val));
             }
             write_bits(bits, cursor, encode_data(dataChecksum));
             write_bits(bits, cursor, encode_data(C64_PADDING));
             write_bits(bits, cursor, encode_data(C64_PADDING));
 
-            //6. Write inter-sector gap 9 - 12 bytes nor gcr
+            // 6. Write inter-sector gap 9 - 12 bytes nor gcr
-            for (int i=0; i<9; i++)
+            for (int i = 0; i < 9; i++)
-                write_bits(bits, cursor, C64_INTER_SECTOR_GAP, 1*8); /* sync */
+                write_bits(
-
+                    bits, cursor, C64_INTER_SECTOR_GAP, 1 * 8); /* sync */
         }
     }
-        
+
 private:
-	const Commodore64EncoderProto& _config;
+    const Commodore64EncoderProto& _config;
-	uint8_t _formatByte1;
+    uint8_t _formatByte1;
-	uint8_t _formatByte2;
+    uint8_t _formatByte2;
 };
 
-std::unique_ptr<AbstractEncoder> createCommodore64Encoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createCommodore64Encoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new Commodore64Encoder(config));
+    return std::unique_ptr<Encoder>(new Commodore64Encoder(config));
 }
 
 // vim: sw=4 ts=4 et
-

arch/f85/decoder.cc

@@ -13,16 +13,18 @@
 
 const FluxPattern SECTOR_RECORD_PATTERN(24, F85_SECTOR_RECORD);
 const FluxPattern DATA_RECORD_PATTERN(24, F85_DATA_RECORD);
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
 static int decode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
+    case gcr:                \
-		#include "data_gcr.h"
+        return data;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
@@ -37,11 +39,11 @@ static Bytes decode(const std::vector<bool>& bits)
     while (ii != bits.end())
     {
         uint8_t inputfifo = 0;
-        for (size_t i=0; i<5; i++)
+        for (size_t i = 0; i < 5; i++)
         {
             if (ii == bits.end())
                 break;
-            inputfifo = (inputfifo<<1) | *ii++;
+            inputfifo = (inputfifo << 1) | *ii++;
         }
 
         bitw.push(decode_data_gcr(inputfifo), 4);
@@ -51,63 +53,58 @@ static Bytes decode(const std::vector<bool>& bits)
     return output;
 }
 
-class DurangoF85Decoder : public AbstractDecoder
+class DurangoF85Decoder : public Decoder
 {
 public:
-	DurangoF85Decoder(const DecoderProto& config):
+    DurangoF85Decoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_RECORD_PATTERN)
-			return RecordType::SECTOR_RECORD;
-		if (matcher == &DATA_RECORD_PATTERN)
-			return RecordType::DATA_RECORD;
-		return RecordType::UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		/* Skip sync bits and ID byte. */
+        /* Skip sync bits and ID byte. */
 
-		readRawBits(24);
+        if (readRaw24() != F85_SECTOR_RECORD)
+            return;
 
-		/* Read header. */
+        /* Read header. */
 
-		const auto& bytes = decode(readRawBits(6*10));
+        const auto& bytes = decode(readRawBits(6 * 10));
 
-		_sector->logicalSector = bytes[2];
+        _sector->logicalSector = bytes[2];
-		_sector->logicalSide = 0;
+        _sector->logicalSide = 0;
-		_sector->logicalTrack = bytes[0];
+        _sector->logicalTrack = bytes[0];
 
-		uint16_t wantChecksum = bytes.reader().seek(4).read_be16();
+        uint16_t wantChecksum = bytes.reader().seek(4).read_be16();
-		uint16_t gotChecksum = crc16(CCITT_POLY, 0xef21, bytes.slice(0, 4));
+        uint16_t gotChecksum = crc16(CCITT_POLY, 0xef21, bytes.slice(0, 4));
-		if (wantChecksum == gotChecksum)
+        if (wantChecksum == gotChecksum)
-			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+            _sector->status =
-	}
+                Sector::DATA_MISSING; /* unintuitive but correct */
+    }
 
-    void decodeDataRecord()
+    void decodeDataRecord() override
-	{
+    {
-		/* Skip sync bits ID byte. */
+        /* Skip sync bits ID byte. */
 
-		readRawBits(24);
+        if (readRaw24() != F85_DATA_RECORD)
+            return;
 
-		const auto& bytes = decode(readRawBits((F85_SECTOR_LENGTH+3)*10))
+        const auto& bytes = decode(readRawBits((F85_SECTOR_LENGTH + 3) * 10))
-			.slice(0, F85_SECTOR_LENGTH+3);
+                                .slice(0, F85_SECTOR_LENGTH + 3);
-		ByteReader br(bytes);
+        ByteReader br(bytes);
 
-		_sector->data = br.read(F85_SECTOR_LENGTH);
+        _sector->data = br.read(F85_SECTOR_LENGTH);
-		uint16_t wantChecksum = br.read_be16();
+        uint16_t wantChecksum = br.read_be16();
-		uint16_t gotChecksum = crc16(CCITT_POLY, 0xbf84, _sector->data);
+        uint16_t gotChecksum = crc16(CCITT_POLY, 0xbf84, _sector->data);
-		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+        _sector->status =
-	}
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createDurangoF85Decoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createDurangoF85Decoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new DurangoF85Decoder(config));
+    return std::unique_ptr<Decoder>(new DurangoF85Decoder(config));
 }
-

arch/f85/f85.h

@@ -2,9 +2,10 @@
 #define F85_H
 
 #define F85_SECTOR_RECORD 0xffffce /* 1111 1111 1111 1111 1100 1110 */
-#define F85_DATA_RECORD 0xffffcb /* 1111 1111 1111 1111 1100 1101 */
+#define F85_DATA_RECORD 0xffffcb   /* 1111 1111 1111 1111 1100 1101 */
-#define F85_SECTOR_LENGTH    512
+#define F85_SECTOR_LENGTH 512
 
-extern std::unique_ptr<AbstractDecoder> createDurangoF85Decoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createDurangoF85Decoder(
+    const DecoderProto& config);
 
 #endif

arch/fb100/decoder.cc

@@ -14,10 +14,10 @@
 
 const FluxPattern SECTOR_ID_PATTERN(16, 0xabaa);
 
-/* 
+/*
  * Reverse engineered from a dump of the floppy drive's ROM. I have no idea how
  * it works.
- * 
+ *
  * LF8BA:
  *         clra
  *         staa    X00B0
@@ -97,52 +97,46 @@ static uint16_t checksum(const Bytes& bytes)
     return (crchi << 8) | crclo;
 }
 
-class Fb100Decoder : public AbstractDecoder
+class Fb100Decoder : public Decoder
 {
 public:
-	Fb100Decoder(const DecoderProto& config):
+    Fb100Decoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(SECTOR_ID_PATTERN);
-		_sector->clock = _fmr->seekToPattern(SECTOR_ID_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_ID_PATTERN)
-			return RecordType::SECTOR_RECORD;
-		return RecordType::UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		auto rawbits = readRawBits(FB100_RECORD_SIZE*16);
+        auto rawbits = readRawBits(FB100_RECORD_SIZE * 16);
 
-		const Bytes bytes = decodeFmMfm(rawbits).slice(0, FB100_RECORD_SIZE);
+        const Bytes bytes = decodeFmMfm(rawbits).slice(0, FB100_RECORD_SIZE);
-		ByteReader br(bytes);
+        ByteReader br(bytes);
-		br.seek(1);
+        br.seek(1);
-		const Bytes id = br.read(FB100_ID_SIZE);
+        const Bytes id = br.read(FB100_ID_SIZE);
-		uint16_t wantIdCrc = br.read_be16();
+        uint16_t wantIdCrc = br.read_be16();
-		uint16_t gotIdCrc = checksum(id);
+        uint16_t gotIdCrc = checksum(id);
-		const Bytes payload = br.read(FB100_PAYLOAD_SIZE);
+        const Bytes payload = br.read(FB100_PAYLOAD_SIZE);
-		uint16_t wantPayloadCrc = br.read_be16();
+        uint16_t wantPayloadCrc = br.read_be16();
-		uint16_t gotPayloadCrc = checksum(payload);
+        uint16_t gotPayloadCrc = checksum(payload);
 
-		if (wantIdCrc != gotIdCrc)
+        if (wantIdCrc != gotIdCrc)
-			return;
+            return;
 
-		uint8_t abssector = id[2];
+        uint8_t abssector = id[2];
-		_sector->logicalTrack = abssector >> 1;
+        _sector->logicalTrack = abssector >> 1;
-		_sector->logicalSide = 0;
+        _sector->logicalSide = 0;
-		_sector->logicalSector = abssector & 1;
+        _sector->logicalSector = abssector & 1;
-		_sector->data.writer().append(id.slice(5, 12)).append(payload);
+        _sector->data.writer().append(id.slice(5, 12)).append(payload);
 
-		_sector->status = (wantPayloadCrc == gotPayloadCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+        _sector->status = (wantPayloadCrc == gotPayloadCrc)
-	}
+                              ? Sector::OK
+                              : Sector::BAD_CHECKSUM;
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createFb100Decoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createFb100Decoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new Fb100Decoder(config));
+    return std::unique_ptr<Decoder>(new Fb100Decoder(config));
 }
-
-

arch/fb100/fb100.h

@@ -5,7 +5,6 @@
 #define FB100_ID_SIZE 17
 #define FB100_PAYLOAD_SIZE 0x500
 
-extern std::unique_ptr<AbstractDecoder> createFb100Decoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createFb100Decoder(const DecoderProto& config);
 
 #endif
-

arch/ibm/decoder.cc

@@ -7,24 +7,25 @@
 #include "sector.h"
 #include "arch/ibm/ibm.pb.h"
 #include "proto.h"
+#include "lib/layout.h"
 #include <string.h>
 
 static_assert(std::is_trivially_copyable<IbmIdam>::value,
-		"IbmIdam is not trivially copyable");
+    "IbmIdam is not trivially copyable");
 
 /*
  * The markers at the beginning of records are special, and have
  * missing clock pulses, allowing them to be found by the logic.
- * 
+ *
  * IAM record:
  * flux:   XXXX-XXX-XXXX-X- = 0xf77a
  * clock:  X X - X - X X X  = 0xd7
  * data:    X X X X X X - - = 0xfc
- * 
+ *
  * (We just ignore this one --- it's useless and optional.)
  */
 
-/* 
+/*
  * IDAM record:
  * flux:   XXXX-X-X-XXXXXX- = 0xf57e
  * clock:  X X - - - X X X  = 0xc7
@@ -32,7 +33,7 @@ static_assert(std::is_trivially_copyable<IbmIdam>::value,
  */
 const FluxPattern FM_IDAM_PATTERN(16, 0xf57e);
 
-/* 
+/*
  * DAM1 record:
  * flux:   XXXX-X-X-XX-X-X- = 0xf56a
  * clock:  X X - - - X X X  = 0xc7
@@ -40,7 +41,7 @@ const FluxPattern FM_IDAM_PATTERN(16, 0xf57e);
  */
 const FluxPattern FM_DAM1_PATTERN(16, 0xf56a);
 
-/* 
+/*
  * DAM2 record:
  * flux:   XXXX-X-X-XX-XXXX = 0xf56f
  * clock:  X X - - - X X X  = 0xc7
@@ -48,7 +49,7 @@ const FluxPattern FM_DAM1_PATTERN(16, 0xf56a);
  */
 const FluxPattern FM_DAM2_PATTERN(16, 0xf56f);
 
-/* 
+/*
  * TRS80DAM1 record:
  * flux:   XXXX-X-X-XX-X-XX = 0xf56b
  * clock:  X X - - - X X X  = 0xc7
@@ -56,7 +57,7 @@ const FluxPattern FM_DAM2_PATTERN(16, 0xf56f);
  */
 const FluxPattern FM_TRS80DAM1_PATTERN(16, 0xf56b);
 
-/* 
+/*
  * TRS80DAM2 record:
  * flux:   XXXX-X-X-XX-XXX- = 0xf56e
  * clock:  X X - - - X X X  = 0xc7
@@ -72,122 +73,178 @@ const FluxPattern FM_TRS80DAM2_PATTERN(16, 0xf56e);
  *                       ^^^^^
  * When shifted out of phase, the special 0xa1 byte becomes an illegal
  * encoding (you can't do 10 00). So this can't be spoofed by user data.
- * 
+ *
  * shifted: 10 00 10 01 00 01 00 1
- * 
+ *
  * It's repeated three times.
  */
 const FluxPattern MFM_PATTERN(48, 0x448944894489LL);
 
-const FluxMatchers ANY_RECORD_PATTERN(
+const FluxMatchers ANY_RECORD_PATTERN({
-    {
+    &MFM_PATTERN,
-        &MFM_PATTERN,
+    &FM_IDAM_PATTERN,
-        &FM_IDAM_PATTERN,
+    &FM_DAM1_PATTERN,
-        &FM_DAM1_PATTERN,
+    &FM_DAM2_PATTERN,
-        &FM_DAM2_PATTERN,
+    &FM_TRS80DAM1_PATTERN,
-        &FM_TRS80DAM1_PATTERN,
+    &FM_TRS80DAM2_PATTERN,
-        &FM_TRS80DAM2_PATTERN,
+});
-    }
-);
 
-class IbmDecoder : public AbstractDecoder
+class IbmDecoder : public Decoder
 {
 public:
     IbmDecoder(const DecoderProto& config):
-		AbstractDecoder(config),
+        Decoder(config),
-		_config(config.ibm())
+        _config(config.ibm())
-    {}
+    {
+    }
 
-    RecordType advanceToNextRecord() override
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-
-		/* If this is the MFM prefix byte, the the decoder is going to expect three
-		 * extra bytes on the front of the header. */
-		_currentHeaderLength = (matcher == &MFM_PATTERN) ? 3 : 0;
-
-		Fluxmap::Position here = tell();
-		resetFluxDecoder();
-		if (_currentHeaderLength > 0)
-			readRawBits(_currentHeaderLength*16);
-		auto idbits = readRawBits(16);
-		const Bytes idbytes = decodeFmMfm(idbits);
-		uint8_t id = idbytes.slice(0, 1)[0];
-		seek(here);
-		
-		switch (id)
-		{
-			case IBM_IDAM:
-				return RecordType::SECTOR_RECORD;
-
-			case IBM_DAM1:
-			case IBM_DAM2:
-			case IBM_TRS80DAM1:
-			case IBM_TRS80DAM2:
-				return RecordType::DATA_RECORD;
-		}
-		return RecordType::UNKNOWN_RECORD;
-	}
 
     void decodeSectorRecord() override
-	{
+    {
-		unsigned recordSize = _currentHeaderLength + IBM_IDAM_LEN;
+        /* This is really annoying because the IBM record scheme has a
-		auto bits = readRawBits(recordSize*16);
+         * variable-sized header _and_ the checksum covers this header too. So
-		auto bytes = decodeFmMfm(bits).slice(0, recordSize);
+         * we have to read and decode a byte at a time until we know where the
+         * record itself starts, saving the bytes for the checksumming later.
+         */
 
-		ByteReader br(bytes);
+        Bytes bytes;
-		br.seek(_currentHeaderLength);
+        ByteWriter bw(bytes);
-		br.read_8(); /* skip ID byte */
-		_sector->logicalTrack = br.read_8();
-		_sector->logicalSide = br.read_8();
-		_sector->logicalSector = br.read_8();
-		_currentSectorSize = 1 << (br.read_8() + 7);
-		uint16_t wantCrc = br.read_be16();
-		uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, _currentHeaderLength + 5));
-		if (wantCrc == gotCrc)
-			_sector->status = Sector::DATA_MISSING; /* correct but unintuitive */
 
-		if (_config.swap_sides())
+        auto readByte = [&]()
-			_sector->logicalSide ^= 1;
+        {
-		if (_config.ignore_side_byte())
+            auto bits = readRawBits(16);
-			_sector->logicalSide = _sector->physicalHead;
+            auto bytes = decodeFmMfm(bits).slice(0, 1);
-		if (_config.ignore_track_byte())
+            uint8_t byte = bytes[0];
-			_sector->logicalTrack = _sector->physicalCylinder;
+            bw.write_8(byte);
-	}
+            return byte;
+        };
+
+        uint8_t id = readByte();
+        if (id == 0xa1)
+        {
+            readByte();
+            readByte();
+            id = readByte();
+        }
+        if (id != IBM_IDAM)
+            return;
+
+        ByteReader br(bytes);
+        br.seek(bw.pos);
+
+        auto bits = readRawBits(IBM_IDAM_LEN * 16);
+        bw += decodeFmMfm(bits).slice(0, IBM_IDAM_LEN);
+
+        IbmDecoderProto::TrackdataProto trackdata;
+        getTrackFormat(
+            trackdata, _sector->physicalTrack, _sector->physicalSide);
+
+        _sector->logicalTrack = br.read_8();
+        _sector->logicalSide = br.read_8();
+        _sector->logicalSector = br.read_8();
+        _currentSectorSize = 1 << (br.read_8() + 7);
+
+        uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, br.pos));
+        uint16_t wantCrc = br.read_be16();
+        if (wantCrc == gotCrc)
+            _sector->status =
+                Sector::DATA_MISSING; /* correct but unintuitive */
+
+        if (trackdata.ignore_side_byte())
+            _sector->logicalSide =
+                Layout::remapSidePhysicalToLogical(_sector->physicalSide);
+        _sector->logicalSide ^= trackdata.invert_side_byte();
+        if (trackdata.ignore_track_byte())
+            _sector->logicalTrack = _sector->physicalTrack;
+
+        for (int sector : trackdata.ignore_sector())
+            if (_sector->logicalSector == sector)
+            {
+                _sector->status = Sector::MISSING;
+                break;
+            }
+    }
 
     void decodeDataRecord() override
-	{
+    {
-		unsigned recordLength = _currentHeaderLength + _currentSectorSize + 3;
+        /* This is the same deal as the sector record. */
-		auto bits = readRawBits(recordLength*16);
-		auto bytes = decodeFmMfm(bits).slice(0, recordLength);
 
-		ByteReader br(bytes);
+        Bytes bytes;
-		br.seek(_currentHeaderLength);
+        ByteWriter bw(bytes);
-		br.read_8(); /* skip ID byte */
 
-		_sector->data = br.read(_currentSectorSize);
+        auto readByte = [&]()
-		uint16_t wantCrc = br.read_be16();
+        {
-		uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, recordLength-2));
+            auto bits = readRawBits(16);
-		_sector->status = (wantCrc == gotCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+            auto bytes = decodeFmMfm(bits).slice(0, 1);
-	}
+            uint8_t byte = bytes[0];
+            bw.write_8(byte);
+            return byte;
+        };
 
-	std::set<unsigned> requiredSectors(unsigned cylinder, unsigned head) const override
+        uint8_t id = readByte();
-	{
+        if (id == 0xa1)
-		std::set<unsigned> s;
+        {
-		for (int sectorId : _config.sectors().sector())
+            readByte();
-			s.insert(sectorId);
+            readByte();
-		return s;
+            id = readByte();
-	}
+        }
+        if ((id != IBM_DAM1) && (id != IBM_DAM2) && (id != IBM_TRS80DAM1) &&
+            (id != IBM_TRS80DAM2))
+            return;
+
+        ByteReader br(bytes);
+        br.seek(bw.pos);
+
+        auto bits = readRawBits((_currentSectorSize + 2) * 16);
+        bw += decodeFmMfm(bits).slice(0, _currentSectorSize + 2);
+
+        _sector->data = br.read(_currentSectorSize);
+        uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, br.pos));
+        uint16_t wantCrc = br.read_be16();
+        _sector->status =
+            (wantCrc == gotCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+
+        auto layout = Layout::getLayoutOfTrack(
+            _sector->logicalTrack, _sector->logicalSide);
+        if (_currentSectorSize != layout->sectorSize)
+            std::cerr << fmt::format(
+                "Warning: configured sector size for t{}.h{}.s{} is {} bytes "
+                "but that seen on disk is {} bytes\n",
+                _sector->logicalTrack,
+                _sector->logicalSide,
+                _sector->logicalSector,
+                layout->sectorSize,
+                _currentSectorSize);
+    }
 
 private:
-	const IbmDecoderProto& _config;
+    void getTrackFormat(IbmDecoderProto::TrackdataProto& trackdata,
+        unsigned track,
+        unsigned head) const
+    {
+        trackdata.Clear();
+        for (const auto& f : _config.trackdata())
+        {
+            if (f.has_track() && (f.track() != track))
+                continue;
+            if (f.has_head() && (f.head() != head))
+                continue;
+
+            trackdata.MergeFrom(f);
+        }
+    }
+
+private:
+    const IbmDecoderProto& _config;
     unsigned _currentSectorSize;
     unsigned _currentHeaderLength;
 };
 
-std::unique_ptr<AbstractDecoder> createIbmDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createIbmDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new IbmDecoder(config));
+    return std::unique_ptr<Decoder>(new IbmDecoder(config));
 }
-

arch/ibm/encoder.cc

@@ -3,11 +3,13 @@
 #include "encoders/encoders.h"
 #include "ibm.h"
 #include "crc.h"
-#include "writer.h"
+#include "readerwriter.h"
 #include "image.h"
 #include "arch/ibm/ibm.pb.h"
 #include "lib/encoders/encoders.pb.h"
 #include "fmt/format.h"
+#include "lib/proto.h"
+#include "lib/layout.h"
 #include <ctype.h>
 
 /* IAM record separator:
@@ -39,9 +41,9 @@
  *                       ^^^^^
  * When shifted out of phase, the special 0xa1 byte becomes an illegal
  * encoding (you can't do 10 00). So this can't be spoofed by user data.
- * 
+ *
  * shifted: 10 00 10 01 00 01 00 1
- * 
+ *
  * It's repeated three times.
  */
 #define MFM_RECORD_SEPARATOR 0x4489
@@ -59,228 +61,222 @@
 
 static uint8_t decodeUint16(uint16_t raw)
 {
-	Bytes b;
+    Bytes b;
-	ByteWriter bw(b);
+    ByteWriter bw(b);
-	bw.write_be16(raw);
+    bw.write_be16(raw);
-	return decodeFmMfm(b.toBits())[0];
+    return decodeFmMfm(b.toBits())[0];
 }
 
-class IbmEncoder : public AbstractEncoder
+class IbmEncoder : public Encoder
 {
 public:
-	IbmEncoder(const EncoderProto& config):
+    IbmEncoder(const EncoderProto& config):
-		AbstractEncoder(config),
+        Encoder(config),
-		_config(config.ibm())
+        _config(config.ibm())
-	{}
+    {
+    }
 
 private:
-	void writeRawBits(uint32_t data, int width)
+    void writeRawBits(uint32_t data, int width)
-	{
+    {
-		_cursor += width;
+        _cursor += width;
-		_lastBit = data & 1;
+        _lastBit = data & 1;
-		for (int i=0; i<width; i++)
+        for (int i = 0; i < width; i++)
-		{
+        {
-			unsigned pos = _cursor - i - 1;
+            unsigned pos = _cursor - i - 1;
-			if (pos < _bits.size())
+            if (pos < _bits.size())
-				_bits[pos] = data & 1;
+                _bits[pos] = data & 1;
-			data >>= 1;
+            data >>= 1;
-		}
+        }
-	}
+    }
 
-	void getTrackFormat(IbmEncoderProto::TrackdataProto& trackdata, unsigned cylinder, unsigned head)
+    void getEncoderTrackData(IbmEncoderProto::TrackdataProto& trackdata,
-	{
+        unsigned track,
-		trackdata.Clear();
+        unsigned head)
-		for (const auto& f : _config.trackdata())
+    {
-		{
+        trackdata.Clear();
-			if (f.has_cylinder() && (f.cylinder() != cylinder))
+        for (const auto& f : _config.trackdata())
-				continue;
+        {
-			if (f.has_head() && (f.head() != head))
+            if (f.has_track() && (f.track() != track))
-				continue;
+                continue;
+            if (f.has_head() && (f.head() != head))
+                continue;
 
-			trackdata.MergeFrom(f);
+            trackdata.MergeFrom(f);
-		}
+        }
-	}
+    }
 
 public:
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
-		IbmEncoderProto::TrackdataProto trackdata;
+    {
-		getTrackFormat(trackdata, physicalTrack, physicalSide);
+        IbmEncoderProto::TrackdataProto trackdata;
+        getEncoderTrackData(
+            trackdata, trackInfo->logicalTrack, trackInfo->logicalSide);
 
-		int logicalSide = physicalSide ^ trackdata.swap_sides();
+        auto trackLayout = Layout::getLayoutOfTrack(
-		for (int sectorId : trackdata.sectors().sector())
+            trackInfo->logicalTrack, trackInfo->logicalSide);
+
+        auto writeBytes = [&](const Bytes& bytes)
         {
-			const auto& sector = image.get(physicalTrack, logicalSide, sectorId);
+            if (trackdata.use_fm())
-			if (sector)
+                encodeFm(_bits, _cursor, bytes);
-				sectors.push_back(sector);
+            else
+                encodeMfm(_bits, _cursor, bytes, _lastBit);
+        };
+
+        auto writeFillerRawBytes = [&](int count, uint16_t byte)
+        {
+            for (int i = 0; i < count; i++)
+                writeRawBits(byte, 16);
+        };
+
+        auto writeFillerBytes = [&](int count, uint8_t byte)
+        {
+            Bytes b{byte};
+            for (int i = 0; i < count; i++)
+                writeBytes(b);
+        };
+
+        double clockRateUs = trackdata.target_clock_period_us();
+        if (!trackdata.use_fm())
+            clockRateUs /= 2.0;
+        int bitsPerRevolution =
+            (trackdata.target_rotational_period_ms() * 1000.0) / clockRateUs;
+        _bits.resize(bitsPerRevolution);
+        _cursor = 0;
+
+        uint8_t idamUnencoded = decodeUint16(trackdata.idam_byte());
+        uint8_t damUnencoded = decodeUint16(trackdata.dam_byte());
+
+        uint8_t sectorSize = 0;
+        {
+            int s = trackLayout->sectorSize >> 7;
+            while (s > 1)
+            {
+                s >>= 1;
+                sectorSize += 1;
+            }
         }
 
-		return sectors;
+        uint16_t gapFill = trackdata.gap_fill_byte();
-	}
 
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
+        writeFillerRawBytes(trackdata.gap0(), gapFill);
-			const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
+        if (trackdata.emit_iam())
-	{
+        {
-		IbmEncoderProto::TrackdataProto trackdata;
+            writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
-		getTrackFormat(trackdata, physicalTrack, physicalSide);
+            if (!trackdata.use_fm())
+            {
+                for (int i = 0; i < 3; i++)
+                    writeRawBits(MFM_IAM_SEPARATOR, 16);
+            }
+            writeRawBits(
+                trackdata.use_fm() ? FM_IAM_RECORD : MFM_IAM_RECORD, 16);
+            writeFillerRawBytes(trackdata.gap1(), gapFill);
+        }
 
-		auto writeBytes = [&](const Bytes& bytes)
+        bool first = true;
-		{
+        for (const auto& sectorData : sectors)
-			if (trackdata.use_fm())
+        {
-				encodeFm(_bits, _cursor, bytes);
+            if (!first)
-			else
+                writeFillerRawBytes(trackdata.gap3(), gapFill);
-				encodeMfm(_bits, _cursor, bytes, _lastBit);
+            first = false;
-		};
 
-		auto writeFillerBytes = [&](int count, uint8_t byte)
+            /* Writing the sector and data records are fantastically annoying.
-		{
+             * The CRC is calculated from the *very start* of the record, and
-			Bytes bytes = { byte };
+             * include the malformed marker bytes. Our encoder doesn't know
-			for (int i=0; i<count; i++)
+             * about this, of course, with the result that we have to construct
-				writeBytes(bytes);
+             * the unencoded header, calculate the checksum, and then use the
-		};
+             * same logic to emit the bytes which require special encoding
+             * before encoding the rest of the header normally. */
 
-		double clockRateUs = 1e3 / trackdata.clock_rate_khz();
+            {
-		if (!trackdata.use_fm())
+                Bytes header;
-			clockRateUs /= 2.0;
+                ByteWriter bw(header);
-		int bitsPerRevolution = (trackdata.track_length_ms() * 1000.0) / clockRateUs;
-		_bits.resize(bitsPerRevolution);
-		_cursor = 0;
 
-		uint8_t idamUnencoded = decodeUint16(trackdata.idam_byte());
+                writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
-		uint8_t damUnencoded = decodeUint16(trackdata.dam_byte());
+                if (!trackdata.use_fm())
+                {
+                    for (int i = 0; i < 3; i++)
+                        bw.write_8(MFM_RECORD_SEPARATOR_BYTE);
+                }
+                bw.write_8(idamUnencoded);
+                bw.write_8(sectorData->logicalTrack);
+                bw.write_8(
+                    sectorData->logicalSide ^ trackdata.invert_side_byte());
+                bw.write_8(sectorData->logicalSector);
+                bw.write_8(sectorSize);
+                uint16_t crc = crc16(CCITT_POLY, header);
+                bw.write_be16(crc);
 
-		uint8_t sectorSize = 0;
+                int conventionalHeaderStart = 0;
-		{
+                if (!trackdata.use_fm())
-			int s = trackdata.sector_size() >> 7;
+                {
-			while (s > 1)
+                    for (int i = 0; i < 3; i++)
-			{
+                        writeRawBits(MFM_RECORD_SEPARATOR, 16);
-				s >>= 1;
+                    conventionalHeaderStart += 3;
-				sectorSize += 1;
+                }
-			}
+                writeRawBits(trackdata.idam_byte(), 16);
-		}
+                conventionalHeaderStart += 1;
 
-		uint8_t gapFill = trackdata.use_fm() ? 0x00 : 0x4e;
+                writeBytes(header.slice(conventionalHeaderStart));
+            }
 
-		writeFillerBytes(trackdata.gap0(), gapFill);
+            writeFillerRawBytes(trackdata.gap2(), gapFill);
-		if (trackdata.emit_iam())
-		{
-			writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
-			if (!trackdata.use_fm())
-			{
-				for (int i=0; i<3; i++)
-					writeRawBits(MFM_IAM_SEPARATOR, 16);
-			}
-			writeRawBits(trackdata.use_fm() ? FM_IAM_RECORD : MFM_IAM_RECORD, 16);
-			writeFillerBytes(trackdata.gap1(), gapFill);
-		}
 
-		int logicalSide = physicalSide ^ trackdata.swap_sides();
+            {
-		bool first = true;
+                Bytes data;
-		for (int sectorId : trackdata.sectors().sector())
+                ByteWriter bw(data);
-		{
-			if (!first)
-				writeFillerBytes(trackdata.gap3(), gapFill);
-			first = false;
 
-			const auto& sectorData = image.get(physicalTrack, logicalSide, sectorId);
+                writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
-			if (!sectorData)
+                if (!trackdata.use_fm())
-				continue;
+                {
+                    for (int i = 0; i < 3; i++)
+                        bw.write_8(MFM_RECORD_SEPARATOR_BYTE);
+                }
+                bw.write_8(damUnencoded);
 
-			/* Writing the sector and data records are fantastically annoying.
+                Bytes truncatedData =
-			 * The CRC is calculated from the *very start* of the record, and
+                    sectorData->data.slice(0, trackLayout->sectorSize);
-			 * include the malformed marker bytes. Our encoder doesn't know
+                bw += truncatedData;
-			 * about this, of course, with the result that we have to construct
+                uint16_t crc = crc16(CCITT_POLY, data);
-			 * the unencoded header, calculate the checksum, and then use the
+                bw.write_be16(crc);
-			 * same logic to emit the bytes which require special encoding
-			 * before encoding the rest of the header normally. */
 
-			{
+                int conventionalHeaderStart = 0;
-				Bytes header;
+                if (!trackdata.use_fm())
-				ByteWriter bw(header);
+                {
+                    for (int i = 0; i < 3; i++)
+                        writeRawBits(MFM_RECORD_SEPARATOR, 16);
+                    conventionalHeaderStart += 3;
+                }
+                writeRawBits(trackdata.dam_byte(), 16);
+                conventionalHeaderStart += 1;
 
-				writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
+                writeBytes(data.slice(conventionalHeaderStart));
-				if (!trackdata.use_fm())
+            }
-				{
+        }
-					for (int i=0; i<3; i++)
-						bw.write_8(MFM_RECORD_SEPARATOR_BYTE);
-				}
-				bw.write_8(idamUnencoded);
-				bw.write_8(sectorData->logicalTrack);
-				bw.write_8(sectorData->logicalSide);
-				bw.write_8(sectorData->logicalSector);
-				bw.write_8(sectorSize);
-				uint16_t crc = crc16(CCITT_POLY, header);
-				bw.write_be16(crc);
 
-				int conventionalHeaderStart = 0;
+        if (_cursor >= _bits.size())
-				if (!trackdata.use_fm())
+            error("track data overrun");
-				{
+        while (_cursor < _bits.size())
-					for (int i=0; i<3; i++)
+            writeFillerRawBytes(1, gapFill);
-						writeRawBits(MFM_RECORD_SEPARATOR, 16);
-					conventionalHeaderStart += 3;
 
-				}
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-				writeRawBits(trackdata.idam_byte(), 16);
+        fluxmap->appendBits(_bits,
-				conventionalHeaderStart += 1;
+            calculatePhysicalClockPeriod(clockRateUs * 1e3,
-
+                trackdata.target_rotational_period_ms() * 1e6));
-				writeBytes(header.slice(conventionalHeaderStart));
+        return fluxmap;
-			}
+    }
-
-			writeFillerBytes(trackdata.gap2(), gapFill);
-
-			{
-				Bytes data;
-				ByteWriter bw(data);
-
-				writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
-				if (!trackdata.use_fm())
-				{
-					for (int i=0; i<3; i++)
-						bw.write_8(MFM_RECORD_SEPARATOR_BYTE);
-				}
-				bw.write_8(damUnencoded);
-
-				Bytes truncatedData = sectorData->data.slice(0, trackdata.sector_size());
-				bw += truncatedData;
-				uint16_t crc = crc16(CCITT_POLY, data);
-				bw.write_be16(crc);
-
-				int conventionalHeaderStart = 0;
-				if (!trackdata.use_fm())
-				{
-					for (int i=0; i<3; i++)
-						writeRawBits(MFM_RECORD_SEPARATOR, 16);
-					conventionalHeaderStart += 3;
-
-				}
-				writeRawBits(trackdata.dam_byte(), 16);
-				conventionalHeaderStart += 1;
-
-				writeBytes(data.slice(conventionalHeaderStart));
-			}
-		}
-
-		if (_cursor >= _bits.size())
-			Error() << "track data overrun";
-		while (_cursor < _bits.size())
-			writeFillerBytes(1, gapFill);
-
-		std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		fluxmap->appendBits(_bits, clockRateUs*1e3);
-		return fluxmap;
-	}
 
 private:
-	const IbmEncoderProto& _config;
+    const IbmEncoderProto& _config;
-	std::vector<bool> _bits;
+    std::vector<bool> _bits;
-	unsigned _cursor;
+    unsigned _cursor;
-	bool _lastBit;
+    bool _lastBit;
 };
 
-std::unique_ptr<AbstractEncoder> createIbmEncoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createIbmEncoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new IbmEncoder(config));
+    return std::unique_ptr<Encoder>(new IbmEncoder(config));
 }
-
-

arch/ibm/ibm.h

@@ -3,35 +3,35 @@
 
 /* IBM format (i.e. ordinary PC floppies). */
 
-#define IBM_MFM_SYNC   0xA1   /* sync byte for MFM */
+#define IBM_MFM_SYNC 0xA1  /* sync byte for MFM */
-#define IBM_IAM        0xFC   /* start-of-track record */
+#define IBM_IAM 0xFC       /* start-of-track record */
-#define IBM_IAM_LEN    1      /* plus prologue */
+#define IBM_IAM_LEN 1      /* plus prologue */
-#define IBM_IDAM       0xFE   /* sector header */
+#define IBM_IDAM 0xFE      /* sector header */
-#define IBM_IDAM_LEN   7      /* plus prologue */
+#define IBM_IDAM_LEN 7     /* plus prologue */
-#define IBM_DAM1       0xF8   /* sector data (type 1) */
+#define IBM_DAM1 0xF8      /* sector data (type 1) */
-#define IBM_DAM2       0xFB   /* sector data (type 2) */
+#define IBM_DAM2 0xFB      /* sector data (type 2) */
-#define IBM_TRS80DAM1  0xF9   /* sector data (TRS-80 directory) */
+#define IBM_TRS80DAM1 0xF9 /* sector data (TRS-80 directory) */
-#define IBM_TRS80DAM2  0xFA   /* sector data (TRS-80 directory) */
+#define IBM_TRS80DAM2 0xFA /* sector data (TRS-80 directory) */
-#define IBM_DAM_LEN    1      /* plus prologue and user data */
+#define IBM_DAM_LEN 1      /* plus prologue and user data */
 
 /* Length of a DAM record is determined by the previous sector header. */
 
 struct IbmIdam
 {
     uint8_t id;
-    uint8_t cylinder;
+    uint8_t track;
     uint8_t side;
     uint8_t sector;
     uint8_t sectorSize;
     uint8_t crc[2];
 };
 
-class AbstractEncoder;
+class Encoder;
-class AbstractDecoder;
+class Decoder;
 class DecoderProto;
 class EncoderProto;
 
-extern std::unique_ptr<AbstractDecoder> createIbmDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createIbmDecoder(const DecoderProto& config);
-extern std::unique_ptr<AbstractEncoder> createIbmEncoder(const EncoderProto& config);
+extern std::unique_ptr<Encoder> createIbmEncoder(const EncoderProto& config);
 
 #endif

arch/ibm/ibm.proto

@@ -2,32 +2,30 @@ syntax = "proto2";
 
 import "lib/common.proto";
 
-// Next: 7
 message IbmDecoderProto {
-	message SectorsProto {
+	// Next: 11
-		repeated int32 sector = 1            [(help) = "require these sectors to exist for a good read"];
+	message TrackdataProto {
+		optional int32 track = 7              [(help) = "if set, the format applies only to this track"];
+		optional int32 head = 8                  [(help) = "if set, the format applies only to this head"];
+
+		optional bool ignore_side_byte = 2       [default = false, (help) = "ignore side byte in sector header"];
+		optional bool ignore_track_byte = 6      [default = false, (help) = "ignore track byte in sector header"];
+		optional bool invert_side_byte = 4       [default = false, (help) = "invert the side byte in the sector header"];
+
+		repeated int32 ignore_sector = 10        [(help) = "sectors with these IDs will not be read"];
 	}
 
-	optional bool ignore_side_byte = 2       [default = false, (help) = "ignore side byte in sector header"];
+	repeated TrackdataProto trackdata = 1;
-	optional bool ignore_track_byte = 6      [default = false, (help) = "ignore track byte in sector header"];
-	optional bool swap_sides = 4             [default = false, (help) = "put logical side 1 on physical side 0"];
-	optional SectorsProto sectors = 5        [(help) = "require these sectors to exist for a good read"];
 }
 
 message IbmEncoderProto {
-	// Next: 18
+	// Next: 20
 	message TrackdataProto {
-		message SectorsProto {
+		optional int32 track = 15        [(help) = "if set, the format applies only to this track"];
-			repeated int32 sector = 1		[(help) = "write these sectors (in order) on each track"];
-		}
-
-		optional int32 cylinder = 15        [(help) = "if set, the format applies only to this track"];
 		optional int32 head = 16            [(help) = "if set, the format applies only to this head"];
 
-		optional double track_length_ms = 1 [(help) = "length of track"];
-		optional int32 sector_size = 2      [default=512, (help) = "number of bytes per sector"];
 		optional bool emit_iam = 3          [default=true, (help) = "whether to emit an IAM record"];
-		optional double clock_rate_khz = 5  [(help) = "data clock rate"];
+		optional double target_clock_period_us = 5  [default=4, (help) = "data clock rate on target disk"];
 		optional bool use_fm = 6            [default=false, (help) = "whether to use FM encoding rather than MFM"];
 		optional int32 idam_byte = 7        [default=0x5554, (help) = "16-bit raw bit pattern of IDAM byte"];
 		optional int32 dam_byte = 8         [default=0x5545, (help) = "16-bit raw bit pattern of DAM byte"];
@@ -35,8 +33,9 @@ message IbmEncoderProto {
 		optional int32 gap1 = 10            [default=50, (help) = "size of gap 2 (the post-ID gap)"];
 		optional int32 gap2 = 11            [default=22, (help) = "size of gap 3 (the pre-data gap)"];
 		optional int32 gap3 = 12            [default=80, (help) = "size of gap 4 (the post-data or format gap)"];
-		optional bool swap_sides = 14       [default=false, (help) = "swap side bytes when writing"];
+		optional bool invert_side_byte = 19 [default=false, (help) = "invert the side byte before writing"];
-		optional SectorsProto sectors = 17	[(help) = "write these sectors (in order) on each track"];
+		optional int32 gap_fill_byte = 18   [default=0x9254, (help) = "16-bit raw bit pattern of gap fill byte"];
+		optional double target_rotational_period_ms = 1 [default=200, (help) = "rotational period of target disk"];
 	}
 
 	repeated TrackdataProto trackdata = 1;

arch/macintosh/decoder.cc

@@ -12,22 +12,25 @@
 
 const FluxPattern SECTOR_RECORD_PATTERN(24, MAC_SECTOR_RECORD);
 const FluxPattern DATA_RECORD_PATTERN(24, MAC_DATA_RECORD);
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
 static int decode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
+    case gcr:                \
-		#include "data_gcr.h"
+        return data;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
 
-/* This is extremely inspired by the MESS implementation, written by Nathan Woods
+/* This is extremely inspired by the MESS implementation, written by Nathan
- * and R. Belmont: https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp
+ * Woods and R. Belmont:
+ * https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp
  */
 static Bytes decode_crazy_data(const Bytes& input, Sector::Status& status)
 {
@@ -41,7 +44,7 @@ static Bytes decode_crazy_data(const Bytes& input, Sector::Status& status)
     uint8_t b2[LOOKUP_LEN + 1];
     uint8_t b3[LOOKUP_LEN + 1];
 
-    for (int i=0; i<=LOOKUP_LEN; i++)
+    for (int i = 0; i <= LOOKUP_LEN; i++)
     {
         uint8_t w4 = br.read_8();
         uint8_t w1 = br.read_8();
@@ -122,97 +125,71 @@ uint8_t decode_side(uint8_t side)
     return !!(side & 0x20);
 }
 
-class MacintoshDecoder : public AbstractDecoder
+class MacintoshDecoder : public Decoder
 {
 public:
-	MacintoshDecoder(const DecoderProto& config):
+    MacintoshDecoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_RECORD_PATTERN)
-			return SECTOR_RECORD;
-		if (matcher == &DATA_RECORD_PATTERN)
-			return DATA_RECORD;
-		return UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		/* Skip ID (as we know it's a MAC_SECTOR_RECORD). */
+        if (readRaw24() != MAC_SECTOR_RECORD)
-		readRawBits(24);
+            return;
 
-		/* Read header. */
+        /* Read header. */
 
-		auto header = toBytes(readRawBits(7*8)).slice(0, 7);
+        auto header = toBytes(readRawBits(7 * 8)).slice(0, 7);
-					
-		uint8_t encodedTrack = decode_data_gcr(header[0]);
-		if (encodedTrack != (_sector->physicalCylinder & 0x3f))
-			return;
-					
-		uint8_t encodedSector = decode_data_gcr(header[1]);
-		uint8_t encodedSide = decode_data_gcr(header[2]);
-		uint8_t formatByte = decode_data_gcr(header[3]);
-		uint8_t wantedsum = decode_data_gcr(header[4]);
 
-		if (encodedSector > 11)
+        uint8_t encodedTrack = decode_data_gcr(header[0]);
-			return;
+        if (encodedTrack != (_sector->physicalTrack & 0x3f))
+            return;
 
-		_sector->logicalTrack = _sector->physicalCylinder;
+        uint8_t encodedSector = decode_data_gcr(header[1]);
-		_sector->logicalSide = decode_side(encodedSide);
+        uint8_t encodedSide = decode_data_gcr(header[2]);
-		_sector->logicalSector = encodedSector;
+        uint8_t formatByte = decode_data_gcr(header[3]);
-		uint8_t gotsum = (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f;
+        uint8_t wantedsum = decode_data_gcr(header[4]);
-		if (wantedsum == gotsum)
-			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
-	}
 
-    void decodeDataRecord()
+        if (encodedSector > 11)
-	{
+            return;
-		auto id = toBytes(readRawBits(24)).reader().read_be24();
-		if (id != MAC_DATA_RECORD)
-			return;
 
-		/* Read data. */
+        _sector->logicalTrack = _sector->physicalTrack;
+        _sector->logicalSide = decode_side(encodedSide);
+        _sector->logicalSector = encodedSector;
+        uint8_t gotsum =
+            (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f;
+        if (wantedsum == gotsum)
+            _sector->status =
+                Sector::DATA_MISSING; /* unintuitive but correct */
+    }
 
-		readRawBits(8); /* skip spare byte */
+    void decodeDataRecord() override
-		auto inputbuffer = toBytes(readRawBits(MAC_ENCODED_SECTOR_LENGTH*8))
+    {
-			.slice(0, MAC_ENCODED_SECTOR_LENGTH);
+        if (readRaw24() != MAC_DATA_RECORD)
+            return;
 
-		for (unsigned i=0; i<inputbuffer.size(); i++)
+        /* Read data. */
-			inputbuffer[i] = decode_data_gcr(inputbuffer[i]);
-			
-		_sector->status = Sector::BAD_CHECKSUM;
-		Bytes userData = decode_crazy_data(inputbuffer, _sector->status);
-		_sector->data.clear();
-		_sector->data.writer().append(userData.slice(12, 512)).append(userData.slice(0, 12));
-	}
 
-	std::set<unsigned> requiredSectors(unsigned cylinder, unsigned head) const
+        readRawBits(8); /* skip spare byte */
-	{
+        auto inputbuffer = toBytes(readRawBits(MAC_ENCODED_SECTOR_LENGTH * 8))
-		int count;
+                               .slice(0, MAC_ENCODED_SECTOR_LENGTH);
-		if (cylinder < 16)
-			count = 12;
-		else if (cylinder < 32)
-			count = 11;
-		else if (cylinder < 48)
-			count = 10;
-		else if (cylinder < 64)
-			count = 9;
-		else
-			count = 8;
 
-		std::set<unsigned> sectors;
+        for (unsigned i = 0; i < inputbuffer.size(); i++)
-		while (count--)
+            inputbuffer[i] = decode_data_gcr(inputbuffer[i]);
-			sectors.insert(count);
+
-		return sectors;
+        _sector->status = Sector::BAD_CHECKSUM;
-	}
+        Bytes userData = decode_crazy_data(inputbuffer, _sector->status);
+        _sector->data.clear();
+        _sector->data.writer()
+            .append(userData.slice(12, 512))
+            .append(userData.slice(0, 12));
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createMacintoshDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createMacintoshDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new MacintoshDecoder(config));
+    return std::unique_ptr<Decoder>(new MacintoshDecoder(config));
 }
-

arch/macintosh/encoder.cc

@@ -3,10 +3,11 @@
 #include "encoders/encoders.h"
 #include "macintosh.h"
 #include "crc.h"
-#include "writer.h"
+#include "readerwriter.h"
 #include "image.h"
 #include "fmt/format.h"
 #include "lib/encoders/encoders.pb.h"
+#include "lib/layout.h"
 #include "arch/macintosh/macintosh.pb.h"
 #include <ctype.h>
 
@@ -14,44 +15,46 @@ static bool lastBit;
 
 static double clockRateUsForTrack(unsigned track)
 {
-	if (track < 16)
+    if (track < 16)
-		return 2.623;
+        return 2.63;
-	if (track < 32)
+    if (track < 32)
-		return 2.861;
+        return 2.89;
-	if (track < 48)
+    if (track < 48)
-		return 3.148;
+        return 3.20;
-	if (track < 64)
+    if (track < 64)
-		return 3.497;
+        return 3.57;
-	return 3.934;
+    return 3.98;
 }
 
 static unsigned sectorsForTrack(unsigned track)
 {
-	if (track < 16)
+    if (track < 16)
-		return 12;
+        return 12;
-	if (track < 32)
+    if (track < 32)
-		return 11;
+        return 11;
-	if (track < 48)
+    if (track < 48)
-		return 10;
+        return 10;
-	if (track < 64)
+    if (track < 64)
-		return 9;
+        return 9;
-	return 8;
+    return 8;
 }
 
 static int encode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case data: return gcr;
+    case data:               \
-		#include "data_gcr.h"
+        return gcr;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
 
-/* This is extremely inspired by the MESS implementation, written by Nathan Woods
+/* This is extremely inspired by the MESS implementation, written by Nathan
- * and R. Belmont: https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp
+ * Woods and R. Belmont:
+ * https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp
  */
 static Bytes encode_crazy_data(const Bytes& input)
 {
@@ -59,7 +62,7 @@ static Bytes encode_crazy_data(const Bytes& input)
     ByteWriter bw(output);
     ByteReader br(input);
 
-	uint8_t w1, w2, w3, w4;
+    uint8_t w1, w2, w3, w4;
 
     static const int LOOKUP_LEN = MAC_SECTOR_LENGTH / 3;
 
@@ -67,92 +70,94 @@ static Bytes encode_crazy_data(const Bytes& input)
     uint8_t b2[LOOKUP_LEN + 1];
     uint8_t b3[LOOKUP_LEN + 1];
 
-	uint32_t c1 = 0;
+    uint32_t c1 = 0;
-	uint32_t c2 = 0;
+    uint32_t c2 = 0;
-	uint32_t c3 = 0;
+    uint32_t c3 = 0;
-	for (int j=0;; j++)
+    for (int j = 0;; j++)
-	{
+    {
-		c1 = (c1 & 0xff) << 1;
+        c1 = (c1 & 0xff) << 1;
-		if (c1 & 0x0100)
+        if (c1 & 0x0100)
-			c1++;
+            c1++;
 
-		uint8_t val = br.read_8();
+        uint8_t val = br.read_8();
-		c3 += val;
+        c3 += val;
-		if (c1 & 0x0100)
+        if (c1 & 0x0100)
-		{
+        {
-			c3++;
+            c3++;
-			c1 &= 0xff;
+            c1 &= 0xff;
-		}
+        }
-		b1[j] = (val ^ c1) & 0xff;
+        b1[j] = (val ^ c1) & 0xff;
 
-		val = br.read_8();
+        val = br.read_8();
-		c2 += val;
+        c2 += val;
-		if (c3 > 0xff)
+        if (c3 > 0xff)
-		{
+        {
-			c2++;
+            c2++;
-			c3 &= 0xff;
+            c3 &= 0xff;
-		}
+        }
-		b2[j] = (val ^ c3) & 0xff;
+        b2[j] = (val ^ c3) & 0xff;
 
-		if (br.pos == 524)
+        if (br.pos == 524)
-			break;
+            break;
 
-		val = br.read_8();
+        val = br.read_8();
-		c1 += val;
+        c1 += val;
-		if (c2 > 0xff)
+        if (c2 > 0xff)
-		{
+        {
-			c1++;
+            c1++;
-			c2 &= 0xff;
+            c2 &= 0xff;
-		}
+        }
-		b3[j] = (val ^ c2) & 0xff;
+        b3[j] = (val ^ c2) & 0xff;
-	}
+    }
-	uint32_t c4 = ((c1 & 0xc0) >> 6) | ((c2 & 0xc0) >> 4) | ((c3 & 0xc0) >> 2);
+    uint32_t c4 = ((c1 & 0xc0) >> 6) | ((c2 & 0xc0) >> 4) | ((c3 & 0xc0) >> 2);
-	b3[LOOKUP_LEN] = 0;
+    b3[LOOKUP_LEN] = 0;
 
-	for (int i = 0; i <= LOOKUP_LEN; i++)
+    for (int i = 0; i <= LOOKUP_LEN; i++)
-	{
+    {
-		w1 = b1[i] & 0x3f;
+        w1 = b1[i] & 0x3f;
-		w2 = b2[i] & 0x3f;
+        w2 = b2[i] & 0x3f;
-		w3 = b3[i] & 0x3f;
+        w3 = b3[i] & 0x3f;
-		w4 =  ((b1[i] & 0xc0) >> 2);
+        w4 = ((b1[i] & 0xc0) >> 2);
-		w4 |= ((b2[i] & 0xc0) >> 4);
+        w4 |= ((b2[i] & 0xc0) >> 4);
-		w4 |= ((b3[i] & 0xc0) >> 6);
+        w4 |= ((b3[i] & 0xc0) >> 6);
 
-		bw.write_8(w4);
+        bw.write_8(w4);
-		bw.write_8(w1);
+        bw.write_8(w1);
-		bw.write_8(w2);
+        bw.write_8(w2);
 
-		if (i != LOOKUP_LEN)
+        if (i != LOOKUP_LEN)
-			bw.write_8(w3);
+            bw.write_8(w3);
-	}
+    }
 
-	bw.write_8(c4 & 0x3f);
+    bw.write_8(c4 & 0x3f);
-	bw.write_8(c3 & 0x3f);
+    bw.write_8(c3 & 0x3f);
-	bw.write_8(c2 & 0x3f);
+    bw.write_8(c2 & 0x3f);
-	bw.write_8(c1 & 0x3f);
+    bw.write_8(c1 & 0x3f);
 
-	return output;
+    return output;
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
 {
-	for (bool bit : src)
+    for (bool bit : src)
-	{
+    {
-		if (cursor < bits.size())
+        if (cursor < bits.size())
-			bits[cursor++] = bit;
+            bits[cursor++] = bit;
-	}
+    }
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
 {
-	cursor += width;
+    cursor += width;
-	for (int i=0; i<width; i++)
+    for (int i = 0; i < width; i++)
-	{
+    {
-		unsigned pos = cursor - i - 1;
+        unsigned pos = cursor - i - 1;
-		if (pos < bits.size())
+        if (pos < bits.size())
-			bits[pos] = data & 1;
+            bits[pos] = data & 1;
-		data >>= 1;
+        data >>= 1;
-	}
+    }
 }
 
 static uint8_t encode_side(uint8_t track, uint8_t side)
@@ -161,103 +166,93 @@ static uint8_t encode_side(uint8_t track, uint8_t side)
      * bit 5) and also whether we're above track 0x3f (in bit 0).
      */
 
-	return (side ? 0x20 : 0x00) | ((track>0x3f) ? 0x01 : 0x00);
+    return (side ? 0x20 : 0x00) | ((track > 0x3f) ? 0x01 : 0x00);
 }
 
-static void write_sector(std::vector<bool>& bits, unsigned& cursor, const std::shared_ptr<Sector>& sector)
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
 {
-	if ((sector->data.size() != 512) && (sector->data.size() != 524))
+    if ((sector->data.size() != 512) && (sector->data.size() != 524))
-		Error() << "unsupported sector size --- you must pick 512 or 524";
+        error("unsupported sector size --- you must pick 512 or 524");
 
-	write_bits(bits, cursor, 0xff, 1*8); /* pad byte */
+    write_bits(bits, cursor, 0xff, 1 * 8); /* pad byte */
-	for (int i=0; i<7; i++)
+    for (int i = 0; i < 7; i++)
-		write_bits(bits, cursor, 0xff3fcff3fcffLL, 6*8); /* sync */
+        write_bits(bits, cursor, 0xff3fcff3fcffLL, 6 * 8); /* sync */
-	write_bits(bits, cursor, MAC_SECTOR_RECORD, 3*8);
+    write_bits(bits, cursor, MAC_SECTOR_RECORD, 3 * 8);
 
     uint8_t encodedTrack = sector->logicalTrack & 0x3f;
-	uint8_t encodedSector = sector->logicalSector;
+    uint8_t encodedSector = sector->logicalSector;
-	uint8_t encodedSide = encode_side(sector->logicalTrack, sector->logicalSide);
+    uint8_t encodedSide =
-	uint8_t formatByte = MAC_FORMAT_BYTE;
+        encode_side(sector->logicalTrack, sector->logicalSide);
-	uint8_t headerChecksum = (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f;
+    uint8_t formatByte = MAC_FORMAT_BYTE;
+    uint8_t headerChecksum =
+        (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f;
 
-	write_bits(bits, cursor, encode_data_gcr(encodedTrack), 1*8);
+    write_bits(bits, cursor, encode_data_gcr(encodedTrack), 1 * 8);
-	write_bits(bits, cursor, encode_data_gcr(encodedSector), 1*8);
+    write_bits(bits, cursor, encode_data_gcr(encodedSector), 1 * 8);
-	write_bits(bits, cursor, encode_data_gcr(encodedSide), 1*8);
+    write_bits(bits, cursor, encode_data_gcr(encodedSide), 1 * 8);
-	write_bits(bits, cursor, encode_data_gcr(formatByte), 1*8);
+    write_bits(bits, cursor, encode_data_gcr(formatByte), 1 * 8);
-	write_bits(bits, cursor, encode_data_gcr(headerChecksum), 1*8);
+    write_bits(bits, cursor, encode_data_gcr(headerChecksum), 1 * 8);
 
-	write_bits(bits, cursor, 0xdeaaff, 3*8);
+    write_bits(bits, cursor, 0xdeaaff, 3 * 8);
-	write_bits(bits, cursor, 0xff3fcff3fcffLL, 6*8); /* sync */
+    write_bits(bits, cursor, 0xff3fcff3fcffLL, 6 * 8); /* sync */
-	write_bits(bits, cursor, MAC_DATA_RECORD, 3*8);
+    write_bits(bits, cursor, MAC_DATA_RECORD, 3 * 8);
-	write_bits(bits, cursor, encode_data_gcr(sector->logicalSector), 1*8);
+    write_bits(bits, cursor, encode_data_gcr(sector->logicalSector), 1 * 8);
 
-	Bytes wireData;
+    Bytes wireData;
-	wireData.writer().append(sector->data.slice(512, 12)).append(sector->data.slice(0, 512));
+    wireData.writer()
-	for (uint8_t b : encode_crazy_data(wireData))
+        .append(sector->data.slice(512, 12))
-		write_bits(bits, cursor, encode_data_gcr(b), 1*8);
+        .append(sector->data.slice(0, 512));
+    for (uint8_t b : encode_crazy_data(wireData))
+        write_bits(bits, cursor, encode_data_gcr(b), 1 * 8);
 
-	write_bits(bits, cursor, 0xdeaaff, 3*8);
+    write_bits(bits, cursor, 0xdeaaff, 3 * 8);
 }
 
-class MacintoshEncoder : public AbstractEncoder
+class MacintoshEncoder : public Encoder
 {
 public:
-	MacintoshEncoder(const EncoderProto& config):
+    MacintoshEncoder(const EncoderProto& config):
-		AbstractEncoder(config),
+        Encoder(config),
-		_config(config.macintosh())
+        _config(config.macintosh())
-	{}
+    {
+    }
 
 public:
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
+    {
+        double clockRateUs = clockRateUsForTrack(trackInfo->logicalTrack);
+        int bitsPerRevolution = 200000.0 / clockRateUs;
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
 
-		if ((physicalTrack >= 0) && (physicalTrack < MAC_TRACKS_PER_DISK))
+        fillBitmapTo(bits,
-        {
+            cursor,
-            unsigned numSectors = sectorsForTrack(physicalTrack);
+            _config.post_index_gap_us() / clockRateUs,
-            for (int sectorId=0; sectorId<numSectors; sectorId++)
+            {true, false});
-            {
+        lastBit = false;
-                const auto& sector = image.get(physicalTrack, physicalSide, sectorId);
-                if (sector)
-                    sectors.push_back(sector);
-            }
-        }
 
-		return sectors;
+        for (const auto& sector : sectors)
-	}
+            write_sector(bits, cursor, sector);
 
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
+        if (cursor >= bits.size())
-			const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
+            error("track data overrun by {} bits", cursor - bits.size());
-	{
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
-		if ((physicalTrack < 0) || (physicalTrack >= MAC_TRACKS_PER_DISK))
-			return std::unique_ptr<Fluxmap>();
 
-		double clockRateUs = clockRateUsForTrack(physicalTrack) * _config.clock_compensation_factor();
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		int bitsPerRevolution = 200000.0 / clockRateUs;
+        fluxmap->appendBits(
-		std::vector<bool> bits(bitsPerRevolution);
+            bits, calculatePhysicalClockPeriod(clockRateUs * 1e3, 200e6));
-		unsigned cursor = 0;
+        return fluxmap;
-
+    }
-		fillBitmapTo(bits, cursor, _config.post_index_gap_us() / clockRateUs, { true, false });
-		lastBit = false;
-
-		for (const auto& sector : sectors)
-			write_sector(bits, cursor, sector);
-
-		if (cursor >= bits.size())
-			Error() << fmt::format("track data overrun by {} bits", cursor - bits.size());
-		fillBitmapTo(bits, cursor, bits.size(), { true, false });
-
-		std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		fluxmap->appendBits(bits, clockRateUs*1e3);
-		return fluxmap;
-	}
 
 private:
-	const MacintoshEncoderProto& _config;
+    const MacintoshEncoderProto& _config;
 };
 
-std::unique_ptr<AbstractEncoder> createMacintoshEncoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createMacintoshEncoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new MacintoshEncoder(config));
+    return std::unique_ptr<Encoder>(new MacintoshEncoder(config));
 }
-

arch/macintosh/macintosh.h

@@ -1,22 +1,23 @@
 #ifndef MACINTOSH_H
 #define MACINTOSH_H
 
-#define MAC_SECTOR_RECORD   0xd5aa96 /* 1101 0101 1010 1010 1001 0110 */
+#define MAC_SECTOR_RECORD 0xd5aa96 /* 1101 0101 1010 1010 1001 0110 */
-#define MAC_DATA_RECORD     0xd5aaad /* 1101 0101 1010 1010 1010 1101 */
+#define MAC_DATA_RECORD 0xd5aaad   /* 1101 0101 1010 1010 1010 1101 */
 
-#define MAC_SECTOR_LENGTH   524 /* yes, really */
+#define MAC_SECTOR_LENGTH 524 /* yes, really */
 #define MAC_ENCODED_SECTOR_LENGTH 703
-#define MAC_FORMAT_BYTE     0x22
+#define MAC_FORMAT_BYTE 0x22
 
 #define MAC_TRACKS_PER_DISK 80
 
-class AbstractEncoder;
+class Encoder;
-class AbstractDecoder;
+class Decoder;
 class DecoderProto;
 class EncoderProto;
 
-extern std::unique_ptr<AbstractDecoder> createMacintoshDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createMacintoshDecoder(
-extern std::unique_ptr<AbstractEncoder> createMacintoshEncoder(const EncoderProto& config);
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createMacintoshEncoder(
+    const EncoderProto& config);
 
 #endif
-

arch/macintosh/macintosh.proto

@@ -7,8 +7,5 @@ message MacintoshDecoderProto {}
 message MacintoshEncoderProto {
 	optional double post_index_gap_us = 1 [default = 0.0,
 		(help) = "post-index gap before first sector header (microseconds)."];
-
-	optional double clock_compensation_factor = 2 [default = 1.0,
-		(help) = "scale the output clock by this much."];
 }
 

arch/micropolis/decoder.cc

@@ -6,70 +6,202 @@
 #include "micropolis.h"
 #include "bytes.h"
 #include "fmt/format.h"
+#include "lib/decoders/decoders.pb.h"
 
-/* The sector has a preamble of MFM 0x00s and uses 0xFF as a sync pattern. */
+/* The sector has a preamble of MFM 0x00s and uses 0xFF as a sync pattern.
-static const FluxPattern SECTOR_SYNC_PATTERN(32, 0xaaaa5555);
+ *
+ * 00        00        00        F         F
+ * 0000 0000 0000 0000 0000 0000 0101 0101 0101 0101
+ * A    A    A    A    A    A    5    5    5    5
+ */
+static const FluxPattern SECTOR_SYNC_PATTERN(64, 0xAAAAAAAAAAAA5555LL);
 
-/* Adds all bytes, with carry. */
+/* Pattern to skip past current SYNC. */
-uint8_t micropolisChecksum(const Bytes& bytes) {
+static const FluxPattern SECTOR_ADVANCE_PATTERN(64, 0xAAAAAAAAAAAAAAAALL);
-	ByteReader br(bytes);
+
-	uint16_t sum = 0;
+/* Standard Micropolis checksum.  Adds all bytes, with carry. */
-	while (!br.eof()) {
+uint8_t micropolisChecksum(const Bytes& bytes)
-		if (sum > 0xFF) {
+{
-			sum -= 0x100 - 1;
+    ByteReader br(bytes);
-		}
+    uint16_t sum = 0;
-		sum += br.read_8();
+    while (!br.eof())
-	}
+    {
-	/* The last carry is ignored */
+        if (sum > 0xFF)
-	return sum & 0xFF;
+        {
+            sum -= 0x100 - 1;
+        }
+        sum += br.read_8();
+    }
+    /* The last carry is ignored */
+    return sum & 0xFF;
 }
 
-class MicropolisDecoder : public AbstractDecoder
+/* Vector MZOS does not use the standard Micropolis checksum.
+ * The checksum is initially 0.
+ * For each data byte in the 256-byte payload, rotate left,
+ * carrying bit 7 to bit 0.  XOR with the current checksum.
+ *
+ * Unlike the Micropolis checksum, this does not cover the 12-byte
+ * header (track, sector, 10 OS-specific bytes.)
+ */
+uint8_t mzosChecksum(const Bytes& bytes)
+{
+    ByteReader br(bytes);
+    uint8_t checksum = 0;
+    uint8_t databyte;
+
+    while (!br.eof())
+    {
+        databyte = br.read_8();
+        checksum ^= ((databyte << 1) | (databyte >> 7));
+    }
+
+    return checksum;
+}
+
+class MicropolisDecoder : public Decoder
 {
 public:
-	MicropolisDecoder(const DecoderProto& config):
+    MicropolisDecoder(const DecoderProto& config):
-		AbstractDecoder(config)
+        Decoder(config),
-	{}
+        _config(config.micropolis())
+    {
+        _checksumType = _config.checksum_type();
+    }
 
-	RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		_fmr->seekToIndexMark();
+        nanoseconds_t now = tell().ns();
-		const FluxMatcher* matcher = nullptr;
-		_sector->clock = _fmr->seekToPattern(SECTOR_SYNC_PATTERN, matcher);
-		if (matcher == &SECTOR_SYNC_PATTERN) {
-			readRawBits(16);
-			return SECTOR_RECORD;
-		}
-		return UNKNOWN_RECORD;
-	}
 
-	void decodeSectorRecord()
+        /* For all but the first sector, seek to the next sector pulse.
-	{
+         * The first sector does not contain the sector pulse in the fluxmap.
-		auto rawbits = readRawBits(MICROPOLIS_ENCODED_SECTOR_SIZE*16);
+         */
-		auto bytes = decodeFmMfm(rawbits).slice(0, MICROPOLIS_ENCODED_SECTOR_SIZE);
+        if (now != 0)
-		ByteReader br(bytes);
+        {
+            seekToIndexMark();
+            now = tell().ns();
+        }
 
-		br.read_8();  /* sync */
+        /* Discard a possible partial sector at the end of the track.
-		_sector->logicalTrack = br.read_8();
+         * This partial sector could be mistaken for a conflicted sector, if
-		_sector->logicalSide = _sector->physicalHead;
+         * whatever data read happens to match the checksum of 0, which is
-		_sector->logicalSector = br.read_8();
+         * rare, but has been observed on some disks.
-		if (_sector->logicalSector > 15)
+         */
-			return;
+        if (now > (getFluxmapDuration() - 12.5e6))
-		if (_sector->logicalTrack > 77)
+        {
-			return;
+            seekToIndexMark();
+            return 0;
+        }
 
-		br.read(10);  /* OS data or padding */
+        nanoseconds_t clock = seekToPattern(SECTOR_SYNC_PATTERN);
-		_sector->data = br.read(256);
-		uint8_t wantChecksum = br.read_8();
-		uint8_t gotChecksum = micropolisChecksum(bytes.slice(1, 2+266));
-		br.read(5);  /* 4 byte ECC and ECC-present flag */
 
-		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+        auto syncDelta = tell().ns() - now;
-	}
+        /* Due to the weak nature of the Micropolis SYNC patern,
+         * it's possible to detect a false SYNC during the gap
+         * between the sector pulse and the write gate.  If the SYNC
+         * is detected less than 100uS after the sector pulse, search
+         * for another valid SYNC.
+         *
+         * Reference: Vector Micropolis Disk Controller Board Technical
+         * Information Manual, pp. 1-16.
+         */
+        if ((syncDelta > 0) && (syncDelta < 100e3))
+        {
+            seekToPattern(SECTOR_ADVANCE_PATTERN);
+            clock = seekToPattern(SECTOR_SYNC_PATTERN);
+        }
+
+        _sector->headerStartTime = tell().ns();
+
+        /* seekToPattern() can skip past the index hole, if this happens
+         * too close to the end of the Fluxmap, discard the sector.
+         */
+        if (_sector->headerStartTime > (getFluxmapDuration() - 12.5e6))
+        {
+            return 0;
+        }
+
+        return clock;
+    }
+
+    void decodeSectorRecord() override
+    {
+        readRawBits(48);
+        auto rawbits = readRawBits(MICROPOLIS_ENCODED_SECTOR_SIZE * 16);
+        auto bytes =
+            decodeFmMfm(rawbits).slice(0, MICROPOLIS_ENCODED_SECTOR_SIZE);
+        ByteReader br(bytes);
+
+        int syncByte = br.read_8(); /* sync */
+        if (syncByte != 0xFF)
+            return;
+
+        _sector->logicalTrack = br.read_8();
+        _sector->logicalSide = _sector->physicalSide;
+        _sector->logicalSector = br.read_8();
+        if (_sector->logicalSector > 15)
+            return;
+        if (_sector->logicalTrack > 76)
+            return;
+        if (_sector->logicalTrack != _sector->physicalTrack)
+            return;
+
+        br.read(10); /* OS data or padding */
+        auto data = br.read(MICROPOLIS_PAYLOAD_SIZE);
+        uint8_t wantChecksum = br.read_8();
+
+        /* If not specified, automatically determine the checksum type.
+         * Once the checksum type is determined, it will be used for the
+         * entire disk.
+         */
+        if (_checksumType == MicropolisDecoderProto::AUTO)
+        {
+            /* Calculate both standard Micropolis (MDOS, CP/M, OASIS) and MZOS
+             * checksums */
+            if (wantChecksum == micropolisChecksum(bytes.slice(1, 2 + 266)))
+            {
+                _checksumType = MicropolisDecoderProto::MICROPOLIS;
+            }
+            else if (wantChecksum ==
+                     mzosChecksum(bytes.slice(
+                         MICROPOLIS_HEADER_SIZE, MICROPOLIS_PAYLOAD_SIZE)))
+            {
+                _checksumType = MicropolisDecoderProto::MZOS;
+                std::cout << "Note: MZOS checksum detected." << std::endl;
+            }
+        }
+
+        uint8_t gotChecksum;
+
+        if (_checksumType == MicropolisDecoderProto::MZOS)
+        {
+            gotChecksum = mzosChecksum(
+                bytes.slice(MICROPOLIS_HEADER_SIZE, MICROPOLIS_PAYLOAD_SIZE));
+        }
+        else
+        {
+            gotChecksum = micropolisChecksum(bytes.slice(1, 2 + 266));
+        }
+
+        br.read(5); /* 4 byte ECC and ECC-present flag */
+
+        if (_config.sector_output_size() == MICROPOLIS_PAYLOAD_SIZE)
+            _sector->data = data;
+        else if (_config.sector_output_size() == MICROPOLIS_ENCODED_SECTOR_SIZE)
+            _sector->data = bytes;
+        else
+            error("Sector output size may only be 256 or 275");
+        _sector->status =
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
+
+private:
+    const MicropolisDecoderProto& _config;
+    MicropolisDecoderProto_ChecksumType
+        _checksumType; /* -1 = auto, 1 = Micropolis, 2=MZOS */
 };
 
-std::unique_ptr<AbstractDecoder> createMicropolisDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createMicropolisDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new MicropolisDecoder(config));
+    return std::unique_ptr<Decoder>(new MicropolisDecoder(config));
 }
-

arch/micropolis/encoder.cc

@@ -6,108 +6,106 @@
 #include "image.h"
 #include "lib/encoders/encoders.pb.h"
 
-static void write_sector(std::vector<bool>& bits, unsigned& cursor, const std::shared_ptr<Sector>& sector)
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
 {
-	if ((sector->data.size() != 256) && (sector->data.size() != MICROPOLIS_ENCODED_SECTOR_SIZE))
+    if ((sector->data.size() != 256) &&
-		Error() << "unsupported sector size --- you must pick 256 or 275";
+        (sector->data.size() != MICROPOLIS_ENCODED_SECTOR_SIZE))
+        error("unsupported sector size --- you must pick 256 or 275");
 
-	int fullSectorSize = 40 + MICROPOLIS_ENCODED_SECTOR_SIZE + 40 + 35;
+    int fullSectorSize = 40 + MICROPOLIS_ENCODED_SECTOR_SIZE + 40 + 35;
-	auto fullSector = std::make_shared<std::vector<uint8_t>>();
+    auto fullSector = std::make_shared<std::vector<uint8_t>>();
-	fullSector->reserve(fullSectorSize);
+    fullSector->reserve(fullSectorSize);
-	/* sector preamble */
+    /* sector preamble */
-	for (int i=0; i<40; i++)
+    for (int i = 0; i < 40; i++)
-		fullSector->push_back(0);
+        fullSector->push_back(0);
-	Bytes sectorData;
+    Bytes sectorData;
-	if (sector->data.size() == MICROPOLIS_ENCODED_SECTOR_SIZE)
+    if (sector->data.size() == MICROPOLIS_ENCODED_SECTOR_SIZE)
-		sectorData = sector->data;
+    {
-	else
+        if (sector->data[0] != 0xFF)
-	{
+            error(
-		ByteWriter writer(sectorData);
+                "275 byte sector doesn't start with sync byte 0xFF. "
-		writer.write_8(0xff); /* Sync */
+                "Corrupted sector");
-		writer.write_8(sector->logicalTrack);
+        uint8_t wantChecksum = sector->data[1 + 2 + 266];
-		writer.write_8(sector->logicalSector);
+        uint8_t gotChecksum =
-		for (int i=0; i<10; i++)
+            micropolisChecksum(sector->data.slice(1, 2 + 266));
-			writer.write_8(0); /* Padding */
+        if (wantChecksum != gotChecksum)
-		writer += sector->data;
+            std::cerr << "Warning: checksum incorrect. Sector: "
-		writer.write_8(micropolisChecksum(sectorData.slice(1)));
+                      << sector->logicalSector << std::endl;
-		for (int i=0; i<5; i++)
+        sectorData = sector->data;
-			writer.write_8(0); /* 4 byte ECC and ECC not present flag */
+    }
-	}
+    else
-	for (uint8_t b : sectorData)
+    {
-		fullSector->push_back(b);
+        ByteWriter writer(sectorData);
-	/* sector postamble */
+        writer.write_8(0xff); /* Sync */
-	for (int i=0; i<40; i++)
+        writer.write_8(sector->logicalTrack);
-		fullSector->push_back(0);
+        writer.write_8(sector->logicalSector);
-	/* filler */
+        for (int i = 0; i < 10; i++)
-	for (int i=0; i<35; i++)
+            writer.write_8(0); /* Padding */
-		fullSector->push_back(0);
+        writer += sector->data;
+        writer.write_8(micropolisChecksum(sectorData.slice(1)));
+        for (int i = 0; i < 5; i++)
+            writer.write_8(0); /* 4 byte ECC and ECC not present flag */
+    }
+    for (uint8_t b : sectorData)
+        fullSector->push_back(b);
+    /* sector postamble */
+    for (int i = 0; i < 40; i++)
+        fullSector->push_back(0);
+    /* filler */
+    for (int i = 0; i < 35; i++)
+        fullSector->push_back(0);
 
-	if (fullSector->size() != fullSectorSize)
+    if (fullSector->size() != fullSectorSize)
-		Error() << "sector mismatched length";
+        error("sector mismatched length");
-	bool lastBit = false;
+    bool lastBit = false;
-	encodeMfm(bits, cursor, fullSector, lastBit);
+    encodeMfm(bits, cursor, fullSector, lastBit);
-	/* filler */
+    /* filler */
-	for (int i=0; i<5; i++)
+    for (int i = 0; i < 5; i++)
-	{
+    {
-		bits[cursor++] = 1;
+        bits[cursor++] = 1;
-		bits[cursor++] = 0;
+        bits[cursor++] = 0;
-	}
+    }
 }
 
-class MicropolisEncoder : public AbstractEncoder
+class MicropolisEncoder : public Encoder
 {
 public:
-	MicropolisEncoder(const EncoderProto& config):
+    MicropolisEncoder(const EncoderProto& config):
-		AbstractEncoder(config),
+        Encoder(config),
-		_config(config.micropolis())
+        _config(config.micropolis())
-	{}
+    {
+    }
 
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
+    {
+        int bitsPerRevolution =
+            (_config.rotational_period_ms() * 1e3) / _config.clock_period_us();
 
-		if ((physicalTrack >= 0) && (physicalTrack < 77))
+        std::vector<bool> bits(bitsPerRevolution);
-		{
+        unsigned cursor = 0;
-			for (int sectorId = 0; sectorId < 16; sectorId++)
-			{
-				const auto& sector = image.get(physicalTrack, physicalSide, sectorId);
-				if (sector)
-					sectors.push_back(sector);
-			}
-		}
 
-		return sectors;
+        for (const auto& sectorData : sectors)
-	}
+            write_sector(bits, cursor, sectorData);
 
-	std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
+        if (cursor != bits.size())
-			const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
+            error("track data mismatched length");
-	{
-		int bitsPerRevolution = 100000;
-		double clockRateUs = 2.00;
 
-		if ((physicalTrack < 0) || (physicalTrack >= 77) || sectors.empty())
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-			return std::unique_ptr<Fluxmap>();
+        fluxmap->appendBits(bits,
-
+            calculatePhysicalClockPeriod(_config.clock_period_us() * 1e3,
-		std::vector<bool> bits(bitsPerRevolution);
+                _config.rotational_period_ms() * 1e6));
-		unsigned cursor = 0;
+        return fluxmap;
-
+    }
-		for (const auto& sectorData : sectors)
-			write_sector(bits, cursor, sectorData);
-
-		if (cursor != bits.size())
-			Error() << "track data mismatched length";
-
-		std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		fluxmap->appendBits(bits, clockRateUs * 1e3);
-		return fluxmap;
-	}
 
 private:
-	const MicropolisEncoderProto& _config;
+    const MicropolisEncoderProto& _config;
 };
 
-std::unique_ptr<AbstractEncoder> createMicropolisEncoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createMicropolisEncoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new MicropolisEncoder(config));
+    return std::unique_ptr<Encoder>(new MicropolisEncoder(config));
 }
-

arch/micropolis/micropolis.h

@@ -1,15 +1,20 @@
 #ifndef MICROPOLIS_H
 #define MICROPOLIS_H
 
-#define MICROPOLIS_ENCODED_SECTOR_SIZE (1+2+266+6)
+#define MICROPOLIS_PAYLOAD_SIZE (256)
+#define MICROPOLIS_HEADER_SIZE (1 + 2 + 10)
+#define MICROPOLIS_ENCODED_SECTOR_SIZE \
+    (MICROPOLIS_HEADER_SIZE + MICROPOLIS_PAYLOAD_SIZE + 6)
 
-class AbstractDecoder;
+class Decoder;
-class AbstractEncoder;
+class Encoder;
 class EncoderProto;
 class DecoderProto;
 
-extern std::unique_ptr<AbstractDecoder> createMicropolisDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createMicropolisDecoder(
-extern std::unique_ptr<AbstractEncoder> createMicropolisEncoder(const EncoderProto& config);
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createMicropolisEncoder(
+    const EncoderProto& config);
 
 extern uint8_t micropolisChecksum(const Bytes& bytes);
 

arch/micropolis/micropolis.proto

@@ -1,5 +1,24 @@
 syntax = "proto2";
 
-message MicropolisDecoderProto {}
+import "lib/common.proto";
-message MicropolisEncoderProto {}
+
+message MicropolisDecoderProto {
+	enum ChecksumType {
+		AUTO = 0;
+		MICROPOLIS = 1;
+		MZOS = 2;
+	}
+
+	optional int32 sector_output_size = 1 [default = 256,
+		(help) = "How much of the raw sector should be saved. Must be 256 or 275"];
+	optional ChecksumType checksum_type = 2 [default = AUTO,
+		(help) = "Checksum type to use: AUTO, MICROPOLIS, MZOS"];
+}
+
+message MicropolisEncoderProto {
+    optional double clock_period_us = 1
+        [ default = 2.0, (help) = "clock rate on the real device" ];
+    optional double rotational_period_ms = 2
+        [ default = 200.0, (help) = "rotational period on the real device" ];
+}
 

arch/mx/decoder.cc

@@ -16,78 +16,68 @@ const int SECTOR_SIZE = 256;
  */
 
 /* FM beginning of track marker:
+ *         0         0         f         3 decoded nibbles
+ *  0 0  0 0  0 0  0 0  1 1  1 1  0 0  1 1
  * 1010 1010 1010 1010 1111 1111 1010 1111
- *    a    a    a    a    f    f    a    f
+ *    a    a    a    a    f    f    a    f encoded nibbles
  */
 const FluxPattern ID_PATTERN(32, 0xaaaaffaf);
 
-class MxDecoder : public AbstractDecoder
+class MxDecoder : public Decoder
 {
 public:
-	MxDecoder(const DecoderProto& config):
+    MxDecoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    void beginTrack()
+    void beginTrack() override
-	{
+    {
-		_currentSector = -1;
+        _clock = _sector->clock = seekToPattern(ID_PATTERN);
-		_clock = 0;
+        _currentSector = 0;
-	}
+    }
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		if (_currentSector == -1)
+        if (_currentSector == 11)
-		{
+        {
-			/* First sector in the track: look for the sync marker. */
+            /* That was the last sector on the disk. */
-			const FluxMatcher* matcher = nullptr;
+            return 0;
-			_sector->clock = _clock = _fmr->seekToPattern(ID_PATTERN, matcher);
+        }
-			readRawBits(32); /* skip the ID mark */
+        else
-			_logicalTrack = decodeFmMfm(readRawBits(32)).slice(0, 32).reader().read_be16();
+            return _clock;
-		}
+    }
-		else if (_currentSector == 10)
-		{
-			/* That was the last sector on the disk. */
-			return UNKNOWN_RECORD;
-		}
-		else
-		{
-			/* Otherwise we assume the clock from the first sector is still valid.
-			 * The decoder framwork will automatically stop when we hit the end of
-			 * the track. */
-			_sector->clock = _clock;
-		}
 
-		_currentSector++;
+    void decodeSectorRecord() override
-		return SECTOR_RECORD;
+    {
-	}
+        /* Skip the ID pattern and track word, which is only present on the
+         * first sector. We don't trust the track word because some driver
+         * don't write it correctly. */
 
-    void decodeSectorRecord()
+        if (_currentSector == 0)
-	{
+            readRawBits(64);
-		auto bits = readRawBits((SECTOR_SIZE+2)*16);
-		auto bytes = decodeFmMfm(bits).slice(0, SECTOR_SIZE+2).swab();
 
-		uint16_t gotChecksum = 0;
+        auto bits = readRawBits((SECTOR_SIZE + 2) * 16);
-		ByteReader br(bytes);
+        auto bytes = decodeFmMfm(bits).slice(0, SECTOR_SIZE + 2);
-		for (int i=0; i<(SECTOR_SIZE/2); i++)
-			gotChecksum += br.read_le16();
-		uint16_t wantChecksum = br.read_le16();
 
-		_sector->logicalTrack = _logicalTrack;
+        uint16_t gotChecksum = 0;
-		_sector->logicalSide = _sector->physicalHead;
+        ByteReader br(bytes);
-		_sector->logicalSector = _currentSector;
+        for (int i = 0; i < (SECTOR_SIZE / 2); i++)
-		_sector->data = bytes.slice(0, SECTOR_SIZE);
+            gotChecksum += br.read_be16();
-		_sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+        uint16_t wantChecksum = br.read_be16();
-	}
+
+        _sector->logicalTrack = _sector->physicalTrack;
+        _sector->logicalSide = _sector->physicalSide;
+        _sector->logicalSector = _currentSector;
+        _sector->data = bytes.slice(0, SECTOR_SIZE).swab();
+        _sector->status =
+            (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+        _currentSector++;
+    }
 
 private:
     nanoseconds_t _clock;
     int _currentSector;
-    int _logicalTrack;
 };
 
-std::unique_ptr<AbstractDecoder> createMxDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createMxDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new MxDecoder(config));
+    return std::unique_ptr<Decoder>(new MxDecoder(config));
 }
-
-

arch/mx/mx.h

@@ -3,6 +3,6 @@
 
 #include "decoders/decoders.h"
 
-extern std::unique_ptr<AbstractDecoder> createMxDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createMxDecoder(const DecoderProto& config);
 
 #endif

arch/northstar/decoder.cc

@@ -21,6 +21,8 @@
 #include "lib/decoders/decoders.pb.h"
 #include "fmt/format.h"
 
+#define MFM_ID 0xaaaaaaaaaaaa5545LL
+#define FM_ID 0xaaaaaaaaaaaaffefLL
 /*
  * MFM sectors have 32 bytes of 00's followed by two sync characters,
  * specified in the North Star MDS manual as 0xFBFB.
@@ -33,164 +35,152 @@
  * 0000 0000 0000 0000 0000 0000 0101 0101 0100 0101
  * A    A    A    A    A    A    5    5    4    5
  */
-static const FluxPattern MFM_PATTERN(64, 0xAAAAAAAAAAAA5545LL);
+static const FluxPattern MFM_PATTERN(64, MFM_ID);
 
 /* FM sectors have 16 bytes of 00's followed by 0xFB.
  * 00        FB
  * 0000 0000 1111 1111 1110 1111
  * A    A    F    F    E    F
  */
-static const FluxPattern FM_PATTERN(64, 0xAAAAAAAAAAAAFFEFLL);
+static const FluxPattern FM_PATTERN(64, FM_ID);
 
-const FluxMatchers ANY_SECTOR_PATTERN(
+const FluxMatchers ANY_SECTOR_PATTERN({
-	{
+    &MFM_PATTERN,
-		&MFM_PATTERN,
+    &FM_PATTERN,
-		&FM_PATTERN,
+});
-	}
-);
 
 /* Checksum is initially 0.
  * For each data byte, XOR with the current checksum.
  * Rotate checksum left, carrying bit 7 to bit 0.
  */
-uint8_t northstarChecksum(const Bytes& bytes) {
+uint8_t northstarChecksum(const Bytes& bytes)
-	ByteReader br(bytes);
+{
-	uint8_t checksum = 0;
+    ByteReader br(bytes);
+    uint8_t checksum = 0;
 
-	while (!br.eof()) {
+    while (!br.eof())
-		checksum ^= br.read_8();
+    {
-		checksum = ((checksum << 1) | ((checksum >> 7)));
+        checksum ^= br.read_8();
-	}
+        checksum = ((checksum << 1) | ((checksum >> 7)));
+    }
 
-	return checksum;
+    return checksum;
 }
 
-class NorthstarDecoder : public AbstractDecoder
+class NorthstarDecoder : public Decoder
 {
 public:
-	NorthstarDecoder(const DecoderProto& config):
+    NorthstarDecoder(const DecoderProto& config):
-		AbstractDecoder(config),
+        Decoder(config),
-		_config(config.northstar())
+        _config(config.northstar())
-	{}
+    {
+    }
 
-	/* Search for FM or MFM sector record */
+    /* Search for FM or MFM sector record */
-	RecordType advanceToNextRecord() override
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		nanoseconds_t now = _fmr->tell().ns();
+        nanoseconds_t now = tell().ns();
 
-		/* For all but the first sector, seek to the next sector pulse.
+        /* For all but the first sector, seek to the next sector pulse.
-		 * The first sector does not contain the sector pulse in the fluxmap.
+         * The first sector does not contain the sector pulse in the fluxmap.
-		 */
+         */
-		if (now != 0) {
+        if (now != 0)
-			_fmr->seekToIndexMark();
+        {
-			now = _fmr->tell().ns();
+            seekToIndexMark();
-		}
+            now = tell().ns();
+        }
 
-		/* Discard a possible partial sector at the end of the track.
+        /* Discard a possible partial sector at the end of the track.
-		 * This partial sector could be mistaken for a conflicted sector, if
+         * This partial sector could be mistaken for a conflicted sector, if
-		 * whatever data read happens to match the checksum of 0, which is
+         * whatever data read happens to match the checksum of 0, which is
-		 * rare, but has been observed on some disks.
+         * rare, but has been observed on some disks.
-		 */
+         */
-		if (now > (_fmr->getDuration() - 21e6)) {
+        if (now > (getFluxmapDuration() - 21e6))
-			_fmr->seekToIndexMark();
+        {
-			return(UNKNOWN_RECORD);
+            seekToIndexMark();
-		}
+            return 0;
+        }
 
-		int msSinceIndex = std::round(now / 1e6);
+        int msSinceIndex = std::round(now / 1e6);
 
-		const FluxMatcher* matcher = nullptr;
+        /* Note that the seekToPattern ignores the sector pulses, so if
+         * a sector is not found for some reason, the seek will advance
+         * past one or more sector pulses.  For this reason, calculate
+         * _hardSectorId after the sector header is found.
+         */
+        nanoseconds_t clock = seekToPattern(ANY_SECTOR_PATTERN);
+        _sector->headerStartTime = tell().ns();
 
-		/* Note that the seekToPattern ignores the sector pulses, so if
+        /* Discard a possible partial sector. */
-		 * a sector is not found for some reason, the seek will advance
+        if (_sector->headerStartTime > (getFluxmapDuration() - 21e6))
-		 * past one or more sector pulses.  For this reason, calculate
+        {
-		 * _hardSectorId after the sector header is found.
+            return 0;
-		 */
+        }
-		_sector->clock = _fmr->seekToPattern(ANY_SECTOR_PATTERN, matcher);
 
-		int sectorFoundTimeRaw = std::round((_fmr->tell().ns()) / 1e6);
+        int sectorFoundTimeRaw = std::round(_sector->headerStartTime / 1e6);
-		int sectorFoundTime;
+        int sectorFoundTime;
 
-		/* Round time to the nearest 20ms */
+        /* Round time to the nearest 20ms */
-		if ((sectorFoundTimeRaw % 20) < 10) {
+        if ((sectorFoundTimeRaw % 20) < 10)
-			sectorFoundTime = (sectorFoundTimeRaw / 20) * 20;
+        {
-		}
+            sectorFoundTime = (sectorFoundTimeRaw / 20) * 20;
-		else {
+        }
-			sectorFoundTime = ((sectorFoundTimeRaw + 20) / 20) * 20;
+        else
-		}
+        {
+            sectorFoundTime = ((sectorFoundTimeRaw + 20) / 20) * 20;
+        }
 
-		/* Calculate the sector ID based on time since the index */
+        /* Calculate the sector ID based on time since the index */
-		_hardSectorId = (sectorFoundTime / 20) % 10;
+        _hardSectorId = (sectorFoundTime / 20) % 10;
 
-	//	std::cout << fmt::format(
+        return clock;
-	//		"Sector ID {}: hole at {}ms, sector start at {}ms",
+    }
-	//		_hardSectorId, msSinceIndex, sectorFoundTimeRaw) << std::endl;
 
-		if (matcher == &MFM_PATTERN) {
+    void decodeSectorRecord() override
-			_sectorType = SECTOR_TYPE_MFM;
+    {
-			readRawBits(48);
+        uint64_t id = toBytes(readRawBits(64)).reader().read_be64();
-			return SECTOR_RECORD;
+        unsigned recordSize, payloadSize, headerSize;
-		}
 
-		if (matcher == &FM_PATTERN) {
+        if (id == MFM_ID)
-			_sectorType = SECTOR_TYPE_FM;
+        {
-			readRawBits(48);
+            recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_DD;
-			return SECTOR_RECORD;
+            payloadSize = NORTHSTAR_PAYLOAD_SIZE_DD;
-		}
+            headerSize = NORTHSTAR_HEADER_SIZE_DD;
+        }
+        else
+        {
+            recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_SD;
+            payloadSize = NORTHSTAR_PAYLOAD_SIZE_SD;
+            headerSize = NORTHSTAR_HEADER_SIZE_SD;
+        }
 
-		return UNKNOWN_RECORD;
+        auto rawbits = readRawBits(recordSize * 16);
-	}
+        auto bytes = decodeFmMfm(rawbits).slice(0, recordSize);
+        ByteReader br(bytes);
 
-	void decodeSectorRecord() override
+        _sector->logicalSide = _sector->physicalSide;
-	{
+        _sector->logicalSector = _hardSectorId;
-		unsigned recordSize, payloadSize, headerSize;
+        _sector->logicalTrack = _sector->physicalTrack;
 
-		if (_sectorType == SECTOR_TYPE_MFM) {
+        if (headerSize == NORTHSTAR_HEADER_SIZE_DD)
-			recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_DD;
+        {
-			payloadSize = NORTHSTAR_PAYLOAD_SIZE_DD;
+            br.read_8(); /* MFM second Sync char, usually 0xFB */
-			headerSize = NORTHSTAR_HEADER_SIZE_DD;
+        }
-		}
-		else {
-			recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_SD;
-			payloadSize = NORTHSTAR_PAYLOAD_SIZE_SD;
-			headerSize = NORTHSTAR_HEADER_SIZE_SD;
-		}
 
-		auto rawbits = readRawBits(recordSize * 16);
+        _sector->data = br.read(payloadSize);
-		auto bytes = decodeFmMfm(rawbits).slice(0, recordSize);
+        uint8_t wantChecksum = br.read_8();
-		ByteReader br(bytes);
+        uint8_t gotChecksum =
-		uint8_t sync_char;
+            northstarChecksum(bytes.slice(headerSize - 1, payloadSize));
-
+        _sector->status =
-		_sector->logicalSide = _sector->physicalHead;
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-		_sector->logicalSector = _hardSectorId;
+    }
-		_sector->logicalTrack = _sector->physicalCylinder;
-
-		sync_char = br.read_8();	/* Sync char: 0xFB */
-		if (_sectorType == SECTOR_TYPE_MFM) {
-			sync_char = br.read_8();/* MFM second Sync char, usually 0xFB */
-		}
-
-		_sector->data = br.read(payloadSize);
-
-		uint8_t wantChecksum = br.read_8();
-		uint8_t gotChecksum = northstarChecksum(bytes.slice(headerSize, payloadSize));
-
-		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-	}
-
-	std::set<unsigned> requiredSectors(unsigned cylinder, unsigned head) const override
-	{
-		static std::set<unsigned> sectors = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 };
-		return sectors;
-	}
 
 private:
-	const NorthstarDecoderProto& _config;
+    const NorthstarDecoderProto& _config;
-	uint8_t _sectorType = SECTOR_TYPE_MFM;
+    uint8_t _hardSectorId;
-	uint8_t _hardSectorId;
 };
 
-std::unique_ptr<AbstractDecoder> createNorthstarDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createNorthstarDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new NorthstarDecoder(config));
+    return std::unique_ptr<Decoder>(new NorthstarDecoder(config));
 }
-

arch/northstar/encoder.cc

@@ -12,155 +12,157 @@
 #define GAP_FILL_SIZE_DD 62
 #define PRE_HEADER_GAP_FILL_SIZE_DD 16
 
-#define GAP1_FILL_BYTE	(0x4F)
+#define GAP1_FILL_BYTE (0x4F)
-#define GAP2_FILL_BYTE	(0x4F)
+#define GAP2_FILL_BYTE (0x4F)
 
 #define TOTAL_SECTOR_BYTES ()
 
-static void write_sector(std::vector<bool>& bits, unsigned& cursor, const std::shared_ptr<Sector>& sector)
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
 {
-	int preambleSize = 0;
+    int preambleSize = 0;
-	int encodedSectorSize = 0;
+    int encodedSectorSize = 0;
-	int gapFillSize = 0;
+    int gapFillSize = 0;
-	int preHeaderGapFillSize = 0;
+    int preHeaderGapFillSize = 0;
 
-	bool doubleDensity;
+    bool doubleDensity;
 
-	switch (sector->data.size()) {
+    switch (sector->data.size())
-	case NORTHSTAR_PAYLOAD_SIZE_SD:
+    {
-		preambleSize = NORTHSTAR_PREAMBLE_SIZE_SD;
+        case NORTHSTAR_PAYLOAD_SIZE_SD:
-		encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_SD + NORTHSTAR_ENCODED_SECTOR_SIZE_SD + GAP_FILL_SIZE_SD;
+            preambleSize = NORTHSTAR_PREAMBLE_SIZE_SD;
-		gapFillSize = GAP_FILL_SIZE_SD;
+            encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_SD +
-		preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_SD;
+                                NORTHSTAR_ENCODED_SECTOR_SIZE_SD +
-		doubleDensity = false;
+                                GAP_FILL_SIZE_SD;
-		break;
+            gapFillSize = GAP_FILL_SIZE_SD;
-	case NORTHSTAR_PAYLOAD_SIZE_DD:
+            preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_SD;
-		preambleSize = NORTHSTAR_PREAMBLE_SIZE_DD;
+            doubleDensity = false;
-		encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_DD + NORTHSTAR_ENCODED_SECTOR_SIZE_DD + GAP_FILL_SIZE_DD;
+            break;
-		gapFillSize = GAP_FILL_SIZE_DD;
+        case NORTHSTAR_PAYLOAD_SIZE_DD:
-		preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_DD;
+            preambleSize = NORTHSTAR_PREAMBLE_SIZE_DD;
-		doubleDensity = true;
+            encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_DD +
-		break;
+                                NORTHSTAR_ENCODED_SECTOR_SIZE_DD +
-	default:
+                                GAP_FILL_SIZE_DD;
-		Error() << "unsupported sector size --- you must pick 256 or 512";
+            gapFillSize = GAP_FILL_SIZE_DD;
-		break;
+            preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_DD;
-	}
+            doubleDensity = true;
+            break;
+        default:
+            error("unsupported sector size --- you must pick 256 or 512");
+            break;
+    }
 
-	int fullSectorSize = preambleSize + encodedSectorSize;
+    int fullSectorSize = preambleSize + encodedSectorSize;
-	auto fullSector = std::make_shared<std::vector<uint8_t>>();
+    auto fullSector = std::make_shared<std::vector<uint8_t>>();
-	fullSector->reserve(fullSectorSize);
+    fullSector->reserve(fullSectorSize);
 
-	/* sector gap after index pulse */
+    /* sector gap after index pulse */
-	for (int i = 0; i < preHeaderGapFillSize; i++)
+    for (int i = 0; i < preHeaderGapFillSize; i++)
-		fullSector->push_back(GAP1_FILL_BYTE);
+        fullSector->push_back(GAP1_FILL_BYTE);
 
-	/* sector preamble */
+    /* sector preamble */
-	for (int i = 0; i < preambleSize; i++)
+    for (int i = 0; i < preambleSize; i++)
-		fullSector->push_back(0);
+        fullSector->push_back(0);
 
-	Bytes sectorData;
+    Bytes sectorData;
-	if (sector->data.size() == encodedSectorSize)
+    if (sector->data.size() == encodedSectorSize)
-		sectorData = sector->data;
+        sectorData = sector->data;
-	else {
+    else
-		ByteWriter writer(sectorData);
+    {
-		writer.write_8(0xFB);     /* sync character */
+        ByteWriter writer(sectorData);
-		if (doubleDensity == true) {
+        writer.write_8(0xFB); /* sync character */
-			writer.write_8(0xFB); /* Double-density has two sync characters */
+        if (doubleDensity == true)
-		}
+        {
-		writer += sector->data;
+            writer.write_8(0xFB); /* Double-density has two sync characters */
-		if (doubleDensity == true) {
+        }
-			writer.write_8(northstarChecksum(sectorData.slice(2)));
+        writer += sector->data;
-		} else {
+        if (doubleDensity == true)
-			writer.write_8(northstarChecksum(sectorData.slice(1)));
+        {
-		}
+            writer.write_8(northstarChecksum(sectorData.slice(2)));
-	}
+        }
-	for (uint8_t b : sectorData)
+        else
-		fullSector->push_back(b);
+        {
+            writer.write_8(northstarChecksum(sectorData.slice(1)));
+        }
+    }
+    for (uint8_t b : sectorData)
+        fullSector->push_back(b);
 
-	if (sector->logicalSector != 9) {
+    if (sector->logicalSector != 9)
-		/* sector postamble */
+    {
-		for (int i = 0; i < gapFillSize; i++)
+        /* sector postamble */
-			fullSector->push_back(GAP2_FILL_BYTE);
+        for (int i = 0; i < gapFillSize; i++)
+            fullSector->push_back(GAP2_FILL_BYTE);
 
-		if (fullSector->size() != fullSectorSize)
+        if (fullSector->size() != fullSectorSize)
-			Error() << "sector mismatched length (" << sector->data.size() << ") expected: " << fullSector->size() << " got " << fullSectorSize;
+            error("sector mismatched length ({}); expected {}, got {}",
-	} else {
+                sector->data.size(),
-		/* sector postamble */
+                fullSector->size(),
-		for (int i = 0; i < gapFillSize; i++)
+                fullSectorSize);
-			fullSector->push_back(GAP2_FILL_BYTE);
+    }
-	}
+    else
+    {
+        /* sector postamble */
+        for (int i = 0; i < gapFillSize; i++)
+            fullSector->push_back(GAP2_FILL_BYTE);
+    }
 
-	bool lastBit = false;
+    bool lastBit = false;
 
-	if (doubleDensity == true) {
+    if (doubleDensity == true)
-		encodeMfm(bits, cursor, fullSector, lastBit);
+    {
-	}
+        encodeMfm(bits, cursor, fullSector, lastBit);
-	else {
+    }
-		encodeFm(bits, cursor, fullSector);
+    else
-	}
+    {
+        encodeFm(bits, cursor, fullSector);
+    }
 }
 
-class NorthstarEncoder : public AbstractEncoder
+class NorthstarEncoder : public Encoder
 {
 public:
-	NorthstarEncoder(const EncoderProto& config):
+    NorthstarEncoder(const EncoderProto& config):
-		AbstractEncoder(config),
+        Encoder(config),
-		_config(config.northstar())
+        _config(config.northstar())
-	{}
+    {
+    }
 
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
+    {
+        int bitsPerRevolution = 100000;
+        double clockRateUs = _config.clock_period_us();
 
-		if ((physicalTrack >= 0) && (physicalTrack < 35))
+        const auto& sector = *sectors.begin();
-		{
+        if (sector->data.size() == NORTHSTAR_PAYLOAD_SIZE_SD)
-			for (int sectorId = 0; sectorId < 10; sectorId++)
+            bitsPerRevolution /= 2; // FM
-			{
+        else
-				const auto& sector = image.get(physicalTrack, physicalSide, sectorId);
+            clockRateUs /= 2.00;
-				if (sector)
-					sectors.push_back(sector);
-			}
-		}
 
-		return sectors;
+        std::vector<bool> bits(bitsPerRevolution);
-	}
+        unsigned cursor = 0;
 
-	std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
+        for (const auto& sectorData : sectors)
-			const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
+            write_sector(bits, cursor, sectorData);
-	{
-		int bitsPerRevolution = 100000;
-		double clockRateUs = 4.00;
 
-		if ((physicalTrack < 0) || (physicalTrack >= 35) || sectors.empty())
+        if (cursor > bits.size())
-			return std::unique_ptr<Fluxmap>();
+            error("track data overrun");
 
-		const auto& sector = *sectors.begin();
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		if (sector->data.size() == NORTHSTAR_PAYLOAD_SIZE_SD) {
+        fluxmap->appendBits(bits,
-			bitsPerRevolution /= 2;		// FM
+            calculatePhysicalClockPeriod(
-		} else {
+                clockRateUs * 1e3, _config.rotational_period_ms() * 1e6));
-			clockRateUs /= 2.00;
+        return fluxmap;
-		}
+    }
-
-		std::vector<bool> bits(bitsPerRevolution);
-		unsigned cursor = 0;
-
-		for (const auto& sectorData : sectors)
-			write_sector(bits, cursor, sectorData);
-
-		if (cursor > bits.size())
-			Error() << "track data overrun";
-
-		std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		fluxmap->appendBits(bits, clockRateUs * 1e3);
-		return fluxmap;
-	}
 
 private:
-	const NorthstarEncoderProto& _config;
+    const NorthstarEncoderProto& _config;
 };
 
-std::unique_ptr<AbstractEncoder> createNorthstarEncoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createNorthstarEncoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new NorthstarEncoder(config));
+    return std::unique_ptr<Encoder>(new NorthstarEncoder(config));
 }
-

arch/northstar/northstar.h

@@ -1,7 +1,8 @@
 #ifndef NORTHSTAR_H
 #define NORTHSTAR_H
 
-/* Northstar floppies are 10-hard sectored disks with a sector format as follows:
+/* Northstar floppies are 10-hard sectored disks with a sector format as
+ * follows:
  *
  * |----------------------------------|
  * | SYNC Byte  | Payload  | Checksum |
@@ -12,27 +13,30 @@
  *
  */
 
-#define NORTHSTAR_PREAMBLE_SIZE_SD		(16)
+#define NORTHSTAR_PREAMBLE_SIZE_SD (16)
-#define NORTHSTAR_PREAMBLE_SIZE_DD		(32)
+#define NORTHSTAR_PREAMBLE_SIZE_DD (32)
-#define NORTHSTAR_HEADER_SIZE_SD		(1)
+#define NORTHSTAR_HEADER_SIZE_SD (1)
-#define NORTHSTAR_HEADER_SIZE_DD		(2)
+#define NORTHSTAR_HEADER_SIZE_DD (2)
-#define NORTHSTAR_PAYLOAD_SIZE_SD		(256)
+#define NORTHSTAR_PAYLOAD_SIZE_SD (256)
-#define NORTHSTAR_PAYLOAD_SIZE_DD		(512)
+#define NORTHSTAR_PAYLOAD_SIZE_DD (512)
-#define NORTHSTAR_CHECKSUM_SIZE		(1)
+#define NORTHSTAR_CHECKSUM_SIZE (1)
-#define NORTHSTAR_ENCODED_SECTOR_SIZE_SD	(NORTHSTAR_HEADER_SIZE_SD + NORTHSTAR_PAYLOAD_SIZE_SD + NORTHSTAR_CHECKSUM_SIZE)
+#define NORTHSTAR_ENCODED_SECTOR_SIZE_SD                    \
-#define NORTHSTAR_ENCODED_SECTOR_SIZE_DD	(NORTHSTAR_HEADER_SIZE_DD + NORTHSTAR_PAYLOAD_SIZE_DD + NORTHSTAR_CHECKSUM_SIZE)
+    (NORTHSTAR_HEADER_SIZE_SD + NORTHSTAR_PAYLOAD_SIZE_SD + \
+        NORTHSTAR_CHECKSUM_SIZE)
+#define NORTHSTAR_ENCODED_SECTOR_SIZE_DD                    \
+    (NORTHSTAR_HEADER_SIZE_DD + NORTHSTAR_PAYLOAD_SIZE_DD + \
+        NORTHSTAR_CHECKSUM_SIZE)
 
-#define SECTOR_TYPE_MFM			(0)
+class Decoder;
-#define SECTOR_TYPE_FM				(1)
+class Encoder;
-
-class AbstractDecoder;
-class AbstractEncoder;
 class EncoderProto;
 class DecoderProto;
 
 extern uint8_t northstarChecksum(const Bytes& bytes);
 
-extern std::unique_ptr<AbstractDecoder> createNorthstarDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createNorthstarDecoder(
-extern std::unique_ptr<AbstractEncoder> createNorthstarEncoder(const EncoderProto& config);
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createNorthstarEncoder(
+    const EncoderProto& config);
 
 #endif /* NORTHSTAR */

arch/northstar/northstar.proto

@@ -1,5 +1,13 @@
 syntax = "proto2";
 
-message NorthstarDecoderProto {}
+import "lib/common.proto";
-message NorthstarEncoderProto {}
+
+message NorthstarDecoderProto {}
+
+message NorthstarEncoderProto {
+    optional double clock_period_us = 1
+        [ default = 4.0, (help) = "clock rate on the real device (for FM)" ];
+    optional double rotational_period_ms = 2
+        [ default = 166.0, (help) = "rotational period on the real device" ];
+}
 

arch/rolandd20/decoder.cc

@@ -0,0 +1,51 @@
+#include "lib/globals.h"
+#include "lib/decoders/decoders.h"
+#include "lib/crc.h"
+#include "lib/fluxmap.h"
+#include "lib/decoders/fluxmapreader.h"
+#include "lib/sector.h"
+#include "lib/bytes.h"
+#include "rolandd20.h"
+#include <string.h>
+
+/* Sector header record:
+ *
+ * BF FF FF FF FF FF FE AB
+ *
+ * This encodes to:
+ *
+ *    e    d    5    5    5    5    5    5
+ * 1110 1101 0101 0101 0101 0101 0101 0101
+ *    5    5    5    5    5    5    5    5
+ * 0101 0101 0101 0101 0101 0101 0101 0101
+ *    5    5    5    5    5    5    5    5
+ * 0101 0101 0101 0101 0101 0101 0101 0101
+ *    5    5    5    4    4    4    4    5
+ * 0101 0101 0101 0100 0100 0100 0100 0101
+ */
+
+static const FluxPattern SECTOR_PATTERN(64, 0xed55555555555555LL);
+
+class RolandD20Decoder : public Decoder
+{
+public:
+    RolandD20Decoder(const DecoderProto& config): Decoder(config) {}
+
+    nanoseconds_t advanceToNextRecord() override
+    {
+        return seekToPattern(SECTOR_PATTERN);
+    }
+
+    void decodeSectorRecord() override
+    {
+        auto rawbits = readRawBits(256);
+        const auto& bytes = decodeFmMfm(rawbits);
+        fmt::print("{} ", _sector->clock);
+        hexdump(std::cout, bytes);
+    }
+};
+
+std::unique_ptr<Decoder> createRolandD20Decoder(const DecoderProto& config)
+{
+    return std::unique_ptr<Decoder>(new RolandD20Decoder(config));
+}

arch/rolandd20/rolandd20.h

@@ -0,0 +1,4 @@
+#pragma once
+
+extern std::unique_ptr<Decoder> createRolandD20Decoder(
+    const DecoderProto& config);

arch/rolandd20/rolandd20.proto

@@ -0,0 +1,5 @@
+syntax = "proto2";
+
+message RolandD20DecoderProto {}
+
+

arch/smaky6/decoder.cc

@@ -0,0 +1,154 @@
+#include "globals.h"
+#include "fluxmap.h"
+#include "decoders/fluxmapreader.h"
+#include "protocol.h"
+#include "decoders/decoders.h"
+#include "sector.h"
+#include "smaky6.h"
+#include "bytes.h"
+#include "crc.h"
+#include "fmt/format.h"
+#include "lib/decoders/decoders.pb.h"
+#include <string.h>
+#include <algorithm>
+
+static const FluxPattern SECTOR_PATTERN(32, 0x54892aaa);
+
+class Smaky6Decoder : public Decoder
+{
+public:
+    Smaky6Decoder(const DecoderProto& config):
+        Decoder(config),
+        _config(config.smaky6())
+    {
+    }
+
+private:
+    /* Returns the sector ID of the _current_ sector. */
+    int advanceToNextSector()
+    {
+        auto previous = tell();
+        seekToIndexMark();
+        auto now = tell();
+        if ((now.ns() - previous.ns()) < 9e6)
+        {
+            seekToIndexMark();
+            auto next = tell();
+            if ((next.ns() - now.ns()) < 9e6)
+            {
+                /* We just found sector 0. */
+
+                _sectorId = 0;
+            }
+            else
+            {
+                /* Spurious... */
+
+                seek(now);
+            }
+        }
+
+        return _sectorId++;
+    }
+
+public:
+    void beginTrack() override
+    {
+        /* Find the start-of-track index marks, which will be an interval
+         * of about 6ms. */
+
+        seekToIndexMark();
+        _sectorId = 99;
+        for (;;)
+        {
+            auto pos = tell();
+            advanceToNextSector();
+            if (_sectorId < 99)
+            {
+                seek(pos);
+                break;
+            }
+
+            if (eof())
+                return;
+        }
+
+        /* Now we know where to start counting, start finding sectors. */
+
+        _sectorStarts.clear();
+        for (;;)
+        {
+            auto now = tell();
+            if (eof())
+                break;
+
+            int id = advanceToNextSector();
+            if (id < 16)
+                _sectorStarts.push_back(std::make_pair(id, now));
+        }
+
+        _sectorIndex = 0;
+    }
+
+    nanoseconds_t advanceToNextRecord() override
+    {
+        if (_sectorIndex == _sectorStarts.size())
+        {
+            seekToIndexMark();
+            return 0;
+        }
+
+        const auto& p = _sectorStarts[_sectorIndex++];
+        _sectorId = p.first;
+        seek(p.second);
+
+        nanoseconds_t clock = seekToPattern(SECTOR_PATTERN);
+        _sector->headerStartTime = tell().ns();
+
+        return clock;
+    }
+
+    void decodeSectorRecord() override
+    {
+        readRawBits(33);
+        const auto& rawbits = readRawBits(SMAKY6_RECORD_SIZE * 16);
+        if (rawbits.size() < SMAKY6_SECTOR_SIZE)
+            return;
+        const auto& rawbytes =
+            toBytes(rawbits).slice(0, SMAKY6_RECORD_SIZE * 16);
+
+        /* The Smaky bytes are stored backwards! Backwards! */
+
+        const auto& bytes =
+            decodeFmMfm(rawbits).slice(0, SMAKY6_RECORD_SIZE).reverseBits();
+        ByteReader br(bytes);
+
+        uint8_t track = br.read_8();
+        Bytes data = br.read(SMAKY6_SECTOR_SIZE);
+        uint8_t wantedChecksum = br.read_8();
+        uint8_t gotChecksum = sumBytes(data) & 0xff;
+
+        if (track != _sector->physicalTrack)
+            return;
+
+        _sector->logicalTrack = _sector->physicalTrack;
+        _sector->logicalSide = _sector->physicalSide;
+        _sector->logicalSector = _sectorId;
+
+        _sector->data = data;
+        _sector->status =
+            (wantedChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
+
+private:
+    const Smaky6DecoderProto& _config;
+    nanoseconds_t _startOfTrack;
+    std::vector<std::pair<int, Fluxmap::Position>> _sectorStarts;
+    int _sectorId;
+    int _sectorIndex;
+};
+
+std::unique_ptr<Decoder> createSmaky6Decoder(const DecoderProto& config)
+{
+    return std::unique_ptr<Decoder>(new Smaky6Decoder(config));
+}

arch/smaky6/smaky6.h

@@ -0,0 +1,9 @@
+#ifndef SMAKY6_H
+#define SMAKY6_H
+
+#define SMAKY6_SECTOR_SIZE 256
+#define SMAKY6_RECORD_SIZE (1 + SMAKY6_SECTOR_SIZE + 1)
+
+extern std::unique_ptr<Decoder> createSmaky6Decoder(const DecoderProto& config);
+
+#endif

arch/smaky6/smaky6.proto

@@ -0,0 +1,6 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message Smaky6DecoderProto {}
+

arch/tids990/decoder.cc

@@ -23,76 +23,78 @@
  * When shifted out of phase, the special 0xa1 byte becomes an illegal
  * encoding (you can't do 10 00). So this can't be spoofed by user data.
  */
+const uint16_t SECTOR_ID = 0x550a;
 const FluxPattern SECTOR_RECORD_PATTERN(32, 0x11112244);
 
 /*
  * Data record:
- * data:    0  1  0  1  0  1  0  1 .0  0  0  0  1  0  1  1  = 0x550c
+ * data:    0  1  0  1  0  1  0  1 .0  0  0  0  1  0  1  1  = 0x550b
  * mfm:     00 01 00 01 00 01 00 01.00 10 10 10 01 00 01 01 = 0x11112a45
  * special: 00 01 00 01 00 01 00 01.00 10 00 10 01 00 01 01 = 0x11112245
  *                                        ^^
  * When shifted out of phase, the special 0xa1 byte becomes an illegal
  * encoding (you can't do 10 00). So this can't be spoofed by user data.
  */
+const uint16_t DATA_ID = 0x550b;
 const FluxPattern DATA_RECORD_PATTERN(32, 0x11112245);
 
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
-class Tids990Decoder : public AbstractDecoder
+class Tids990Decoder : public Decoder
 {
 public:
-	Tids990Decoder(const DecoderProto& config):
+    Tids990Decoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_RECORD_PATTERN)
-			return RecordType::SECTOR_RECORD;
-		if (matcher == &DATA_RECORD_PATTERN)
-			return RecordType::DATA_RECORD;
-		return RecordType::UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		auto bits = readRawBits(TIDS990_SECTOR_RECORD_SIZE*16);
+        auto bits = readRawBits(TIDS990_SECTOR_RECORD_SIZE * 16);
-		auto bytes = decodeFmMfm(bits).slice(0, TIDS990_SECTOR_RECORD_SIZE);
+        auto bytes = decodeFmMfm(bits).slice(0, TIDS990_SECTOR_RECORD_SIZE);
 
-		ByteReader br(bytes);
+        ByteReader br(bytes);
-		uint16_t gotChecksum = crc16(CCITT_POLY, bytes.slice(1, TIDS990_SECTOR_RECORD_SIZE-3));
+        if (br.read_be16() != SECTOR_ID)
+            return;
 
-		br.seek(2);
+        uint16_t gotChecksum =
-		_sector->logicalSide = br.read_8() >> 3;
+            crc16(CCITT_POLY, bytes.slice(1, TIDS990_SECTOR_RECORD_SIZE - 3));
-		_sector->logicalTrack = br.read_8();
-		br.read_8(); /* number of sectors per track */
-		_sector->logicalSector = br.read_8();
-		br.read_be16(); /* sector size */
-		uint16_t wantChecksum = br.read_be16();
 
-		if (wantChecksum == gotChecksum)
+        _sector->logicalSide = br.read_8() >> 3;
-			_sector->status = Sector::DATA_MISSING; /* correct but unintuitive */
+        _sector->logicalTrack = br.read_8();
-	}
+        br.read_8(); /* number of sectors per track */
+        _sector->logicalSector = br.read_8();
+        br.read_be16(); /* sector size */
+        uint16_t wantChecksum = br.read_be16();
 
-	void decodeDataRecord()
+        if (wantChecksum == gotChecksum)
-	{
+            _sector->status =
-		auto bits = readRawBits(TIDS990_DATA_RECORD_SIZE*16);
+                Sector::DATA_MISSING; /* correct but unintuitive */
-		auto bytes = decodeFmMfm(bits).slice(0, TIDS990_DATA_RECORD_SIZE);
+    }
 
-		ByteReader br(bytes);
+    void decodeDataRecord() override
-		uint16_t gotChecksum = crc16(CCITT_POLY, bytes.slice(1, TIDS990_DATA_RECORD_SIZE-3));
+    {
+        auto bits = readRawBits(TIDS990_DATA_RECORD_SIZE * 16);
+        auto bytes = decodeFmMfm(bits).slice(0, TIDS990_DATA_RECORD_SIZE);
 
-		br.seek(2);
+        ByteReader br(bytes);
-		_sector->data = br.read(TIDS990_PAYLOAD_SIZE);
+        if (br.read_be16() != DATA_ID)
-		uint16_t wantChecksum = br.read_be16();
+            return;
-		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+
-	}
+        uint16_t gotChecksum =
+            crc16(CCITT_POLY, bytes.slice(1, TIDS990_DATA_RECORD_SIZE - 3));
+
+        _sector->data = br.read(TIDS990_PAYLOAD_SIZE);
+        uint16_t wantChecksum = br.read_be16();
+        _sector->status =
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createTids990Decoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createTids990Decoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new Tids990Decoder(config));
+    return std::unique_ptr<Decoder>(new Tids990Decoder(config));
 }
-

arch/tids990/encoder.cc

@@ -3,7 +3,7 @@
 #include "encoders/encoders.h"
 #include "tids990.h"
 #include "crc.h"
-#include "writer.h"
+#include "readerwriter.h"
 #include "image.h"
 #include "arch/tids990/tids990.pb.h"
 #include "lib/encoders/encoders.pb.h"
@@ -11,158 +11,141 @@
 
 static int charToInt(char c)
 {
-	if (isdigit(c))
+    if (isdigit(c))
-		return c - '0';
+        return c - '0';
-	return 10 + tolower(c) - 'a';
+    return 10 + tolower(c) - 'a';
 }
 
 static uint8_t decodeUint16(uint16_t raw)
 {
-	Bytes b;
+    Bytes b;
-	ByteWriter bw(b);
+    ByteWriter bw(b);
-	bw.write_be16(raw);
+    bw.write_be16(raw);
-	return decodeFmMfm(b.toBits())[0];
+    return decodeFmMfm(b.toBits())[0];
 }
 
-class Tids990Encoder : public AbstractEncoder
+class Tids990Encoder : public Encoder
 {
 public:
-	Tids990Encoder(const EncoderProto& config):
+    Tids990Encoder(const EncoderProto& config):
-		AbstractEncoder(config),
+        Encoder(config),
-		_config(config.tids990())
+        _config(config.tids990())
-	{}
+    {
+    }
 
 private:
-	void writeRawBits(uint32_t data, int width)
+    void writeRawBits(uint32_t data, int width)
-	{
+    {
-		_cursor += width;
+        _cursor += width;
-		_lastBit = data & 1;
+        _lastBit = data & 1;
-		for (int i=0; i<width; i++)
+        for (int i = 0; i < width; i++)
-		{
+        {
-			unsigned pos = _cursor - i - 1;
+            unsigned pos = _cursor - i - 1;
-			if (pos < _bits.size())
+            if (pos < _bits.size())
-				_bits[pos] = data & 1;
+                _bits[pos] = data & 1;
-			data >>= 1;
+            data >>= 1;
-		}
+        }
-	}
+    }
 
-	void writeBytes(const Bytes& bytes)
+    void writeBytes(const Bytes& bytes)
-	{
+    {
-		encodeMfm(_bits, _cursor, bytes, _lastBit);
+        encodeMfm(_bits, _cursor, bytes, _lastBit);
-	}
+    }
 
-	void writeBytes(int count, uint8_t byte)
+    void writeBytes(int count, uint8_t byte)
-	{
+    {
-		Bytes bytes = { byte };
+        Bytes bytes = {byte};
-		for (int i=0; i<count; i++)
+        for (int i = 0; i < count; i++)
-			writeBytes(bytes);
+            writeBytes(bytes);
-	}
+    }
 
 public:
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
+    {
+        double clockRateUs = _config.clock_period_us() / 2.0;
+        int bitsPerRevolution =
+            (_config.rotational_period_ms() * 1000.0) / clockRateUs;
+        _bits.resize(bitsPerRevolution);
+        _cursor = 0;
 
-		for (char sectorChar : _config.sector_skew())
+        uint8_t am1Unencoded = decodeUint16(_config.am1_byte());
+        uint8_t am2Unencoded = decodeUint16(_config.am2_byte());
+
+        writeBytes(_config.gap1_bytes(), 0x55);
+
+        bool first = true;
+        for (const auto& sectorData : sectors)
         {
-			int sectorId = charToInt(sectorChar);
+            if (!first)
-			const auto& sector = image.get(physicalTrack, physicalSide, sectorId);
+                writeBytes(_config.gap3_bytes(), 0x55);
-			if (sector)
+            first = false;
-				sectors.push_back(sector);
+
+            /* Writing the sector and data records are fantastically annoying.
+             * The CRC is calculated from the *very start* of the record, and
+             * include the malformed marker bytes. Our encoder doesn't know
+             * about this, of course, with the result that we have to construct
+             * the unencoded header, calculate the checksum, and then use the
+             * same logic to emit the bytes which require special encoding
+             * before encoding the rest of the header normally. */
+
+            {
+                Bytes header;
+                ByteWriter bw(header);
+
+                writeBytes(12, 0x55);
+                bw.write_8(am1Unencoded);
+                bw.write_8(sectorData->logicalSide << 3);
+                bw.write_8(sectorData->logicalTrack);
+                bw.write_8(_config.sector_count());
+                bw.write_8(sectorData->logicalSector);
+                bw.write_be16(sectorData->data.size());
+                uint16_t crc = crc16(CCITT_POLY, header);
+                bw.write_be16(crc);
+
+                writeRawBits(_config.am1_byte(), 16);
+                writeBytes(header.slice(1));
+            }
+
+            writeBytes(_config.gap2_bytes(), 0x55);
+
+            {
+                Bytes data;
+                ByteWriter bw(data);
+
+                writeBytes(12, 0x55);
+                bw.write_8(am2Unencoded);
+
+                bw += sectorData->data;
+                uint16_t crc = crc16(CCITT_POLY, data);
+                bw.write_be16(crc);
+
+                writeRawBits(_config.am2_byte(), 16);
+                writeBytes(data.slice(1));
+            }
         }
 
-		return sectors;
+        if (_cursor >= _bits.size())
-	}
+            error("track data overrun");
+        while (_cursor < _bits.size())
+            writeBytes(1, 0x55);
 
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
+        auto fluxmap = std::make_unique<Fluxmap>();
-			const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
+        fluxmap->appendBits(_bits,
-	{
+            calculatePhysicalClockPeriod(
-		double clockRateUs = 1e3 / _config.clock_rate_khz() / 2.0;
+                clockRateUs * 1e3, _config.rotational_period_ms() * 1e6));
-		int bitsPerRevolution = (_config.track_length_ms() * 1000.0) / clockRateUs;
+        return fluxmap;
-		_bits.resize(bitsPerRevolution);
+    }
-		_cursor = 0;
-
-		uint8_t am1Unencoded = decodeUint16(_config.am1_byte());
-		uint8_t am2Unencoded = decodeUint16(_config.am2_byte());
-
-		writeBytes(_config.gap1_bytes(), 0x55);
-
-		bool first = true;
-		for (char sectorChar : _config.sector_skew())
-		{
-			int sectorId = charToInt(sectorChar);
-			if (!first)
-				writeBytes(_config.gap3_bytes(), 0x55);
-			first = false;
-
-			const auto& sectorData = image.get(physicalTrack, physicalSide, sectorId);
-			if (!sectorData)
-				Error() << fmt::format("format tried to find sector {} which wasn't in the input file", sectorId);
-
-			/* Writing the sector and data records are fantastically annoying.
-			 * The CRC is calculated from the *very start* of the record, and
-			 * include the malformed marker bytes. Our encoder doesn't know
-			 * about this, of course, with the result that we have to construct
-			 * the unencoded header, calculate the checksum, and then use the
-			 * same logic to emit the bytes which require special encoding
-			 * before encoding the rest of the header normally. */
-
-			{
-				Bytes header;
-				ByteWriter bw(header);
-
-				writeBytes(12, 0x55);
-				bw.write_8(am1Unencoded);
-				bw.write_8(sectorData->logicalSide << 3);
-				bw.write_8(sectorData->logicalTrack);
-				bw.write_8(_config.sector_count());
-				bw.write_8(sectorData->logicalSector);
-				bw.write_be16(sectorData->data.size());
-				uint16_t crc = crc16(CCITT_POLY, header);
-				bw.write_be16(crc);
-
-				writeRawBits(_config.am1_byte(), 16);
-				writeBytes(header.slice(1));
-			}
-
-			writeBytes(_config.gap2_bytes(), 0x55);
-
-			{
-				Bytes data;
-				ByteWriter bw(data);
-
-				writeBytes(12, 0x55);
-				bw.write_8(am2Unencoded);
-
-				bw += sectorData->data;
-				uint16_t crc = crc16(CCITT_POLY, data);
-				bw.write_be16(crc);
-
-				writeRawBits(_config.am2_byte(), 16);
-				writeBytes(data.slice(1));
-			}
-		}
-
-		if (_cursor >= _bits.size())
-			Error() << "track data overrun";
-		while (_cursor < _bits.size())
-			writeBytes(1, 0x55);
-		
-		std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-		fluxmap->appendBits(_bits, clockRateUs*1e3);
-		return fluxmap;
-	}
 
 private:
-	const Tids990EncoderProto& _config;
+    const Tids990EncoderProto& _config;
-	std::vector<bool> _bits;
+    std::vector<bool> _bits;
-	unsigned _cursor;
+    unsigned _cursor;
-	bool _lastBit;
+    bool _lastBit;
 };
 
-std::unique_ptr<AbstractEncoder> createTids990Encoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createTids990Encoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new Tids990Encoder(config));
+    return std::unique_ptr<Encoder>(new Tids990Encoder(config));
 }
-
-

arch/tids990/tids990.h

@@ -1,18 +1,18 @@
 #ifndef TIDS990_H
 #define TIDS990_H
 
-#define TIDS990_PAYLOAD_SIZE       288 /* bytes */
+#define TIDS990_PAYLOAD_SIZE 288                            /* bytes */
-#define TIDS990_SECTOR_RECORD_SIZE 10 /* bytes */
+#define TIDS990_SECTOR_RECORD_SIZE 10                       /* bytes */
-#define TIDS990_DATA_RECORD_SIZE   (TIDS990_PAYLOAD_SIZE + 4) /* bytes */
+#define TIDS990_DATA_RECORD_SIZE (TIDS990_PAYLOAD_SIZE + 4) /* bytes */
 
-class AbstractEncoder;
+class Encoder;
-class AbstractDecoder;
+class Decoder;
 class DecoderProto;
 class EncoderProto;
 
-extern std::unique_ptr<AbstractDecoder> createTids990Decoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createTids990Decoder(
-extern std::unique_ptr<AbstractEncoder> createTids990Encoder(const EncoderProto& config);
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createTids990Encoder(
+    const EncoderProto& config);
 
 #endif
-
-

arch/tids990/tids990.proto

@@ -3,12 +3,13 @@ syntax = "proto2";
 import "lib/common.proto";
 
 message Tids990DecoderProto {}
+
 message Tids990EncoderProto {
-	optional double track_length_ms = 1 [ default = 166,
+	optional double rotational_period_ms = 1 [ default = 166,
 		(help) = "length of a track" ];
 	optional int32 sector_count = 2 [ default = 26,
 		(help) = "number of sectors per track" ];
-	optional double clock_rate_khz = 3 [ default = 500,
+	optional double clock_period_us = 3 [ default = 2,
 		(help) = "clock rate of data to write" ];
 	optional int32 am1_byte = 4 [ default = 0x2244,
 		(help) = "16-bit RAW bit pattern to use for the AM1 ID byte" ];
@@ -20,7 +21,5 @@ message Tids990EncoderProto {
 		(help) = "size of gap 2 (the post-ID gap)" ];
 	optional int32 gap3_bytes = 8 [ default = 51,
 		(help) = "size of gap 3 (the post-data or format gap)" ];
-	optional string sector_skew = 9 [ default = "1mhc72nid83oje94pkfa50lgb6",
-		(help) = "order to emit sectors" ];
 }
 

arch/victor9k/decoder.cc

@@ -13,16 +13,18 @@
 
 const FluxPattern SECTOR_RECORD_PATTERN(32, VICTOR9K_SECTOR_RECORD);
 const FluxPattern DATA_RECORD_PATTERN(32, VICTOR9K_DATA_RECORD);
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
 static int decode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
+    case gcr:                \
-		#include "data_gcr.h"
+        return data;
-		#undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
@@ -37,11 +39,11 @@ static Bytes decode(const std::vector<bool>& bits)
     while (ii != bits.end())
     {
         uint8_t inputfifo = 0;
-        for (size_t i=0; i<5; i++)
+        for (size_t i = 0; i < 5; i++)
         {
             if (ii == bits.end())
                 break;
-            inputfifo = (inputfifo<<1) | *ii++;
+            inputfifo = (inputfifo << 1) | *ii++;
         }
 
         uint8_t decoded = decode_data_gcr(inputfifo);
@@ -52,73 +54,65 @@ static Bytes decode(const std::vector<bool>& bits)
     return output;
 }
 
-class Victor9kDecoder : public AbstractDecoder
+class Victor9kDecoder : public Decoder
 {
 public:
-	Victor9kDecoder(const DecoderProto& config):
+    Victor9kDecoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        return seekToPattern(ANY_RECORD_PATTERN);
-		_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_RECORD_PATTERN)
-			return SECTOR_RECORD;
-		if (matcher == &DATA_RECORD_PATTERN)
-			return DATA_RECORD;
-		return UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		/* Skip the sync marker bit. */
+        /* Check the ID. */
-		readRawBits(22);
 
-		/* Read header. */
+        if (readRaw32() != VICTOR9K_SECTOR_RECORD)
+            return;
 
-		auto bytes = decode(readRawBits(4*10)).slice(0, 4);
+        /* Read header. */
 
-		uint8_t rawTrack = bytes[1];
+        auto bytes = decode(readRawBits(3 * 10)).slice(0, 3);
-		_sector->logicalSector = bytes[2];
-		uint8_t gotChecksum = bytes[3];
 
-		_sector->logicalTrack = rawTrack & 0x7f;
+        uint8_t rawTrack = bytes[0];
-		_sector->logicalSide = rawTrack >> 7;
+        _sector->logicalSector = bytes[1];
-		uint8_t wantChecksum = bytes[1] + bytes[2];
+        uint8_t gotChecksum = bytes[2];
-		if ((_sector->logicalSector > 20) || (_sector->logicalTrack > 85) || (_sector->logicalSide > 1))
-			return;
-					
-		if (wantChecksum == gotChecksum)
-			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
-	}
 
-    void decodeDataRecord()
+        _sector->logicalTrack = rawTrack & 0x7f;
-	{
+        _sector->logicalSide = rawTrack >> 7;
-		/* Skip the sync marker bit. */
+        uint8_t wantChecksum = bytes[0] + bytes[1];
-		readRawBits(22);
+        if ((_sector->logicalSector > 20) || (_sector->logicalTrack > 85) ||
+            (_sector->logicalSide > 1))
+            return;
 
-		/* Read data. */
+        if (wantChecksum == gotChecksum)
+            _sector->status =
+                Sector::DATA_MISSING; /* unintuitive but correct */
+    }
 
-		auto bytes = decode(readRawBits((VICTOR9K_SECTOR_LENGTH+5)*10))
+    void decodeDataRecord() override
-			.slice(0, VICTOR9K_SECTOR_LENGTH+5);
+    {
-		ByteReader br(bytes);
+        /* Check the ID. */
 
-		/* Check that this is actually a data record. */
+        if (readRaw32() != VICTOR9K_DATA_RECORD)
-		
+            return;
-		if (br.read_8() != 8)
-			return;
 
-		_sector->data = br.read(VICTOR9K_SECTOR_LENGTH);
+        /* Read data. */
-		uint16_t gotChecksum = sumBytes(_sector->data);
+
-		uint16_t wantChecksum = br.read_le16();
+        auto bytes = decode(readRawBits((VICTOR9K_SECTOR_LENGTH + 4) * 10))
-		_sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+                         .slice(0, VICTOR9K_SECTOR_LENGTH + 4);
-	}
+        ByteReader br(bytes);
+
+        _sector->data = br.read(VICTOR9K_SECTOR_LENGTH);
+        uint16_t gotChecksum = sumBytes(_sector->data);
+        uint16_t wantChecksum = br.read_le16();
+        _sector->status =
+            (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createVictor9kDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createVictor9kDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new Victor9kDecoder(config));
+    return std::unique_ptr<Decoder>(new Victor9kDecoder(config));
 }
-
-

arch/victor9k/encoder.cc

@@ -4,106 +4,126 @@
 #include "victor9k.h"
 #include "crc.h"
 #include "sector.h"
-#include "writer.h"
+#include "readerwriter.h"
 #include "image.h"
 #include "fmt/format.h"
 #include "arch/victor9k/victor9k.pb.h"
 #include "lib/encoders/encoders.pb.h"
+#include "lib/layout.h"
 #include <ctype.h>
 #include "bytes.h"
 
 static bool lastBit;
 
-static void write_zero_bits(std::vector<bool>& bits, unsigned& cursor, unsigned count)
+static void write_zero_bits(
+    std::vector<bool>& bits, unsigned& cursor, unsigned count)
 {
     while (count--)
-	{
+    {
-		if (cursor < bits.size())
+        if (cursor < bits.size())
-			lastBit = bits[cursor++] = 0;
+            lastBit = bits[cursor++] = 0;
-	}
+    }
 }
 
-static void write_one_bits(std::vector<bool>& bits, unsigned& cursor, unsigned count)
+static void write_one_bits(
+    std::vector<bool>& bits, unsigned& cursor, unsigned count)
 {
     while (count--)
-	{
+    {
-		if (cursor < bits.size())
+        if (cursor < bits.size())
-			lastBit = bits[cursor++] = 1;
+            lastBit = bits[cursor++] = 1;
-	}
+    }
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
 {
-	for (bool bit : src)
+    for (bool bit : src)
-	{
+    {
-		if (cursor < bits.size())
+        if (cursor < bits.size())
-			lastBit = bits[cursor++] = bit;
+            lastBit = bits[cursor++] = bit;
-	}
+    }
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
 {
-	cursor += width;
+    cursor += width;
-	lastBit = data & 1;
+    lastBit = data & 1;
-	for (int i=0; i<width; i++)
+    for (int i = 0; i < width; i++)
-	{
+    {
-		unsigned pos = cursor - i - 1;
+        unsigned pos = cursor - i - 1;
-		if (pos < bits.size())
+        if (pos < bits.size())
-			bits[pos] = data & 1;
+            bits[pos] = data & 1;
-		data >>= 1;
+        data >>= 1;
-	}
+    }
 }
 
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
 {
-	ByteReader br(bytes);
+    ByteReader br(bytes);
-	BitReader bitr(br);
+    BitReader bitr(br);
 
-	while (!bitr.eof())
+    while (!bitr.eof())
-	{
+    {
-		if (cursor < bits.size())
+        if (cursor < bits.size())
-			bits[cursor++] = bitr.get();
+            bits[cursor++] = bitr.get();
-	}
+    }
 }
 
 static int encode_data_gcr(uint8_t data)
 {
     switch (data & 0x0f)
     {
-        #define GCR_ENTRY(gcr, data) \
+#define GCR_ENTRY(gcr, data) \
-            case data: return gcr;
+    case data:               \
-        #include "data_gcr.h"
+        return gcr;
-        #undef GCR_ENTRY
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
 }
 
-static void write_bytes(std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
+static void write_byte(std::vector<bool>& bits, unsigned& cursor, uint8_t b)
 {
-    for (uint8_t b : bytes)
+    write_bits(bits, cursor, encode_data_gcr(b >> 4), 5);
-    {
+    write_bits(bits, cursor, encode_data_gcr(b), 5);
-        write_bits(bits, cursor, encode_data_gcr(b>>4), 5);
-        write_bits(bits, cursor, encode_data_gcr(b),    5);
-    }
 }
 
-static void write_sector(std::vector<bool>& bits, unsigned& cursor,
+static void write_bytes(
-		const Victor9kEncoderProto::TrackdataProto& trackdata,
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
-        const Sector& sector)
+{
+    for (uint8_t b : bytes)
+        write_byte(bits, cursor, b);
+}
+
+static void write_gap(std::vector<bool>& bits, unsigned& cursor, int length)
+{
+    for (int i = 0; i < length / 10; i++)
+        write_byte(bits, cursor, '0');
+}
+
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const Victor9kEncoderProto::TrackdataProto& trackdata,
+    const Sector& sector)
 {
     write_one_bits(bits, cursor, trackdata.pre_header_sync_bits());
     write_bits(bits, cursor, VICTOR9K_SECTOR_RECORD, 10);
 
-    uint8_t encodedTrack = sector.logicalTrack | (sector.logicalSide<<7);
+    uint8_t encodedTrack = sector.logicalTrack | (sector.logicalSide << 7);
     uint8_t encodedSector = sector.logicalSector;
-    write_bytes(bits, cursor, Bytes {
+    write_bytes(bits,
-        encodedTrack,
+        cursor,
-        encodedSector,
+        Bytes{
-        (uint8_t)(encodedTrack + encodedSector),
+            encodedTrack,
-    });
+            encodedSector,
+            (uint8_t)(encodedTrack + encodedSector),
+        });
 
+    write_gap(bits, cursor, trackdata.post_header_gap_bits());
 
-    write_zero_bits(bits, cursor, trackdata.post_header_gap_bits());
     write_one_bits(bits, cursor, trackdata.pre_data_sync_bits());
     write_bits(bits, cursor, VICTOR9K_DATA_RECORD, 10);
 
@@ -112,89 +132,79 @@ static void write_sector(std::vector<bool>& bits, unsigned& cursor,
     Bytes checksum(2);
     checksum.writer().write_le16(sumBytes(sector.data));
     write_bytes(bits, cursor, checksum);
-
+    write_gap(bits, cursor, trackdata.post_data_gap_bits());
-    write_zero_bits(bits, cursor, trackdata.post_data_gap_bits());
 }
 
-class Victor9kEncoder : public AbstractEncoder
+class Victor9kEncoder : public Encoder
 {
 public:
-	Victor9kEncoder(const EncoderProto& config):
+    Victor9kEncoder(const EncoderProto& config):
-        AbstractEncoder(config),
+        Encoder(config),
-		_config(config.victor9k())
+        _config(config.victor9k())
-	{}
+    {
+    }
 
 private:
+    void getTrackFormat(Victor9kEncoderProto::TrackdataProto& trackdata,
+        unsigned track,
+        unsigned head)
+    {
+        trackdata.Clear();
+        for (const auto& f : _config.trackdata())
+        {
+            if (f.has_min_track() && (track < f.min_track()))
+                continue;
+            if (f.has_max_track() && (track > f.max_track()))
+                continue;
+            if (f.has_head() && (head != f.head()))
+                continue;
 
-	void getTrackFormat(Victor9kEncoderProto::TrackdataProto& trackdata, unsigned cylinder, unsigned head)
+            trackdata.MergeFrom(f);
-	{
+        }
-		trackdata.Clear();
+    }
-		for (const auto& f : _config.trackdata())
-		{
-			if (f.has_min_cylinder() && (cylinder < f.min_cylinder()))
-				continue;
-			if (f.has_max_cylinder() && (cylinder > f.max_cylinder()))
-				continue;
-			if (f.has_head() && (head != f.head()))
-				continue;
-
-			trackdata.MergeFrom(f);
-		}
-	}
 
 public:
-	std::vector<std::shared_ptr<Sector>> collectSectors(int physicalTrack, int physicalSide, const Image& image) override
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
-	{
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
-		std::vector<std::shared_ptr<Sector>> sectors;
+        const Image& image) override
-
-		Victor9kEncoderProto::TrackdataProto trackdata;
-		getTrackFormat(trackdata, physicalTrack, physicalSide);
-
-        for (int i = 0; i < trackdata.sector_range().sector_count(); i++)
-        {
-            int sectorId = trackdata.sector_range().start_sector() + i;
-			const auto& sector = image.get(physicalTrack, physicalSide, sectorId);
-			if (sector)
-				sectors.push_back(sector);
-        }
-
-		return sectors;
-	}
-
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide,
-            const std::vector<std::shared_ptr<Sector>>& sectors, const Image& image) override
     {
-		Victor9kEncoderProto::TrackdataProto trackdata;
+        Victor9kEncoderProto::TrackdataProto trackdata;
-		getTrackFormat(trackdata, physicalTrack, physicalSide);
+        getTrackFormat(
+            trackdata, trackInfo->logicalTrack, trackInfo->logicalSide);
 
-        unsigned bitsPerRevolution = trackdata.original_data_rate_khz() * trackdata.original_period_ms();
+        unsigned bitsPerRevolution = (trackdata.rotational_period_ms() * 1e3) /
+                                     trackdata.clock_period_us();
         std::vector<bool> bits(bitsPerRevolution);
-        double clockRateUs = 166666.0 / bitsPerRevolution;
+        nanoseconds_t clockPeriod =
+            calculatePhysicalClockPeriod(trackdata.clock_period_us() * 1e3,
+                trackdata.rotational_period_ms() * 1e6);
         unsigned cursor = 0;
 
-        fillBitmapTo(bits, cursor, trackdata.post_index_gap_us() / clockRateUs, { true, false });
+        fillBitmapTo(bits,
+            cursor,
+            trackdata.post_index_gap_us() * 1e3 / clockPeriod,
+            {true, false});
         lastBit = false;
 
         for (const auto& sector : sectors)
             write_sector(bits, cursor, trackdata, *sector);
 
         if (cursor >= bits.size())
-            Error() << fmt::format("track data overrun by {} bits", cursor - bits.size());
+            error("track data overrun by {} bits", cursor - bits.size());
-        fillBitmapTo(bits, cursor, bits.size(), { true, false });
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
 
         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-        fluxmap->appendBits(bits, clockRateUs*1e3);
+        fluxmap->appendBits(bits, clockPeriod);
         return fluxmap;
     }
 
 private:
-	const Victor9kEncoderProto& _config;
+    const Victor9kEncoderProto& _config;
 };
 
-std::unique_ptr<AbstractEncoder> createVictor9kEncoder(const EncoderProto& config)
+std::unique_ptr<Encoder> createVictor9kEncoder(const EncoderProto& config)
 {
-	return std::unique_ptr<AbstractEncoder>(new Victor9kEncoder(config));
+    return std::unique_ptr<Encoder>(new Victor9kEncoder(config));
 }
 
 // vim: sw=4 ts=4 et
-

arch/victor9k/victor9k.h

@@ -1,22 +1,26 @@
 #ifndef VICTOR9K_H
 #define VICTOR9K_H
 
-class AbstractEncoder;
+class Encoder;
-class AbstractDecoder;
+class Decoder;
 class EncoderProto;
 class DecoderProto;
 
 /* ... 1101 0101 0111
  *       ^^ ^^^^ ^^^^ ten bit IO byte */
-#define VICTOR9K_SECTOR_RECORD 0xfffffd57 
+#define VICTOR9K_SECTOR_RECORD 0xfffffd57
+#define VICTOR9K_HEADER_ID 0x7
 
 /* ... 1101 0100 1001
  *       ^^ ^^^^ ^^^^ ten bit IO byte */
-#define VICTOR9K_DATA_RECORD   0xfffffd49
+#define VICTOR9K_DATA_RECORD 0xfffffd49
+#define VICTOR9K_DATA_ID 0x8
 
 #define VICTOR9K_SECTOR_LENGTH 512
 
-extern std::unique_ptr<AbstractDecoder> createVictor9kDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createVictor9kDecoder(
-extern std::unique_ptr<AbstractEncoder> createVictor9kEncoder(const EncoderProto& config);
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createVictor9kEncoder(
+    const EncoderProto& config);
 
 #endif

arch/victor9k/victor9k.proto

@@ -5,28 +5,32 @@ import "lib/common.proto";
 message Victor9kDecoderProto {}
 
 // NEXT: 12
-message Victor9kEncoderProto {
+message Victor9kEncoderProto
-	message TrackdataProto {
+{
-		message SectorRangeProto {
+    message TrackdataProto
-			optional int32 start_sector = 1 [(help) = "first sector ID on track"];
+    {
-			optional int32 sector_count = 2 [(help) = "number of sectors on track"];
+        optional int32 min_track = 1
-		}
+            [ (help) = "minimum track this format applies to" ];
+        optional int32 max_track = 2
+            [ (help) = "maximum track this format applies to" ];
+        optional int32 head = 3
+            [ (help) = "which head this format applies to" ];
 
-		optional int32 min_cylinder = 1            [(help) = "minimum cylinder this format applies to"];
+        optional double rotational_period_ms = 4
-		optional int32 max_cylinder = 2            [(help) = "maximum cylinder this format applies to"];
+            [ (help) = "original rotational period of this track" ];
-		optional int32 head = 3                    [(help) = "which head this format applies to"];
+        optional double clock_period_us = 5
+            [ (help) = "original data rate of this track" ];
+        optional double post_index_gap_us = 6
+            [ (help) = "size of post-index gap" ];
+        optional int32 pre_header_sync_bits = 10
+            [ (help) = "number of sync bits before the sector header" ];
+        optional int32 pre_data_sync_bits = 8
+            [ (help) = "number of sync bits before the sector data" ];
+        optional int32 post_data_gap_bits = 9
+            [ (help) = "size of gap between data and the next header" ];
+        optional int32 post_header_gap_bits = 11
+            [ (help) = "size of gap between header and the data" ];
+    }
 
-		optional double original_period_ms = 4     [(help) = "original rotational period of this cylinder"];
+    repeated TrackdataProto trackdata = 1;
-		optional double original_data_rate_khz = 5 [(help) = "original data rate of this cylinder"];
-		optional double post_index_gap_us = 6      [(help) = "size of post-index gap"];
-		optional int32 pre_header_sync_bits = 10   [(help) = "number of sync bits before the sector header"];
-		optional int32 pre_data_sync_bits = 8      [(help) = "number of sync bits before the sector data"];
-		optional int32 post_data_gap_bits = 9      [(help) = "size of gap between data and the next header"];
-		optional int32 post_header_gap_bits = 11   [(help) = "size of gap between header and the data"];
-
-		optional SectorRangeProto sector_range = 7 [(help) = "write these sectors on each track"];
-	}
-
-	repeated TrackdataProto trackdata = 1;
 }
-

arch/zilogmcz/decoder.cc

@@ -13,49 +13,43 @@
 
 static const FluxPattern SECTOR_START_PATTERN(16, 0xaaab);
 
-class ZilogMczDecoder : public AbstractDecoder
+class ZilogMczDecoder : public Decoder
 {
 public:
-	ZilogMczDecoder(const DecoderProto& config):
+    ZilogMczDecoder(const DecoderProto& config): Decoder(config) {}
-		AbstractDecoder(config)
-	{}
 
-    RecordType advanceToNextRecord()
+    nanoseconds_t advanceToNextRecord() override
-	{
+    {
-		const FluxMatcher* matcher = nullptr;
+        seekToIndexMark();
-		_fmr->seekToIndexMark();
+        return seekToPattern(SECTOR_START_PATTERN);
-		_sector->clock = _fmr->seekToPattern(SECTOR_START_PATTERN, matcher);
+    }
-		if (matcher == &SECTOR_START_PATTERN)
-			return SECTOR_RECORD;
-		return UNKNOWN_RECORD;
-	}
 
-    void decodeSectorRecord()
+    void decodeSectorRecord() override
-	{
+    {
-		readRawBits(14);
+        readRawBits(14);
 
-		auto rawbits = readRawBits(140*16);
+        auto rawbits = readRawBits(140 * 16);
-		auto bytes = decodeFmMfm(rawbits).slice(0, 140);
+        auto bytes = decodeFmMfm(rawbits).slice(0, 140);
-		ByteReader br(bytes);
+        ByteReader br(bytes);
 
-		_sector->logicalSector = br.read_8() & 0x1f;
+        _sector->logicalSector = br.read_8() & 0x1f;
-		_sector->logicalSide = 0;
+        _sector->logicalSide = 0;
-		_sector->logicalTrack = br.read_8() & 0x7f;
+        _sector->logicalTrack = br.read_8() & 0x7f;
-		if (_sector->logicalSector > 31)
+        if (_sector->logicalSector > 31)
-			return;
+            return;
-		if (_sector->logicalTrack > 80)
+        if (_sector->logicalTrack > 80)
-			return;
+            return;
 
-		_sector->data = br.read(132);
+        _sector->data = br.read(132);
-		uint16_t wantChecksum = br.read_be16();
+        uint16_t wantChecksum = br.read_be16();
-		uint16_t gotChecksum = crc16(MODBUS_POLY, 0x0000, bytes.slice(0, 134));
+        uint16_t gotChecksum = crc16(MODBUS_POLY, 0x0000, bytes.slice(0, 134));
 
-		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+        _sector->status =
-	}
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
 };
 
-std::unique_ptr<AbstractDecoder> createZilogMczDecoder(const DecoderProto& config)
+std::unique_ptr<Decoder> createZilogMczDecoder(const DecoderProto& config)
 {
-	return std::unique_ptr<AbstractDecoder>(new ZilogMczDecoder(config));
+    return std::unique_ptr<Decoder>(new ZilogMczDecoder(config));
 }
-

arch/zilogmcz/zilogmcz.h

@@ -1,8 +1,7 @@
 #ifndef ZILOGMCZ_H
 #define ZILOGMCZ_H
 
-extern std::unique_ptr<AbstractDecoder> createZilogMczDecoder(const DecoderProto& config);
+extern std::unique_ptr<Decoder> createZilogMczDecoder(
+    const DecoderProto& config);
 
 #endif
-
-

build.lua

@@ -0,0 +1,194 @@
+vars.cflags = { "$(CFLAGS)" }
+vars.cxxflags = { "$(CXXFLAGS)" }
+vars.ldflags = { "-pthread" }
+
+include "build/protobuf.lua"
+include "build/dependency.lua"
+include "build/tests.lua"
+
+dependency {
+	name = "fmt_dep",
+	pkg_config = "fmt",
+}
+
+dependency {
+	name = "stb_dep",
+	pkg_config = "stb",
+	fallback = "dep/stb+stb"
+}
+
+dependency {
+	name = "protobuf_dep",
+	pkg_config = "protobuf"
+}
+
+dependency {
+	name = "zlib_dep",
+	pkg_config = "zlib"
+}
+
+proto_cc_library {
+	name = "config_lib",
+	srcs = {
+		"./lib/common.proto",
+		"./lib/config.proto",
+		"./lib/decoders/decoders.proto",
+		"./lib/drive.proto",
+		"./lib/encoders/encoders.proto",
+		"./lib/fl2.proto",
+		"./lib/fluxsink/fluxsink.proto",
+		"./lib/fluxsource/fluxsource.proto",
+		"./lib/imagereader/imagereader.proto",
+		"./lib/imagewriter/imagewriter.proto",
+		"./lib/mapper.proto",
+		"./lib/usb/usb.proto",
+		"./arch/aeslanier/aeslanier.proto",
+		"./arch/agat/agat.proto",
+		"./arch/amiga/amiga.proto",
+		"./arch/apple2/apple2.proto",
+		"./arch/brother/brother.proto",
+		"./arch/c64/c64.proto",
+		"./arch/f85/f85.proto",
+		"./arch/fb100/fb100.proto",
+		"./arch/ibm/ibm.proto",
+		"./arch/macintosh/macintosh.proto",
+		"./arch/micropolis/micropolis.proto",
+		"./arch/mx/mx.proto",
+		"./arch/northstar/northstar.proto",
+		"./arch/rolandd20/rolandd20.proto",
+		"./arch/tids990/tids990.proto",
+		"./arch/victor9k/victor9k.proto",
+		"./arch/zilogmcz/zilogmcz.proto",
+	}
+}
+
+clibrary {
+	name = "protocol_lib",
+	hdrs = { "./protocol.h" }
+}
+
+clibrary {
+	name = "libfluxengine",
+	srcs = {
+		"./arch/aeslanier/decoder.cc",
+		"./arch/agat/agat.cc",
+		"./arch/agat/decoder.cc",
+		"./arch/amiga/amiga.cc",
+		"./arch/amiga/decoder.cc",
+		"./arch/amiga/encoder.cc",
+		"./arch/apple2/decoder.cc",
+		"./arch/apple2/encoder.cc",
+		"./arch/brother/decoder.cc",
+		"./arch/brother/encoder.cc",
+		"./arch/c64/c64.cc",
+		"./arch/c64/decoder.cc",
+		"./arch/c64/encoder.cc",
+		"./arch/f85/decoder.cc",
+		"./arch/fb100/decoder.cc",
+		"./arch/ibm/decoder.cc",
+		"./arch/ibm/encoder.cc",
+		"./arch/macintosh/decoder.cc",
+		"./arch/macintosh/encoder.cc",
+		"./arch/micropolis/decoder.cc",
+		"./arch/micropolis/encoder.cc",
+		"./arch/mx/decoder.cc",
+		"./arch/northstar/decoder.cc",
+		"./arch/northstar/encoder.cc",
+		"./arch/rolandd20/rolandd20.cc",
+		"./arch/tids990/decoder.cc",
+		"./arch/tids990/encoder.cc",
+		"./arch/victor9k/decoder.cc",
+		"./arch/victor9k/encoder.cc",
+		"./arch/zilogmcz/decoder.cc",
+		"./lib/bitmap.cc",
+		"./lib/bytes.cc",
+		"./lib/crc.cc",
+		"./lib/csvreader.cc",
+		"./lib/decoders/decoders.cc",
+		"./lib/decoders/fluxdecoder.cc",
+		"./lib/decoders/fluxmapreader.cc",
+		"./lib/decoders/fmmfm.cc",
+		"./lib/encoders/encoders.cc",
+		"./lib/flags.cc",
+		"./lib/fluxmap.cc",
+		"./lib/fluxsink/aufluxsink.cc",
+		"./lib/fluxsink/fl2fluxsink.cc",
+		"./lib/fluxsink/fluxsink.cc",
+		"./lib/fluxsink/hardwarefluxsink.cc",
+		"./lib/fluxsink/scpfluxsink.cc",
+		"./lib/fluxsink/vcdfluxsink.cc",
+		"./lib/fluxsource/cwffluxsource.cc",
+		"./lib/fluxsource/erasefluxsource.cc",
+		"./lib/fluxsource/fl2fluxsource.cc",
+		"./lib/fluxsource/fluxsource.cc",
+		"./lib/fluxsource/hardwarefluxsource.cc",
+		"./lib/fluxsource/kryoflux.cc",
+		"./lib/fluxsource/kryofluxfluxsource.cc",
+		"./lib/fluxsource/scpfluxsource.cc",
+		"./lib/fluxsource/testpatternfluxsource.cc",
+		"./lib/globals.cc",
+		"./lib/hexdump.cc",
+		"./lib/image.cc",
+		"./lib/imagereader/d64imagereader.cc",
+		"./lib/imagereader/d88imagereader.cc",
+		"./lib/imagereader/dimimagereader.cc",
+		"./lib/imagereader/diskcopyimagereader.cc",
+		"./lib/imagereader/fdiimagereader.cc",
+		"./lib/imagereader/imagereader.cc",
+		"./lib/imagereader/imdimagereader.cc",
+		"./lib/imagereader/imgimagereader.cc",
+		"./lib/imagereader/jv3imagereader.cc",
+		"./lib/imagereader/nfdimagereader.cc",
+		"./lib/imagereader/nsiimagereader.cc",
+		"./lib/imagereader/td0imagereader.cc",
+		"./lib/imagewriter/d64imagewriter.cc",
+		"./lib/imagewriter/d88imagewriter.cc",
+		"./lib/imagewriter/diskcopyimagewriter.cc",
+		"./lib/imagewriter/imagewriter.cc",
+		"./lib/imagewriter/imgimagewriter.cc",
+		"./lib/imagewriter/ldbsimagewriter.cc",
+		"./lib/imagewriter/nsiimagewriter.cc",
+		"./lib/imagewriter/rawimagewriter.cc",
+		"./lib/imginputoutpututils.cc",
+		"./lib/ldbs.cc",
+		"./lib/logger.cc",
+		"./lib/mapper.cc",
+		"./lib/proto.cc",
+		"./lib/readerwriter.cc",
+		"./lib/sector.cc",
+		"./lib/usb/fluxengineusb.cc",
+		"./lib/usb/greaseweazle.cc",
+		"./lib/usb/greaseweazleusb.cc",
+		"./lib/usb/serial.cc",
+		"./lib/usb/usb.cc",
+		"./lib/usb/usbfinder.cc",
+		"./lib/utils.cc",
+		"protocol.h",
+	},
+	deps = {
+		"+config_lib",
+		"+protocol_lib",
+		"+fmt_dep",
+		"+protobuf_dep",
+		"+zlib_dep",
+		"dep/libusbp+libusbp",
+	},
+	dep_cflags = { "-Ilib", "-Iarch", "-I." },
+	vars = {
+		["+cflags"] = { "-Ilib", "-Iarch", "-I." }
+	}
+}
+
+installable {
+	name = "all",
+	map = {
+		["fluxengine"] = "src+fluxengine",
+		["fluxengine-gui"] = "src/gui+fluxengine",
+		["brother120tool"] = "tools+brother120tool",
+		["brother240tool"] = "tools+brother240tool",
+		["upgrade-flux-file"] = "tools+upgrade-flux-file",
+	}
+}
+
+include "tests/build.lua"
+

build/build.lua

@@ -0,0 +1,251 @@
+local OBJDIR = "$(OBJDIR)"
+
+local function objdir(e)
+	return concatpath(OBJDIR, e.cwd, e.name)
+end
+
+definerule("normalrule",
+	{
+		ins = { type="targets" },
+		deps = { type="targets", default={} },
+		outs = { type="targets", default={} },
+		outleaves = { type="strings" },
+		label = { type="string", optional=true },
+		objdir = { type="string", optional=true },
+		commands = { type="strings" },
+	},
+	function (e)
+		local dir = e.objdir or objdir(e)
+		local realouts = {}
+		for _, v in pairs(e.outleaves) do
+			realouts[#realouts+1] = concatpath(dir, v)
+		end
+
+		local vars = inherit(e.vars, {
+			dir = dir
+		})
+
+		local result = simplerule {
+			name = e.name,
+			ins = e.ins,
+			deps = e.deps,
+			outs = concat(realouts, filenamesof(e.outs)),
+			label = e.label,
+			commands = e.commands,
+			vars = vars,
+		}
+		result.dir = dir
+		return result
+	end
+)
+
+local function is_clike(f)
+	return f:find("%.c$") or f:find("%.cc$") or f:find("%.cpp$")
+end
+
+definerule("cfile",
+	{
+		srcs = { type="targets" },
+		deps = { type="targets", default={} }
+	},
+	function (e)
+		local cflags = e.vars.cflags
+		local cxxflags = e.vars.cxxflags
+		for _, target in ipairs(targetsof(e.deps)) do
+			if target.is.clibrary then
+				cflags = concat(cflags, target.dep_cflags)
+				cxxflags = concat(cxxflags, target.dep_cxxflags)
+			end
+		end
+
+		local src = filter(filenamesof(e.srcs), is_clike)
+		local cmd
+		local cxx = false
+		if src[1]:find("%.c$") then
+			cmd = "$(CC) -c -o %{outs[1]} %{ins[1]} %{hdrpaths} %{cflags}"
+		else
+			cmd = "$(CXX) -c -o %{outs[1]} %{ins[1]} %{hdrpaths} %{cflags} %{cxxflags}"
+			cxx = true
+		end
+
+		local outleaf = basename(e.name)..".o"
+		local rule = normalrule {
+			name = e.name,
+			cwd = e.cwd,
+			ins = e.srcs,
+			deps = e.deps,
+			outleaves = {outleaf},
+			label = e.label,
+			commands = cmd,
+			vars = {
+				hdrpaths = {},
+				cflags = cflags,
+				cxxflags = cxxflags,
+			}
+		}
+
+		rule.is.cxxfile = cxx
+		return rule
+	end
+)
+
+local function do_cfiles(e)
+	local outs = {}
+	local srcs = filenamesof(e.srcs)
+	for _, f in ipairs(sorted(filter(srcs, is_clike))) do
+		local ofile
+		if f:find(OBJDIR, 1, true) == 1 then
+			ofile = e.name.."/"..f:sub(#OBJDIR+1)..".o"
+		else
+			ofile = e.name.."/"..f..".o"
+		end
+		outs[#outs+1] = cfile {
+			name = ofile,
+			srcs = { f },
+			deps = e.deps
+		}
+	end
+	return outs
+end
+
+definerule("clibrary",
+	{
+		srcs = { type="targets", default={} },
+		deps = { type="targets", default={} },
+		hdrs = { type="targets", default={} },
+		dep_cflags = { type="strings", default={} },
+		dep_cxxflags = { type="strings", default={} },
+		dep_ldflags = { type="strings", default={} },
+		dep_libs = { type="strings", default={} },
+	},
+	function (e)
+		local ins = do_cfiles(e)
+		local cxx = false
+		for _, f in ipairs(ins) do
+			if f.is.cxxfile then
+				cxx = true
+				break
+			end
+		end
+
+		local mkdirs = {}
+		local copies = {}
+		local outs = {}
+		local function copy_file(src, dest)
+			mkdirs[#mkdirs+1] = "mkdir -p %{dir}/"..dirname(dest)
+			copies[#copies+1] = "cp "..src.." %{dir}/"..dest
+			outs[#outs+1] = objdir(e).."/"..dest
+		end
+
+		local deps = {}
+		for k, v in pairs(e.hdrs) do
+			deps[#deps+1] = v
+			if type(k) == "number" then
+				v = filenamesof(v)
+				for _, v in ipairs(v) do
+					if not startswith(e.cwd, v) then
+						error(string.format("filename '%s' is not local to '%s' --- "..
+							"you'll have to specify the output filename manually", v, e.cwd))
+					end
+					copy_file(v, v:gsub("^"..e.cwd, ""))
+				end
+			else
+				v = filenamesof(v)
+				if #v ~= 1 then
+					error("each mapped hdrs item can only cope with a single file")
+				end
+				copy_file(v[1], k)
+			end
+		end
+
+		ins = sorted(filenamesof(ins))
+		local has_ar = (#ins ~= 0)
+		local lib = normalrule {
+			name = e.name,
+			cwd = e.cwd,
+			ins = sorted(filenamesof(ins)),
+			deps = deps,
+			outs = outs,
+			outleaves = { e.name..".a" },
+			label = e.label,
+			commands = {
+				sorted(mkdirs),
+				sorted(copies),
+				has_ar and "rm -f %{outs[1]} && $(AR) cqs %{outs[1]} %{ins}" or {},
+			}
+		}
+		
+		lib.dep_cflags = concat(e.dep_cflags, "-I"..lib.dir)
+		lib.dep_cxxflags = e.dep_cxxflags
+		lib.dep_ldflags = e.dep_ldflags
+		lib.dep_libs = concat(e.dep_libs, has_ar and matching(filenamesof(lib), "%.a$") or {})
+		lib.dep_cxx = cxx
+
+		for _, d in pairs(targetsof(e.deps)) do
+			lib.dep_cflags = concat(lib.dep_cflags, d.dep_cflags)
+			lib.dep_cxxflags = concat(lib.dep_cxxflags, d.dep_cxxflags)
+			lib.dep_ldflags = concat(lib.dep_ldflags, d.dep_ldflags)
+			lib.dep_libs = concat(lib.dep_libs, d.dep_libs)
+			lib.dep_cxx = lib.dep_cxx or d.dep_cxx
+		end
+
+		return lib
+	end
+)
+
+definerule("cprogram",
+	{
+		srcs = { type="targets", default={} },
+		deps = { type="targets", default={} },
+	},
+	function (e)
+		local deps = e.deps
+		local ins = {}
+		local cxx = false
+
+		if (#e.srcs > 0) then
+			local objs = do_cfiles(e)
+			for _, obj in pairs(objs) do
+				if obj.is.cxxfile then
+					cxx = true
+				end
+				ins[#ins+1] = obj
+			end
+		end
+
+		local libs = {}
+		local cflags = {}
+		local cxxflags = {}
+		local ldflags = {}
+		for _, lib in pairs(e.deps) do
+			cflags = concat(cflags, lib.dep_cflags)
+			cxxflags = concat(cxxflags, lib.dep_cxxflags)
+			ldflags = concat(ldflags, lib.dep_ldflags)
+			libs = concat(libs, lib.dep_libs)
+			cxx = cxx or lib.dep_cxx
+		end
+
+		local command
+		if cxx then
+			command = "$(CXX) $(LDFLAGS) %{ldflags} -o %{outs[1]} %{ins} %{libs} %{libs}"
+		else
+			command = "$(CC) $(LDFLAGS) %{ldflags} -o %{outs[1]} %{ins} %{libs} %{libs}"
+		end
+
+		return normalrule {
+			name = e.name,
+			cwd = e.cwd,
+			deps = deps,
+			ins = ins,
+			outleaves = { e.name },
+			commands = { command },
+			vars = {
+				cflags = cflags,
+				cxxflags = cxxflags,
+				ldflags = ldflags,
+				libs = libs,
+			}
+		}
+	end
+)
+

build/tests.lua

@@ -0,0 +1,18 @@
+definerule("test",
+	{
+		srcs = { type="targets", default={} },
+	},
+	function (e)
+		if vars.TESTS == "yes" then
+			normalrule {
+				name = e.name,
+				ins = e.srcs,
+				outleaves = { "log.txt" },
+				commands = {
+					"%{ins} > %{outs}",
+				}
+			}
+		end
+	end
+)
+

dep/adflib/.gitignore

@@ -0,0 +1,45 @@
+# Object files
+*.o
+*.lo
+
+# Libraries
+.libs
+*.lib
+*.a
+*.la
+
+# Shared objects (inc. Windows DLLs)
+*.dll
+*.so
+*.so.*
+*.dylib
+
+# Executables
+*.exe
+*.out
+*.app
+
+# generated by autogen.sh
+INSTALL
+Makefile.in
+aclocal.m4
+autom4te.cache
+compile
+config.guess
+config.h.in
+config.sub
+configure
+depcomp
+install-sh
+ltmain.sh
+missing
+
+# generated by configure
+.deps
+Makefile
+adflib.pc
+config.h
+config.log
+config.status
+libtool
+stamp-h1

dep/adflib/AUTHORS

@@ -0,0 +1,13 @@
+
+The main developper is 
+ Laurent Clévy (laurent.clevy@club-internet.fr)
+
+Contributors are:
+ Bjarne Viksoe 
+   (C++ wrapper, lot of bug fixes)
+ Gary Harris 
+   (bug fixes and W32 support)
+ Dan Sutherland 
+   (bug fixes and W32 support)
+
+See CHANGES.txt for detailed contributions.

dep/adflib/COPYING

@@ -0,0 +1,339 @@
+		    GNU GENERAL PUBLIC LICENSE
+		       Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.,
+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+			    Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.  This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it.  (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.)  You can apply it to
+your programs, too.
+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+  For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must show them these terms so they know their
+rights.
+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+  Finally, any free program is threatened constantly by software
+patents.  We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary.  To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+		    GNU GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License.  The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language.  (Hereinafter, translation is included without limitation in
+the term "modification".)  Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+  1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+  2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) You must cause the modified files to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    b) You must cause any work that you distribute or publish, that in
+    whole or in part contains or is derived from the Program or any
+    part thereof, to be licensed as a whole at no charge to all third
+    parties under the terms of this License.
+
+    c) If the modified program normally reads commands interactively
+    when run, you must cause it, when started running for such
+    interactive use in the most ordinary way, to print or display an
+    announcement including an appropriate copyright notice and a
+    notice that there is no warranty (or else, saying that you provide
+    a warranty) and that users may redistribute the program under
+    these conditions, and telling the user how to view a copy of this
+    License.  (Exception: if the Program itself is interactive but
+    does not normally print such an announcement, your work based on
+    the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+    a) Accompany it with the complete corresponding machine-readable
+    source code, which must be distributed under the terms of Sections
+    1 and 2 above on a medium customarily used for software interchange; or,
+
+    b) Accompany it with a written offer, valid for at least three
+    years, to give any third party, for a charge no more than your
+    cost of physically performing source distribution, a complete
+    machine-readable copy of the corresponding source code, to be
+    distributed under the terms of Sections 1 and 2 above on a medium
+    customarily used for software interchange; or,
+
+    c) Accompany it with the information you received as to the offer
+    to distribute corresponding source code.  (This alternative is
+    allowed only for noncommercial distribution and only if you
+    received the program in object code or executable form with such
+    an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it.  For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable.  However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License.  Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+  5. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Program or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+  6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+  7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded.  In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+  9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+  10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.  For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+			    NO WARRANTY
+
+  11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+  12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+		     END OF TERMS AND CONDITIONS
+
+	    How to Apply These Terms to Your New Programs
+
+  If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+  To do so, attach the following notices to the program.  It is safest
+to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+    <one line to give the program's name and a brief idea of what it does.>
+    Copyright (C) <year>  <name of author>
+
+    This program is free software; you can redistribute it and/or modify
+    it under the terms of the GNU General Public License as published by
+    the Free Software Foundation; either version 2 of the License, or
+    (at your option) any later version.
+
+    This program is distributed in the hope that it will be useful,
+    but WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+    GNU General Public License for more details.
+
+    You should have received a copy of the GNU General Public License along
+    with this program; if not, write to the Free Software Foundation, Inc.,
+    51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+Also add information on how to contact you by electronic and paper mail.
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
+    Gnomovision version 69, Copyright (C) year name of author
+    Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+    This is free software, and you are welcome to redistribute it
+    under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the appropriate
+parts of the General Public License.  Of course, the commands you use may
+be called something other than `show w' and `show c'; they could even be
+mouse-clicks or menu items--whatever suits your program.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary.  Here is a sample; alter the names:
+
+  Yoyodyne, Inc., hereby disclaims all copyright interest in the program
+  `Gnomovision' (which makes passes at compilers) written by James Hacker.
+
+  <signature of Ty Coon>, 1 April 1989
+  Ty Coon, President of Vice
+
+This General Public License does not permit incorporating your program into
+proprietary programs.  If your program is a subroutine library, you may
+consider it more useful to permit linking proprietary applications with the
+library.  If this is what you want to do, use the GNU Lesser General
+Public License instead of this License.

dep/adflib/README

@@ -0,0 +1,128 @@
+
+
+The ADFlib is a free, portable and open implementation of the Amiga filesystem.
+
+initial release in 1999
+
+It supports :
+- floppy dumps
+- multiple partitions harddisk dumps
+- UAE hardfiles
+- WinNT devices with the 'native driver' written by Dan Sutherland
+- mount/unmount/create a device (real one or a dump file),
+- mount/unmount/create a volume (partition),
+- create/open/close/delete/rename/undel a file,
+- read/write bytes from/to a file,
+- create/delete/rename/move/undel a directory,
+- get directory contents, change current directory, get parent directory
+- use dir cache to get directory contents.
+
+
+It is written in portable C, and support the WinNT platform to access
+real drives.
+
+See also : 
+https://packages.debian.org/source/sid/unadf
+https://www.cvedetails.com/cve/CVE-2016-1243/
+https://www.cvedetails.com/cve/CVE-2016-1244/
+
+---
+
+unADF is a unzip like for .ADF files :
+
+
+unadf [-lrcsp -v n] dumpname.adf [files-with-path] [-d extractdir]
+    -l : lists root directory contents
+    -r : lists directory tree contents
+    -c : use dircache data (must be used with -l)
+    -s : display entries logical block pointer (must be used with -l)
+    -m : display file comments, if exists (must be used with -l)
+
+    -v n : mount volume #n instead of default #0 volume
+
+    -p : send extracted files to pipe (unadf -p dump.adf Pics/pic1.gif | xv -)
+    -d dir : extract to 'dir' directory
+
+
+
+Credits:
+--------
+
+main design and code             Laurent Clevy
+Bug fixes and C++ wrapper        Bjarke Viksoe (adfwrapper.h)
+WinNT native driver              Dan Sutherland and Gary Harris
+
+
+New versions and contact e-mail can be found at : 
+
+http://lclevy.free.fr/adflib
+
+
+
+COMPILATION
+-----------
+
+The following commands should automatically detect the system 
+configuration and build the library and examples/unadf, 
+the ADF extractor binary.
+
+	./autogen.sh
+	./configure
+	make
+
+
+
+FEATURES NEEDING FURTHER TESTS
+------------------------------
+
+* Native driver
+
+The NATIV_DIR variable is used to choose the (only one) target platform
+of the native driver. The default is :
+
+NATIV_DIR = ./Generic
+
+This one do not give access to any real device. The other one available is
+Win32, to access real devices under WinNT.
+
+
+* Win32DLL
+
+The 'prefix.h' is used to create the Win32 DLL version of the library.
+If the WIN32DLL variable is defined in the library code, public functions
+are preceded by the '__declspec(dllexport)' directive. If this same
+variable is defined, the '__declspec(dllimport)' is put before the functions
+prototypes in the 'adflib.h' library include file.
+
+
+
+
+FILES
+-----
+
+AUTHORS   Contributors
+README			The file you are reading
+TODO			Future improvements and bugfixes
+CHANGES			Detailed changes
+src/			main library files
+src/win32/		WinNT native driver
+src/generic/		native files templates
+boot/			Bootblocks that might by used to put on floppy disks
+doc/			The library developpers documentation 
+doc/FAQ/		The Amiga Filesystem explained
+examples/		unadf.c
+
+
+Possible bugs
+-------------
+
+- in dircache updates
+- when a volume is becoming full
+- lost memory releases
+
+
+Please report any bugs or mistakes in the documentation !
+
+
+
+Have fun anyway !

dep/adflib/UPSTREAM.md

@@ -0,0 +1,2 @@
+This is head of git downloaded from https://github.com/lclevy/ADFlib on
+2022-08-28.

dep/adflib/adf_nativ.h

@@ -0,0 +1,37 @@
+#ifndef ADF_NATIV_H
+#define ADF_NATIV_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "adf_str.h"
+
+#define NATIVE_FILE 8001
+
+struct nativeDevice
+{
+	FILE* fd;
+};
+
+struct nativeFunctions
+{
+    /* called by adfMount() */
+    RETCODE (*adfInitDevice)(struct Device*, char*, BOOL);
+    /* called by adfReadBlock() */
+    RETCODE (*adfNativeReadSector)(struct Device*, int32_t, int, uint8_t*);
+    /* called by adfWriteBlock() */
+    RETCODE (*adfNativeWriteSector)(struct Device*, int32_t, int, uint8_t*);
+    /* called by adfMount() */
+    BOOL (*adfIsDevNative)(char*);
+    /* called by adfUnMount() */
+    RETCODE (*adfReleaseDevice)(struct Device*);
+};
+
+extern void adfInitNativeFct();
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif

dep/adflib/build.mk

@@ -0,0 +1,22 @@
+ADFLIB_SRCS = \
+	dep/adflib/src/adf_bitm.c \
+	dep/adflib/src/adf_cache.c \
+	dep/adflib/src/adf_dir.c \
+	dep/adflib/src/adf_disk.c \
+	dep/adflib/src/adf_dump.c \
+	dep/adflib/src/adf_env.c \
+	dep/adflib/src/adf_file.c \
+	dep/adflib/src/adf_hd.c \
+	dep/adflib/src/adf_link.c \
+	dep/adflib/src/adf_raw.c \
+	dep/adflib/src/adf_salv.c \
+	dep/adflib/src/adf_util.c \
+
+ADFLIB_OBJS = $(patsubst %.c, $(OBJDIR)/%.o, $(ADFLIB_SRCS))
+$(ADFLIB_OBJS): CFLAGS += -Idep/adflib/src -Idep/adflib
+ADFLIB_LIB = $(OBJDIR)/libadflib.a
+$(ADFLIB_LIB): $(ADFLIB_OBJS)
+ADFLIB_CFLAGS = -Idep/adflib/src
+ADFLIB_LDFLAGS =
+OBJS += $(ADFLIB_OBJS)
+

dep/adflib/config.h

@@ -0,0 +1,2 @@
+/* empty config.h to keep the source happy */
+

dep/adflib/src/Makefile.am

@@ -0,0 +1,44 @@
+NATIVE_DIR = generic
+
+lib_LTLIBRARIES = libadf.la
+
+libadf_la_SOURCES = adf_hd.c \
+                    adf_disk.c \
+                    adf_raw.c \
+                    adf_bitm.c \
+                    adf_dump.c \
+                    adf_util.c \
+                    adf_env.c \
+                    $(NATIVE_DIR)/adf_nativ.c \
+                    adf_dir.c \
+                    adf_file.c \
+                    adf_cache.c \
+                    adf_link.c \
+                    adf_salv.c
+
+include_HEADERS = adf_defs.h \
+                  adf_blk.h \
+                  adf_err.h \
+                  adf_str.h \
+                  adflib.h \
+                  adf_bitm.h \
+                  adf_cache.h \
+                  adf_dir.h \
+                  adf_disk.h \
+                  adf_dump.h \
+                  adf_env.h \
+                  adf_file.h \
+                  adf_hd.h \
+                  adf_link.h \
+                  adf_raw.h \
+                  adf_salv.h \
+                  adf_util.h \
+                  defendian.h \
+                  hd_blk.h \
+                  prefix.h \
+                  $(NATIVE_DIR)/adf_nativ.h
+
+libadf_la_LDFLAGS = -version-info 0:12:0
+AM_CPPFLAGS = -D_XOPEN_SOURCE -D_SVID_SOURCE -D_BSD_SOURCE -D_DEFAULT_SOURCE -D_GNU_SOURCE -I$(srcdir) -I$(srcdir)/$(NATIVE_DIR)
+AM_CFLAGS = -std=c99 -pedantic -Wall
+

dep/adflib/src/adf_bitm.c

@@ -0,0 +1,561 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_bitm.c
+ *
+ *  $Id$
+ *
+ *  bitmap code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+#include <stdlib.h>
+#include <string.h>
+
+#include"adf_raw.h"
+#include"adf_bitm.h"
+#include"adf_err.h"
+#include"adf_disk.h"
+#include"adf_util.h"
+#include"defendian.h"
+
+extern uint32_t bitMask[32];
+
+extern struct Env adfEnv;
+
+/*
+ * adfUpdateBitmap
+ *
+ */
+RETCODE adfUpdateBitmap(struct Volume *vol)
+{
+	int i;
+    struct bRootBlock root;
+
+/*printf("adfUpdateBitmap\n");*/
+        
+    if (adfReadRootBlock(vol, vol->rootBlock,&root)!=RC_OK)
+		return RC_ERROR;
+
+    root.bmFlag = BM_INVALID;
+    if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK)
+		return RC_ERROR;
+
+    for(i=0; i<vol->bitmapSize; i++)
+    if (vol->bitmapBlocksChg[i]) {
+        if (adfWriteBitmapBlock(vol, vol->bitmapBlocks[i], vol->bitmapTable[i])!=RC_OK)
+			return RC_ERROR;
+  	    vol->bitmapBlocksChg[i] = FALSE;
+    }
+
+    root.bmFlag = BM_VALID;
+    adfTime2AmigaTime(adfGiveCurrentTime(),&(root.days),&(root.mins),&(root.ticks));
+    if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfCountFreeBlocks
+ *
+ */
+int32_t adfCountFreeBlocks(struct Volume* vol)
+{
+    int32_t freeBlocks;
+    int j;
+
+	freeBlocks = 0L;
+    for(j=vol->firstBlock+2; j<=(vol->lastBlock - vol->firstBlock); j++)
+        if ( adfIsBlockFree(vol,j) )
+            freeBlocks++;
+
+    return freeBlocks;
+}
+
+
+/*
+ * adfReadBitmap
+ *
+ */
+RETCODE adfReadBitmap(struct Volume* vol, int32_t nBlock, struct bRootBlock* root)
+{
+	int32_t mapSize, nSect;
+	int32_t j, i;
+	struct bBitmapExtBlock bmExt;
+
+    mapSize = nBlock / (127*32);
+    if ( (nBlock%(127*32))!=0 )
+        mapSize++;
+    vol->bitmapSize = mapSize;
+
+    vol->bitmapTable = (struct bBitmapBlock**) malloc(sizeof(struct bBitmapBlock*)*mapSize);
+    if (!vol->bitmapTable) { 
+		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapTable");
+        return RC_MALLOC;
+    }
+	vol->bitmapBlocks = (SECTNUM*) malloc(sizeof(SECTNUM)*mapSize);
+    if (!vol->bitmapBlocks) {
+        free(vol->bitmapTable);
+		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks");
+        return RC_MALLOC;
+    }
+	vol->bitmapBlocksChg = (BOOL*) malloc(sizeof(BOOL)*mapSize);
+    if (!vol->bitmapBlocksChg) { 
+        free(vol->bitmapTable); free(vol->bitmapBlocks);
+		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks");
+        return RC_MALLOC;
+    }
+    for(i=0; i<mapSize; i++) {
+        vol->bitmapBlocksChg[i] = FALSE;
+
+		vol->bitmapTable[i] = (struct bBitmapBlock*)malloc(sizeof(struct bBitmapBlock));
+		if (!vol->bitmapTable[i]) {
+            free(vol->bitmapBlocksChg); free(vol->bitmapBlocks);
+            for(j=0; j<i; j++) 
+                free(vol->bitmapTable[j]);
+            free(vol->bitmapTable);
+	        (*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks");
+            return RC_MALLOC;
+        }
+    }
+
+	j=0; i=0;
+    /* bitmap pointers in rootblock : 0 <= i <BM_SIZE */
+	while(i<BM_SIZE && root->bmPages[i]!=0) {
+		vol->bitmapBlocks[j] = nSect = root->bmPages[i];
+        if ( !isSectNumValid(vol,nSect) ) {
+			(*adfEnv.wFct)("adfReadBitmap : sector out of range");
+        }
+
+		if (adfReadBitmapBlock(vol, nSect, vol->bitmapTable[j])!=RC_OK) {
+            adfFreeBitmap(vol);
+            return RC_ERROR;
+		}
+		j++; i++;
+	}
+	nSect = root->bmExt;
+	while(nSect!=0) {
+        /* bitmap pointers in bitmapExtBlock, j <= mapSize */
+        if (adfReadBitmapExtBlock(vol, nSect, &bmExt)!=RC_OK) {
+            adfFreeBitmap(vol);
+            return RC_ERROR;
+        }
+		i=0;
+		while(i<127 && j<mapSize) {
+            nSect = bmExt.bmPages[i];
+            if ( !isSectNumValid(vol,nSect) )
+                (*adfEnv.wFct)("adfReadBitmap : sector out of range");
+			vol->bitmapBlocks[j] = nSect;
+
+			if (adfReadBitmapBlock(vol, nSect, vol->bitmapTable[j])!=RC_OK) {
+                adfFreeBitmap(vol);
+                return RC_ERROR;
+            }
+			i++; j++;
+		}
+		nSect = bmExt.nextBlock;
+	}
+
+    return RC_OK;
+}
+
+
+/*
+ * adfIsBlockFree
+ *
+ */
+BOOL adfIsBlockFree(struct Volume* vol, SECTNUM nSect)
+{
+    int sectOfMap = nSect-2;
+    int block = sectOfMap/(127*32);
+    int indexInMap = (sectOfMap/32)%127;
+	
+/*printf("sect=%d block=%d ind=%d,  ",sectOfMap,block,indexInMap);
+printf("bit=%d,  ",sectOfMap%32);
+printf("bitm=%x,  ",bitMask[ sectOfMap%32]);
+printf("res=%x,  ",vol->bitmapTable[ block ]->map[ indexInMap ]
+        & bitMask[ sectOfMap%32 ]);
+*/
+    return ( (vol->bitmapTable[ block ]->map[ indexInMap ]
+        & bitMask[ sectOfMap%32 ])!=0 );
+}
+
+
+/*
+ * adfSetBlockFree OK
+ *
+ */
+void adfSetBlockFree(struct Volume* vol, SECTNUM nSect)
+{
+    uint32_t oldValue;
+    int sectOfMap = nSect-2;
+    int block = sectOfMap/(127*32);
+    int indexInMap = (sectOfMap/32)%127;
+
+/*printf("sect=%d block=%d ind=%d,  ",sectOfMap,block,indexInMap);
+printf("bit=%d,  ",sectOfMap%32);
+*printf("bitm=%x,  ",bitMask[ sectOfMap%32]);*/
+
+    oldValue = vol->bitmapTable[ block ]->map[ indexInMap ];
+/*printf("old=%x,  ",oldValue);*/
+    vol->bitmapTable[ block ]->map[ indexInMap ]
+	    = oldValue | bitMask[ sectOfMap%32 ];
+/*printf("new=%x,  ",vol->bitmapTable[ block ]->map[ indexInMap ]);*/
+
+    vol->bitmapBlocksChg[ block ] = TRUE;
+}
+
+
+/*
+ * adfSetBlockUsed
+ *
+ */
+void adfSetBlockUsed(struct Volume* vol, SECTNUM nSect)
+{
+    uint32_t oldValue;
+    int sectOfMap = nSect-2;
+    int block = sectOfMap/(127*32);
+    int indexInMap = (sectOfMap/32)%127;
+
+    oldValue = vol->bitmapTable[ block ]->map[ indexInMap ];
+
+    vol->bitmapTable[ block ]->map[ indexInMap ]
+	    = oldValue & (~bitMask[ sectOfMap%32 ]);
+    vol->bitmapBlocksChg[ block ] = TRUE;
+}
+
+
+/*
+ * adfGet1FreeBlock
+ *
+ */
+SECTNUM adfGet1FreeBlock(struct Volume *vol) {
+    SECTNUM block[1];
+    if (!adfGetFreeBlocks(vol,1,block))
+        return(-1);
+    else
+        return(block[0]);
+}
+
+/*
+ * adfGetFreeBlocks
+ *
+ */
+BOOL adfGetFreeBlocks(struct Volume* vol, int nbSect, SECTNUM* sectList)
+{
+	int i, j;
+    BOOL diskFull;
+    int32_t block = vol->rootBlock;
+
+    i = 0;
+    diskFull = FALSE;
+/*printf("lastblock=%ld\n",vol->lastBlock);*/
+	while( i<nbSect && !diskFull ) {
+        if ( adfIsBlockFree(vol, block) ) {
+            sectList[i] = block;
+			i++;
+        }
+/*        if ( block==vol->lastBlock )
+            block = vol->firstBlock+2;*/
+        if ( (block+vol->firstBlock)==vol->lastBlock )
+            block = 2;
+        else if (block==vol->rootBlock-1)
+            diskFull = TRUE;
+        else
+            block++;
+    }
+
+    if (!diskFull)
+        for(j=0; j<nbSect; j++)
+            adfSetBlockUsed( vol, sectList[j] );
+
+    return (i==nbSect);
+}
+
+
+/*
+ * adfCreateBitmap
+ *
+ * create bitmap structure in vol
+ */
+RETCODE adfCreateBitmap(struct Volume *vol)
+{
+    int32_t nBlock, mapSize ;
+    int i, j;
+
+    nBlock = vol->lastBlock - vol->firstBlock +1 - 2;
+
+    mapSize = nBlock / (127*32);
+    if ( (nBlock%(127*32))!=0 )
+        mapSize++;
+    vol->bitmapSize = mapSize;
+
+    vol->bitmapTable = (struct bBitmapBlock**)malloc( sizeof(struct bBitmapBlock*)*mapSize );
+    if (!vol->bitmapTable) {
+        (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapTable");
+        return RC_MALLOC;
+    }
+
+	vol->bitmapBlocksChg = (BOOL*) malloc(sizeof(BOOL)*mapSize);
+    if (!vol->bitmapBlocksChg) {
+        free(vol->bitmapTable);
+        (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapBlocksChg");
+        return RC_MALLOC;
+    }
+
+	vol->bitmapBlocks = (SECTNUM*) malloc(sizeof(SECTNUM)*mapSize);
+    if (!vol->bitmapBlocks) {
+        free(vol->bitmapTable); free(vol->bitmapBlocksChg);
+        (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapBlocks");
+        return RC_MALLOC;
+    }
+
+    for(i=0; i<mapSize; i++) {
+        vol->bitmapTable[i] = (struct bBitmapBlock*)malloc(sizeof(struct bBitmapBlock));
+        if (!vol->bitmapTable[i]) {
+            free(vol->bitmapTable); free(vol->bitmapBlocksChg);
+            for(j=0; j<i; j++) 
+                free(vol->bitmapTable[j]);
+            free(vol->bitmapTable);
+			(*adfEnv.eFct)("adfCreateBitmap : malloc");
+            return RC_MALLOC;
+        }
+    }
+
+    for(i=vol->firstBlock+2; i<=(vol->lastBlock - vol->firstBlock); i++)
+        adfSetBlockFree(vol, i);
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteNewBitmap
+ *
+ * write ext blocks and bitmap
+ *
+ * uses vol->bitmapSize, 
+ */
+RETCODE adfWriteNewBitmap(struct Volume *vol)
+{
+    struct bBitmapExtBlock bitme;
+    SECTNUM *bitExtBlock;
+    int n, i, k;
+    int nExtBlock;
+    int nBlock;
+    SECTNUM *sectList;
+    struct bRootBlock root;
+
+    sectList=(SECTNUM*)malloc(sizeof(SECTNUM)*vol->bitmapSize);
+    if (!sectList) {
+		(*adfEnv.eFct)("adfCreateBitmap : sectList");
+        return RC_MALLOC;
+    }
+
+    if (!adfGetFreeBlocks(vol, vol->bitmapSize, sectList)) {
+        free(sectList);
+		return RC_ERROR;
+    }
+	
+    if (adfReadRootBlock(vol, vol->rootBlock, &root)!=RC_OK) {
+        free(sectList);
+		return RC_ERROR;
+    }
+    nBlock = 0;
+    n = min( vol->bitmapSize, BM_SIZE );
+    for(i=0; i<n; i++) {
+        root.bmPages[i] = vol->bitmapBlocks[i] = sectList[i];
+    }
+    nBlock = n;
+
+    /* for devices with more than 25*127 blocks == hards disks */
+    if (vol->bitmapSize>BM_SIZE) {
+
+        nExtBlock = (vol->bitmapSize-BM_SIZE)/127;
+        if ((vol->bitmapSize-BM_SIZE)%127)
+            nExtBlock++;
+
+        bitExtBlock=(SECTNUM*)malloc(sizeof(SECTNUM)*nExtBlock);
+        if (!bitExtBlock) {
+            free(sectList);
+			adfEnv.eFct("adfWriteNewBitmap : malloc failed");
+            return RC_MALLOC;
+        }
+
+        if (!adfGetFreeBlocks(vol, nExtBlock, bitExtBlock)) {  
+           free(sectList); free(bitExtBlock);
+           return RC_MALLOC;
+        }
+
+        k = 0;
+        root.bmExt = bitExtBlock[ k ];
+        while( nBlock<vol->bitmapSize ) {
+            i=0;
+            while( i<127 && nBlock<vol->bitmapSize ) {
+                bitme.bmPages[i] = vol->bitmapBlocks[nBlock] = sectList[i];
+                i++;
+                nBlock++;
+            }
+            if ( k+1<nExtBlock )
+                bitme.nextBlock = bitExtBlock[ k+1 ];
+            else
+                bitme.nextBlock = 0;
+            if (adfWriteBitmapExtBlock(vol, bitExtBlock[ k ], &bitme)!=RC_OK) {
+                free(sectList); free(bitExtBlock);
+				return RC_ERROR;
+            }
+            k++;
+        }
+        free( bitExtBlock );
+
+    }
+    free( sectList);
+
+    if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK)
+        return RC_ERROR;
+    
+    return RC_OK;
+}
+
+/*
+ * adfReadBitmapBlock
+ *
+ * ENDIAN DEPENDENT
+ */
+RETCODE
+adfReadBitmapBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapBlock* bitm)
+{
+	uint8_t buf[LOGICAL_BLOCK_SIZE];
+
+/*printf("bitmap %ld\n",nSect);*/
+	if (adfReadBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+
+	memcpy(bitm, buf, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    /* big to little = 68000 to x86 */
+    swapEndian((uint8_t*)bitm, SWBL_BITMAP);
+#endif
+
+	if (bitm->checkSum!=adfNormalSum(buf,0,LOGICAL_BLOCK_SIZE))
+		(*adfEnv.wFct)("adfReadBitmapBlock : invalid checksum");
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteBitmapBlock
+ *
+ * OK
+ */
+RETCODE
+adfWriteBitmapBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapBlock* bitm)
+{
+    uint8_t buf[LOGICAL_BLOCK_SIZE];
+	uint32_t newSum;
+	
+	memcpy(buf,bitm,LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    /* little to big */
+    swapEndian(buf, SWBL_BITMAP);
+#endif
+
+	newSum = adfNormalSum(buf, 0, LOGICAL_BLOCK_SIZE);
+    swLong(buf,newSum);
+
+/*	dumpBlock((uint8_t*)buf);*/
+	if (adfWriteBlock(vol, nSect, (uint8_t*)buf)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfReadBitmapExtBlock
+ *
+ * ENDIAN DEPENDENT
+ */
+RETCODE
+adfReadBitmapExtBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapExtBlock* bitme)
+{
+	uint8_t buf[LOGICAL_BLOCK_SIZE];
+
+	if (adfReadBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+
+	memcpy(bitme, buf, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    swapEndian((uint8_t*)bitme, SWBL_BITMAP);
+#endif
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteBitmapExtBlock
+ *
+ */
+RETCODE
+adfWriteBitmapExtBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapExtBlock* bitme)
+{
+	uint8_t buf[LOGICAL_BLOCK_SIZE];
+	
+	memcpy(buf,bitme, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    /* little to big */
+    swapEndian(buf, SWBL_BITMAPE);
+#endif
+
+/*	dumpBlock((uint8_t*)buf);*/
+	if (adfWriteBlock(vol, nSect, (uint8_t*)buf)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfFreeBitmap
+ *
+ */
+void adfFreeBitmap(struct Volume* vol)
+{
+    int i;
+
+    for(i=0; i<vol->bitmapSize; i++)
+        free(vol->bitmapTable[i]);
+    vol->bitmapSize = 0;
+
+    free(vol->bitmapTable);
+	vol->bitmapTable = 0;
+
+    free(vol->bitmapBlocks);
+	vol->bitmapBlocks = 0;
+
+    free(vol->bitmapBlocksChg);
+	vol->bitmapBlocksChg = 0;
+}
+
+
+/*#######################################################################################*/

dep/adflib/src/adf_bitm.h

@@ -0,0 +1,52 @@
+#ifndef ADF_BITM_H
+#define ADF_BITM_H
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_bitm.h
+ *
+ *  $Id$
+ *
+ *  bitmap code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+#include"adf_str.h"
+#include"prefix.h"
+
+RETCODE adfReadBitmapBlock(struct Volume*, SECTNUM nSect, struct bBitmapBlock*);
+RETCODE adfWriteBitmapBlock(struct Volume*, SECTNUM nSect, struct bBitmapBlock*);
+RETCODE adfReadBitmapExtBlock(struct Volume*, SECTNUM nSect, struct bBitmapExtBlock*);
+RETCODE adfWriteBitmapExtBlock(struct Volume*, SECTNUM, struct bBitmapExtBlock* );
+
+SECTNUM adfGet1FreeBlock(struct Volume *vol);
+RETCODE adfUpdateBitmap(struct Volume *vol);
+PREFIX int32_t adfCountFreeBlocks(struct Volume* vol);
+RETCODE adfReadBitmap(struct Volume* , SECTNUM nBlock, struct bRootBlock* root);
+BOOL adfIsBlockFree(struct Volume* vol, SECTNUM nSect);
+void adfSetBlockFree(struct Volume* vol, SECTNUM nSect);
+void adfSetBlockUsed(struct Volume* vol, SECTNUM nSect);
+BOOL adfGetFreeBlocks(struct Volume* vol, int nbSect, SECTNUM* sectList);
+RETCODE adfCreateBitmap(struct Volume *vol);
+RETCODE adfWriteNewBitmap(struct Volume *vol);
+void adfFreeBitmap(struct Volume *vol);
+
+#endif /* ADF_BITM_H */
+
+/*#######################################################################################*/

dep/adflib/src/adf_blk.h

@@ -0,0 +1,288 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_blk.h
+ *
+ *  $Id$
+ *
+ *  general blocks structures
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+
+#ifndef ADF_BLK_H
+#define ADF_BLK_H 1
+
+#define ULONG   uint32_t
+#define USHORT  uint16_t
+#define UCHAR   uint8_t
+
+#define LOGICAL_BLOCK_SIZE    512
+
+/* ----- FILE SYSTEM ----- */
+
+#define FSMASK_FFS         1
+#define FSMASK_INTL        2
+#define FSMASK_DIRCACHE    4
+
+#define isFFS(c)           ((c)&FSMASK_FFS)
+#define isOFS(c)           (!((c)&FSMASK_FFS))
+#define isINTL(c)          ((c)&FSMASK_INTL)
+#define isDIRCACHE(c)      ((c)&FSMASK_DIRCACHE)
+
+
+/* ----- ENTRIES ----- */
+
+/* access constants */
+
+#define ACCMASK_D	(1<<0)
+#define ACCMASK_E	(1<<1)
+#define ACCMASK_W	(1<<2)
+#define ACCMASK_R	(1<<3)
+#define ACCMASK_A	(1<<4)
+#define ACCMASK_P	(1<<5)
+#define ACCMASK_S	(1<<6)
+#define ACCMASK_H	(1<<7)
+
+#define hasD(c)    ((c)&ACCMASK_D)
+#define hasE(c)    ((c)&ACCMASK_E)
+#define hasW(c)    ((c)&ACCMASK_W)
+#define hasR(c)    ((c)&ACCMASK_R)
+#define hasA(c)    ((c)&ACCMASK_A)
+#define hasP(c)	   ((c)&ACCMASK_P)
+#define hasS(c)    ((c)&ACCMASK_S)
+#define hasH(c)    ((c)&ACCMASK_H)
+
+
+/* ----- BLOCKS ----- */
+
+/* block constants */
+
+#define BM_VALID	-1
+#define BM_INVALID	0
+
+#define HT_SIZE		72
+#define BM_SIZE     25
+#define MAX_DATABLK	72
+
+#define MAXNAMELEN	30
+#define MAXCMMTLEN	79
+
+
+/* block primary and secondary types */
+
+#define T_HEADER	2
+#define ST_ROOT		1
+#define ST_DIR		2
+#define ST_FILE		-3
+#define ST_LFILE	-4
+#define ST_LDIR		4
+#define ST_LSOFT	3
+#define T_LIST		16
+#define T_DATA		8
+#define T_DIRC		33
+
+
+/*--- blocks structures --- */
+
+
+struct bBootBlock {
+/*000*/	char	dosType[4];
+/*004*/	ULONG	checkSum;
+/*008*/	int32_t	rootBlock;
+/*00c*/	UCHAR	data[500+512];
+};
+
+
+struct bRootBlock {
+/*000*/	int32_t	type;
+        int32_t	headerKey;
+        int32_t	highSeq;
+/*00c*/	int32_t	hashTableSize;
+        int32_t	firstData;
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	hashTable[HT_SIZE];		/* hash table */
+/*138*/	int32_t	bmFlag;				/* bitmap flag, -1 means VALID */
+/*13c*/	int32_t	bmPages[BM_SIZE];
+/*1a0*/	int32_t	bmExt;
+/*1a4*/	int32_t	cDays; 	/* creation date FFS and OFS */
+/*1a8*/	int32_t	cMins;
+/*1ac*/	int32_t	cTicks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char 	diskName[MAXNAMELEN+1];
+        char	r2[8];
+/*1d8*/	int32_t	days;		/* last access : days after 1 jan 1978 */
+/*1dc*/	int32_t	mins;		/* hours and minutes in minutes */
+/*1e0*/	int32_t	ticks;		/* 1/50 seconds */
+/*1e4*/	int32_t	coDays;	/* creation date OFS */
+/*1e8*/	int32_t	coMins;
+/*1ec*/	int32_t	coTicks;
+        int32_t	nextSameHash;	/* == 0 */
+        int32_t	parent;		/* == 0 */
+/*1f8*/	int32_t	extension;		/* FFS: first directory cache block */
+/*1fc*/	int32_t	secType;	/* == 1 */
+};
+
+
+struct bFileHeaderBlock {
+/*000*/	int32_t	type;		/* == 2 */
+/*004*/	int32_t	headerKey;	/* current block number */
+/*008*/	int32_t	highSeq;	/* number of data block in this hdr block */
+/*00c*/	int32_t	dataSize;	/* == 0 */
+/*010*/	int32_t	firstData;
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	dataBlocks[MAX_DATABLK];
+/*138*/	int32_t	r1;
+/*13c*/	int32_t	r2;
+/*140*/	int32_t	access;	/* bit0=del, 1=modif, 2=write, 3=read */
+/*144*/	uint32_t	byteSize;
+/*148*/	char	commLen;
+/*149*/	char	comment[MAXCMMTLEN+1];
+        char	r3[91-(MAXCMMTLEN+1)];
+/*1a4*/	int32_t	days;
+/*1a8*/	int32_t	mins;
+/*1ac*/	int32_t	ticks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char	fileName[MAXNAMELEN+1];
+        int32_t	r4;
+/*1d4*/	int32_t	real;		/* unused == 0 */
+/*1d8*/	int32_t	nextLink;	/* link chain */
+        int32_t	r5[5];
+/*1f0*/	int32_t	nextSameHash;	/* next entry with sane hash */
+/*1f4*/	int32_t	parent;		/* parent directory */
+/*1f8*/	int32_t	extension;	/* pointer to extension block */
+/*1fc*/	int32_t	secType;	/* == -3 */
+};
+
+
+/*--- file header extension block structure ---*/
+
+struct bFileExtBlock {
+/*000*/	int32_t	type;		/* == 0x10 */
+/*004*/	int32_t	headerKey;
+/*008*/	int32_t	highSeq;
+/*00c*/	int32_t	dataSize;	/* == 0 */
+/*010*/	int32_t	firstData;	/* == 0 */
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	dataBlocks[MAX_DATABLK];
+        int32_t	r[45];
+        int32_t	info;		/* == 0 */
+        int32_t	nextSameHash;	/* == 0 */
+/*1f4*/	int32_t	parent;		/* header block */
+/*1f8*/	int32_t	extension;	/* next header extension block */
+/*1fc*/	int32_t	secType;	/* -3 */	
+};
+
+
+
+struct bDirBlock {
+/*000*/	int32_t	type;		/* == 2 */
+/*004*/	int32_t	headerKey;
+/*008*/	int32_t	highSeq;	/* == 0 */
+/*00c*/	int32_t	hashTableSize;	/* == 0 */
+        int32_t	r1;		/* == 0 */
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	hashTable[HT_SIZE];		/* hash table */
+        int32_t	r2[2];
+/*140*/	int32_t	access;
+        int32_t	r4;		/* == 0 */
+/*148*/	char	commLen;
+/*149*/	char	comment[MAXCMMTLEN+1];
+        char	r5[91-(MAXCMMTLEN+1)];
+/*1a4*/	int32_t	days;		/* last access */
+/*1a8*/	int32_t	mins;
+/*1ac*/	int32_t	ticks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char 	dirName[MAXNAMELEN+1];
+        int32_t	r6;
+/*1d4*/	int32_t	real;		/* ==0 */
+/*1d8*/	int32_t	nextLink;	/* link list */
+        int32_t	r7[5];
+/*1f0*/	int32_t	nextSameHash;
+/*1f4*/	int32_t	parent;
+/*1f8*/	int32_t	extension;		/* FFS : first directory cache */
+/*1fc*/	int32_t	secType;	/* == 2 */
+};
+
+
+
+struct bOFSDataBlock{
+/*000*/	int32_t	type;		/* == 8 */
+/*004*/	int32_t	headerKey;	/* pointer to file_hdr block */
+/*008*/	int32_t	seqNum;	/* file data block number */
+/*00c*/	int32_t	dataSize;	/* <= 0x1e8 */
+/*010*/	int32_t	nextData;	/* next data block */
+/*014*/	ULONG	checkSum;
+/*018*/	UCHAR	data[488];
+/*200*/	};
+
+
+/* --- bitmap --- */
+
+struct bBitmapBlock {
+/*000*/	ULONG	checkSum;
+/*004*/	ULONG	map[127];
+	};
+
+
+struct bBitmapExtBlock {
+/*000*/	int32_t	bmPages[127];
+/*1fc*/	int32_t	nextBlock;
+	};
+
+
+struct bLinkBlock {
+/*000*/	int32_t	type;		/* == 2 */
+/*004*/	int32_t	headerKey;	/* self pointer */
+        int32_t	r1[3];
+/*014*/	ULONG	checkSum;
+/*018*/	char	realName[64];
+        int32_t	r2[83];
+/*1a4*/	int32_t	days;		/* last access */
+/*1a8*/	int32_t	mins;
+/*1ac*/	int32_t	ticks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char 	name[MAXNAMELEN+1];
+        int32_t	r3;
+/*1d4*/	int32_t	realEntry;
+/*1d8*/	int32_t	nextLink;
+        int32_t	r4[5];
+/*1f0*/	int32_t	nextSameHash;
+/*1f4*/	int32_t	parent;	
+        int32_t	r5;
+/*1fc*/	int32_t	secType;	/* == -4, 4, 3 */
+	};
+
+
+
+/*--- directory cache block structure ---*/
+
+struct bDirCacheBlock {
+/*000*/	int32_t	type;		/* == 33 */
+/*004*/	int32_t	headerKey;
+/*008*/	int32_t	parent;
+/*00c*/	int32_t	recordsNb;
+/*010*/	int32_t	nextDirC;
+/*014*/	ULONG	checkSum;
+/*018*/	uint8_t records[488];
+	};
+
+
+#endif /* ADF_BLK_H */
+/*##########################################################################*/

dep/adflib/src/adf_cache.c

@@ -0,0 +1,615 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_cache.c
+ *
+ *  $Id$
+ *
+ *  directory cache code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */ 
+
+#include<stdlib.h>
+#include<string.h>
+
+#include"adf_defs.h"
+#include"adf_str.h"
+#include"adf_err.h"
+#include"defendian.h"
+#include"adf_cache.h"
+#include"adf_raw.h"
+#include"adf_disk.h"
+#include"adf_bitm.h"
+#include"adf_util.h"
+#include"adf_dir.h"
+
+
+extern struct Env adfEnv;
+/*
+freeEntCache(struct CacheEntry *cEntry)
+{
+    if (cEntry->name!=NULL)
+        free(cEntry->name);
+    if (cEntry->comm!=NULL)
+        free(cEntry->comm);
+}
+*/
+
+/*
+ * adfGetDirEntCache
+ *
+ * replace 'adfGetDirEnt'. returns a the dir contents based on the dircache list
+ */
+struct List* adfGetDirEntCache(struct Volume *vol, SECTNUM dir, BOOL recurs)
+{
+	struct bEntryBlock parent;
+	struct bDirCacheBlock dirc;
+    int offset, n;
+    struct List *cell, *head;
+    struct CacheEntry caEntry;
+    struct Entry *entry;
+    SECTNUM nSect;
+
+    if (adfReadEntryBlock(vol,dir,&parent)!=RC_OK)
+        return NULL;
+
+    nSect = parent.extension;
+
+    cell = head = NULL;
+    do {
+        /* one loop per cache block */
+        n = offset = 0;
+	    if (adfReadDirCBlock(vol, nSect, &dirc)!=RC_OK)
+            return NULL;
+        while (n<dirc.recordsNb) {
+            /* one loop per record */
+            entry = (struct Entry*)malloc(sizeof(struct Entry));
+            if (!entry) {
+                adfFreeDirList(head);
+                return NULL;
+            }
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+
+            /* converts a cache entry into a dir entry */
+            entry->type = (int)caEntry.type;
+            entry->name = strdup(caEntry.name);
+            if (entry->name==NULL) {
+                free(entry); adfFreeDirList(head);
+                return NULL;
+            }
+            entry->sector = caEntry.header;
+            entry->comment = strdup(caEntry.comm);
+            if (entry->comment==NULL) {
+                free(entry->name); adfFreeDirList(head);
+                return NULL;
+            }
+            entry->size = caEntry.size;
+            entry->access = caEntry.protect;
+            adfDays2Date( caEntry.days, &(entry->year), &(entry->month), 
+                &(entry->days) );
+            entry->hour = caEntry.mins/60;
+            entry->mins = caEntry.mins%60;
+            entry->secs = caEntry.ticks/50;
+
+            /* add it into the linked list */
+            if (head==NULL)
+                head = cell = newCell(NULL, (void*)entry); 
+            else
+                cell = newCell(cell, (void*)entry); 
+
+            if (cell==NULL) {
+                adfFreeEntry(entry);
+                adfFreeDirList(head);
+                return NULL;
+            }
+
+            if (recurs && entry->type==ST_DIR)
+                 cell->subdir = adfGetDirEntCache(vol,entry->sector,recurs);
+
+            n++;
+        }
+        nSect = dirc.nextDirC;
+    }while (nSect!=0);
+    
+    return head;	
+}
+
+
+
+/*
+ * adfGetCacheEntry
+ *
+ * Returns a cache entry, starting from the offset p (the index into records[])
+ * This offset is updated to the end of the returned entry.
+ */
+void adfGetCacheEntry(struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry)
+{
+    int ptr;
+
+    ptr = *p;
+
+/*printf("p=%d\n",ptr);*/
+
+#ifdef LITT_ENDIAN
+    cEntry->header = swapLong(dirc->records+ptr);
+    cEntry->size = swapLong(dirc->records+ptr+4);
+    cEntry->protect = swapLong(dirc->records+ptr+8);
+    cEntry->days = swapShort(dirc->records+ptr+16);
+    cEntry->mins = swapShort(dirc->records+ptr+18);
+    cEntry->ticks = swapShort(dirc->records+ptr+20);
+#else
+    cEntry->header = Long(dirc->records+ptr);
+    cEntry->size = Long(dirc->records+ptr+4);
+    cEntry->protect = Long(dirc->records+ptr+8);
+    cEntry->days = Short(dirc->records+ptr+16);
+    cEntry->mins = Short(dirc->records+ptr+18);
+    cEntry->ticks = Short(dirc->records+ptr+20);
+#endif
+    cEntry->type =(signed char) dirc->records[ptr+22];
+
+    cEntry->nLen = dirc->records[ptr+23];
+/*    cEntry->name = (char*)malloc(sizeof(char)*(cEntry->nLen+1));
+    if (!cEntry->name)
+         return;
+*/    memcpy(cEntry->name, dirc->records+ptr+24, cEntry->nLen);
+    cEntry->name[(int)(cEntry->nLen)]='\0';
+
+    cEntry->cLen = dirc->records[ptr+24+cEntry->nLen];
+    if (cEntry->cLen>0) {
+/*        cEntry->comm =(char*)malloc(sizeof(char)*(cEntry->cLen+1));
+        if (!cEntry->comm) {
+            free( cEntry->name ); cEntry->name=NULL;
+            return;
+        }
+*/        memcpy(cEntry->comm,dirc->records+ptr+24+cEntry->nLen+1,cEntry->cLen);
+    }
+        cEntry->comm[(int)(cEntry->cLen)]='\0';
+/*printf("cEntry->nLen %d cEntry->cLen %d %s\n",cEntry->nLen,cEntry->cLen,cEntry->name);*/
+    *p  = ptr+24+cEntry->nLen+1+cEntry->cLen;
+
+    /* the starting offset of each record must be even (68000 constraint) */ 
+    if ((*p%2)!=0)
+        *p=(*p)+1;
+}
+
+
+/*
+ * adfPutCacheEntry
+ *
+ * remplaces one cache entry at the p offset, and returns its length
+ */
+int adfPutCacheEntry( struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry)
+{
+    int ptr, l;
+
+    ptr = *p;
+
+#ifdef LITT_ENDIAN
+    swLong(dirc->records+ptr, cEntry->header);
+    swLong(dirc->records+ptr+4, cEntry->size);
+    swLong(dirc->records+ptr+8, cEntry->protect);
+    swShort(dirc->records+ptr+16, cEntry->days);
+    swShort(dirc->records+ptr+18, cEntry->mins);
+    swShort(dirc->records+ptr+20, cEntry->ticks);
+#else
+    memcpy(dirc->records+ptr,&(cEntry->header),4);
+    memcpy(dirc->records+ptr+4,&(cEntry->size),4);
+    memcpy(dirc->records+ptr+8,&(cEntry->protect),4);
+    memcpy(dirc->records+ptr+16,&(cEntry->days),2);
+    memcpy(dirc->records+ptr+18,&(cEntry->mins),2);
+    memcpy(dirc->records+ptr+20,&(cEntry->ticks),2);
+#endif
+    dirc->records[ptr+22] =(signed char)cEntry->type;
+
+    dirc->records[ptr+23] = cEntry->nLen;
+    memcpy(dirc->records+ptr+24, cEntry->name, cEntry->nLen);
+
+    dirc->records[ptr+24+cEntry->nLen] = cEntry->cLen;
+    memcpy(dirc->records+ptr+24+cEntry->nLen+1, cEntry->comm, cEntry->cLen);
+
+/*puts("adfPutCacheEntry");*/
+
+    l = 25+cEntry->nLen+cEntry->cLen;
+    if ((l%2)==0)
+        return l;
+    else {
+        dirc->records[ptr+l] =(char)0;
+        return l+1;
+    }
+
+    /* ptr%2 must be == 0, if l%2==0, (ptr+l)%2==0 */ 
+}
+
+
+/*
+ * adfEntry2CacheEntry
+ *
+ * converts one dir entry into a cache entry, and return its future length in records[]
+ */
+int adfEntry2CacheEntry(struct bEntryBlock *entry, struct CacheEntry *newEntry)
+{
+    int entryLen;
+
+    /* new entry */
+    newEntry->header = entry->headerKey;
+    if (entry->secType==ST_FILE)
+        newEntry->size = entry->byteSize;
+    else
+        newEntry->size = 0L;
+    newEntry->protect = entry->access;
+    newEntry->days = (short)entry->days;
+    newEntry->mins = (short)entry->mins;
+    newEntry->ticks  = (short)entry->ticks;
+    newEntry->type = (signed char)entry->secType;
+    newEntry->nLen = entry->nameLen;
+    memcpy(newEntry->name, entry->name, newEntry->nLen);
+    newEntry->name[(int)(newEntry->nLen)] = '\0';
+    newEntry->cLen = entry->commLen;
+    if (newEntry->cLen>0)
+        memcpy(newEntry->comm, entry->comment, newEntry->cLen);
+
+    entryLen = 24+newEntry->nLen+1+newEntry->cLen;
+
+/*printf("entry->name %d entry->comment %d\n",entry->nameLen,entry->commLen);
+printf("newEntry->nLen %d newEntry->cLen %d\n",newEntry->nLen,newEntry->cLen);
+*/    if ((entryLen%2)==0)
+        return entryLen;
+    else
+        return entryLen+1;
+}
+
+
+/*
+ * adfDelFromCache
+ *
+ * delete one cache entry from its block. don't do 'records garbage collecting'
+ */
+RETCODE adfDelFromCache(struct Volume *vol, struct bEntryBlock *parent, 
+    SECTNUM headerKey)
+{
+    struct bDirCacheBlock dirc;
+    SECTNUM nSect, prevSect;
+    struct CacheEntry caEntry;
+    int offset, oldOffset, n;
+    BOOL found;
+    int entryLen;
+    int i;
+    RETCODE rc = RC_OK;
+
+    prevSect = -1;
+	nSect = parent->extension;
+    found = FALSE;
+    do {
+        adfReadDirCBlock(vol, nSect, &dirc);
+        offset = 0; n = 0;
+        while(n < dirc.recordsNb && !found) {
+            oldOffset = offset;
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+            found = (caEntry.header==headerKey);
+            if (found) {
+                entryLen = offset-oldOffset;
+                if (dirc.recordsNb>1 || prevSect==-1) {
+                    if (n<dirc.recordsNb-1) {
+                        /* not the last of the block : switch the following records */
+                        for(i=oldOffset; i<(488-entryLen); i++)
+                            dirc.records[i] = dirc.records[i+entryLen];
+                        /* and clear the following bytes */
+                        for(i=488-entryLen; i<488; i++)
+                            dirc.records[i] = 0;
+                    }
+                    else {
+                        /* the last record of this cache block */
+                        for(i=oldOffset; i<offset; i++)
+                            dirc.records[i] = 0;
+                    }
+                    dirc.recordsNb--;
+                    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+						return -1;
+                }
+                else {
+                    /* dirc.recordsNb ==1 or == 0 , prevSect!=-1 : 
+                    * the only record in this dirc block and a previous dirc block exists 
+                    */
+                    adfSetBlockFree(vol, dirc.headerKey);
+                    adfReadDirCBlock(vol, prevSect, &dirc);
+                    dirc.nextDirC = 0L;
+                    adfWriteDirCBlock(vol, prevSect, &dirc);
+
+                    adfUpdateBitmap(vol);
+                }
+            }
+            n++;
+        }
+        prevSect = nSect;
+        nSect = dirc.nextDirC;
+    }while(nSect!=0 && !found);
+
+    if (!found)
+        (*adfEnv.wFct)("adfUpdateCache : entry not found");
+
+    return rc;
+}
+
+
+/*
+ * adfAddInCache
+ *
+ */
+RETCODE adfAddInCache(struct Volume *vol, struct bEntryBlock *parent, 
+    struct bEntryBlock *entry)
+{
+    struct bDirCacheBlock dirc, newDirc;
+    SECTNUM nSect, nCache;
+    struct CacheEntry caEntry, newEntry;
+    int offset, n;
+    int entryLen;
+
+    entryLen = adfEntry2CacheEntry(entry, &newEntry);
+/*printf("adfAddInCache--%4ld %2d %6ld %8lx %4d %2d:%02d:%02d %30s %22s\n",
+    newEntry.header, newEntry.type, newEntry.size, newEntry.protect,
+    newEntry.days, newEntry.mins/60, newEntry.mins%60, 
+	newEntry.ticks/50,
+	newEntry.name, newEntry.comm);
+*/
+    nSect = parent->extension;
+    do {
+        if (adfReadDirCBlock(vol, nSect, &dirc)!=RC_OK)
+            return RC_ERROR;
+        offset = 0; n = 0;
+/*printf("parent=%4ld\n",dirc.parent);*/
+        while(n < dirc.recordsNb) {
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+/*printf("*%4ld %2d %6ld %8lx %4d %2d:%02d:%02d %30s %22s\n",
+    caEntry.header, caEntry.type, caEntry.size, caEntry.protect,
+    caEntry.days, caEntry.mins/60, caEntry.mins%60, 
+	caEntry.ticks/50,
+	caEntry.name, caEntry.comm);
+*/
+            n++;
+        }
+        
+/*        if (offset+entryLen<=488) {
+            adfPutCacheEntry(&dirc, &offset, &newEntry);
+            dirc.recordsNb++;
+            adfWriteDirCBlock(vol, dirc.headerKey, &dirc);
+            return rc;
+        }*/
+        nSect = dirc.nextDirC;
+    }while(nSect!=0);
+
+    /* in the last block */
+    if (offset+entryLen<=488) {
+        adfPutCacheEntry(&dirc, &offset, &newEntry);
+        dirc.recordsNb++;
+/*printf("entry name=%s\n",newEntry.name);*/
+    }
+    else {
+        /* request one new block free */
+        nCache = adfGet1FreeBlock(vol);
+        if (nCache==-1) {
+           (*adfEnv.wFct)("adfCreateDir : nCache==-1");
+           return RC_VOLFULL;
+        }
+
+        /* create a new dircache block */
+        memset(&newDirc,0,512);
+        if (parent->secType==ST_ROOT)
+            newDirc.parent = vol->rootBlock;
+        else if (parent->secType==ST_DIR)
+            newDirc.parent = parent->headerKey;
+        else
+            (*adfEnv.wFct)("adfAddInCache : unknown secType");
+        newDirc.recordsNb = 0L;
+        newDirc.nextDirC = 0L;
+
+        adfPutCacheEntry(&dirc, &offset, &newEntry);
+        newDirc.recordsNb++;
+        if (adfWriteDirCBlock(vol, nCache, &newDirc)!=RC_OK)
+			return RC_ERROR;
+        dirc.nextDirC = nCache;
+    }
+/*printf("dirc.headerKey=%ld\n",dirc.headerKey);*/
+    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+		return RC_ERROR;
+/*if (strcmp(entry->name,"file_5u")==0)
+dumpBlock(&dirc);
+*/
+    return RC_OK;
+}
+
+
+/*
+ * adfUpdateCache
+ *
+ */
+RETCODE adfUpdateCache(struct Volume *vol, struct bEntryBlock *parent, 
+    struct bEntryBlock *entry, BOOL entryLenChg)
+{
+    struct bDirCacheBlock dirc;
+    SECTNUM nSect;
+    struct CacheEntry caEntry, newEntry;
+    int offset, oldOffset, n;
+    BOOL found;
+    int i, oLen, nLen;
+    int sLen; /* shift length */
+
+    nLen = adfEntry2CacheEntry(entry, &newEntry);
+
+    nSect = parent->extension;
+    found = FALSE;
+    do {
+/*printf("dirc=%ld\n",nSect);*/
+        if (adfReadDirCBlock(vol, nSect, &dirc)!=RC_OK)
+			return RC_ERROR;
+        offset = 0; n = 0;
+        /* search entry to update with its header_key */
+        while(n < dirc.recordsNb && !found) {
+            oldOffset = offset;
+            /* offset is updated */
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+            oLen = offset-oldOffset;
+            sLen = oLen-nLen;
+/*printf("olen=%d nlen=%d\n",oLen,nLen);*/
+            found = (caEntry.header==newEntry.header);
+            if (found) {
+                if (!entryLenChg || oLen==nLen) {
+                    /* same length : remplace the old values */
+                    adfPutCacheEntry(&dirc, &oldOffset, &newEntry);
+/*if (entryLenChg) puts("oLen==nLen");*/
+                    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+                        return RC_ERROR;
+                }
+                else if (oLen>nLen) {
+/*puts("oLen>nLen");*/
+                    /* the new record is shorter, write it, 
+                     * then shift down the following records 
+                     */
+                    adfPutCacheEntry(&dirc, &oldOffset, &newEntry);
+                    for(i=oldOffset+nLen; i<(488-sLen); i++)
+                        dirc.records[i] = dirc.records[i+sLen];
+                    /* then clear the following bytes */
+                    for(i=488-sLen; i<488; i++)
+                        dirc.records[i] = (char)0;
+
+                    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+                        return RC_ERROR;
+                }
+                else {
+                    /* the new record is larger */
+/*puts("oLen<nLen");*/
+                    adfDelFromCache(vol,parent,entry->headerKey);
+                    adfAddInCache(vol,parent,entry);
+/*puts("oLen<nLen end");*/
+
+                }
+            }
+            n++;
+        }
+        nSect = dirc.nextDirC;
+    }while(nSect!=0 && !found);
+
+    if (found) {
+        if (adfUpdateBitmap(vol)!=RC_OK)
+			return RC_ERROR;
+    }
+    else
+        (*adfEnv.wFct)("adfUpdateCache : entry not found");
+
+    return RC_OK;
+}
+
+
+/*
+ * adfCreateEmptyCache
+ *
+ */
+RETCODE adfCreateEmptyCache(struct Volume *vol, struct bEntryBlock *parent, SECTNUM nSect)
+{
+    struct bDirCacheBlock dirc;
+    SECTNUM nCache;
+
+    if (nSect==-1) {
+        nCache = adfGet1FreeBlock(vol);
+        if (nCache==-1) {
+           (*adfEnv.wFct)("adfCreateDir : nCache==-1");
+           return RC_VOLFULL;
+        }
+    }
+    else
+        nCache = nSect;
+
+    if (parent->extension==0)
+		parent->extension = nCache;
+
+    memset(&dirc,0, sizeof(struct bDirCacheBlock));
+
+    if (parent->secType==ST_ROOT)
+        dirc.parent = vol->rootBlock;
+    else if (parent->secType==ST_DIR)
+        dirc.parent = parent->headerKey;
+    else {
+        (*adfEnv.wFct)("adfCreateEmptyCache : unknown secType");
+/*printf("secType=%ld\n",parent->secType);*/
+    }
+        
+    dirc.recordsNb = 0;
+    dirc.nextDirC = 0;
+
+    if (adfWriteDirCBlock(vol, nCache, &dirc)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfReadDirCBlock
+ *
+ */
+RETCODE adfReadDirCBlock(struct Volume *vol, SECTNUM nSect, struct bDirCacheBlock *dirc)
+{
+    uint8_t buf[512];
+
+    if (adfReadBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+
+    memcpy(dirc,buf,512);
+#ifdef LITT_ENDIAN
+    swapEndian((uint8_t*)dirc,SWBL_CACHE);
+#endif
+    if (dirc->checkSum!=adfNormalSum(buf,20,512))
+        (*adfEnv.wFct)("adfReadDirCBlock : invalid checksum");
+    if (dirc->type!=T_DIRC)
+        (*adfEnv.wFct)("adfReadDirCBlock : T_DIRC not found");
+    if (dirc->headerKey!=nSect)
+        (*adfEnv.wFct)("adfReadDirCBlock : headerKey!=nSect");
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteDirCblock
+ *
+ */
+RETCODE adfWriteDirCBlock(struct Volume* vol, int32_t nSect, struct bDirCacheBlock* dirc)
+{
+    uint8_t buf[LOGICAL_BLOCK_SIZE];
+    uint32_t newSum;
+ 
+    dirc->type = T_DIRC;
+    dirc->headerKey = nSect; 
+
+    memcpy(buf, dirc, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    swapEndian(buf, SWBL_CACHE);
+#endif
+
+    newSum = adfNormalSum(buf, 20, LOGICAL_BLOCK_SIZE);
+    swLong(buf+20,newSum);
+/*    *(int32_t*)(buf+20) = swapLong((uint8_t*)&newSum);*/
+
+    if (adfWriteBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+/*puts("adfWriteDirCBlock");*/
+
+    return RC_OK;
+}
+
+/*################################################################################*/

dep/adflib/src/adf_cache.h

@@ -0,0 +1,48 @@
+#ifndef _ADF_CACHE_H
+#define _ADF_CACHE_H 1
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_cache.h
+ *
+ *  $Id$
+ *
+ *  directory cache code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+
+#include "adf_str.h"
+
+void adfGetCacheEntry(struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry);
+int adfPutCacheEntry( struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry);
+
+struct List* adfGetDirEntCache(struct Volume *vol, SECTNUM dir, BOOL recurs);
+
+RETCODE adfCreateEmptyCache(struct Volume *vol, struct bEntryBlock *parent, SECTNUM nSect);
+RETCODE adfAddInCache(struct Volume *vol, struct bEntryBlock *parent, struct bEntryBlock *entry);
+RETCODE adfUpdateCache(struct Volume *vol, struct bEntryBlock *parent, struct bEntryBlock *entry, BOOL);
+RETCODE adfDelFromCache(struct Volume *vol, struct bEntryBlock *parent, SECTNUM);
+
+RETCODE adfReadDirCBlock(struct Volume *vol, SECTNUM nSect, struct bDirCacheBlock *dirc);
+RETCODE adfWriteDirCBlock(struct Volume*, int32_t, struct bDirCacheBlock* dirc);
+
+#endif /* _ADF_CACHE_H */
+
+/*##########################################################################*/

dep/adflib/src/adf_defs.h

@@ -0,0 +1,71 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_defs.h
+ *
+ *  $Id$
+ *
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+
+#ifndef _ADF_DEFS_H
+#define _ADF_DEFS_H 1
+
+#define ADFLIB_VERSION "0.7.11a"
+#define ADFLIB_DATE "January 20th, 2007"
+
+#define SECTNUM int32_t
+#define RETCODE int32_t
+
+#define TRUE    1
+#define FALSE   0
+
+#include <stdint.h>
+#define ULONG   uint32_t
+#define USHORT  uint16_t
+#define UCHAR   uint8_t
+#define BOOL    int
+
+
+/* defines max and min */
+
+#ifndef max
+#define max(a,b)        (a)>(b) ? (a) : (b)
+#endif
+#ifndef min
+#define min(a,b)        (a)<(b) ? (a) : (b)
+#endif
+
+
+/* (*byte) to (*short) and (*byte) to (*long) conversion */
+
+#define Short(p) ((p)[0]<<8 | (p)[1])
+#define Long(p) (Short(p)<<16 | Short(p+2))
+
+
+/* swap short and swap long macros for little endian machines */
+
+#define swapShort(p) ((p)[0]<<8 | (p)[1])
+#define swapLong(p) (swapShort(p)<<16 | swapShort(p+2))
+
+
+
+#endif /* _ADF_DEFS_H */
+/*##########################################################################*/

dep/adflib/src/adf_dir.h

@@ -0,0 +1,70 @@
+#ifndef ADF_DIR_H
+#define ADF_DIR_H 1
+
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_dir.h
+ *
+ *  $Id$
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+#include"adf_str.h"
+#include"adf_err.h"
+#include"adf_defs.h"
+
+#include"prefix.h"
+
+PREFIX RETCODE adfToRootDir(struct Volume *vol);
+BOOL isDirEmpty(struct bDirBlock *dir);
+PREFIX RETCODE adfRemoveEntry(struct Volume *vol, SECTNUM pSect, char *name);
+PREFIX struct List* adfGetDirEnt(struct Volume* vol, SECTNUM nSect );
+PREFIX struct List* adfGetRDirEnt(struct Volume* vol, SECTNUM nSect, BOOL recurs );
+PREFIX void adfFreeDirList(struct List* list);
+
+RETCODE adfEntBlock2Entry(struct bEntryBlock *entryBlk, struct Entry *entry);
+PREFIX void adfFreeEntry(struct Entry *entry);
+RETCODE adfCreateFile(struct Volume* vol, SECTNUM parent, char *name,
+    struct bFileHeaderBlock *fhdr);
+PREFIX RETCODE adfCreateDir(struct Volume* vol, SECTNUM parent, char* name);
+SECTNUM adfCreateEntry(struct Volume *vol, struct bEntryBlock *dir, char *name, SECTNUM );
+PREFIX RETCODE adfRenameEntry(struct Volume *vol, SECTNUM, char *old,SECTNUM,char *new);
+
+
+RETCODE adfReadEntryBlock(struct Volume* vol, SECTNUM nSect, struct bEntryBlock* ent);
+RETCODE adfWriteDirBlock(struct Volume* vol, SECTNUM nSect, struct bDirBlock *dir);
+RETCODE adfWriteEntryBlock(struct Volume* vol, SECTNUM nSect, struct bEntryBlock *ent);
+
+char* adfAccess2String(int32_t acc);
+uint8_t adfIntlToUpper(uint8_t c);
+int adfGetHashValue(uint8_t *name, BOOL intl);
+void myToUpper( uint8_t *ostr, uint8_t *nstr, int,BOOL intl );
+PREFIX RETCODE adfChangeDir(struct Volume* vol, char *name);
+PREFIX RETCODE adfParentDir(struct Volume* vol);
+PREFIX RETCODE adfSetEntryAccess(struct Volume*, SECTNUM, char*, int32_t);
+PREFIX RETCODE adfSetEntryComment(struct Volume*, SECTNUM, char*, char*);
+SECTNUM adfNameToEntryBlk(struct Volume *vol, int32_t ht[], char* name, 
+    struct bEntryBlock *entry, SECTNUM *);
+
+PREFIX void printEntry(struct Entry* entry);
+void adfFreeDirList(struct List* list);
+
+#endif /* ADF_DIR_H */
+

dep/adflib/src/adf_disk.c

@@ -0,0 +1,454 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_disk.c
+ *
+ *  $Id$
+ *
+ * logical disk/volume code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+#include <limits.h>
+#include <stdlib.h>
+#include <string.h>
+
+#include "adf_str.h"
+#include "adf_disk.h"
+#include "adf_raw.h"
+#include "adf_hd.h"
+#include "adf_bitm.h"
+#include "adf_util.h"
+#include "adf_nativ.h"
+#include "adf_dump.h"
+#include "adf_err.h"
+#include "adf_cache.h"
+
+extern struct Env adfEnv;
+
+uint32_t bitMask[32] = { 
+    0x1, 0x2, 0x4, 0x8,
+	0x10, 0x20, 0x40, 0x80,
+    0x100, 0x200, 0x400, 0x800,
+	0x1000, 0x2000, 0x4000, 0x8000,
+	0x10000, 0x20000, 0x40000, 0x80000,
+	0x100000, 0x200000, 0x400000, 0x800000,
+	0x1000000, 0x2000000, 0x4000000, 0x8000000,
+	0x10000000, 0x20000000, 0x40000000, 0x80000000 };
+
+
+RETCODE adfInstallBootBlock(struct Volume *vol, uint8_t* code)
+{
+    int i;
+    struct bBootBlock boot;
+
+    if (vol->dev->devType!=DEVTYPE_FLOPDD && vol->dev->devType!=DEVTYPE_FLOPHD)
+        return RC_ERROR;
+
+    if (adfReadBootBlock(vol, &boot)!=RC_OK)
+        return RC_ERROR;
+
+    boot.rootBlock = 880;
+    for(i=0; i<1024-12; i++)         /* bootcode */
+        boot.data[i] = code[i+12];
+
+    if (adfWriteBootBlock(vol, &boot)!=RC_OK)
+		return RC_ERROR;
+
+	vol->bootCode = TRUE;
+
+    return RC_OK;
+}
+
+
+/*
+ * isSectNumValid
+ *
+ */
+BOOL isSectNumValid(struct Volume *vol, SECTNUM nSect)
+{
+    return( 0<=nSect && nSect<=(vol->lastBlock - vol->firstBlock) );
+}	
+	
+
+
+/*
+ * adfVolumeInfo
+ *
+ */
+void adfVolumeInfo(struct Volume *vol)
+{
+	struct bRootBlock root;
+	char diskName[35];
+	int days,month,year;
+	
+	if (adfReadRootBlock(vol, vol->rootBlock, &root)!=RC_OK)
+		return;
+	
+	memset(diskName, 0, 35);
+	memcpy(diskName, root.diskName, root.nameLen);
+	
+	printf ("Name : %-30s\n",vol->volName);
+	printf ("Type : ");
+	switch(vol->dev->devType) {
+		case DEVTYPE_FLOPDD:
+			printf ("Floppy Double Density : 880 KBytes\n");
+			break;
+		case DEVTYPE_FLOPHD:
+			printf ("Floppy High Density : 1760 KBytes\n");
+			break;
+		case DEVTYPE_HARDDISK:
+			printf ("Hard Disk partition : %3.1f KBytes\n", 
+				(vol->lastBlock - vol->firstBlock +1) * 512.0/1024.0);
+			break;
+		case DEVTYPE_HARDFILE:
+			printf ("HardFile : %3.1f KBytes\n", 
+				(vol->lastBlock - vol->firstBlock +1) * 512.0/1024.0);
+			break;
+		default:
+			printf ("Unknown devType!\n");
+	}
+	printf ("Filesystem : ");
+	printf("%s ",isFFS(vol->dosType) ? "FFS" : "OFS");
+	if (isINTL(vol->dosType))
+		printf ("INTL ");
+	if (isDIRCACHE(vol->dosType))
+		printf ("DIRCACHE ");
+	putchar('\n');
+
+    printf("Free blocks = %d\n", adfCountFreeBlocks(vol));
+    if (vol->readOnly)
+        printf("Read only\n");
+    else
+        printf("Read/Write\n");
+ 	
+    /* created */
+	adfDays2Date(root.coDays, &year, &month, &days);
+    printf ("created %d/%02d/%02d %d:%02d:%02d\n",days,month,year,
+	    root.coMins/60,root.coMins%60,root.coTicks/50);	
+	adfDays2Date(root.days, &year, &month, &days);
+    printf ("last access %d/%02d/%02d %d:%02d:%02d,   ",days,month,year,
+	    root.mins/60,root.mins%60,root.ticks/50);	
+	adfDays2Date(root.cDays, &year, &month, &days);
+    printf ("%d/%02d/%02d %d:%02d:%02d\n",days,month,year,
+	    root.cMins/60,root.cMins%60,root.cTicks/50);	
+}
+
+
+
+/*
+ * adfMount
+ *
+ * 
+ */
+struct Volume* adfMount( struct Device *dev, int nPart, BOOL readOnly )
+{
+    int32_t nBlock;
+    struct bRootBlock root;
+	struct bBootBlock boot;
+	struct Volume* vol;
+
+    if (dev==NULL || nPart >= dev->nVol) {
+        (*adfEnv.eFct)("adfMount : invalid parameter(s)");
+        return NULL;
+    }
+
+    vol = dev->volList[nPart];
+	vol->dev = dev;
+    vol->mounted = TRUE;
+
+/*printf("first=%ld last=%ld root=%ld\n",vol->firstBlock,
+ vol->lastBlock, vol->rootBlock);
+*/
+    if (adfReadBootBlock(vol, &boot)!=RC_OK) {
+        (*adfEnv.wFct)("adfMount : BootBlock invalid");
+        return NULL;
+    }       
+    
+	vol->dosType = boot.dosType[3];
+	if (isFFS(vol->dosType))
+		vol->datablockSize=512;
+	else
+		vol->datablockSize=488;
+
+    if (dev->readOnly /*|| isDIRCACHE(vol->dosType)*/)
+       vol->readOnly = TRUE;
+    else
+       vol->readOnly = readOnly;
+	   	
+	if (adfReadRootBlock(vol, vol->rootBlock, &root)!=RC_OK) {
+        (*adfEnv.wFct)("adfMount : RootBlock invalid");       
+        return NULL;
+    }
+
+    nBlock = vol->lastBlock - vol->firstBlock +1 - 2;
+
+	adfReadBitmap( vol, nBlock, &root );
+    vol->curDirPtr = vol->rootBlock;
+
+/*printf("blockSize=%d\n",vol->blockSize);*/
+
+    return( vol );
+}
+
+
+/*
+*
+* adfUnMount
+*
+* free bitmap structures
+* free current dir
+*/
+void adfUnMount(struct Volume *vol)
+{
+	if (!vol) {
+		(*adfEnv.eFct)("adfUnMount : vol is null");
+        return;
+    }
+
+    adfFreeBitmap(vol);
+
+    vol->mounted = FALSE;
+	
+}
+
+
+
+/*
+ * adfCreateVol
+ *
+ * 
+ */
+struct Volume* adfCreateVol( struct Device* dev, int32_t start, int32_t len, 
+    char* volName, int volType )
+{
+    struct bBootBlock boot;
+    struct bRootBlock root;
+/*    struct bDirCacheBlock dirc;*/
+    SECTNUM blkList[2];
+    struct Volume* vol;
+    int nlen;
+
+    if (adfEnv.useProgressBar)
+        (*adfEnv.progressBar)(0);
+
+    vol=(struct Volume*)malloc(sizeof(struct Volume));
+    if (!vol) { 
+		(*adfEnv.eFct)("adfCreateVol : malloc vol");
+        return NULL;
+    }
+	
+    vol->dev = dev;
+    vol->firstBlock = (dev->heads * dev->sectors)*start;
+    vol->lastBlock = (vol->firstBlock + (dev->heads * dev->sectors)*len)-1;
+    vol->rootBlock = (vol->lastBlock - vol->firstBlock+1)/2;
+/*printf("first=%ld last=%ld root=%ld\n",vol->firstBlock,
+ vol->lastBlock, vol->rootBlock);
+*/
+    vol->curDirPtr = vol->rootBlock;
+
+    vol->readOnly = dev->readOnly;
+
+    vol->mounted = TRUE;
+
+    nlen = min( MAXNAMELEN, strlen(volName) );
+    vol->volName = (char*)malloc(nlen+1);
+    if (!vol->volName) { 
+		(*adfEnv.eFct)("adfCreateVol : malloc");
+		free(vol); return NULL;
+    }
+    memcpy(vol->volName, volName, nlen);
+    vol->volName[nlen]='\0';
+
+    if (adfEnv.useProgressBar)
+        (*adfEnv.progressBar)(25);
+
+    memset(&boot, 0, 1024);
+    boot.dosType[3] = volType;
+/*printf("first=%d last=%d\n", vol->firstBlock, vol->lastBlock);
+printf("name=%s root=%d\n", vol->volName, vol->rootBlock);
+*/
+    if (adfWriteBootBlock(vol, &boot)!=RC_OK) {
+        free(vol->volName); free(vol);
+        return NULL;
+    }
+
+    if (adfEnv.useProgressBar)
+        (*adfEnv.progressBar)(20);
+
+    if (adfCreateBitmap( vol )!=RC_OK) {
+        free(vol->volName); free(vol);
+        return NULL;
+    }
+
+    if (adfEnv.useProgressBar)
+        (*adfEnv.progressBar)(40);
+
+
+/*for(i=0; i<127; i++)
+printf("%3d %x, ",i,vol->bitmapTable[0]->map[i]);
+*/
+    if ( isDIRCACHE(volType) )
+        adfGetFreeBlocks( vol, 2, blkList );
+    else
+        adfGetFreeBlocks( vol, 1, blkList );
+
+
+/*printf("[0]=%d [1]=%d\n",blkList[0],blkList[1]);*/
+
+    memset(&root, 0, LOGICAL_BLOCK_SIZE);
+
+    if (strlen(volName)>MAXNAMELEN)
+        volName[MAXNAMELEN]='\0';
+    root.nameLen = strlen(volName);
+    memcpy(root.diskName,volName,root.nameLen);
+    adfTime2AmigaTime(adfGiveCurrentTime(),&(root.coDays),&(root.coMins),&(root.coTicks));
+
+    /* dircache block */
+    if ( isDIRCACHE(volType) ) {
+        root.extension = 0L;
+        root.secType = ST_ROOT; /* needed by adfCreateEmptyCache() */
+        adfCreateEmptyCache(vol, (struct bEntryBlock*)&root, blkList[1]);
+    }
+
+    if (adfEnv.useProgressBar)
+        (*adfEnv.progressBar)(60);
+
+    if (adfWriteRootBlock(vol, blkList[0], &root)!=RC_OK) {
+        free(vol->volName); free(vol);
+        return NULL;
+    }
+
+   /* fills root->bmPages[] and writes filled bitmapExtBlocks */
+    if (adfWriteNewBitmap(vol)!=RC_OK)
+		return NULL;
+
+    if (adfEnv.useProgressBar)
+        (*adfEnv.progressBar)(80);
+
+    if (adfUpdateBitmap(vol)!=RC_OK)
+		return NULL;
+
+    if (adfEnv.useProgressBar)
+        (*adfEnv.progressBar)(100);
+/*printf("free blocks %ld\n",adfCountFreeBlocks(vol));*/
+
+    /* will be managed by adfMount() later */
+    adfFreeBitmap(vol);
+
+    vol->mounted = FALSE;
+
+    return(vol);
+}
+
+
+/*-----*/
+
+/*
+ * adfReadBlock
+ *
+ * read logical block
+ */
+RETCODE
+adfReadBlock(struct Volume* vol, int32_t nSect, uint8_t* buf)
+{
+  /*    char strBuf[80];*/
+    int32_t pSect;
+    struct nativeFunctions *nFct;
+    RETCODE rc;
+
+    if (!vol->mounted) {
+        (*adfEnv.eFct)("the volume isn't mounted, adfReadBlock not possible");
+        return RC_ERROR;
+    }
+
+    /* translate logical sect to physical sect */
+    pSect = nSect+vol->firstBlock;
+
+    if (adfEnv.useRWAccess)
+        (*adfEnv.rwhAccess)(pSect,nSect,FALSE);
+
+/*printf("psect=%ld nsect=%ld\n",pSect,nSect);*/
+/*    sprintf(strBuf,"ReadBlock : accessing logical block #%ld", nSect);	
+    (*adfEnv.vFct)(strBuf);
+*/
+    if (pSect<vol->firstBlock || pSect>vol->lastBlock) {
+        (*adfEnv.wFct)("adfReadBlock : nSect out of range");
+        
+    }
+/*printf("pSect R =%ld\n",pSect);*/
+    nFct = adfEnv.nativeFct;
+    if (vol->dev->isNativeDev)
+        rc = (*nFct->adfNativeReadSector)(vol->dev, pSect, 512, buf);
+    else
+        rc = adfReadDumpSector(vol->dev, pSect, 512, buf);
+/*printf("rc=%ld\n",rc);*/
+    if (rc!=RC_OK)
+        return RC_ERROR;
+    else
+        return RC_OK;
+}
+
+
+/*
+ * adfWriteBlock
+ *
+ */
+RETCODE adfWriteBlock(struct Volume* vol, int32_t nSect, uint8_t *buf)
+{
+    int32_t pSect;
+    struct nativeFunctions *nFct;
+    RETCODE rc;
+
+    if (!vol->mounted) {
+        (*adfEnv.eFct)("the volume isn't mounted, adfWriteBlock not possible");
+        return RC_ERROR;
+    }
+
+    if (vol->readOnly) {
+        (*adfEnv.wFct)("adfWriteBlock : can't write block, read only volume");
+        return RC_ERROR;
+    }
+
+    pSect = nSect+vol->firstBlock;
+/*printf("write nsect=%ld psect=%ld\n",nSect,pSect);*/
+
+    if (adfEnv.useRWAccess)
+        (*adfEnv.rwhAccess)(pSect,nSect,TRUE);
+ 
+    if (pSect<vol->firstBlock || pSect>vol->lastBlock) {
+        (*adfEnv.wFct)("adfWriteBlock : nSect out of range");
+    }
+
+    nFct = adfEnv.nativeFct;
+/*printf("nativ=%d\n",vol->dev->isNativeDev);*/
+    if (vol->dev->isNativeDev)
+        rc = (*nFct->adfNativeWriteSector)(vol->dev, pSect, 512, buf);
+    else
+        rc = adfWriteDumpSector(vol->dev, pSect, 512, buf);
+
+    if (rc!=RC_OK)
+        return RC_ERROR;
+    else
+        return RC_OK;
+}
+
+
+
+/*#######################################################################################*/

dep/adflib/src/adf_disk.h

@@ -0,0 +1,52 @@
+#ifndef _ADF_DISK_H
+#define _ADF_DISK_H 1
+
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_disk.h
+ *
+ *  $Id$
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+#include "prefix.h"
+
+#include "adf_str.h"
+#include "adf_defs.h"
+
+PREFIX RETCODE adfInstallBootBlock(struct Volume *vol,uint8_t*);
+
+PREFIX BOOL isSectNumValid(struct Volume *vol, SECTNUM nSect);
+
+PREFIX struct Volume* adfMount( struct Device *dev, int nPart, BOOL readOnly );
+PREFIX void adfUnMount(struct Volume *vol);
+PREFIX void adfVolumeInfo(struct Volume *vol);
+struct Volume* adfCreateVol( struct Device* dev, int32_t start, int32_t len, 
+    char* volName, int volType );
+
+/*void adfReadBitmap(struct Volume* , int32_t nBlock, struct bRootBlock* root);
+void adfUpdateBitmap(struct Volume*);
+*/
+PREFIX RETCODE adfReadBlock(struct Volume* , int32_t nSect, uint8_t* buf);
+PREFIX RETCODE adfWriteBlock(struct Volume* , int32_t nSect, uint8_t* buf);
+
+#endif /* _ADF_DISK_H */
+
+/*##########################################################################*/