mirror of
				https://github.com/davidgiven/fluxengine.git
				synced 2025-10-24 11:11:02 -07:00 
			
		
		
		
	Compare commits
	
		
			1594 Commits
		
	
	
		
			FluxEngine
			...
			requiremen
		
	
	| Author | SHA1 | Date | |
|---|---|---|---|
|  | bab350d771 | ||
|  | 048dac223f | ||
|  | b7634da310 | ||
|  | 882c92c64a | ||
|  | 4592dbe28b | ||
|  | edc0f21ae7 | ||
|  | 8715b7f6c1 | ||
|  | 99511910dd | ||
|  | a03478b011 | ||
|  | 5c428e1f07 | ||
|  | ee57615735 | ||
|  | 67300e5769 | ||
|  | 873e05051c | ||
|  | 4daaec46a7 | ||
|  | dd8cc7bfd4 | ||
|  | 5568ac382f | ||
|  | dcdb3e4455 | ||
|  | 17b29b1626 | ||
|  | dcfcc6271c | ||
|  | 1d77ba6429 | ||
|  | ff5f019ac1 | ||
|  | e61eeb8c6f | ||
|  | 68d22e7f54 | ||
|  | 790f0a42e3 | ||
|  | 08e9e508cc | ||
|  | ad1a8d608f | ||
|  | d74ed71023 | ||
|  | 0c7f9e0888 | ||
|  | ba5f6528a8 | ||
|  | 65cf552ec2 | ||
|  | 715c0a0c42 | ||
|  | 9e383575d1 | ||
|  | d84c366480 | ||
|  | 42e6c11081 | ||
|  | 9ba3f90f1e | ||
|  | 24ff51274b | ||
|  | 4c4c752827 | ||
|  | 5022b67e4a | ||
|  | 6b990a9f51 | ||
|  | e69ce3b8df | ||
|  | cf537b6222 | ||
|  | ed4067f194 | ||
|  | d4b55cd8f5 | ||
|  | baaeb0bca7 | ||
|  | 466c3c34e5 | ||
|  | 099d7969ca | ||
|  | 5adfa95a85 | ||
|  | bfa0846ad0 | ||
|  | 7099264334 | ||
|  | 69b44e7968 | ||
|  | fe39977ff7 | ||
|  | b9fc8de5b5 | ||
|  | f7b8022d3a | ||
|  | a62346c515 | ||
|  | e372d757ad | ||
|  | ab1b10f935 | ||
|  | 8e918706dc | ||
|  | 76450d00bf | ||
|  | ee53542e18 | ||
|  | db004bc787 | ||
|  | 71a7f3554e | ||
|  | 5c3f422a53 | ||
|  | 2fe0cec04a | ||
|  | de59e781b5 | ||
|  | 8c77af651b | ||
|  | 638f6928cf | ||
|  | ccc8e597a7 | ||
|  | 585f19d884 | ||
|  | bb2b7d7df6 | ||
|  | e75d218438 | ||
|  | 7f81b554fd | ||
|  | 2490f19a1a | ||
|  | 30f382bf22 | ||
|  | ad03c187cf | ||
|  | 06560b5a5a | ||
|  | 7c40093698 | ||
|  | d37c75d703 | ||
|  | 82bfb9a303 | ||
|  | 01682101a6 | ||
|  | 3c46f787b1 | ||
|  | 591d200283 | ||
|  | 195534c21e | ||
|  | 0f9d851a29 | ||
|  | 18a03baf99 | ||
|  | 5e06db4a52 | ||
|  | bf78508ef7 | ||
|  | 137c0340fb | ||
|  | e6d9de2d80 | ||
|  | d9b319eaed | ||
|  | f2e713bde3 | ||
|  | 94e2e494c9 | ||
|  | 5af408e1d1 | ||
|  | 77bdc727ab | ||
|  | eb26426424 | ||
|  | f624bb6e5b | ||
|  | 4a8fb9288c | ||
|  | f8f5873973 | ||
|  | 5f4903f2d1 | ||
|  | b02a894663 | ||
|  | 510b530551 | ||
|  | c36662205b | ||
|  | a2ffe06792 | ||
|  | 0f56108bf5 | ||
|  | 199cefdb71 | ||
|  | 1bdeaa326c | ||
|  | cce8cfe88d | ||
|  | bcfc0217dc | ||
|  | 7cfa080220 | ||
|  | 45ebc0f40f | ||
|  | 38d575eda7 | ||
|  | 9cb284583b | ||
|  | 137b921e8d | ||
|  | 8c876f555d | ||
|  | 0988dd524b | ||
|  | 2dc649ef09 | ||
|  | baf02cb849 | ||
|  | 51fa3c5293 | ||
|  | 134dd6c37d | ||
|  | d766e1f9a9 | ||
|  | d298f5b16e | ||
|  | ed634fbbf6 | ||
|  | 4c776d584b | ||
|  | c2c04862a2 | ||
|  | ccd9539015 | ||
|  | 624c597735 | ||
|  | 9300aa79c3 | ||
|  | 9e522c7da2 | ||
|  | ef60bfff6b | ||
|  | 635c6c7bfe | ||
|  | df6e47fa50 | ||
|  | 654cdcd3d1 | ||
|  | a633b73e12 | ||
|  | ba93dae240 | ||
|  | 8e0ca85d1e | ||
|  | 56a4926bd3 | ||
|  | 6a2aae4ef2 | ||
|  | ec68ce3bfa | ||
|  | a777a5be30 | ||
|  | b553a8b1fb | ||
|  | b119e1f72d | ||
|  | 7345d3e6c1 | ||
|  | e9b7a7bb52 | ||
|  | 2022732dd9 | ||
|  | 63544647b6 | ||
|  | 6b62585ad5 | ||
|  | 14027210f7 | ||
|  | 3df17b23b8 | ||
|  | cbf3f56562 | ||
|  | 1f74d9189f | ||
|  | 137658d1d6 | ||
|  | 5b627bd2b1 | ||
|  | 38ff08885a | ||
|  | a89993aabb | ||
|  | d6353403e2 | ||
|  | bc62ee04c0 | ||
|  | d3ff836b63 | ||
|  | a7aac5578e | ||
|  | add5a141d3 | ||
|  | 330410ec61 | ||
|  | d0f49dcfa6 | ||
|  | 124f6ab7cb | ||
|  | 471f63592e | ||
|  | 50e210c72f | ||
|  | d3396aa535 | ||
|  | 5ed8b838bc | ||
|  | d1757eacc2 | ||
|  | 0692e5f5d5 | ||
|  | e4204196cd | ||
|  | 241d4342e4 | ||
|  | c04cbc631c | ||
|  | 29b273ad7b | ||
|  | 9720dab2f6 | ||
|  | bddc64a324 | ||
|  | eb324f14de | ||
|  | b78a057c81 | ||
|  | 5751725213 | ||
|  | f194392f99 | ||
|  | fea62178af | ||
|  | 33ef4ce8de | ||
|  | 3728120f95 | ||
|  | 2944b9b3f6 | ||
|  | 3430574364 | ||
|  | fc5a5212c0 | ||
|  | 20f724ed13 | ||
|  | 94c1d21938 | ||
|  | a1a9666b6f | ||
|  | 0551ddc276 | ||
|  | 049ffd3b04 | ||
|  | c28f757c5c | ||
|  | 91dbb86e64 | ||
|  | 27a04ee22b | ||
|  | 5cefce9922 | ||
|  | 8fb4c90bed | ||
|  | 81753669cc | ||
|  | 0a0a72bcf3 | ||
|  | c4a6e3e063 | ||
|  | 1138e6b77f | ||
|  | 030f9218d6 | ||
|  | 2fff32e8f2 | ||
|  | 5b2aa9926f | ||
|  | 921e178e83 | ||
|  | 25ffd900c8 | ||
|  | 7ea4e116cc | ||
|  | a9daec36f5 | ||
|  | cebc7c6cd2 | ||
|  | 3f85c9f006 | ||
|  | ed5efd7b87 | ||
|  | 4984a53bfd | ||
|  | b0c77653a2 | ||
|  | 909f0d628b | ||
|  | e27e3ada92 | ||
|  | 339ea3b5a4 | ||
|  | 9bd8b8915e | ||
|  | 35008656a9 | ||
|  | 825089458f | ||
|  | 4a086d94b7 | ||
|  | 0aeddf7e98 | ||
|  | 4922d1deb4 | ||
|  | 86d0893261 | ||
|  | e4c67f18bd | ||
|  | d07c5a94e1 | ||
|  | a91dee27e7 | ||
|  | e3219087c9 | ||
|  | cc9ec84aec | ||
|  | a33cc5710c | ||
|  | c2b148288a | ||
|  | a483567564 | ||
|  | bd99bc6d94 | ||
|  | 8f79071aad | ||
|  | ef9071049b | ||
|  | 60e1ab8cca | ||
|  | d3dbfd3154 | ||
|  | ee2dffb498 | ||
|  | 6d9510cc65 | ||
|  | 49f0f5d000 | ||
|  | d8528d889a | ||
|  | ec439a5f2a | ||
|  | d88110488e | ||
|  | 2f4b15293a | ||
|  | 3d71f32587 | ||
|  | 5136dda598 | ||
|  | d26940304b | ||
|  | f9f11b4966 | ||
|  | 1297b568ba | ||
|  | fd10840cc0 | ||
|  | 7e86be979d | ||
|  | 731d1efcc4 | ||
|  | dfda8be30c | ||
|  | 7dd1b6d8e9 | ||
|  | ec1bcdb9e5 | ||
|  | c0f46d2bd4 | ||
|  | 615dca3130 | ||
|  | 9cf9597c54 | ||
|  | e24ee648e7 | ||
|  | e3518dc389 | ||
|  | 693ba20606 | ||
|  | b947c6c186 | ||
|  | 7f8ecb8514 | ||
|  | 4df6afa9c1 | ||
|  | d0620f8efe | ||
|  | 2b1a6dbb03 | ||
|  | c6ef667c3f | ||
|  | 8c1d1bec93 | ||
|  | 8be174e65a | ||
|  | 6d37fafb02 | ||
|  | 46ce882daa | ||
|  | 6d14cbdb9b | ||
|  | 4bf6b433ae | ||
|  | 87a1b2e6f8 | ||
|  | c6ee48ec85 | ||
|  | b58a6b1649 | ||
|  | bd9736df93 | ||
|  | 3b9c966e3d | ||
|  | 96c9a89171 | ||
|  | c374ffd15e | ||
|  | c53109e1a1 | ||
|  | 4598b3a7a6 | ||
|  | cf975b74bf | ||
|  | 5d65dcf3c8 | ||
|  | f299ec1f8d | ||
|  | 6677034774 | ||
|  | 3c7c4639a9 | ||
|  | 7e9a1268a5 | ||
|  | a60b8e68ca | ||
|  | b2161aa67e | ||
|  | d1fffb1d08 | ||
|  | 52d66d9555 | ||
|  | 66f2d359e2 | ||
|  | 8327f33ee6 | ||
|  | d4a94551d9 | ||
|  | d2a545d83e | ||
|  | aee4eac271 | ||
|  | cbeddb11bc | ||
|  | 4c51cf8316 | ||
|  | 345cd6bd92 | ||
|  | 48540245b5 | ||
|  | 088bd9434d | ||
|  | 8ba8c58377 | ||
|  | 4ae43d0503 | ||
|  | 00fdb90adf | ||
|  | f8257e697a | ||
|  | 0ddfd3bead | ||
|  | 4797d1ea10 | ||
|  | d20ce3dde7 | ||
|  | ef5f7ec9c3 | ||
|  | 69c60c4026 | ||
|  | 2f4f2083ba | ||
|  | 77ada0471b | ||
|  | 00cab46a0d | ||
|  | 7f7460f3f3 | ||
|  | c225eef9ad | ||
|  | 460f920502 | ||
|  | c7677e5514 | ||
|  | 12fb39baa9 | ||
|  | 201fd22861 | ||
|  | d0fb85e712 | ||
|  | 81cbd00cc8 | ||
|  | 4a565b5ea0 | ||
|  | 82f61eee12 | ||
|  | 88fc7ff9c3 | ||
|  | 8eb17bf104 | ||
|  | 9a8fc80220 | ||
|  | e5e652fad2 | ||
|  | 924d077315 | ||
|  | 44a7505295 | ||
|  | b1a6fa4084 | ||
|  | 0665fc0a6f | ||
|  | 4bf5fd49d6 | ||
|  | 0a6bc99ecd | ||
|  | 45cc617fc5 | ||
|  | 6dc5eabdf0 | ||
|  | 48d3bc55bf | ||
|  | 6b7e81d7fb | ||
|  | dce6248193 | ||
|  | 0e349ede4c | ||
|  | 60117471a7 | ||
|  | 3c23e7b047 | ||
|  | b48e1ba9e0 | ||
|  | 1267191e8e | ||
|  | 65a43b64ae | ||
|  | 09e446a26e | ||
|  | 2ecb3059e5 | ||
|  | 237cb42695 | ||
|  | 49b6bbff37 | ||
|  | 5e05083008 | ||
|  | 339e9cca10 | ||
|  | d441ad8875 | ||
|  | 72fc6bf913 | ||
|  | fcf278c61c | ||
|  | 890404ded5 | ||
|  | 6fd9b47c45 | ||
|  | 003651ec68 | ||
|  | c63a761ca4 | ||
|  | 32dcd1551b | ||
|  | 90fbdd5fab | ||
|  | 1fea200582 | ||
|  | 55b8a62f64 | ||
|  | a8906bf58f | ||
|  | 0d6b9263d4 | ||
|  | f091a54ca6 | ||
|  | 5262929c16 | ||
|  | c1ca8a3ae6 | ||
|  | a7e36472d5 | ||
|  | 538a22e2f7 | ||
|  | 0c40a3e79c | ||
|  | 3cb098f9ba | ||
|  | ea1ab029f3 | ||
|  | 92a76a6d39 | ||
|  | c451950dbf | ||
|  | 644adc43ed | ||
|  | 63a7340c21 | ||
|  | 6824f00867 | ||
|  | 3cb48b40aa | ||
|  | dda713a6be | ||
|  | 415aa82a6f | ||
|  | 4ae664fd93 | ||
|  | 5d1e304642 | ||
|  | 6b228d7a0a | ||
|  | 085ad5f2a4 | ||
|  | e40e6bd07f | ||
|  | a6db36e7b3 | ||
|  | 1a4caccd07 | ||
|  | 7f1017ebd9 | ||
|  | f792cd2677 | ||
|  | 1361cab603 | ||
|  | 05b784d203 | ||
|  | 542c3e38f5 | ||
|  | bcdead1eca | ||
|  | a79a927a13 | ||
|  | 5bcc9071f6 | ||
|  | 88869ff6d4 | ||
|  | 1655505b95 | ||
|  | 9abfa3726e | ||
|  | 89a4abf9cf | ||
|  | 854afc6de3 | ||
|  | 03048797c5 | ||
|  | 2478ccd8ef | ||
|  | 827cfd818e | ||
|  | b0e0cd6a1f | ||
|  | 003e919bd5 | ||
|  | 56dadfc228 | ||
|  | b70603e92b | ||
|  | 6294bc4505 | ||
|  | 326bc931ad | ||
|  | 734913f638 | ||
|  | 157a525ec1 | ||
|  | 352abe07d8 | ||
|  | 0111ed37ba | ||
|  | 079c4c955c | ||
|  | 922715480e | ||
|  | 99ca175e9a | ||
|  | c1fefb7e13 | ||
|  | 31495d484d | ||
|  | 1c6ae0bd88 | ||
|  | 177aadbb45 | ||
|  | a6868acfa0 | ||
|  | 907d46a28b | ||
|  | 87dda265f4 | ||
|  | 7106882212 | ||
|  | 59e5f3d27e | ||
|  | b2eba66bff | ||
|  | b8b5509d49 | ||
|  | e667e302dc | ||
|  | ba68a13712 | ||
|  | c562c6f23a | ||
|  | fad79e51ac | ||
|  | 9438d68dae | ||
|  | 39b761ea16 | ||
|  | 64689cf59d | ||
|  | 17f80e4e53 | ||
|  | 4117e233b3 | ||
|  | 6c0bb3781a | ||
|  | eb55fe1fe3 | ||
|  | dc396d5cf7 | ||
|  | 80ec4407bc | ||
|  | 1e45374d41 | ||
|  | 92ae233f39 | ||
|  | d3f8eb09d0 | ||
|  | 058ef8495b | ||
|  | e2ac8eb43c | ||
|  | 56121e39e2 | ||
|  | 57bc2c459b | ||
|  | 311beacfff | ||
|  | 67e9c65313 | ||
|  | 9a0257caaa | ||
|  | a121fb8c6e | ||
|  | a044f9a4a4 | ||
|  | 0b7a2d7b34 | ||
|  | 07ba160119 | ||
|  | d887c86cd4 | ||
|  | 372af03d9e | ||
|  | aed6a6f142 | ||
|  | f5fa89bafe | ||
|  | 6a1d181a34 | ||
|  | dbcd8c27c5 | ||
|  | 2764be5d32 | ||
|  | d69c534614 | ||
|  | f436d6e48c | ||
|  | e49fcd12fa | ||
|  | f2699c4f1e | ||
|  | 2319243444 | ||
|  | 8e44e6625a | ||
|  | 4cd87ab08a | ||
|  | 98a125eb06 | ||
|  | 7c690695b9 | ||
|  | 066a12edaa | ||
|  | 4c0971800d | ||
|  | c375b73db9 | ||
|  | a392b84d9b | ||
|  | 34f034c6c4 | ||
|  | f5640b970b | ||
|  | b7028f20e6 | ||
|  | 0cb059e59f | ||
|  | 8d90a974c6 | ||
|  | d44b83e60d | ||
|  | ac7493fdc0 | ||
|  | c6c2553b42 | ||
|  | 7d5460f8d1 | ||
|  | f9fa8a3616 | ||
|  | 6c117df0a3 | ||
|  | b8bf08eace | ||
|  | 027af76d5d | ||
|  | b7eee599f4 | ||
|  | 42a350156a | ||
|  | f382b70cdf | ||
|  | f753929e87 | ||
|  | b3c5ab0b4e | ||
|  | 9d8adcc511 | ||
|  | 1afa9ce697 | ||
|  | b91edac0ba | ||
|  | 5d6f031973 | ||
|  | 72c56ee337 | ||
|  | 72498a200a | ||
|  | 1e9e95754c | ||
|  | eb99cd895c | ||
|  | 5625cf5254 | ||
|  | 9c6dc0a2f8 | ||
|  | 3458874a68 | ||
|  | 4e93b43d8d | ||
|  | b895545ec3 | ||
|  | 92316c4d83 | ||
|  | af71409cab | ||
|  | df5a60d946 | ||
|  | 0181ab1c03 | ||
|  | 1a5ccca67a | ||
|  | 99e1a90729 | ||
|  | 54e11e96e9 | ||
|  | b339a776fc | ||
|  | db1a84b490 | ||
|  | 3256b4f627 | ||
|  | c16ab349b1 | ||
|  | a981cb72d0 | ||
|  | 5251a5f195 | ||
|  | 917d5d2dd2 | ||
|  | 983f6caf46 | ||
|  | c9a58e9d57 | ||
|  | c5fd24496f | ||
|  | 0d502933ae | ||
|  | cc4bb3a5ec | ||
|  | b42f82ecb1 | ||
|  | b6beaae7da | ||
|  | e698900497 | ||
|  | bbad2fc1ba | ||
|  | e9f5087eb6 | ||
|  | c1caa22524 | ||
|  | 5303903f89 | ||
|  | 27d520e42a | ||
|  | 8607f4af57 | ||
|  | f0ec8bd5b9 | ||
|  | 9007e264cf | ||
|  | 529bd6fa33 | ||
|  | eb8827bdf2 | ||
|  | be78d91a07 | ||
|  | 20b7008994 | ||
|  | 84d7b1d4ba | ||
|  | 0154ed46e8 | ||
|  | 5a11fa4704 | ||
|  | 8b9e153ac4 | ||
|  | badc7366c2 | ||
|  | 24ef479913 | ||
|  | 1dd94a7d82 | ||
|  | 40d5d92dbc | ||
|  | 0cc3433d6d | ||
|  | 0e157af8d9 | ||
|  | 0e719c2b86 | ||
|  | 82fd336792 | ||
|  | e733dc90d8 | ||
|  | 9985d80432 | ||
|  | 7177a781dc | ||
|  | 498558c2b1 | ||
|  | c8e6795a90 | ||
|  | 1edc51c067 | ||
|  | 6f7054c4b2 | ||
|  | 03d2a3a685 | ||
|  | 1d4dccf454 | ||
|  | cb93890d13 | ||
|  | f39b2801b8 | ||
|  | 073a8f5fbd | ||
|  | 669c19882a | ||
|  | 43ca6437ab | ||
|  | e61a1ea582 | ||
|  | a477655270 | ||
|  | 88e1acfdff | ||
|  | 39e1dcb900 | ||
|  | 2489b93de8 | ||
|  | 8eb25a911d | ||
|  | 2d5e91b853 | ||
|  | 4f8c68c40d | ||
|  | 9a5c66a311 | ||
|  | 69bb6a74b8 | ||
|  | 7aa5fc91cf | ||
|  | de0b53de62 | ||
|  | a1df18e3ca | ||
|  | 6a4c85245d | ||
|  | 52a121c9ed | ||
|  | 2acda695ba | ||
|  | 89953d9e84 | ||
|  | 7054a0eded | ||
|  | 6105e16b28 | ||
|  | eb9d0dbbd4 | ||
|  | 567b074792 | ||
|  | 416c70f5e5 | ||
|  | 30681dfa2c | ||
|  | c5b78ffa99 | ||
|  | cb5e859c34 | ||
|  | 4470fb4312 | ||
|  | da11fad696 | ||
|  | 72ae4b2b53 | ||
|  | b8e72039b9 | ||
|  | 878ccd5128 | ||
|  | 45e0946b6b | ||
|  | b57af55b8a | ||
|  | 677ee5da91 | ||
|  | a6526ccc13 | ||
|  | 8323593720 | ||
|  | dd00a69018 | ||
|  | 4d7ddf3d9e | ||
|  | fbc39a41f8 | ||
|  | 3e934a8527 | ||
|  | bc474724c6 | ||
|  | 553eccf029 | ||
|  | 63e344d6cf | ||
|  | 0dc992561e | ||
|  | 77006d5736 | ||
|  | 359f5583a6 | ||
|  | 58dbb1c7ef | ||
|  | 47ac8238f7 | ||
|  | fa760b702c | ||
|  | 2a6ebe2c04 | ||
|  | 3e97faa704 | ||
|  | a9e82676c7 | ||
|  | d755fd9c08 | ||
|  | c4f1d7bccb | ||
|  | b55ebe95d9 | ||
|  | cb5c0d5ebe | ||
|  | 404f583dc2 | ||
|  | 19cd5638ba | ||
|  | b917552ca5 | ||
|  | 71deb14c85 | ||
|  | e9c1041d9b | ||
|  | ffece005c5 | ||
|  | ff5d22adbe | ||
|  | aaffe1b208 | ||
|  | b86d2466d2 | ||
|  | c2230d0462 | ||
|  | dc4e4aa9c7 | ||
|  | 56e5b4e529 | ||
|  | 3577812dd1 | ||
|  | 256c42833a | ||
|  | 372a9075d7 | ||
|  | 9a5d0db3d4 | ||
|  | 82fe952d7f | ||
|  | da8382236f | ||
|  | 4d2d03b8fc | ||
|  | b025e6bb88 | ||
|  | 521bbd4ea5 | ||
|  | 95d5d42608 | ||
|  | 90884d8877 | ||
|  | 62258be400 | ||
|  | 8cbdce1d5b | ||
|  | 9099d59c08 | ||
|  | f6bcc37168 | ||
|  | 0db1ddc788 | ||
|  | 93821c8991 | ||
|  | 195c4ca3e5 | ||
|  | f6023ebbd0 | ||
|  | 41dde0e516 | ||
|  | 07b1719b17 | ||
|  | d31399702b | ||
|  | 601e220b18 | ||
|  | 246e580bb5 | ||
|  | e141267cfb | ||
|  | eb21f33f99 | ||
|  | f91ddaeec7 | ||
|  | afc432078c | ||
|  | 4ba30fcfec | ||
|  | d7fd99cad6 | ||
|  | eaab2a3ec4 | ||
|  | 1f938457db | ||
|  | 855a9d5224 | ||
|  | d1a9531175 | ||
|  | 58aacd3f28 | ||
|  | 4aee2732bc | ||
|  | 24a3468928 | ||
|  | dff7502a92 | ||
|  | c34f4bff08 | ||
|  | 5753cd4877 | ||
|  | 0949cf254f | ||
|  | 935a68d871 | ||
|  | 7592556e4d | ||
|  | e3f06cbdd4 | ||
|  | 5397482ca3 | ||
|  | eafb5d9f7f | ||
|  | 5efbb38270 | ||
|  | c4603e1230 | ||
|  | c6fd31564d | ||
|  | c4d72d3c11 | ||
|  | d7ce10001b | ||
|  | 4220a3fedd | ||
|  | 65100a18d2 | ||
|  | d913b0910b | ||
|  | 968184fa7a | ||
|  | 7e2d300017 | ||
|  | 6cf86a4797 | ||
|  | feb5eac02e | ||
|  | a107d4f17f | ||
|  | 5e4c7719ff | ||
|  | 00d30fe26b | ||
|  | f2083ed5e9 | ||
|  | 6ac98d02a7 | ||
|  | 8baf4ffd2f | ||
|  | 632357ff9d | ||
|  | 074714180b | ||
|  | bd62b7a9bf | ||
|  | 49723d05cf | ||
|  | f75422a412 | ||
|  | 5e8f35c94e | ||
|  | 15eb88e922 | ||
|  | 9a299b758a | ||
|  | 21afc26b68 | ||
|  | 5c68b47a29 | ||
|  | adff739a5d | ||
|  | 0da3d8b231 | ||
|  | 3c17e74f6d | ||
|  | bf35983ebb | ||
|  | cc31b325ea | ||
|  | 7c0eb464c1 | ||
|  | 8884ca09fa | ||
|  | 287f0d8909 | ||
|  | 26c20e2262 | ||
|  | b062582d15 | ||
|  | fb66e49a1f | ||
|  | 79e37f2c18 | ||
|  | 9ab1dae553 | ||
|  | c5ad0b4bec | ||
|  | 606d1012d3 | ||
|  | 45f2d98f3c | ||
|  | 5cf15a9b11 | ||
|  | 178aa9d32f | ||
|  | 29f181f9bf | ||
|  | 86c5cccb08 | ||
|  | ea8af83d61 | ||
|  | d303067deb | ||
|  | 6e817e2d7c | ||
|  | 16277f803c | ||
|  | ef55e10ff2 | ||
|  | aaccd648b3 | ||
|  | 9596cbd85a | ||
|  | 5b6320b61a | ||
|  | 4de4fdc0d1 | ||
|  | 77a0c9f341 | ||
|  | fc7859dc27 | ||
|  | 39d6b0525f | ||
|  | 51e091ded6 | ||
|  | 52407848c1 | ||
|  | a6e2511e6b | ||
|  | 422f3ba8c8 | ||
|  | 276282e847 | ||
|  | 7782e27cc5 | ||
|  | 4f0a178984 | ||
|  | 28ddda4635 | ||
|  | 36e20ec396 | ||
|  | 22e65227fb | ||
|  | 9ea68b66f7 | ||
|  | 7d93692468 | ||
|  | 93121275ae | ||
|  | 07b48b2e0d | ||
|  | 294672d946 | ||
|  | ba3f806616 | ||
|  | 9e4d99faca | ||
|  | e89648200b | ||
|  | 3c305e8a37 | ||
|  | 6cfe69634c | ||
|  | 61be3714a5 | ||
|  | 0aed615ee5 | ||
|  | 6797037bdb | ||
|  | 39f8b25fd8 | ||
|  | 96214bf3fd | ||
|  | 400cd87802 | ||
|  | 00c458db1e | ||
|  | 1454e200db | ||
|  | 752875061c | ||
|  | 78186d8a45 | ||
|  | a4ef434f11 | ||
|  | 9842c9945d | ||
|  | 6dcd97dedf | ||
|  | 549a984eab | ||
|  | aa805f81e0 | ||
|  | 93a67dadf6 | ||
|  | e9286f6ae9 | ||
|  | a31fcdb753 | ||
|  | 0edca836f0 | ||
|  | 8537f291b7 | ||
|  | 46611ec720 | ||
|  | cbc3db8100 | ||
|  | 7d5b07bf37 | ||
|  | 5bd633d5bb | ||
|  | 17fdad1d6e | ||
|  | 1ad26671b0 | ||
|  | 2dc5064409 | ||
|  | 79eec41bcd | ||
|  | 386d22a45e | ||
|  | d90fcbf7ad | ||
|  | c4e4520058 | ||
|  | dd49f01499 | ||
|  | 2c698cee71 | ||
|  | 87cb4b6d18 | ||
|  | 2b7c747209 | ||
|  | 707308b490 | ||
|  | ed1012bf07 | ||
|  | cc5b2bc27b | ||
|  | a1a7cfa735 | ||
|  | 4624ff92df | ||
|  | 47dde98728 | ||
|  | 6f1031e95b | ||
|  | d5245e3784 | ||
|  | d97e72edb6 | ||
|  | 23b9e9ef5f | ||
|  | 02c7b86f85 | ||
|  | f796b6b40d | ||
|  | 528454c361 | ||
|  | 9ae3f7e61d | ||
|  | dd33922810 | ||
|  | b52fdb3155 | ||
|  | edf9f9e714 | ||
|  | 38eda6ed3c | ||
|  | 32f0c5dc09 | ||
|  | b45b45b1b3 | ||
|  | f1c60b7177 | ||
|  | 2d8ff826f3 | ||
|  | d028db1ba3 | ||
|  | 2d4e2b87bc | ||
|  | 1d7a75c7b3 | ||
|  | 65584a953d | ||
|  | 4cbd19d2e5 | ||
|  | a59b59fea4 | ||
|  | 5c063a9de3 | ||
|  | 3666a7d7bd | ||
|  | 8250112c7f | ||
|  | 30957f4105 | ||
|  | eade2e279e | ||
|  | b4489b9402 | ||
|  | a67b7c80c1 | ||
|  | dfc0cdd0fa | ||
|  | d6faf5b074 | ||
|  | 44ffa6a3b0 | ||
|  | 168b78d9d7 | ||
|  | bd8f313ccb | ||
|  | 4a0fc3d566 | ||
|  | 8d04d17e39 | ||
|  | 9f44b1e783 | ||
|  | 1b15271fe2 | ||
|  | f451d3203c | ||
|  | c713d38c19 | ||
|  | 4d51f9d097 | ||
|  | 8750341862 | ||
|  | 3a4fe086ea | ||
|  | 212e457c4c | ||
|  | 790e2b534f | ||
|  | 48414f0ce9 | ||
|  | b5c3e75f10 | ||
|  | 548e07ce17 | ||
|  | 0aa0c6866c | ||
|  | 3d4cf7df26 | ||
|  | c4ba180a0c | ||
|  | bd392b91b7 | ||
|  | 042f7b0502 | ||
|  | 0fc5f0ee7d | ||
|  | 8cbef669b1 | ||
|  | f9004fb14c | ||
|  | 40a42c65c1 | ||
|  | e14030e369 | ||
|  | c6cef191a7 | ||
|  | 6ca9f83bfe | ||
|  | b3fcdc5f40 | ||
|  | c6591cc11a | ||
|  | e31ba479b2 | ||
|  | 659b668012 | ||
|  | d69944dd8c | ||
|  | a25111e411 | ||
|  | 6866d5d3fa | ||
|  | 21b3d1c521 | ||
|  | f2bdd1cc49 | ||
|  | 9f09794ae6 | ||
|  | 6a1fb3d829 | ||
|  | 631b9768af | ||
|  | a2d9db85cb | ||
|  | 4cb9d0b50a | ||
|  | 73f37ef289 | ||
|  | dbda19a209 | ||
|  | 0d7de7bbc0 | ||
|  | 649b78611c | ||
|  | 22a21d76a4 | ||
|  | 5668a74aef | ||
|  | 482638601a | ||
|  | 1bfe518f74 | ||
|  | eeb5ba40fb | ||
|  | 33bd912476 | ||
|  | 33f1084f0a | ||
|  | e8a9b7cae3 | ||
|  | f6b1d9c493 | ||
|  | 624c34b378 | ||
|  | bc6753e5bf | ||
|  | c539debc84 | ||
|  | 830f4cec0f | ||
|  | 03dd9e6e83 | ||
|  | e8d1c90182 | ||
|  | 0933dc1afa | ||
|  | 610b7fe95c | ||
|  | a6bf6f901f | ||
|  | ca2e37e852 | ||
|  | d1ffaaa327 | ||
|  | 8b7f551505 | ||
|  | 759b3f8fcd | ||
|  | 9ec56f1dfa | ||
|  | 84e997949f | ||
|  | f82bd45fec | ||
|  | 3863724007 | ||
|  | 7e0ed9fe93 | ||
|  | 945e3f3c5f | ||
|  | 6f100219f7 | ||
|  | 89688394f8 | ||
|  | 091ef6d972 | ||
|  | e501c44985 | ||
|  | bc9b761903 | ||
|  | dfb461b05c | ||
|  | 86f6a2f722 | ||
|  | 77d6d0d5be | ||
|  | 4946909c6d | ||
|  | 2439736cb4 | ||
|  | 8fb2ad1986 | ||
|  | 1d7bbcec66 | ||
|  | 6ac9d34aac | ||
|  | 3369029e9a | ||
|  | 11f411b745 | ||
|  | 9bb6e15900 | ||
|  | d2a6b37f5f | ||
|  | 0c1f6163f7 | ||
|  | 6860317a58 | ||
|  | 77257b0989 | ||
|  | 8f35da5163 | ||
|  | 82d8c40b5f | ||
|  | dbfc0f98c3 | ||
|  | ca15bf4a92 | ||
|  | 3e4d4cc002 | ||
|  | 4257544402 | ||
|  | 83d44bd03e | ||
|  | 745e0685a4 | ||
|  | d6db2128df | ||
|  | 6e83ed5654 | ||
|  | a4f44933ec | ||
|  | fe080e1d90 | ||
|  | dd462873d2 | ||
|  | 628fec2c92 | ||
|  | c4700f3cb8 | ||
|  | fac606c475 | ||
|  | 5a0aadabc1 | ||
|  | 283b9871cb | ||
|  | f9d88cc2a0 | ||
|  | c751810b84 | ||
|  | 2dbc9c39b1 | ||
|  | a9933c7764 | ||
|  | ffcac3a12d | ||
|  | a4130e5f78 | ||
|  | de8f8b7d91 | ||
|  | b8c58b12fd | ||
|  | 4af355e1f9 | ||
|  | 0e7e9d5643 | ||
|  | fafadc3333 | ||
|  | 752c92bb21 | ||
|  | 45d7b284e3 | ||
|  | 085fca7e31 | ||
|  | 8744114790 | ||
|  | c658a764d0 | ||
|  | 6a07ba850c | ||
|  | c4e29e74b2 | ||
|  | 40bca8b38c | ||
|  | 18af881fe5 | ||
|  | dfd97d9fc5 | ||
|  | ebd2c329ff | ||
|  | 265b169d43 | ||
|  | d154b1464f | ||
|  | a32ea6e5f8 | ||
|  | d7b21bf07e | ||
|  | d120790da7 | ||
|  | bd854d29a4 | ||
|  | d06e3db90b | ||
|  | 5ada533b06 | ||
|  | 6f5e648751 | ||
|  | 9ee5b3eaf3 | ||
|  | 0560da246b | ||
|  | 8b6b3ee3b8 | ||
|  | 45fe83951a | ||
|  | 57e5d8911d | ||
|  | 5768a766b8 | ||
|  | 051e9e38f3 | ||
|  | 63a5954dfa | ||
|  | 897931f273 | ||
|  | 03e80b2f1c | ||
|  | 53c8ec864c | ||
|  | 5d3002f118 | ||
|  | 5eeb52660c | ||
|  | 3dfafaa278 | ||
|  | 462bd9ae5e | ||
|  | dab0fcc7c0 | ||
|  | b8a3e8085e | ||
|  | c9d1d72ba3 | ||
|  | ccf5d513d2 | ||
|  | d157b7b05d | ||
|  | 05981ac46c | ||
|  | 08615a5954 | ||
|  | b6dbe26c7e | ||
|  | 4f0d61b379 | ||
|  | 9e5e494f88 | ||
|  | b15fd05e8d | ||
|  | faabc28d1b | ||
|  | 4b815846ee | ||
|  | fe8be18c4c | ||
|  | 519c30321d | ||
|  | 77be88a5bb | ||
|  | 8d04931f9f | ||
|  | 3d1ee7a43e | ||
|  | 2584a25527 | ||
|  | 0647a82d38 | ||
|  | c56459c98c | ||
|  | 7b0a4a057d | ||
|  | 3c3e520594 | ||
|  | ce1daf6a2b | ||
|  | 68314cd44d | ||
|  | 17787b97d4 | ||
|  | da84297b2c | ||
|  | e3e3bb770d | ||
|  | 9d4f180741 | ||
|  | 316836d9f6 | ||
|  | aa3b0a117a | ||
|  | 0f7df3281f | ||
|  | 4a91a35799 | ||
|  | 36c2263675 | ||
|  | 28068d8d31 | ||
|  | 0c3c08db36 | ||
|  | bb5d62fe69 | ||
|  | 376270dd53 | ||
|  | 9056b23eaa | ||
|  | 634be4ae51 | ||
|  | 422620f4fe | ||
|  | 194b9b1193 | ||
|  | 27fceb3f41 | ||
|  | 930e0bcd67 | ||
|  | d81e0a3ed4 | ||
|  | ebb5c17be4 | ||
|  | 1e99fe5b04 | ||
|  | 5f5f22c82b | ||
|  | 709e300960 | ||
|  | d2f677d84e | ||
|  | 18d90c44dd | ||
|  | 298f77f52e | ||
|  | 70b2f7efb4 | ||
|  | 78a070bd99 | ||
|  | c88ff973b1 | ||
|  | 66f82f764d | ||
|  | d36a18c17a | ||
|  | 8efd95346a | ||
|  | 04b91377c9 | ||
|  | f5d04d989c | ||
|  | 06a497f346 | ||
|  | b1cf706a8f | ||
|  | 91f04e36e9 | ||
|  | 5d76eec0f6 | ||
|  | 7822325866 | ||
|  | 521123f139 | ||
|  | b3f511b025 | ||
|  | ff63840beb | ||
|  | 1fbcf4aa5f | ||
|  | 8d6a811204 | ||
|  | 08fe2a9e27 | ||
|  | d8465f4374 | ||
|  | 8a3cd14723 | ||
|  | 08c1671f21 | ||
|  | 91e794add1 | ||
|  | 9c98caf21d | ||
|  | f97c42017f | ||
|  | 3033a2cb95 | ||
|  | bcf6f48d46 | ||
|  | 4c97f15a65 | ||
|  | 5dc6349818 | ||
|  | 6ab5c4012a | ||
|  | 1d50e45777 | ||
|  | 3cbf420acd | ||
|  | ea407b2182 | ||
|  | 5228885760 | ||
|  | 676845aaf3 | ||
|  | 61af9b3810 | ||
|  | 406a433c3f | ||
|  | 2abd413c08 | ||
|  | ad96c9bb9f | ||
|  | b412d54998 | ||
|  | 6247d3c5e6 | ||
|  | b7ee513dfd | ||
|  | 3795abc19e | ||
|  | 1d32a4d984 | ||
|  | a20a78cd64 | ||
|  | a2f51b36ec | ||
|  | 910ccb273a | ||
|  | 2cbe39e553 | ||
|  | 994c8fc02d | ||
|  | 57dcd6d520 | ||
|  | 20ade1de7b | ||
|  | 28aff78469 | ||
|  | 3b95e56418 | ||
|  | 056055bf0b | ||
|  | 368d329459 | ||
|  | 2fe1ffeaf1 | ||
|  | e252e8eb1d | ||
|  | e160bcc7d5 | ||
|  | 41bd035690 | ||
|  | b0003fc7e5 | ||
|  | 8e1be97589 | ||
|  | 181f2f38d8 | ||
|  | 661940114e | ||
|  | 9874d4bec5 | ||
|  | 7d5fedf35f | ||
|  | 69ad36a9ae | ||
|  | ce5fcaf172 | ||
|  | a00137d742 | ||
|  | e002842640 | ||
|  | 41e9c46cba | ||
|  | bc2d58bee3 | ||
|  | c54de27503 | ||
|  | d9bfd77fba | ||
|  | 336cc0077c | ||
|  | 0be673b210 | ||
|  | 028e2498fb | ||
|  | 249f1dea9d | ||
|  | 07c7b22669 | ||
|  | 6623058a18 | ||
|  | 68e4d569d0 | ||
|  | 7186b25a69 | ||
|  | 42cacb18bd | ||
|  | d09c03f4d2 | ||
|  | ad240b150e | ||
|  | 1177ef6f8d | ||
|  | 2ff50c0c56 | ||
|  | 4f4ed1307f | ||
|  | 6d5b7cb64e | ||
|  | 00fc4e3890 | ||
|  | 7344ee4402 | ||
|  | 740eacc7ac | ||
|  | 8b1bcf21ee | ||
|  | b0a5174c0a | ||
|  | b7cca1b95b | ||
|  | 44c51f1246 | ||
|  | 516d43d7a8 | ||
|  | 86d49d563e | ||
|  | a2911a9585 | ||
|  | 9a12b651f9 | ||
|  | 9fa631acca | ||
|  | 8df7998a83 | ||
|  | c81c1926c0 | ||
|  | 7ab1288424 | ||
|  | 3ee88adfa9 | ||
|  | 29e8c99b4f | ||
|  | 8b115f8156 | ||
|  | 11c546f113 | ||
|  | c087539eb7 | ||
|  | 27f7cbb892 | ||
|  | 11ffb09b66 | ||
|  | 114f9f522d | ||
|  | 91dc51d59a | ||
|  | 11b3922b02 | ||
|  | 05552cc3e5 | ||
|  | 3db7964509 | ||
|  | 2a06adcabb | ||
|  | 8cec3354ea | ||
|  | f9df728f45 | ||
|  | 46eead34c4 | ||
|  | 786b35fee2 | ||
|  | 5c6c609991 | ||
|  | 0be8fedf26 | ||
|  | 1f9aaf1ac0 | ||
|  | 3926de3fa1 | ||
|  | 9086f18413 | ||
|  | ad2576bc76 | ||
|  | 4523407d9d | ||
|  | 53162ac934 | ||
|  | 1dac51d4ba | ||
|  | 13deef3416 | ||
|  | b887bebb26 | ||
|  | d51160babb | ||
|  | 44b9e7a398 | ||
|  | 065cd113c1 | ||
|  | a5f618b7e4 | ||
|  | a06e4e862d | ||
|  | 084c858446 | ||
|  | 5d889d4d95 | ||
|  | f589e094b2 | ||
|  | 2eff798d74 | ||
|  | 239cecff9e | ||
|  | fa36af454e | ||
|  | 458d0f7a1b | ||
|  | f1f27ffd33 | ||
|  | 4a2e09e8eb | ||
|  | 4b3fada646 | ||
|  | 690befc98b | ||
|  | c6b3c0f9eb | ||
|  | b423a71b38 | ||
|  | e226773066 | ||
|  | 98918d160a | ||
|  | 969298fb58 | ||
|  | bc60f3b45a | ||
|  | f7a4785d22 | ||
|  | 1bf41cbfd7 | ||
|  | e9d80423ae | ||
|  | 928ffbd7af | ||
|  | 25ebad2448 | ||
|  | dd951dc0ed | ||
|  | aed9e44b6b | ||
|  | 1fa2547aff | ||
|  | 164ceb845e | ||
|  | ce463686dc | ||
|  | 92aa28cac2 | ||
|  | f8674230ed | ||
|  | 326969e488 | ||
|  | 155e8c2a4b | ||
|  | 7f95f6b43f | ||
|  | b2d7ba1a65 | ||
|  | b550bbbd08 | ||
|  | cc79977ac0 | ||
|  | 4cbb75df60 | ||
|  | 7d8926659e | ||
|  | 37ca3f74c7 | ||
|  | 56cbf39d59 | ||
|  | a783e7f500 | ||
|  | 2f4ac42684 | ||
|  | ec689e100e | ||
|  | 6f0909d992 | ||
|  | 0092dec49e | ||
|  | 3447689c19 | ||
|  | d4563fd842 | ||
|  | d2ecec6009 | ||
|  | 26f26aec50 | ||
|  | 34dfc2767f | ||
|  | bc3d3cabce | ||
|  | 23d80b93ae | ||
|  | 0d59d3d195 | ||
|  | 192427cf80 | ||
|  | 98e4094d70 | ||
|  | e88b939866 | ||
|  | aed5a02ee1 | ||
|  | 9f1e1bb2b6 | ||
|  | 15e9383d0b | ||
|  | 4ec056900c | ||
|  | 983feb59b0 | ||
|  | 8b2ce33f83 | ||
|  | 44b452b30b | ||
|  | f60c9981b8 | ||
|  | 7c3df93580 | ||
|  | 601d7dfcf8 | ||
|  | 41cb53a550 | ||
|  | 87c13ae20c | ||
|  | c30482af66 | ||
|  | 5f4f2f10d7 | ||
|  | ae630a0e18 | ||
|  | c66931cb12 | ||
|  | fb2dbe25cd | ||
|  | bf4831be9f | ||
|  | 0f83082cf0 | ||
|  | fbfde604e7 | ||
|  | 5e2dfbed73 | ||
|  | 571602d3de | ||
|  | 85693f2577 | ||
|  | 60bc8ad888 | ||
|  | 9bf309eb5c | ||
|  | eeddfa87b6 | ||
|  | 861fe2466c | ||
|  | 3a2cce78ca | ||
|  | 4e01f1de0d | ||
|  | 4f0a5e854c | ||
|  | c669a9c808 | ||
|  | e4d827256f | ||
|  | 1c1ad2725e | ||
|  | d18e54c5a3 | ||
|  | 7a885e23d3 | ||
|  | 33dde3a465 | ||
|  | 8d4ac59f03 | ||
|  | 4fbfc492ce | ||
|  | ac1fb71bc5 | ||
|  | 01d6b37b83 | ||
|  | 2284b4dce1 | ||
|  | b92f80e6be | ||
|  | bd5596fa30 | ||
|  | 4614b63c30 | ||
|  | cf41b6cbb2 | ||
|  | 87f3e0e291 | ||
|  | 1997abcde6 | ||
|  | 8b761298ee | ||
|  | df0356b841 | ||
|  | dc158ebff4 | ||
|  | f8192b90f4 | ||
|  | 5237049e2c | ||
|  | 9d70fb261e | ||
|  | 8370b8a743 | ||
|  | 25656d81a1 | ||
|  | be97791428 | ||
|  | 18b683d22e | ||
|  | 34e9742f71 | ||
|  | 087eb7777e | ||
|  | c469c5e3a1 | ||
|  | 485c29bb49 | ||
|  | aa0cf150bd | ||
|  | 91c52e91cd | ||
|  | a1f4014738 | ||
|  | 8a136ac4f6 | ||
|  | ea43b3dc6a | ||
|  | 57fc787819 | ||
|  | a0164b8de3 | ||
|  | 9df35c1814 | ||
|  | 9d2a5fee86 | ||
|  | a6b2e932fa | ||
|  | 05aaa2634b | ||
|  | 2c98f5c542 | ||
|  | d246fca9df | ||
|  | c79feb405c | ||
|  | b1145f8da3 | ||
|  | 3588d681a2 | ||
|  | 55d894ae1f | ||
|  | 0509caf432 | ||
|  | 5d1d807e78 | ||
|  | 22ba38b2e0 | ||
|  | 42f858267c | ||
|  | 5b1a3173f8 | ||
|  | 97822bd9a8 | ||
|  | b926f5a692 | ||
|  | 191dfdf13f | ||
|  | a100f1fe1e | ||
|  | 471ccf281c | ||
|  | 6c959be188 | ||
|  | 010887f18f | ||
|  | e4b5e4c502 | ||
|  | 2de3b4f92e | ||
|  | 225a93330d | ||
|  | 41b36649a9 | ||
|  | 55c26ab1c4 | ||
|  | 8b1e60a1fd | ||
|  | ed0f38748b | ||
|  | 7d75a720ca | ||
|  | 5a38db166f | ||
|  | 3c9fb79263 | ||
|  | 98d5a2dad9 | ||
|  | 4ab8b4984d | ||
|  | f741ad058e | ||
|  | 2512a4fc32 | ||
|  | 5554d5e608 | ||
|  | 48d5ed2ff9 | ||
|  | 2632668d0e | ||
|  | f46e444aa2 | ||
|  | 1149ad86a2 | ||
|  | e1398d98b0 | ||
|  | 8133e2b7aa | ||
|  | ebe678b18b | ||
|  | 509217606c | ||
|  | 6fb694669c | ||
|  | 5a63172a86 | ||
|  | 93dcc7e242 | ||
|  | 243eea33e9 | ||
|  | 38a8367f62 | ||
|  | a02953cccc | ||
|  | f13f96967e | ||
|  | f7c31281e0 | ||
|  | ac34a43d9b | ||
|  | c8d0950979 | ||
|  | a4ff59eccb | ||
|  | c3a50f9442 | ||
|  | 57e81ee72e | ||
|  | 05df0a37b1 | ||
|  | 25f2c3a8c1 | ||
|  | c3aa12db78 | ||
|  | a3bd7cc644 | ||
|  | 5a186b6960 | ||
|  | 639588fa68 | ||
|  | f9510c54b2 | ||
|  | 3a8ddf8025 | ||
| a2801ea88c | |||
|  | c2aae7ee18 | ||
|  | 9d0804eff4 | ||
|  | 6ff84b3693 | ||
|  | b641e0282b | ||
|  | 37a467cabc | ||
|  | e01a7110ac | ||
|  | 5dad5de548 | ||
|  | 295325a20b | ||
|  | df0a9bac96 | ||
|  | cf9cef6f87 | ||
|  | f92814b24b | ||
|  | 331b59cd1e | ||
|  | ed6d211aff | ||
|  | a8f1469d36 | ||
|  | 74cb332706 | ||
|  | 89165369b1 | ||
|  | a54e3d33a6 | ||
|  | 0f17984f41 | ||
|  | 6527ceb913 | ||
|  | 64a57ba837 | ||
|  | 74da9330f8 | ||
|  | 4fa1dd6860 | ||
|  | e55effc9ca | ||
|  | 924b862f7c | ||
|  | 5f077762d5 | ||
|  | 1b0ec50711 | ||
|  | 22f320f1c4 | ||
|  | 9949476584 | ||
|  | 1b5b170557 | ||
|  | 925a3a4bdb | ||
|  | 720fe9f95f | ||
|  | 7c4f8e1443 | ||
|  | 79d24dff46 | ||
|  | 928435a31d | ||
|  | 26ac92eaa3 | ||
|  | 2974c08b08 | ||
|  | 5a7b0b3050 | ||
|  | cc2d9bbdd1 | ||
|  | e912152784 | ||
|  | d00681f623 | ||
|  | 52942c3d2a | ||
|  | dedabdd8d8 | ||
|  | 3061499860 | ||
|  | 20f18755ed | ||
|  | 333f2aba54 | ||
|  | 1cb673ed80 | ||
|  | 57e0bc784a | ||
|  | 425afa93da | ||
|  | 259b2cebc7 | ||
|  | 06589826c8 | ||
|  | 2245cd982a | ||
|  | 065b50769f | ||
|  | d1e99852bc | ||
|  | bf8f6ae687 | ||
|  | 4ad6805ea1 | ||
|  | 4f4e3f0b89 | ||
|  | b51f2c1ec8 | ||
|  | 1bec06fd75 | ||
|  | 451d2e2d1d | ||
|  | 9cee12f9f4 | ||
|  | f5d6011a77 | ||
|  | 64b2ff19ea | ||
|  | 9c17a64773 | ||
|  | 69c877ff66 | ||
|  | ac557ffedc | ||
|  | b1e41bc583 | ||
|  | a144395ec9 | ||
|  | 0cf9d05489 | ||
|  | 0e6c0a41d0 | ||
|  | 8a83652d08 | ||
|  | 91ee72a8d6 | ||
|  | 91b1c8c13c | ||
|  | 26effeabe6 | ||
|  | 611c9740ed | ||
|  | 2a048c3228 | ||
|  | f4fd83d999 | ||
|  | cf68585808 | ||
|  | 9f9e926cff | ||
|  | 9dc0dd75fd | ||
|  | 9f285710f8 | ||
|  | ee1c448327 | ||
|  | e85bf1713e | ||
|  | 7341c71277 | ||
|  | d579863311 | ||
|  | c79cfc19aa | ||
|  | 997a6be267 | ||
|  | 762bb3006d | ||
|  | 07f2bd8cab | ||
|  | daf83db9b3 | ||
|  | 55c6e19af4 | ||
|  | 9cadc94c5a | ||
|  | cacdf9ef56 | ||
|  | a3042fc6c0 | ||
|  | 3efd492525 | ||
|  | 55a5cbc356 | ||
|  | 2887b024ab | ||
|  | 917303edb9 | ||
|  | c712c15a30 | ||
|  | 0c541db8e0 | ||
|  | 603b1520d7 | ||
|  | c7eb8ad5c8 | ||
|  | 0b285aa7f4 | ||
|  | e8665bd00c | ||
|  | fb4eaa4332 | ||
|  | 874a9eae76 | ||
|  | 8230520956 | ||
|  | 66da9675f1 | ||
|  | 61ff48c005 | ||
|  | 5fc8a1e52a | ||
|  | df1ac74069 | ||
|  | 91f718bf38 | ||
|  | 46e987e393 | ||
|  | a59b4f7be7 | ||
|  | ca66e3c35c | ||
|  | 31e2ad8cba | ||
|  | 320f32895a | ||
|  | d4db131d3c | ||
|  | 27c2c9045e | ||
|  | f97b7c7d62 | ||
|  | 9eb33d31ac | ||
|  | 6dd84d6fc2 | ||
|  | daddd60581 | ||
|  | e832723ee4 | ||
|  | 35f4a63c0e | ||
|  | 28478ea4ac | ||
|  | 0f93a68694 | ||
|  | 1a2d5d13b3 | ||
|  | 5f2894fc5b | ||
|  | 66cb39dce2 | ||
|  | d44c871c54 | ||
|  | dff0378ba8 | ||
|  | 4f7b1b7140 | ||
|  | 662514304b | ||
|  | 0913e9e0c0 | ||
|  | d403733627 | ||
|  | fae5b439d0 | ||
|  | bc66de6d85 | ||
|  | 57e598156c | ||
|  | b570e44ee4 | ||
|  | b115d0b55b | ||
|  | 03fc1419de | ||
|  | 8b71c0d737 | ||
|  | a833aa0a00 | ||
|  | 52332b04ac | ||
|  | 529488cab0 | ||
|  | b2429a7ca3 | ||
|  | 0bce12d3b4 | ||
|  | 75f557cb18 | ||
|  | 035dd1fad1 | ||
|  | d2df79a665 | ||
|  | 103e0a13bb | ||
|  | d1b5eec84a | ||
|  | 6b1e6b31ed | ||
|  | f6f6db913e | ||
|  | ec0a6416fd | ||
|  | 1787402be9 | ||
|  | 5f6d99f138 | ||
|  | d1e2b0d1f8 | ||
|  | c2c51bbe33 | ||
|  | bb806e3853 | ||
|  | a11d0e75c8 | ||
|  | 5406ff0ea3 | ||
|  | c88317b44a | ||
|  | 6898062d66 | ||
|  | 6e1f264e6a | ||
|  | 082be14232 | ||
|  | 231aa44d03 | ||
|  | cdb12f35d4 | ||
|  | e831ee8b44 | ||
|  | 40e9a6082f | ||
|  | 53cec292d0 | ||
|  | 3f85309ee5 | ||
|  | 70944f8521 | ||
|  | 2ab00c42ff | ||
|  | a572742caa | ||
|  | 400e5f8580 | ||
|  | 74f0fd89b6 | ||
|  | 09f9bea7a2 | ||
|  | 8bffb38117 | ||
|  | eb5d545c35 | ||
|  | a79a545730 | ||
|  | 3863dab944 | ||
|  | e53b7ecd8b | ||
|  | 7d88673ed5 | ||
|  | 41f2da71e4 | ||
|  | cb4ee0fd74 | ||
|  | 088381a5a6 | ||
|  | 629af2a697 | ||
|  | 884edfd497 | ||
|  | 83dd9e462e | ||
|  | 70a6dfd98a | ||
|  | 7f5d96382b | ||
|  | fd4d1c4bb7 | ||
|  | 7eaf3de572 | ||
|  | 4b608de3fb | ||
|  | b47e6e852b | ||
|  | a8a8ce4a36 | ||
|  | c61376d5a1 | ||
|  | d3a5bb08d3 | ||
|  | f1506d0dbd | ||
|  | 15e6d4959e | ||
|  | 41216fd1cd | ||
|  | b8786866db | ||
|  | 82bd1bead4 | ||
|  | 6e2bdcad79 | ||
|  | ef3c9f3d03 | ||
|  | 5427f24df2 | ||
|  | b374340303 | ||
|  | c78ed2c6ad | ||
|  | 3b02bc8cf1 | ||
|  | c7e48a7e76 | ||
|  | 77d125c03d | ||
|  | 8aa52aeefd | ||
|  | 0bab038454 | ||
|  | 6c3b49f4d0 | ||
|  | 03dd689f17 | ||
|  | c375c948c0 | ||
|  | cbcf457ce3 | ||
|  | 4855f825e2 | ||
|  | 85bc1637f2 | ||
|  | 73398b83a9 | ||
|  | 2727e66d40 | ||
|  | 8b6be5a501 | ||
|  | 4fee29307c | ||
|  | 35f8249c67 | ||
|  | d1467a14b8 | ||
|  | 3e6b9eb74d | ||
|  | ce2e8fb4b5 | ||
|  | 7eaa75c05d | ||
|  | e86de4483a | ||
|  | 203a74713f | ||
|  | 59ed2a6793 | 
| @@ -1,41 +0,0 @@ | ||||
| version: '{branch}.{build}' | ||||
| clone_depth: 1 | ||||
| skip_tags: true | ||||
|  | ||||
| environment: | ||||
|   MSYSTEM: MINGW32 | ||||
|  | ||||
| init: | ||||
|   - git config --global core.autocrlf input | ||||
|  | ||||
| install: | ||||
|   - set PATH=c:\msys64\mingw32\bin;c:\msys64\usr\bin;c:\msys64\bin;%PATH% | ||||
|   - echo %PATH% | ||||
|   - pacman -S --noconfirm --needed make ninja mingw-w64-i686-libusb mingw-w64-i686-sqlite3 mingw-w64-i686-zlib mingw-w64-i686-gcc zip | ||||
|  | ||||
| build_script: | ||||
|   - make | ||||
|   - zip -9 fluxengine.zip fluxengine.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex | ||||
|  | ||||
| artifacts: | ||||
|   - path: fluxengine.zip | ||||
|     name: fluxengine.zip | ||||
|  | ||||
| deploy: | ||||
|   release: FluxEngine Windows client version $(APPVEYOR_BUILD_NUMBER) | ||||
|   description: > | ||||
|     This is an automatically built version of the FluxEngine Windows client | ||||
|     which is generated whenever a significant checkin has happened. It's had | ||||
|     no testing whatsoever. | ||||
|  | ||||
|     To use, download it, put it somewhere, and then run it from a cmd window | ||||
|     or other command line shell. | ||||
|   provider: GitHub | ||||
|   auth_token: | ||||
|     secure: dfJjj7fWCoDUz+Ni11OcNPB/U3TNJFwNA2AsL++ChFjniUsZLlC6SDWHiL/t4FZo | ||||
|   artifact: fluxengine.zip | ||||
|   draft: false | ||||
|   prerelease: false | ||||
|   on: | ||||
|     branch: master | ||||
|  | ||||
							
								
								
									
										44
									
								
								.clang-format
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										44
									
								
								.clang-format
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,44 @@ | ||||
| --- | ||||
| AccessModifierOffset: -4 | ||||
| AlignAfterOpenBracket: DontAlign | ||||
| AlignArrayOfStructures: Left | ||||
| AlignEscapedNewlines: Left | ||||
| AllowAllArgumentsOnNextLine: 'true' | ||||
| AllowAllConstructorInitializersOnNextLine: 'false' | ||||
| AllowAllParametersOfDeclarationOnNextLine: 'true' | ||||
| AllowShortBlocksOnASingleLine: 'true' | ||||
| AllowShortCaseLabelsOnASingleLine: 'false' | ||||
| AllowShortFunctionsOnASingleLine: Empty | ||||
| AllowShortIfStatementsOnASingleLine: Never | ||||
| AllowShortLambdasOnASingleLine: None | ||||
| AllowShortLoopsOnASingleLine: 'false' | ||||
| AlwaysBreakAfterDefinitionReturnType: None | ||||
| AlwaysBreakAfterReturnType: None | ||||
| AlwaysBreakBeforeMultilineStrings: 'true' | ||||
| AlwaysBreakTemplateDeclarations: 'Yes' | ||||
| BinPackArguments: 'false' | ||||
| BinPackParameters: 'false' | ||||
| BreakBeforeBraces: Allman | ||||
| BreakConstructorInitializers: 'AfterColon' | ||||
| BreakInheritanceList: AfterColon | ||||
| BreakStringLiterals: 'true' | ||||
| ColumnLimit: '80' | ||||
| ConstructorInitializerAllOnOneLineOrOnePerLine: 'true' | ||||
| FixNamespaceComments: 'false' | ||||
| IncludeBlocks: Preserve | ||||
| IndentCaseLabels: 'true' | ||||
| IndentWidth: '4' | ||||
| IndentWrappedFunctionNames: 'false' | ||||
| KeepEmptyLinesAtTheStartOfBlocks: 'true' | ||||
| NamespaceIndentation: All | ||||
| PointerAlignment: Left | ||||
| ReflowComments: 'true' | ||||
| SortIncludes: 'false' | ||||
| SortUsingDeclarations: 'true' | ||||
| SpaceAfterTemplateKeyword: 'true' | ||||
| SpaceBeforeAssignmentOperators: 'true' | ||||
| SpaceBeforeCtorInitializerColon: 'false' | ||||
| SpaceBeforeInheritanceColon: 'true' | ||||
| SpaceBeforeParens: ControlStatements | ||||
| SpaceInEmptyParentheses: 'false' | ||||
| ... | ||||
							
								
								
									
										104
									
								
								.github/workflows/ccpp.yml
									
									
									
									
										vendored
									
									
								
							
							
						
						
									
										104
									
								
								.github/workflows/ccpp.yml
									
									
									
									
										vendored
									
									
								
							| @@ -2,40 +2,98 @@ name: C/C++ CI | ||||
|  | ||||
| on: [push] | ||||
|  | ||||
| concurrency:  | ||||
|   group: environment-${{ github.head_ref }} | ||||
|   cancel-in-progress: true | ||||
|  | ||||
| jobs: | ||||
|   build-linux: | ||||
|     runs-on: ubuntu-latest | ||||
|     runs-on: ubuntu-22.04 | ||||
|     steps: | ||||
|     - uses: actions/checkout@v1 | ||||
|     - uses: actions/checkout@v2 | ||||
|       with: | ||||
|         fetch-depth: 1 | ||||
|         repository: 'davidgiven/fluxengine' | ||||
|         path: 'fluxengine' | ||||
|     - uses: actions/checkout@v2 | ||||
|       with: | ||||
|         repository: 'davidgiven/fluxengine-testdata' | ||||
|         path: 'fluxengine-testdata' | ||||
|     - name: apt | ||||
|       run: sudo apt update && sudo apt install libusb-1.0-0-dev libsqlite3-dev ninja-build | ||||
|       run: sudo apt update && sudo apt install libudev-dev libsqlite3-dev protobuf-compiler libwxgtk3.0-gtk3-dev libfmt-dev | ||||
|     - name: make | ||||
|       run: make | ||||
|       run: CXXFLAGS="-Wp,-D_GLIBCXX_ASSERTIONS" make -j2 -C fluxengine | ||||
|  | ||||
|   build-macos: | ||||
|   build-macos-current: | ||||
|     runs-on: macos-latest | ||||
|     steps: | ||||
|     - uses: actions/checkout@v1 | ||||
|     - uses: actions/checkout@v2 | ||||
|       with: | ||||
|         fetch-depth: 1 | ||||
|         repository: 'davidgiven/fluxengine' | ||||
|         path: 'fluxengine' | ||||
|     - uses: actions/checkout@v2 | ||||
|       with: | ||||
|         repository: 'davidgiven/fluxengine-testdata' | ||||
|         path: 'fluxengine-testdata' | ||||
|     - name: brew | ||||
|       run: brew install sqlite pkg-config libusb ninja | ||||
|       run: brew install sqlite pkg-config libusb protobuf wxwidgets fmt make coreutils dylibbundler libjpeg | ||||
|     - name: make | ||||
|       run: make | ||||
|       run: gmake -j2 -C fluxengine | ||||
|  | ||||
| #  build-windows: | ||||
| #    runs-on: windows-latest | ||||
| #    steps: | ||||
| #    - uses: numworks/setup-msys2@v1 | ||||
| #      with: | ||||
| #        path-type: inherit | ||||
| #    - uses: actions/checkout@v1 | ||||
| #    - name: pacman | ||||
| #      run: | | ||||
| #        msys2do pacman -S --noconfirm --needed make ninja mingw-w64-i686-libusb mingw-w64-i686-sqlite3 mingw-w64-i686-zlib mingw-w64-i686-gcc zip | ||||
| #    - name: build | ||||
| #      run: | | ||||
| #        msys2do make | ||||
|     - name: Upload build artifacts | ||||
|       uses: actions/upload-artifact@v2 | ||||
|       with: | ||||
|         name: ${{ github.event.repository.name }}.${{ github.sha }} | ||||
|         path: fluxengine.FluxEngine.pkg | ||||
|  | ||||
|   build-windows: | ||||
|     runs-on: windows-latest | ||||
|     defaults: | ||||
|       run: | ||||
|         shell: msys2 {0} | ||||
|     steps: | ||||
|     - uses: msys2/setup-msys2@v2 | ||||
|       with: | ||||
|         update: true | ||||
|         msystem: MINGW32 | ||||
|         install: >- | ||||
|           diffutils | ||||
|           make | ||||
|           mingw-w64-i686-fmt | ||||
|           mingw-w64-i686-gcc | ||||
|           mingw-w64-i686-libusb | ||||
|           mingw-w64-i686-pkg-config | ||||
|           mingw-w64-i686-protobuf | ||||
|           mingw-w64-i686-sqlite3 | ||||
|           mingw-w64-i686-wxWidgets | ||||
|           mingw-w64-i686-zlib | ||||
|           mingw-w64-i686-nsis | ||||
|           zip | ||||
|           vim | ||||
|     - uses: actions/checkout@v2 | ||||
|       with: | ||||
|         repository: 'davidgiven/fluxengine' | ||||
|         path: 'fluxengine' | ||||
|     - uses: actions/checkout@v2 | ||||
|       with: | ||||
|         repository: 'davidgiven/fluxengine-testdata' | ||||
|         path: 'fluxengine-testdata' | ||||
|     - name: build | ||||
|       run: make -j2 -C fluxengine | ||||
|  | ||||
|     - name: nsis | ||||
|       run: | | ||||
|         cd fluxengine | ||||
|         strip fluxengine.exe -o fluxengine-stripped.exe | ||||
|         strip fluxengine-gui.exe -o fluxengine-gui-stripped.exe | ||||
|         makensis -v2 -nocd -dOUTFILE=fluxengine-installer.exe extras/windows-installer.nsi | ||||
|  | ||||
|     - name: zip | ||||
|       run: | | ||||
|         cd fluxengine | ||||
|         zip -9 fluxengine-windows.zip fluxengine.exe fluxengine-gui.exe upgrade-flux-file.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex fluxengine-installer.exe | ||||
|  | ||||
|     - name: Upload build artifacts | ||||
|       uses: actions/upload-artifact@v2 | ||||
|       with: | ||||
|         name: ${{ github.event.repository.name }}.${{ github.sha }} | ||||
|         path: fluxengine/fluxengine-windows.zip | ||||
|   | ||||
							
								
								
									
										123
									
								
								.github/workflows/release.yml
									
									
									
									
										vendored
									
									
										Normal file
									
								
							
							
						
						
									
										123
									
								
								.github/workflows/release.yml
									
									
									
									
										vendored
									
									
										Normal file
									
								
							| @@ -0,0 +1,123 @@ | ||||
| name: Autorelease | ||||
|  | ||||
| concurrency:  | ||||
|   group: environment-${{ github.head_ref }} | ||||
|   cancel-in-progress: true | ||||
|  | ||||
| on: | ||||
|   push: | ||||
|     branches: | ||||
|       - "master" | ||||
|  | ||||
| jobs: | ||||
|   dev-release: | ||||
|     runs-on: windows-latest | ||||
|     defaults: | ||||
|       run: | ||||
|         shell: msys2 {0} | ||||
|     steps: | ||||
|     - uses: msys2/setup-msys2@v2 | ||||
|       with: | ||||
|         update: true | ||||
|         msystem: MINGW32 | ||||
|         install: >- | ||||
|           diffutils | ||||
|           make | ||||
|           mingw-w64-i686-fmt | ||||
|           mingw-w64-i686-gcc | ||||
|           mingw-w64-i686-libusb | ||||
|           mingw-w64-i686-pkg-config | ||||
|           mingw-w64-i686-protobuf | ||||
|           mingw-w64-i686-sqlite3 | ||||
|           mingw-w64-i686-wxWidgets | ||||
|           mingw-w64-i686-zlib | ||||
|           mingw-w64-i686-nsis | ||||
|           zip | ||||
|           vim | ||||
|     - uses: actions/checkout@v3 | ||||
|  | ||||
|     - name: build | ||||
|       run: | | ||||
|         make -j2 | ||||
|  | ||||
|     - name: nsis | ||||
|       run: | | ||||
|         strip fluxengine.exe -o fluxengine-stripped.exe | ||||
|         strip fluxengine-gui.exe -o fluxengine-gui-stripped.exe | ||||
|         makensis -v2 -nocd -dOUTFILE=fluxengine-installer.exe extras/windows-installer.nsi | ||||
|  | ||||
|     - name: zip | ||||
|       run: | | ||||
|         zip -9 fluxengine.zip fluxengine.exe fluxengine-gui.exe upgrade-flux-file.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex | ||||
|  | ||||
|     - name: date | ||||
|       run: | | ||||
|         echo "RELEASE_DATE=$(date --rfc-3339=date)" >> ${GITHUB_ENV} | ||||
|  | ||||
|     - name: tag | ||||
|       uses: EndBug/latest-tag@latest | ||||
|       with: | ||||
|         tag-name: dev | ||||
|         force-branch: false | ||||
|       env: | ||||
|         GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} | ||||
|  | ||||
|     - name: delete-old-assets | ||||
|       uses: mknejp/delete-release-assets@v1 | ||||
|       with: | ||||
|         token: ${{ github.token }} | ||||
|         tag: dev | ||||
|         assets: |  | ||||
|           fluxengine.zip | ||||
|           fluxengine-installer.exe | ||||
|         fail-if-no-assets: false | ||||
|  | ||||
|     - name: release | ||||
|       uses: softprops/action-gh-release@v1 | ||||
|       with: | ||||
|         name: Development build ${{ env.RELEASE_DATE }} | ||||
|         files: | | ||||
|           fluxengine.zip | ||||
|           fluxengine-installer.exe | ||||
|         tag_name: dev | ||||
|       env: | ||||
|         GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} | ||||
|  | ||||
|   build-macos: | ||||
|     runs-on: macos-latest | ||||
|     steps: | ||||
|     - uses: actions/checkout@v2 | ||||
|     - name: brew | ||||
|       run: brew install sqlite pkg-config libusb protobuf wxwidgets fmt make coreutils dylibbundler libjpeg | ||||
|     - name: make | ||||
|       run: gmake | ||||
|  | ||||
|     - name: tag | ||||
|       uses: EndBug/latest-tag@latest | ||||
|       with: | ||||
|         tag-name: dev | ||||
|         force-branch: false | ||||
|       env: | ||||
|         GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} | ||||
|  | ||||
|     - name: delete-old-assets | ||||
|       uses: mknejp/delete-release-assets@v1 | ||||
|       with: | ||||
|         token: ${{ github.token }} | ||||
|         tag: dev | ||||
|         assets: |  | ||||
|           FluxEngine.pkg | ||||
|         fail-if-no-assets: false | ||||
|  | ||||
|     - name: release | ||||
|       uses: softprops/action-gh-release@v1 | ||||
|       with: | ||||
|         name: Development build ${{ env.RELEASE_DATE }} | ||||
|         files: | | ||||
|           FluxEngine.pkg | ||||
|         tag_name: dev | ||||
|       env: | ||||
|         GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }} | ||||
|  | ||||
|  | ||||
|  | ||||
							
								
								
									
										8
									
								
								.gitignore
									
									
									
									
										vendored
									
									
								
							
							
						
						
									
										8
									
								
								.gitignore
									
									
									
									
										vendored
									
									
								
							| @@ -1,2 +1,10 @@ | ||||
| .obj | ||||
| .project | ||||
| /.ninja* | ||||
| /brother120tool | ||||
| /brother120tool-* | ||||
| /brother240tool | ||||
| /brother240tool-* | ||||
| /fluxengine | ||||
| /fluxengine-* | ||||
| /upgrade-flux-file | ||||
|   | ||||
| @@ -1,250 +1,250 @@ | ||||
| :400000000080002011000000A10F0000A10F0000064A08B5136843F020031360044B1A6803F53F5302331A6000F0D8FFE8460040FA46004010B5054C237833B9044B13B1EF | ||||
| :400040000448AFF300800123237010BD6881FF1F0000000020380000084B10B51BB108490848AFF300800848036803B910BD074B002BFBD0BDE81040184700BF00000000E9 | ||||
| :400080006C81FF1F20380000C880FF1F000000000A4A0B4B116801310B40002BBEBF03F1FF3363F03F030133136011685368994202BF024B01221A72704700BF8881FF1F64 | ||||
| :4000C0003F0000800A4A0B4B516801310B40002BBEBF03F1FF3363F03F030133536051681368994202BF024B01221A72704700BF8881FF1F3F000080024B012200205A7293 | ||||
| :4001000002F012B98881FF1F10B5C4B2204601F027F90128FAD110BD08B572B60F4B0F49DA680132DA601A690132C82A08BF00221A615A6918690132A72A08BF00224A613A | ||||
| :400140005B69002B0CBF02230023002814BF184643F0010002F050FE62B608BD8881FF1F38B50446C5B2284602F080F8062002F09DFA44F00200C0B202F078F8062002F055 | ||||
| :4001800095FA284602F072F8BDE83840062002F077BA10B5642402F063F830B90120FFF7DFFF013CF7D1204610BD012010BD70B5C4B2054620460E4601F0D2F8012805D089 | ||||
| :4001C000204601F0EBF92846FFF79EFF204601F0CFF8314605460246204601F08BF9204601F0BEF80028FAD1284670BD38B5044D0024285D013402F009FA402CF9D138BDE9 | ||||
| :40020000A081FF1F08B502F023FC002002F02CFC02F03EFC02F048FC80B208BD10B50446012002F03BF8642002F02AFAFFF7EAFF2080002002F032F8642002F021FAFFF7ED | ||||
| :40024000E1FF608010BD08B502F02EFD002002F037FD02F049FD02F053FD80B208BD10B50446FFF796FF322002F00AFAFFF7EBFF20800020FFF774FF322002F001FAFFF740 | ||||
| :40028000E2FF608010BD0FB400B593B014AB53F8042B402102A8019302F0AAFE02A802F04AF802F054F813B05DF804EB04B0704710B5044601780648FFF7E5FF0420FFF72B | ||||
| :4002C00023FF62782146BDE81040042001F0A0B83438000007B50023ADF804308DF80600032301A88DF80530FFF7E2FF03B05DF804FB000010B5074C94F8583043B10020E3 | ||||
| :4003000001F0A8FF002002F03BFD002384F8583010BD00BF8881FF1F38B5104D837895F85B2004469A4204D0FFF7E4FF002385F85E302368C5F859302279094B1A71A3784D | ||||
| :40034000002B14BF0220012002F01AFDE07802F011FD2079BDE8384002F048BD8881FF1FE181FF1F38B50D4C94F8585065B904F15900FFF7D1FF012001F06CFF4FF47A7031 | ||||
| :4003800002F07EF984F85E50E3682366012384F85830BDE8384002F0B1B900BF8881FF1FF8B51E4C0646FFF7DDFF94F85E3003B15EB91B48FFF767FFFFF7EBFE0120002353 | ||||
| :4003C00084F85E00636602F071F93246616E1548FFF759FF114D0027636E9E4216D001F03FFF00B16F66636E9E4205DD0020FFF7B7FE6B6E013305E005DA0120FFF7B0FE47 | ||||
| :400400006B6E013B6B6602F079F9E5E7322002F037F9BDE8F8400448FFF735BF8881FF1F4138000048380000653800002DE9F04F99B062B602F0CCF99949042002F0F0F914 | ||||
| :40044000984801F019FF984802F0BCFC974801F04DFF02F09DFB02F06FFA002002F090FC01F068FF0221002000F030FF904C012001F0A8F8002384F85B30FFF773FFFFF79A | ||||
| :4004800088FE84F86800FFF735FF012384F85B30FFF768FFFFF77DFE84F86900FFF72AFF844B94F86800844994F869202546002A14BF0A461A46002808BF19467F48FFF7E3 | ||||
| :4004C000E2FE0321084602F0F9F8264602F016F994F8583043B12A6EEB689B1A41F28832934201D9FFF706FF00F028FF18B97448FFF7C9FE04E000F027FF0028F7D10BE0E5 | ||||
| :4005000000F01CFF10B902F0F9F8F9E76D48FFF7BAFE032001F042F8032000F021FF0128D4D16948FFF7F8FE68490320FFF73FFE94F86A106648FFF7A6FE94F86A30023B1D | ||||
| :40054000142B00F2AB83DFE813F01500A9031E00A9032400A9034600A9036C00A903CF00A903AA01A903E202A9030103A9030803A903220303238DF820308DF821300E23FD | ||||
| :400580008DF82230FFE294F86C00FFF709FF514BF6E2FFF7E7FE00236372E068627A02F0FF0132B9EB681B1AB3F57A7FF6DD0B4608E03BB100227272F168627A12B9EB68CB | ||||
| :4005C0005B1AFAE707228DF8202004228DF82120ADF82230D7E20220FFF796FD4FF000080DF1200A02F08AF84FF480790027C9EB0803DA1907F80A200137402FF9D10220BC | ||||
| :40060000FFF782FD3A465146022000F001FFB9F10109EBD108F10108B8F1400FE2D12E4B38E04FF0010A4FF000080DF1200B02F065F84FF0000959460120FFF7B8FD08EBBF | ||||
| :40064000090300270493049B1BF807203B44DBB2934209D08DE80C0041463B464A461F48FFF711FE4FF0000A0137402FEBD109F10109B9F5807FDED108F10108B8F1400F92 | ||||
| :40068000D5D151461648FFF7FEFDBAF1000F00F00E81144B1B8807A8ADF81C3074E200BF19010000F900000091000000C50000008881FF1F77380000733800007A38000022 | ||||
| :4006C00092380000A5380000E181FF1FF281FF1FAF3800002438000026380000BE380000DA3800002838000094F86C0001F0D6FD606EFFF755FE02F0E7FBB24BDFF8E0825C | ||||
| :400700001A78002702F0FB021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F0D5FB0220FFF7EEFC012141F6FF734FF48042084602F028FB84F8AA00FD | ||||
| :4007400001F04AFF08F807000137402FF8D1DFF894A200270AF199091FFA89F80137402F14BF3A4600221AF8010F22440623127E402101F065FF424646F24A519AF800005D | ||||
| :4007800001F070FF08F14008402F1FFA88F8E5D196F86D3033B100237372637A002BFCD00023737200234FF0FF32236062602372236894F8AA002344197E01F0C5FE94F87B | ||||
| :4007C000AA0001F083FE012194F8AA0001F056FE2368002BFCD0002398467360D6F80CA0012701F08BFFE368B4F86E20CAEB030393420DD367B1042195F8AA0001F0B0FEC5 | ||||
| :4008000094F8AA0001F0BCFE0028F9D107463072237AFBB96A682B689A4202D1002FE0D118E00220FFF770FC6968402209EB8111022000F0EDFD6A68634B01321340002B4F | ||||
| :40084000BEBF03F1FF3363F03F03013308F101086360C6E70220277AFFF756FC00221146022000F0D5FDFFB20220FFF74DFCFFF7BDFC37B15548FFF706FD0220FFF72AFDB4 | ||||
| :4008800006E0534B08A81B88ADF82030FFF710FD627A4146237A4F48FFF7F5FC01E24E48FFF7F1FCD4F86E7017F03F0701D00320F5E1012001F0F8FC95F86C0001F0EEFCF4 | ||||
| :4008C00002F002FB454BDFF818811A7842F004021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F0F1FA686EFFF756FD01214FF4804341F6FF7208462E | ||||
| :4009000001F0D8FC85F8AA0001F066FE08F807000137402FF8D1DFF8CC90002709F199031FFA83F804930137402F14BF3A46002219F8010F22440523127E402101F080FEB9 | ||||
| :40094000414646F24C4299F8000001F08BFE08F14008402F1FFA88F8E5D100274FF0FF33376098467360BB463B46D6F86E9037725FEA99190CBF4FF0010A4FF0000A216867 | ||||
| :40098000114A01310A40002ABCBF02F1FF3262F03F026068B8BF013282426BD02BB1227A002A76D16A7A002A73D12068049A059302EB8010BAF1000F16D040223F2102F0C9 | ||||
| :4009C000E3FA1CE09A6500403F000080E43800002A380000FE380000113900009C640040A081FF1F9F81FF1F014601370120FFF7DEFBC7EB0903D3F1000A4AEB030A21689F | ||||
| :400A0000AB4A01310A40002ABEBF02F1FF3262F03F02013222606268059B01322AD12A683F2A27D14FF00008C5F8048001F070FC85F808806B6895F8AA002B44197E01F0BC | ||||
| :400A400083FD95F8AA0001F041FD012195F8AA0001F014FD85F80980637A002BFCD04FF00008012086F8098001F05EFC404601F01BFC00E023B1237A5BB96B7A4BB90123A1 | ||||
| :400A8000626842453FF47BAF0BF1010BD5F8048075E701F043FC012001F006FC002001F043FC042194F8AA0001F05AFD94F8AA0001F066FD0028F9D196F8AA0001F0F4FC07 | ||||
| :400AC000737A327A0293012303920193CDF800A05B463A4649467748FFF7D5FBBAF1000F08D0FFF783FB237A63B17348FFF7CBFB0220D4E0B945F4D070490120FFF757FBF9 | ||||
| :400B00000137F7E76E48FFF7BEFB6E4B38E094F86C0001F0C3FB606EFFF742FC6A48FFF7B2FB00236372637A002BFCD0012001F0FBFB00237372637A002BFCD0002001F0AA | ||||
| :400B4000F3FB6248FFF79FFB614B19E0002084F85E00FFF725FC5F4B12E094F8683023B195F869200AB985F86C2094F869201AB113B9012385F86C305748FFF7CDFB574B39 | ||||
| :400B80001B88ADF8203008A8FFF792FB89E0FFF7B1FB02F07BF8002002F01EF82A2701F049FF002001F0ECFE3A46002108A802F0EBF917238DF820308DF8217001F09EFD75 | ||||
| :400BC000002001F047FB002002F0DAF8C82001F057FD0DF12200FFF721FB0DF13600FFF73EFB01F08BFD012002F0CAF8322001F047FD0DF12600FFF711FB0DF13A00FFF7D3 | ||||
| :400C00002EFB012001F026FB4FF4967001F038FD01F074FD0DF12E00FFF700FB0DF14200FFF71DFB002001F015FB4FF4967001F027FD01F063FD022002F0A2F8322001F05B | ||||
| :400C40001FFD0DEB0700FFF7E9FA0DF13E00FFF706FB012001F0FEFA4FF4967001F010FD01F04CFD0DF13200FFF7D8FA0DF14600FFF7F5FA002001F0EDFA4FF4967001F06F | ||||
| :400C8000FFFC01F03BFD002002F07AF8002384F85E3001F07DFF01F04FFE74E70120FFF719FB032000F07AFC0D48FFF7ECFA0DE43F0000801B3900004B3900003892FF1F04 | ||||
| :400CC000553900002C3800005D3900006B3900002E38000030380000F281FF1F32380000783900002DE9F04172B6884B61221A70A3F5F06301221A801924854A9C7092E8C5 | ||||
| :400D000003008033062283F8002283E80300522203F580731A707F4B7F4A1B787F4EDBB2137040F618027E4B00251A8041F2512223F8022C33784FF4F07003F0010343EAA5 | ||||
| :400D4000450502F0B9F8013C05F003052ED0032DF0D1744B4FF480721A8007221A70724A002548211570917002221D705D7103F8032C0422DA716D4A6D4C13786D4E43F049 | ||||
| :400D80000103137012F8013C062743F0030302F8013C2378012243F0800323705B4B1A70654A137843F02003137000E0FEE707FB056300219A881868013502F0E5F8072D53 | ||||
| :400DC000F5D15E485E4E002550F8041F05F1105303F1440221F0FF074533C9B20B4452005B0002329A4206D012F802EC12F801CC0EF807C0F5E7B0420D44E5D1514A00239D | ||||
| :400E000013609360136193614F4B504F1A68504BDFF888811A604F4B1A684F4B1A604F4A137843F002031370137C43F0020313742378A2F5863243F040032370413A1378DE | ||||
| :400E400043F010031370464A464B07CA03C31A80454A2833106843F8250C127903F8212C424A07CA03C31A80414AE83B07CA03C31A80404A083307CA03C31A803E4A3F4B12 | ||||
| :400E8000A2F5616203CBC2F8100EC2F8141E1378042043F008031370394B02F5AA521B783D78DBB298F80060EDB203F007010C321B091170F6B2537045F003033B7046F096 | ||||
| :400EC000030388F800302F4B48221A702E4A402313702E49937013729372082382F81F3220220A7048710A72294A0A20137001F0DDFB284B88F8006044223D70264D1A7039 | ||||
| :400F000094E80F0007C52B80BDE8F08100480040B00900480F010049A146004025420040224200400440004006400040A2430040A04300407D390000E8460040FCFFFF478E | ||||
| :400F40008400004800760040B8090048F846004020760040BC090048287600400350014070090048C05100407C09004884090048900900489C09004832510040A8090048D5 | ||||
| :400F8000CF0100491D51004001590040235B0040585B004076580040B0430040F946004008B501F0C5FF03680C2B00D1FEE7FEE7084908B50B68084A1844821A802A01DC5E | ||||
| :400FC000086005E001F0B4FF0C2303604FF0FF33184608BDCC80FF1F8893FF1F80B51148114B0025C0B1A3F1100192C922460439161BB74204D051F8046F42F8046BF7E7D1 | ||||
| :40100000114653F8046C8C1AA64202D041F8045BF9E701381033E5E701F090FFFFF706FAFEE700BF010000004C3B0000124A134B10B51A60124A134C1368134843F40073A8 | ||||
| :4010400013600023032B98BF54F823204FEA830188BF0E4A0133302B4250F3D10C4B1A780C4B1A700C4B084A1A60FFF73BFEBDE8104001F0EDB900BF0004FA050CED00E042 | ||||
| :4010800014ED00E0000000000080FF1FA10F0000BC760040C080FF1F08ED00E0F8B501F013FF4B4A01271378022643F001031370137C484C43F001031374474B02F5E352E3 | ||||
| :4010C0001F700B3203F8946C1378054603F07F031370002001F0EAFA2378404A03F0F90323701378384603F0DF03137023783B43237001F0DBFA282001F0D8FA384B3046E8 | ||||
| :401100001A7802F07F021A701A7802F0BF021A7023783343237001F0C9FA2378314A43F0040323700023137053702F4AFF2199540133092BFBD1284601F0CAFE072117206D | ||||
| :4011400001F0FCFA2949172001F0EAFA0721182001F0F4FA2649182001F0E2FA0721152001F0ECFA2349152001F0DAFA0721052001F0E4FA2049052001F0D2FA0721062008 | ||||
| :4011800001F0DCFA1D49062001F0CAFA0721084601F0D4FA1A49072001F0C2FA0721082001F0CCFA1749082001F0BAFA0021162001F0C4FA1449162001F0B2FA07210C20FD | ||||
| :4011C00001F0BCFABDE8F84010490C2001F0A8BAA5430040944300409D60004012600040F851004084600040AD92FF1F6B1A0000A5180000691A00009D190000C9190000FE | ||||
| :40120000F9190000311A0000711A0000E51A0000214B224A10B5187000231370204A40201370204A0F2413701F4A13701F4A13701F4A13701F4A13701F4B4FF400021A60B6 | ||||
| :401240004FF080721A604FF400121A6020221A601860802018604FF480701860174804704FF480001860164B1A70933B19B91A7802F0FE0202E01A7842F001021A70114B51 | ||||
| :4012800003221A70802203F8202C012001F014FE0D4B04221A7010BDC892FF1FCE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F00E100E09E60004062 | ||||
| :4012C0009C600040286000401260004070B5074C054623780E461BB9FFF7E0FE0123237031462846BDE87040FFF792BF7892FF1F0A4A002313700A4A13700A4A13700A4A82 | ||||
| :4013000013700A4A13700A4A13700A4A13700A4B03221A70802203F8202C7047CE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F28600040014B187899 | ||||
| :40134000704700BFCD92FF1F044B1A7802F0FF001AB118780022C0B21A707047CC92FF1F024A0C2303FB002040787047D492FF1F431E072B0CD8074A064B00010344805C33 | ||||
| :401380005B7800F00F0043EA0020023880B2704700207047FC5F00401A4A38B50C2303FB00231B79090C13F0800F00F1FF35044619BF8AB24FF480438BB24FF48042032DA2 | ||||
| :4013C00018D8DFE805F002070C110021084601F01BF80DE00021084600F0FAFF08E00021084600F0D9FF03E00021084600F0B8FF054B1855EDB2072D03D801F0EDF8034BBC | ||||
| :40140000185538BDD492FF1FA492FF1FAD92FF1F431E072B2DE9F0470446894615465CD82F4F0C2202FB0072D388DFF8B8A09BB2C3F500739D424FF00C0303FB007388BF8B | ||||
| :40144000D588DB7884BFC5F50075ADB2254A43EA15230601B354B244EBB28AF80130224B1A5C9846FF2A01D1FFF796FF0C2303FB047200215170B9F1000F28D03DB31B4FEC | ||||
| :40148000385D01F011F811232946FE2218F8040001F0D6F806F5C04278321FFA89F118F8040001F0DFF8124D18F80410385D01F04BF80121385D00F0E1FF735D43F0020316 | ||||
| :4014C0007355735D03F0FD037355BDE8F08703FB04746379DBB28AF80230BDE8F08700BFD492FF1FFC5F0040AD92FF1FA492FF1F706000402DE9F047044615468846002946 | ||||
| :4015000040D0431E072B3FD8FFF732FFA84203D22046FFF72DFF05461D4E335DFF2B03D141462046FFF738FFDFF868A027011AF8040000F0B9FF1223FE222946305D01F01E | ||||
| :401540007FF807F5C0411FFA88F27831305D01F089F8DFF84490315D1AF8040000F0F4FF01211AF8040000F089FF17F8093043F0020307F8093017F8093003F0FD0307F8E8 | ||||
| :40158000093002E00D4600E000252846BDE8F087AD92FF1FA492FF1F70600040431E072B0AD8064A0C2303FB002300225A705A79034BD2B200011A54704700BFD492FF1F5E | ||||
| :4015C000FE5F0040431E072B9FBF024B000108221A547047FE5F004030B51A4A1A491B4D0878138803449BB21380194A00231488D8B2A4B27CB1082B0CD050680078C0B2ED | ||||
| :40160000E85450680133013050601088013880B21080ECE718460B780E4C082B0E4A00D040B10E4D2B7883F080032B700F232370022301E0022323701370094B18700870CB | ||||
| :4016400030BD00BF4493FF1F4093FF1F00600040BC92FF1FB992FF1FCE92FF1FCA92FF1F4193FF1F074B02221A70074B80221A70064B0F221A70064A00231370054A012089 | ||||
| :4016800013707047CE92FF1FCA92FF1FB992FF1F4093FF1F4193FF1F30B5164B16491B780A8803F00F03023BDBB21A4492B20A80124C134A0020118889B279B173B155682D | ||||
| :4016C000215C013BC9B229705168DBB20131516011880130013989B21180ECE7094A1370094A137883F080031370084B0B221A7030BD00BF296000404493FF1F0060004010 | ||||
| :40170000BC92FF1F4193FF1FCA92FF1FB992FF1F064A06231370064A01201370054B80221A70054B00221A70704700BFCE92FF1FB992FF1FCA92FF1F4193FF1F054B9A68E5 | ||||
| :401740003AB19A68044910709A680988518000229A607047BC92FF1F4493FF1F08B5124B1A78D2B21A701B78DBB21A0602D50F4A137008BD0220FFF7E1FF0D4B1B7803F0CF | ||||
| :401780006003202B05D0402B06D043B900F012FC04E001F0A1FB01E000F046FD10B9034B03221A7008BD00BF28600040B992FF1F0060004008B5084A084B0120197813881C | ||||
| :4017C0000B449BB21380064B00221A70FFF7B6FF044B03221A7008BD4493FF1F4093FF1FCE92FF1FB992FF1F08B50C4B1B78DBB2042B07D0062B09D0022B0DD1BDE8084046 | ||||
| :40180000FFF7D8BFBDE80840FFF746BF0320FFF795FF034B03221A7008BD00BFCE92FF1FB992FF1F08B5054B002201201A70FFF785FF034B03221A7008BD00BFCE92FF1FCB | ||||
| :40184000B992FF1F08B50A4B1A7832B11A78094942F080020A7000221A70074B002201201A70FFF76BFF054B03221A7008BD00BFB892FF1F08600040CE92FF1FB992FF1FC1 | ||||
| :40188000074B1B78DBB2042B05D0062B05D0022B05D1FFF7A1BEFFF7C5BFFFF7D3BF7047CE92FF1F38B51D4C2378DBB2DD0634D518060AD503F00F03012B2ED1FFF74EFF43 | ||||
| :4018C000174B1B78190609D538BD5A0602D5FFF7D7FF03E09D0620D5FFF786FF23781B061BD4104B1A78104B1B7813430F4A13701278934211D10A4A0849154613782078EC | ||||
| :40190000DBB2000605D41378DBB20B700B7803F00F0328788342F1D138BD38BD28600040B992FF1FCA92FF1F4193FF1F29600040054A00231380054A916819B191680B701E | ||||
| :4019400092685380704700BF4493FF1FBC92FF1F0E4808B503889BB213B9FFF783FE13E00B4B02221A700B4B00221A70FFF7E0FF094AD1799379028843EA012392B293422A | ||||
| :4019800038BF0380FFF728FE012008BDBC92FF1FCE92FF1FCA92FF1F00600040084B01221A700F3B9B7C074B1A7B02F00302012A1EBFDA7B82F08002DA7301225A73704723 | ||||
| :4019C0000B600040D492FF1F094B02221A700F3B93F82230074B1A7E02F00302012A1EBFDA7E82F08002DA7601225A76704700BF0B600040D492FF1F0B4B04221A700F3B22 | ||||
| :401A000093F83230094B93F8242002F00302012A1EBF93F8272082F0800283F82720012283F82520704700BF0B600040D492FF1F0B4B08221A700F3B93F84230094B93F857 | ||||
| :401A4000302002F00302012A1EBF93F8332082F0800283F83320012283F83120704700BF0B600040D492FF1F7047FFF741BC0000F0B5184B184E19780C27C9B201234FF029 | ||||
| :401A8000000C31B3CA0720D5144A4FEA031E7244947850782040C5070DD507FB03652C79240608D5147804F0FE0414706D790C4CEDB204F80E50840706D507FB0364257960 | ||||
| :401AC0002D0658BF84F801C090700133DBB24908D7E7F0BD9F600040D492FF1F70600040FE5F004000F0ACBC70B50446184B88B003AA03F11006154618685968083303C5BA | ||||
| :401B0000B3422A46F7D11B782B70FCB12223237001AD03232846637000F08AFE002220461146AB5C08AC04EB131414F8144C03F00F03847008AC234413F8143C0132082A48 | ||||
| :401B4000C1700371417100F10400EAD108B070BDA73900002DE9F0431C4D01222E460C201F274FF0800E4FF0080C194B00FB02581401234418705F70164998F80590214449 | ||||
| :401B8000B9F1000F07D098F8044024064CBF887081F802C001E081F802E000FB0261CC880132E4B29C71CC88092AC4F30724DC71CC88E4B21C71C988C1F307215971D4D1CC | ||||
| :401BC000054BFF221A70BDE8F08300BFD492FF1F70600040FC5F00400A600040064B074A1B7802EBC30253681A7C824286BF03EBC003586900207047C892FF1F083A0000F6 | ||||
| :401C00002DE9F84F424B1A78002A7ED01878414D0138C0B2FFF7E2FFA8463F4AC3681478007ADFF800C1E4B203EBC0000C2600274FF0010E834268D01A78A24263D11CF82A | ||||
| :401C40000420597891425ED19A7893F8039002F07F0206FB02FA05EB0A01CF7093F802B009F0030981F804B093F803B005F80AB0B3F804A0A1F808A093F902A0BAF1000FB7 | ||||
| :401C80000BDAB9F1010F0CBF4FF007094FF00D0981F8059081F801E009E0B9F1010F0CBF4FF005094FF0090981F805904F704FEA02191A4906FB0282494481F802E0B2F807 | ||||
| :401CC00008A0CAF3072A81F800A0B2F808A05FFA8AFA81F801A0B2F806A011495FFA8AFA494481F806A0B2F80690C9F3072981F80790B2F806905FFA89F981F80490D288FB | ||||
| :401D0000C2F307224A71083394E7BDE8F88F00BFCD92FF1FD492FF1FC992FF1FFC5F004070600040BA92FF1F08B5064B18780138C0B2FFF753FF20B143681B7900EBC3008B | ||||
| :401D4000406908BDCD92FF1F00212DE9F84F0B464E4E0C2707FB01F401313219092933554FF000059370494CD3701381937253705371EFD118B1464B1D70464B1D70464B17 | ||||
| :401D80001A78002A7FD0187801250138C0B2FFF725FFA8464368DFF8F8E0DB790C2713F0400F3E4B4FF0000C1A7814BF42F0010202F0FE021A70027AD20007FB0541C368D1 | ||||
| :401DC00003EB02094B4531D093F802A00AF07F06AE4229D10E89B3F804B0B6B25E4538BFA1F808B01E7893F801B01EF80660B3451AD181F804A0DE780E7093F902A0DE78D4 | ||||
| :401E0000BAF1000F06F0030607DA012E0CBF07260D264E7181F8018006E0012E0CBF052609264E7181F801C00833CBE70135092DC3D1C1680A328B1C0A440C20083393423F | ||||
| :401E400009D013F8081C13F80A5C01F07F0100FB01418D72F2E7FFF767FF114B0121186000230C2000FB0142D3801289013113449BB203F00102134409299BB2F2D1BDE88C | ||||
| :401E8000F84FFFF767BEBDE8F88F00BFD492FF1FBA92FF1F4293FF1FCD92FF1FCB92FF1FD092FF1F114B1B7903F07F035A1E072A19D80F490C2202FB031291781B0141F08F | ||||
| :401EC000010191700021D170517841F002015170127912F0800F074A1A4414BF8D2389239370FFF715BC0020704700BF00600040D492FF1FFC5F004030B4194B1A7902F0D9 | ||||
| :401F00007F02531E072B27D8164B0C2404FB02339978154D01F0FE0199700021D97029461201505D114400F07F0050555A7802F0FD025A701A795B78120605D5012B01D168 | ||||
| :401F40008C7006E00D2303E0012B0CBF082309238B7030BCFFF7DCBB002030BC704700BF00600040D492FF1FFC5F004010B50D4B0D4C21791878C9B20138C0B2FFF72EFE81 | ||||
| :401F800043681B798B4201D2012909D8074A0848535CDBB24354A3780120DBB2535410BD002010BDCD92FF1F00600040BA92FF1F4293FF1F38B58A4A8A4C13780021DBB24F | ||||
| :401FC00021801806517840F18D800A2900F20581DFE811F05D00030103010301030103010B0003017E0003018200D3787C49012B09D17D4B1A787D4B03EBC2035B685B68B3 | ||||
| :402000006360122310E0CB78022B12D18878FFF7E5FD002800F0E180436863606368DA7863689B7843EA02232380BDE83840FFF78FBCCB78032B26D16D4B00228878D5B28F | ||||
| :40204000854209D3664A91786A4AEE2908BF1346634A917881B106E0187801320028F1D018780344EAE764499278097C914203D16248FFF739FD614B1A78002A00F0AD80B9 | ||||
| :402080001A78228018E0BDE8384000F025BF13F0030313D0022B40F0A0802380504B0C211B7903F07F02564B01FB02339A78554BD2B21A7000225A706360B6E70222228083 | ||||
| :4020C000514A11784F4AC9B2117053706260ACE7012323804D4BEFE70123238013794C4A1344E9E701390A2977D8DFE801F037764F76067676760A7620009378454ADBB2B5 | ||||
| :402100005AE0937803F0FF0153B9404B1A7891425FD01970404B01201870FFF715FE58E0481EC0B2FFF75AFD0028EED155E0FFF71DFF002851D02A4A384913791279DBB209 | ||||
| :40214000D2B20A70364A3249D25CCB5C9A4240D0314B01221A70FFF753FD3AE003F00303012B2BD009D3022B37D11D4B9B78002B33D1BDE83840FFF7BFBE194B9B78012B8E | ||||
| :402180002BD1214A137803F0FD0315E003F00303012B13D008D3022B1FD1114B9B78E3B9BDE83840FFF77EBE0D4B9B78012B14D1154A137843F0020313700AE0084B1A79FA | ||||
| :4021C0005AB998781B791749DBB2CA5C22EA0002CA54BDE83840FFF79BBA002038BD00BF00600040BC92FF1FC892FF1F083A00006C3A0000F4390000DF3A00006093FF1FEA | ||||
| :40220000D492FF1F7992FF1FCB92FF1FCD92FF1FBA92FF1FB892FF1FCC92FF1FC992FF1F4293FF1FCF92FF1F074B1A78120609D55B78012B06D1054B054A5A6012781A8093 | ||||
| :40224000FFF786BB0020704700600040BC92FF1FCC390000014B1870704700BF78640040014B1878704700BF6B650040014B1870704700BF79640040064A0123136002F631 | ||||
| :4022800088321268E0211064034A1170A2F540721360704780E100E000E400E0014B1870704700BF79650040014B1870704700BF7D64004073B515461E460B4C05230022D4 | ||||
| :4022C000019200920A4601461846237000F064F932462946207800F01FF90221207800F009F9207802B070BDD080FF1F064A0423136002F688321268E0219064034A1170F2 | ||||
| :40230000A2F202321360704780E100E002E400E0014B04221A60704700E100E0014B04221A60704780E100E0014B1870704700BF7B650040704738B505460078012428B18D | ||||
| :4023400000F062FD285D0134E4B2F8E738BD08B50D2000F059FDBDE808400A2000F054BDF7B516461F460B4C00230325019300930A4601462846257000F00EF93A463146E4 | ||||
| :40238000207800F0C9F80221207800F0B3F8207803B0F0BDE080FF1FF7B516461F460B4C00230225019300930A4601462846257000F0F2F83A463146207800F0ADF82946CC | ||||
| :4023C000207800F097F8207803B0F0BDE180FF1FF7B516461F460B4C00230125019300930A4601462846257000F0D6F83A463146207800F091F80221207800F07BF8207805 | ||||
| :4024000003B0F0BDE280FF1F73B515461E460B4C0023019300930A4601461846237000F0BBF832462946207800F076F80221207800F060F8207802B070BD00BFE380FF1F72 | ||||
| :40244000024B1878C0F38010704700BF8F450040074A7F23802113705170064A013BDBB202F80839002BF9D1034A1370704700BFE480FF1FF87B00400078004017280FD838 | ||||
| :40248000084B0001C25C11B142F0200201E002F0DF02C254C25C42F00102C25400207047012070471070004017280BD8064B0001C25C02F0FE02C254C25C02F0DF02C25451 | ||||
| :4024C00000207047012070471070004017280DD8074900010B4603441A7942F004021A71435C43F00103435400207047012070471070004017280BD8064A0001835C490093 | ||||
| :4025000003F0F10301F00E011943815400207047012070471070004041F6FF73994208BF4FF400519A4208BF4FF4005217289FBFC00000F1804000F5EC4081809ABFC28032 | ||||
| :40254000002001207047000017289FBF034B00011954002088BF0120704700BF1970004017289FBF054B00011A5C01F007019DBF1143195400200120704700BF147000404E | ||||
| :4025800017289FBF034B0001185C00F0070088BFFF20704714700040172810B51AD8C00001F07F0100F1804441EAC21204F5EC44D2B222709DF8082003F00F0343EA0213C5 | ||||
| :4025C000DBB263709DF80C30002003F00F03A370E07010BD012010BD10B500F075FC0A4A5378182B0AD91478013B5370E30003F1804303F5F0431B78137000E0FF2400F0A3 | ||||
| :4026000067FC204610BD00BFE480FF1F030610B5044611D400F058FC084AE300117803F1804303F5F04319705378147001335370BDE8104000F04CBC10BD00BFE480FF1F18 | ||||
| :4026400030B504060CD411F4704509D1C40004F1804404F5F0442180A270E370284630BD012030BD03065FBFC00000F1804000F5F04081805ABFC2800020012070470000CD | ||||
| :4026800038B50446084DB4F5004F05D9286800F013FCA4F50044F6E7034B58686043BDE8384000F009BC00BFEC80FF1F024B1B7A584300F001BC00BFEC80FF1F0E4B00F0E7 | ||||
| :4026C00003001A78490102F0FC02104318701A7801F0600142F080021A701A7802F07F021A701A7802F09F020A431A701A7842F010021A70704700BF83430040014B012238 | ||||
| :402700001A70704784430040044B00F00F021B6853F8220043F82210704700BF08ED00E0054A00F01F00126800F1100352F8230042F82310704700BF08ED00E000F01F0049 | ||||
| :4027400000F16040490100F56440C9B2017070470F4B10B50F4900240F205C609C60DC601C615C61FFF7D0FF0B4A136843F0040313600A4B4FF47A72DB68B3FBF2F3084A5C | ||||
| :402780001360084B4FF400421C60C3F8E82010BD7C92FF1FFD27000010E000E0EC80FF1F14E000E018E000E0024A136843F002031360704710E000E008B5FFF7F5FF034A7F | ||||
| :4027C000136843F00103136008BD00BF10E000E010B5054CA3691BB9FFF7BAFF0123A361BDE81040FFF7E8BF7C92FF1F024B1868C0F30040704700BF10E000E038B5FFF7EC | ||||
| :40280000F5FF012808D1054D002455F8243003B198470134052CF8D138BD00BF8092FF1F024B03EB80035868596070477C92FF1F134B144A1B78DBB20360127843EA0223B0 | ||||
| :40284000114A0360127843EA0243104A0360127843EA026303600E4B0E4A1B78DBB24360127843EA02230C4A4360127843EA02430A4A4360127843EA02634360704700BFF1 | ||||
| :402880000301004904010049EC460040020100490101004900010049050100490601004910B500F011FB204A044613780A2043F002031370137C43F00203137412F80A3C08 | ||||
| :4028C00043F0010302F80A3C937943F00103937102F5AB52137843F003031370134B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CCE2203F8062C7C | ||||
| :40290000A3F597530222183B1A70094A137843F008031370FFF7CAFE064B10222046BDE810401A6000F0D4BAAB4300400E5900402F5B004080E200E008B500F0C5FA0F4A3B | ||||
| :40294000137803F0FE031370A2F5AA521D3A137803F0FD031370137C03F0FD03137412F80A3C03F0FE0302F80A3C937903F0FE039371BDE8084000F0ABBA00BF0859004037 | ||||
| :40298000044A137803F03F0343EA8010C0B21070704700BF08590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF0000298BF33F9101028 | ||||
| :4029C0000A4B88BF11461A8042F210734B4341F2883103F6C41393FBF1F305490B60054B1A8070470A590040B83900004A93FF1F4C93FF1F5093FF1F08B5102000F0A6F974 | ||||
| :402A000007210420FFF79AFE07490420FFF788FE064A0C20137843F006031370FFF7BCFF034B00221A8008BDF12A0000095900404893FF1F10B5054C23781BB9FFF7DCFF7A | ||||
| :402A400001232370BDE81040FFF72ABF9892FF1F044B1A7802F0FB021A701A7842F001021A7070470859004010B5084B1C7814F0010403D10028F9D0002404E02046FFF7A2 | ||||
| :402A800015FE024B1B78204610BD00BF09590040034A044B1B881088181A00B2704700BF5093FF1FA25B00400E4A13881BB223B111880A2309B2594301E00B4B19680B4B61 | ||||
| :402AC0001B88C01A42F2107300B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F000B270474A93FF1F4C93FF1F4893FF1F7047000010B500F0E7F9214A0446137861 | ||||
| :402B00000A2043F001031370137C43F00103137412F80A3C43F0020302F80A3C937943F00203937102F5AA521832137843F003031370144B18221A7013F8012C42F0400201 | ||||
| :402B400003F8012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222123B1A70094A137843F008031370FFF79FFD074B08222046BDE810401A6000F0A9B900BFB0 | ||||
| :402B8000AB43004006590040275B004080E200E008B500F099F90F4A137803F0FE031370A2F5AA52153A137803F0FE031370137C03F0FE03137412F80A3C03F0FD0302F87F | ||||
| :402BC0000A3C937903F0FD039371BDE8084000F07FB900BF00590040044A137803F03F0343EA8010C0B21070704700BF00590040082804D00A280CBF8223C22300E0422383 | ||||
| :402C000008380E4AC0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A8042F210734B4341F2883103F6C41393FBF1F305490B60054B1A8070470259004054 | ||||
| :402C4000C23900005693FF1F5C93FF1F5493FF1F08B5102000F084F807210320FFF76EFD07490320FFF75CFD064A0C20137843F006031370FFF7BCFF034B00221A8008BD33 | ||||
| :402C8000492D0000015900405893FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040FFF728BF9992FF1F044B1A7802F0FB021A701A7842F001021A70704700590040D8 | ||||
| :402CC00010B5084B1C7814F0010403D10028F9D0002404E02046FFF7E9FC024B1B78204610BD00BF01590040034A044B1B881088181A00B2704700BF5493FF1FA05B004034 | ||||
| :402D00000E4A13881BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107300B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F000B270475693FF1FD5 | ||||
| :402D40005C93FF1F5893FF1F70470000034A00F0F800137803431370704700BF02410040034A00F0F800137803431370704700BF06410040014B1870704700BF7A65004015 | ||||
| :402D8000014B1870704700BF7E64004073B515461E460B4C04230022019200920A46014618462370FFF7F8FB324629462078FFF7B3FB02212078FFF79DFB207802B070BDA7 | ||||
| :402DC000FC80FF1F074A0223136002F688321268E0215064044A11706FF440710A441360704700BF80E100E001E400E0014B1870704700BF7A640040014B1870704700BF9D | ||||
| :402E00007B64004000000000FEB5494652465B460EB40746244909688A46244A12682448022100F071F8030020480068C018204900F06AF8143883460121C9430C4601254A | ||||
| :402E4000002600F041F8814651460B7823400B705846013000F030F83800F04028400B78234003430B70584600F026F80136072EF2D9002001300138013001200B78234041 | ||||
| :402E800003430B705846043000F016F8484600F01FF800BF00BF00BF0EBC894692469B46FEBD00BFAFF30080D480FF1FF880FF1F00C20100000000000230800803D000BFAA | ||||
| :402EC00001380046FCD17047EFF3108072B6704780F31088704700BF094A137803F00303012B0AD0022B09D113790C2103F07F02044B01FB02339B7A00E013790020704714 | ||||
| :402F000000600040D492FF1F002902D0B0FBF1F0704708B14FF0FF3000F008B80029F8D00246B0FBF1F000FB11217047704700BF014B1868704700BF6081FF1F0E4B70B57A | ||||
| :402F40001E460E4C0025E41AA410A54204D056F8253098470135F8E700F0DEFD084B094C1E46E41AA4100025A54204D056F8253098470135F8E770BD243B0000243B00007F | ||||
| :402F8000243B00002C3B000003460244934202D003F8011BFAE7704730B5141E05469BB0184604DA8B232B604FF0FF301DE04FF40273ADF80C300CBF234604F1FF33029350 | ||||
| :402FC00005934FF6FF7300910491ADF80E3002461E9B6946284600F073F8431CBCBF8B232B6014B1009B00221A701BB030BD000007B5009313460A46014603480068FFF741 | ||||
| :40300000CBFF03B05DF804FB6081FF1F2DE9F0478E6882469E420C46914698463ED88A8912F4906F3AD02568096902236F1A656905EB450595FBF3F57B1C43449D4238BF75 | ||||
| :403040001D4653050FD5294600F04AFB064698B13A46216900F0D2FAA38923F4906343F08003A38113E02A4600F098FB064670B92169504600F0E8FA0C23CAF80030A38908 | ||||
| :403080004FF0FF3043F04003A381BDE8F08726613E44266046466561ED1BA560464528BF464649463246206800F0B3FAA36800209B1BA36023681E442660BDE8F087000061 | ||||
| :4030C0002DE9F04F9DB003938B8980461C060D4616460DD50B695BB9402100F001FB2860286118B90C23C8F80030CDE040236B610023099320238DF82930DFF89CB1302302 | ||||
| :403100008DF82A3037463C4614F8013B1BB9B7EB060910D003E0252BF9D02746F3E74B46324629464046FFF771FF013000F0A780099B4B4409933B78002B00F0A080002335 | ||||
| :403140004FF0FF3204930793059206938DF853301A930126052221784E4800F041FA671C049B38B14B4A3C46801A06FA00F018430490EFE7D90644BF20228DF853201A0773 | ||||
| :4031800044BF2B228DF8532022782A2A03D0079A00210A200BE0039A111D12680391002A10DA524243F00200079204900BE027463B780134303B092B03D800FB0232012141 | ||||
| :4031C000F5E701B107923B782E2B1ED17B782A2B0AD1039B02371A1D1B680392002BB8BF4FF0FF33059310E0002319460593781C0A2407463A780130303A092A03D804FB46 | ||||
| :4032000001210123F5E703B1059103223978224800F0E6F940B14023CBEB000003FA00F0049B013718430490397806221B487E1C8DF8281000F0D4F988B1194B33B9039BDF | ||||
| :40324000073323F007030833039314E003AB00932A46144B04A94046AFF3008007E003AB00932A460F4B04A9404600F093F8B0F1FF3F824603D0099B5344099342E7AB897F | ||||
| :403280005B0601D4099801E04FF0FF301DB0BDE8F08F00BFF33A0000F93A0000FD3A0000000000000D3000002DE9F04791461F460A698B6806469342B8BF1346C9F8003093 | ||||
| :4032C00091F843200C46DDF8208012B10133C9F800302368990642BFD9F800300233C9F80030256815F0060510D104F1190A07E00123524639463046C04701301AD001355B | ||||
| :40330000E368D9F800209B1A9D42F1DB94F843302268003318BF012392060FD5E118302081F843005A1C94F845102244023382F8431003E04FF0FF30BDE8F08704F1430253 | ||||
| :4033400039463046C0470130F4D02268D9F80050E36802F00602042A08BF5D1B2269A3680CBF25EAE57500259342C4BF9B1AED184FF000091A344D4509D0012322463946F2 | ||||
| :403380003046C0470130D5D009F10109F3E70020BDE8F0872DE9F04317460A7E85B06E2A984606460C460C9B01F1430E00F0AE8011D8632A22D009D8002A00F0BB80582A01 | ||||
| :4033C00040F0CA8081F84520834955E0642A1ED0692A1CD0C0E0732A00F0B08009D86F2A2ED0702A40F0B8800A6842F020020A603EE0752A24D0782A3AD0ADE01A6801F114 | ||||
| :403400004205111D1960136884F84230A8E021681A6811F0800F02D0111D196008E011F0400F02F10401196002D0B2F9003000E01368002B3CDA2D225B4284F8432037E0C5 | ||||
| :4034400021681A6811F0800F02D0111D196007E011F0400F02F10401196001D0138800E01368227E5C496F2A14BF0A2208221BE078225A4984F845202268186812F0800F0E | ||||
| :4034800000F104051D6003D1550601D5038800E00368D00744BF42F0200222601BB9226822F0200222601022002084F8430001E049490A226568002DA56008DB206820F0CC | ||||
| :4034C000040020602BB9002D7DD175460CE0002B79D07546B3FBF2F002FB1033CB5C05F8013D03460028F5D1082A0BD12368DA0708D5236962689A42DEBF302305F8013CF7 | ||||
| :4035000005F1FF35C5EB0E0323612EE008681A6810F0800F496903D0101D1860136808E010F0400F02F104001860136801D0198000E0196000232361754616E01A68111DFC | ||||
| :403540001960156800216268284600F049F808B1401B6060636804E004F1420584F8422001232361002384F84330CDF800803B4603AA21463046FFF797FE013002D14FF056 | ||||
| :40358000FF3026E023692A4639463046C0470130F5D023689B0710D5002504F1190907E001234A4639463046C0470130E7D00135E368039A9B1A9D42F2DBE068039B9842DC | ||||
| :4035C000B8BF184605E00B7804F1420584F842308AE705B0BDE8F083A7390000043B000010B5C9B202449042034605D01C7801308C42F8D1184610BD002010BD10B5431EF7 | ||||
| :403600000A44914204D011F8014B03F8014FF8E710BD884210B501EB020301D8421E0BE09842FBD28118D21AD34204D013F8014D01F8014DF8E710BD994204D011F8014B40 | ||||
| :4036400002F8014FF8E710BD38B50546002944D051F8043C0C1F002BB8BFE41800F0D4F81E4A1368114613B96360146030E0A3420DD92268A018834201BF18685B68121885 | ||||
| :40368000226063600C6023E0A24203D813465A68002AF9D118681918A1420BD12168014458188242196013D110685268014419605A600DE002D90C232B6009E021686018A3 | ||||
| :4036C000824201BF106852680918216062605C602846BDE8384000F098B838BDA092FF1F70B5CD1C25F0030508350C2D38BF0C25002D064601DBA94202D90C23336046E018 | ||||
| :4037000000F082F8234B1C681A462146A1B10B685B1B0ED40B2B03D90B60CC18CD501EE08C420BBF63684B681360636018BF0C4615E00C464968E9E7174C23681BB9304658 | ||||
| :4037400000F052F820602946304600F04DF8431C18D0C41C24F00304A0420DD12560304600F053F804F10B00231D20F00700C31A0ED05A42E25070BD211A304600F034F863 | ||||
| :403780000130EBD10C233360304600F03EF8002070BD00BFA092FF1F9C92FF1FF8B5074615460E4621B91146BDE8F840FFF798BF1AB9FFF749FF2846F8BD00F027F8854208 | ||||
| :4037C0000ED929463846FFF78BFF044650B131462A46FFF713FF31463846FFF735FF01E03046F8BD2046F8BD38B5064C0023054608462360FDF7DCFB431C02D1236803B13B | ||||
| :403800002B6038BD8493FF1F7047704751F8040C0028BEBF091851F8043CC0180438704700000000050209020B020D020F021102130215027265706C792030782530327881 | ||||
| :4038400000686F6D696E6700626567696E6E696E67207365656B2066726F6D20256420746F2025640066696E6973686564207365656B00796573006E6F00647269766520AA | ||||
| :40388000303A20257320647269766520313A2025730057616974696E6720666F72205553422E2E2E0055534220726561647900636F6D6D616E64203078253032780066610F | ||||
| :4038C000696C2025642B25642B2564203D3D2025642C206E6F74202564007061737365643D256400756E64657272756E206166746572202564207061636B65747300636FE8 | ||||
| :40390000756E743D256420693D256420643D256400636D645F777269746500703D25642063723D25642063773D256420663D256420773D256420696E6465783D2564207526 | ||||
| :403940006E64657272756E3D256400756E64657272756E2100737563636573730073746172742065726173696E670073746F702065726173696E670069646C650000510001 | ||||
| :4039800040100040510040300000000140001000140140000800400140000A004C014000020050014020003031323334353637383941424344454600000100000004000096 | ||||
| :4039C00000100001000000040000001028000000000104000100000000000000000157494E5553420000303030303100000000000000000012034D0053004600540031002A | ||||
| :403A0000300030000100000001000000103A000001000000DF3A0000000000000000000001000000283A000001000000B13A0000040000004A3A00000000000000000000E9 | ||||
| :403A400000000000483A0000FF00000001024000FF00000082024000FF00000003034000FF00000084034000FF00020304030904160346006C007500780045006E006700CA | ||||
| :403A800069006E0065002A0343006F0077006C00610072006B00200054006500630068006E006F006C006F0067006900650073000009022E0001010080320904000004FFC9 | ||||
| :403AC00000000107050102400000070582024000000705030340000A0705840340000A12010002FF0001080912006E0100020180014300232D302B2000686C4C00656667E2 | ||||
| :403B0000454647003031323334353637383961626364656600000000F8B500BFF8BC08BC9E467047590000002D100000F8B500BFF8BC08BC9E46704735000000503B0000FD | ||||
| :403B4000C880FF1FA00000002012000000000000000000008893FF1FFF000000675000400C00000007000000FFFFFFFF7F8000003F0000000000007D00FA000040000000DA | ||||
| :403B80000090D003FF0000000000000000000000000000000000000000000000000000000000000000000000F13A0000000000000000000000000000000000000000000078 | ||||
| :403BC000000000000000000000000000000000000000000000000000000000000000000000000000000000000081FF1F000000000000000000000000000000000000000026 | ||||
| :403C00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000084 | ||||
| :403C40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000044 | ||||
| :403C80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000004 | ||||
| :403CC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C4 | ||||
| :403D00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000083 | ||||
| :403D40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000043 | ||||
| :403D80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000003 | ||||
| :400000000080002011000000A1100000A1100000064A08B5136843F020031360044B1A6803F53F5302331A6001F058F8E8460040FA46004010B5054C237833B9044B13B173 | ||||
| :400040000448AFF300800123237010BD6081FF1F00000000F0380000084B10B51BB108490848AFF300800848036803B910BD074B002BFBD0BDE81040184700BF0000000021 | ||||
| :400080006481FF1FF0380000C880FF1F000000000A4A0B4B116801310B40002BBEBF03F1FF3363F03F030133136011685368994202BF024B01221A72704700BF8081FF1FA4 | ||||
| :4000C0003F0000800A4A0B4B516801310B40002BBEBF03F1FF3363F03F030133536051681368994202BF024B01221A72704700BF8081FF1F3F000080114BDA68196919B905 | ||||
| :4001000001221A75597514E09969521A19698A4294BF587D00201875187D094908B1002204E0086982428CBF002201224A75DA689A611B7D13B1002002F082B9704700BF34 | ||||
| :400140008081FF1F10B5C4B2204601F089F90128FAD110BD08B572B60F4B0F49DA680132DA60DA690132C82A08BF0022DA611A6AD8690132A72A08BF00220A621B6A002BEB | ||||
| :400180000CBF02230023002814BF184643F0010002F0DAFB62B608BD8081FF1F38B50446C5B2284602F0C4F8062002F099FD44F00200C0B202F0BCF8062002F091FD284602 | ||||
| :4001C00002F0B6F8BDE83840062002F073BD10B5642402F0A7F828B9FFF7E0FF013CF8D1204610BD012010BD70B5C4B2054620460E4601F035F9012805D0204601F04EFAE3 | ||||
| :400200002846FFF79FFF204601F032F9314605460246204601F0EEF9204601F021F90028FAD1284670BD000038B5044D0024285D013402F005FD402CF9D138BDA481FF1F75 | ||||
| :4002400008B502F0FDF9002002F006FA02F018FA02F022FA80B208BD10B50446012002F07FF8642002F026FDFFF7EAFF2080002002F076F8642002F01DFDFFF7E1FF608047 | ||||
| :4002800010BD08B502F008FB002002F011FB02F023FB02F02DFB80B208BD10B50446FFF796FF322002F006FDFFF7EBFF20800120FFF774FF322002F0FDFCFFF7E2FF6080A1 | ||||
| :4002C00010BD0FB400B593B014AB53F8042B402102A8019302F0F4FE02A802F0BEF802F0C8F813B05DF804EB04B0704710B5044601780648FFF7E5FF0420FFF723FF62787E | ||||
| :400300002146BDE81040042001F002B90C3A000007B50023ADF804308DF80600032301A88DF80530FFF7E2FF03B05DF804FB000010B5074C94F8643043B1002001F0ECFF79 | ||||
| :40034000002002F083F8002384F8643010BD00BF8081FF1F38B5124D837895F8672004469A4204D0FFF7E4FF002385F86A302368C5F8653022790B4B1A71A378002B14BF38 | ||||
| :400380000220012002F062F8E078B0FA80F0400902F0D4FA2079BDE8384002F0DBBA00BF8081FF1FE581FF1F38B50D4C94F8645065B904F16500FFF7CDFF012001F0ACFF17 | ||||
| :4003C0004FF47A7002F076FC84F86A50E368E366012384F86430BDE8384002F0A9BC00BF8081FF1FF8B5214C0546FFF7DDFF94F86A3003B15DB91E48FFF763FFFFF7E7FE5C | ||||
| :400400000120002384F86A00236702F069FC2A46216F1848FFF755FF144E0027236F9D4216D001F07FFF00B13767236F9D4205DD0120FFF7B3FE336F013305E005DA002094 | ||||
| :40044000FFF7ACFE336F013B336702F071FCE5E7322002F02FFC2A2DCCBF0020012002F07FFABDE8F8400448FFF72BBF8081FF1F193A0000203A00003D3A00002DE9F04F9B | ||||
| :4004800099B062B602F0BEFC9F49042002F0E2FC9E4801F053FF9E4801F084FF9D4801F0B1FF02F06DF902F03FF8002001F0CEFF01F0D2FF0221002000F088FF012001F05D | ||||
| :4004C00001F9954D0321084602F012FC2E462C4602F02EFC95F8643043B1EA6EEB689B1A41F28832934201D9FFF722FF00F0A6FF18B98A48FFF7E5FE04E000F0A5FF0028D3 | ||||
| :40050000F7D134E000F09AFF10B902F011FCF9E78348FFF7D6FE032001F0C0F88148FFF7D0FE002386F86730FFF73EFFFFF74FFE86F87400FFF7FCFE012386F86730FFF701 | ||||
| :4005400033FFFFF744FE86F87500FFF7F1FE96F874007549754B96F87520002A14BF0A461A46002808BF19467148FFF7AAFE032000F076FF0128ABD16E48FFF7EBFE6E49CB | ||||
| :400580000320FFF731FE94F876106C48FFF799FE94F87630023B142B00F2D783DFE813F01500D5031E00D5032400D5035000D5037600D503DA00D503C201D5030903D50356 | ||||
| :4005C0002D03D5033403D5034E0303238DF820308DF8213011238DF822302BE394F87800FFF700FF564B22E340F2DC57FFF7DCFE00232375E068227D02F0FF012AB9EB680B | ||||
| :400600001B1ABB42F7DD0B4611E083B10022174696F87810F068277594F814E0BEF1000F02D1EB681B1AF7E701329142F3DA07228DF8202004228DF82120ADF82230F9E2BF | ||||
| :400640000220FFF77FFD4FF000080DF1200A02F06FFB4FF480790027C9EB0803DA1907F80A200137402FF9D10220FFF76BFD3A465146022000F04CFFB9F10109EBD108F10F | ||||
| :400680000108B8F1400FE2D12E4B38E04FF0010A4FF000080DF1200B02F04AFB4FF0000959460120FFF7A0FD08EB090300270493049B1BF807203B44DBB29A4209D08DE89D | ||||
| :4006C0000C0041463B464A461F48FFF7FAFD4FF0000A0137402FEBD109F10109B9F5807FDED108F10108B8F1400FD5D151461748FFF7E7FDBAF1000F00F01C81144B1B883D | ||||
| :4007000007A8ADF81C3096E255010000F900000091000000C50000008081FF1F523A0000653A00006F3A00004B3A00004F3A0000823A0000E581FF1FF681FF1F9A3A000052 | ||||
| :40074000F4380000F6380000A93A0000C53A0000F8380000206FFFF745FE94F8780001F0FFFD94F8780001F0E3FD02F015FCB94BDFF8FC821A78002702F0FB021A701A785F | ||||
| :4007800042F001021A701A7802F0FE021A701A7802F0FE021A7002F003FC0220FFF7D2FC012141F6FF734FF48042084601F0DEFD84F8B60002F02AFA08F807000137402FA7 | ||||
| :4007C000F8D1DFF8B0A200270AF195091FFA89F80137402F14BF3A4600221AF8010F2244062392F82420402102F044FA424646F24E419AF8000002F04FFA08F14008402FB5 | ||||
| :400800001FFA88F8E4D196F8793053B196F87C30336100233375237D002BFCD000233375336100234FF0FF32236062602372236894F8B600234493F8241002F09FF994F82A | ||||
| :40084000B60002F05DF9012194F8B60002F030F92368002BFCD0002398467360D6F80CA0012702F065FAE368B4F87A20CAEB030393420DD367B1042195F8B60002F08AF9BC | ||||
| :4008800094F8B60002F096F90028F9D107463072237AFBB96A682B689A4202D1002FE0D118E00220FFF74EFC6968402209EB8111022000F02DFE6A68674B01321340002BCA | ||||
| :4008C000BEBF03F1FF3363F03F03013308F101086360C6E70220277AFFF734FC00221146022000F015FE0220FFF72CFCFFB2FFF79BFC002001F01CFD37B15848FFF7E1FC90 | ||||
| :400900000220FFF705FD06E0554B08A81B88ADF82030FFF7EBFC227D4146237A5148FFF7D0FC15E25048FFF7CCFCD4F87A7017F03F0701D0032009E2286FFFF753FD95F83B | ||||
| :40094000780001F00DFD95F8780001F0F1FC012001F098FD02F020FB444BDFF814811A7842F004021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F0BF | ||||
| :400980000FFB01214FF4804341F6FF72084601F01DFD85F8B60002F039F908F807000137402FF8D1DFF8CC90002709F195031FFA83F804930137402F14BF3A46002219F8F2 | ||||
| :4009C000010F2244052392F82420402102F052F9414646F2484299F8000002F05DF908F14008402F1FFA88F8E4D100274FF0FF33376098467360BB463B46D6F87A903772EA | ||||
| :400A00005FEA99190CBF4FF0010A4FF0000A2168114A01310A40002ABCBF02F1FF3262F03F026068B8BF013282426FD02BB1227A002A7AD12A7D002A77D12068049A059368 | ||||
| :400A400002EB8010BAF1000F16D040223F2102F003FB1CE09E6400403F000080CF3A0000FA380000E93A0000FC3A000098640040A481FF1FA381FF1F014601370120FFF7BF | ||||
| :400A8000B3FBC7EB0903D3F1000A4AEB030A2168B34A01310A40002ABEBF02F1FF3262F03F02013222606268059B01322ED12A683F2A2BD14FF00008C5F8048001F0B4FCE9 | ||||
| :400AC00085F808806B6895F8B6002B4493F8241002F054F895F8B60002F012F8012195F8B60001F0E5FF95F87E302B6185F81480237D002BFCD04FF00008012086F814800D | ||||
| :400B000001F09EFC404601F0BDFC00E023B1237A5BB92B7D4BB90123626842453FF477AF0BF1010BD5F8048071E701F083FC012001F0A8FC002001F083FC042194F8B6004D | ||||
| :400B400002F028F894F8B60002F034F880460028F8D196F8B60001F0C1FF337D327A0293012303920193CDF800A05B463A4649467C48FFF7A6FBC6F81080BAF1000F0BD0C6 | ||||
| :400B8000FFF752FB002001F0D3FB237A63B17648FFF797FB0220D9E0B945F1D073490120FFF722FB0137F7E77148FFF78AFB714B3DE094F8780001F0D3FB206FFFF712FC19 | ||||
| :400BC0006D48FFF77EFB94F87930236100232375237D002BFCD0012001F032FC00233375237D002BFCD0002001F02AFC002363483361FFF766FB624B19E0002084F86A0088 | ||||
| :400C0000FFF7F0FB5F4B12E094F8743023B195F875200AB985F8782094F875201AB113B9012385F878305848FFF794FB574B1B88ADF8203008A8FFF759FB89E0FFF778FB0D | ||||
| :400C400001F01CFE002001F0BFFD2A2701F0EAFC002001F08DFC3A46002108A802F0FCF917238DF820308DF8217002F061F8002001F052FB002001F0E9FBC82002F01AF8F3 | ||||
| :400C80000DF12200FFF7E8FA0DF13600FFF705FB02F04EF8012001F0D9FB322002F00AF80DF12600FFF7D8FA0DF13A00FFF7F5FA012001F031FB4FF4967001F0FBFF02F041 | ||||
| :400CC00037F80DF12E00FFF7C7FA0DF14200FFF7E4FA002001F020FB4FF4967001F0EAFF02F026F8022001F0B1FB322001F0E2FF0DEB0700FFF7B0FA0DF13E00FFF7CDFAF4 | ||||
| :400D0000012001F009FB4FF4967001F0D3FF02F00FF80DF13200FFF79FFA0DF14600FFF7BCFA002001F0F8FA4FF4967001F0C2FF01F0FEFF002001F089FB002384F86A302F | ||||
| :400D400001F01EFD01F0F0FB74E70120FFF7E0FA032000F0A3FC0E48FFF7B3FAFFF7B8BB3F000080063B0000363B00003892FF1F403B0000FC380000483B0000563B00000F | ||||
| :400D8000FE38000000390000F681FF1F02390000633B00000F4B1A78120616D55878C0B2012814D11B79DBB2042B02D0052B05D07047094A094B5A60282203E0084A074B07 | ||||
| :400DC0005A60E0221A8000F043BE002070470120704700BF0060004004390000BC92FF1F2C3900002DE9F04172B6884B61221A70A3F5F06301221A801924854A9C7092E807 | ||||
| :400E000003008033062283F8002283E80300522203F580731A707F4B7F4A1B787F4EDBB2137040F618027E4B00251A8041F2512223F8022C33784FF4F07003F0010343EAA4 | ||||
| :400E4000450502F0A1F8013C05F003052ED0032DF0D1744B4FF480721A8007221A70724A002548211570917002221D705D7103F8032C0422DA716D4A6D4C13786D4E43F060 | ||||
| :400E80000103137012F8013C062743F0030302F8013C2378012243F0800323705B4B1A70654A137843F02003137000E0FEE707FB056300219A881868013502F0CDF8072D6A | ||||
| :400EC000F5D15E485E4E002550F8041F05F1105303F14A0221F0FF074B33C9B20B4452005B0002329A4206D012F802EC12F801CC0EF807C0F5E7B0420D44E5D1514A002390 | ||||
| :400F000013609360136193614F4B504F1A68504BDFF888811A604F4B1A684F4B1A604F4A137843F002031370137C43F0020313742378A2F5863243F040032370413A1378DD | ||||
| :400F400043F010031370464A464B07CA03C31A80454A2833106843F8250C127903F8212C424A07CA03C31A80414AE83B07CA03C31A80404A083307CA03C31A803E4A3F4B11 | ||||
| :400F8000A2F5616203CBC2F8100EC2F8141E1378042043F008031370394B02F5AA521B783D78DBB298F80060EDB203F007010C321B091170F6B2537045F003033B7046F095 | ||||
| :400FC000030388F800302F4B48221A702E4A402313702E49937013729372082382F81F3220220A7048710A72294A0A20137001F077FE284B88F8006044223D70264D1A709B | ||||
| :4010000094E80F0007C52B80BDE8F08100480040680A00480F010049A146004025420040224200400440004006400040A2430040A0430040683B0000E8460040FCFFFF47E7 | ||||
| :401040009000004800760040700A0048F846004020760040740A00482876004003500140280A0048C0510040340A00483C0A0048480A0048540A004832510040600A004800 | ||||
| :40108000CF0100491D51004001590040235B0040585B004076580040B0430040F946004008B501F0ADFF03680C2B00D1FEE7FEE7084908B50B68084A1844821A802A01DC75 | ||||
| :4010C000086005E001F09CFF0C2303604FF0FF33184608BDCC80FF1F8893FF1F80B51148114B0025C0B1A3F1100192C922460439161BB74204D051F8046F42F8046BF7E7E8 | ||||
| :40110000114653F8046C8C1AA64202D041F8045BF9E701381033E5E701F078FFFFF7AEF9FEE700BF01000000FC3C0000124A134B10B51A60124A134C1368134843F4007367 | ||||
| :4011400013600023032B98BF54F823204FEA830188BF0E4A0133302B4250F3D10C4B1A780C4B1A700C4B084A1A60FFF73BFEBDE8104001F087BC00BF0004FA050CED00E0A4 | ||||
| :4011800014ED00E0000000000080FF1FA1100000BC760040C080FF1F08ED00E0F8B501F0FBFE4B4A01271378022643F001031370137C484C43F001031374474B02F5E352FA | ||||
| :4011C0001F700B3203F8946C1378054603F07F031370002001F084FD2378404A03F0F90323701378384603F0DF03137023783B43237001F075FD282001F072FD384B304610 | ||||
| :401200001A7802F07F021A701A7802F0BF021A7023783343237001F063FD2378314A43F0040323700023137053702F4AFF2199540133092BFBD1284601F0B2FE07211720E7 | ||||
| :4012400001F096FD2949172001F084FD0721182001F08EFD2649182001F07CFD0721152001F086FD2349152001F074FD0721052001F07EFD2049052001F06CFD072106201F | ||||
| :4012800001F076FD1D49062001F064FD0721084601F06EFD1A49072001F05CFD0721082001F066FD1749082001F054FD0021162001F05EFD1449162001F04CFD07210C2014 | ||||
| :4012C00001F056FDBDE8F84010490C2001F042BDA5430040944300409D60004012600040F851004084600040AD92FF1F6B1B0000A5190000691B00009D1A0000C91A0000BE | ||||
| :40130000F91A0000311B0000711B0000E51B0000214B224A10B5187000231370204A40201370204A0F2413701F4A13701F4A13701F4A13701F4A13701F4B4FF400021A60B1 | ||||
| :401340004FF080721A604FF400121A6020221A601860802018604FF480701860174804704FF480001860164B1A70933B19B91A7802F0FE0202E01A7842F001021A70114B50 | ||||
| :4013800003221A70802203F8202C012001F0FCFD0D4B04221A7010BDC892FF1FCE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F00E100E09E6000407A | ||||
| :4013C0009C600040286000401260004070B5074C054623780E461BB9FFF7E0FE0123237031462846BDE87040FFF792BF7892FF1F0A4A002313700A4A13700A4A13700A4A81 | ||||
| :4014000013700A4A13700A4A13700A4A13700A4B03221A70802203F8202C7047CE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F28600040014B187898 | ||||
| :40144000704700BFCD92FF1F044B1A7802F0FF001AB118780022C0B21A707047CC92FF1F024A0C2303FB002040787047D492FF1F431E072B0CD8074A064B00010344805C32 | ||||
| :401480005B7800F00F0043EA0020023880B2704700207047FC5F00401A4A38B50C2303FB00231B79090C13F0800F00F1FF35044619BF8AB24FF480438BB24FF48042032DA1 | ||||
| :4014C00018D8DFE805F002070C110021084601F0A1FA0DE00021084601F080FA08E00021084601F05FFA03E00021084601F03EFA054B1855EDB2072D03D801F087FB034B10 | ||||
| :40150000185538BDD492FF1FA492FF1FAD92FF1F431E072B2DE9F0470446894615465CD82F4F0C2202FB0072D388DFF8B8A09BB2C3F500739D424FF00C0303FB007388BF8A | ||||
| :40154000D588DB7884BFC5F50075ADB2254A43EA15230601B354B244EBB28AF80130224B1A5C9846FF2A01D1FFF796FF0C2303FB047200215170B9F1000F28D03DB31B4FEB | ||||
| :40158000385D01F0ABFA11232946FE2218F8040001F070FB06F5C04278321FFA89F118F8040001F079FB124D18F80410385D01F0E5FA0121385D01F07BFA735D43F002030D | ||||
| :4015C0007355735D03F0FD037355BDE8F08703FB04746379DBB28AF80230BDE8F08700BFD492FF1FFC5F0040AD92FF1FA492FF1F706000402DE9F047044615468846002945 | ||||
| :4016000040D0431E072B3FD8FFF732FFA84203D22046FFF72DFF05461D4E335DFF2B03D141462046FFF738FFDFF868A027011AF8040001F053FA1223FE222946305D01F087 | ||||
| :4016400019FB07F5C0411FFA88F27831305D01F023FBDFF84490315D1AF8040001F08EFA01211AF8040001F023FA17F8093043F0020307F8093017F8093003F0FD0307F881 | ||||
| :40168000093002E00D4600E000252846BDE8F087AD92FF1FA492FF1F70600040431E072B0AD8064A0C2303FB002300225A705A79034BD2B200011A54704700BFD492FF1F5D | ||||
| :4016C000FE5F0040431E072B9FBF024B000108221A547047FE5F004030B51A4A1A491B4D0878138803449BB21380194A00231488D8B2A4B27CB1082B0CD050680078C0B2EC | ||||
| :40170000E85450680133013050601088013880B21080ECE718460B780E4C082B0E4A00D040B10E4D2B7883F080032B700F232370022301E0022323701370094B18700870CA | ||||
| :4017400030BD00BF4493FF1F4093FF1F00600040BC92FF1FB992FF1FCE92FF1FCA92FF1F4193FF1F074B02221A70074B80221A70064B0F221A70064A00231370054A012088 | ||||
| :4017800013707047CE92FF1FCA92FF1FB992FF1F4093FF1F4193FF1F30B5164B16491B780A8803F00F03023BDBB21A4492B20A80124C134A0020118889B279B173B155682C | ||||
| :4017C000215C013BC9B229705168DBB20131516011880130013989B21180ECE7094A1370094A137883F080031370084B0B221A7030BD00BF296000404493FF1F006000400F | ||||
| :40180000BC92FF1F4193FF1FCA92FF1FB992FF1F064A06231370064A01201370054B80221A70054B00221A70704700BFCE92FF1FB992FF1FCA92FF1F4193FF1F054B9A68E4 | ||||
| :401840003AB19A68044910709A680988518000229A607047BC92FF1F4493FF1F08B5124B1A78D2B21A701B78DBB21A0602D50F4A137008BD0220FFF7E1FF0D4B1B7803F0CE | ||||
| :401880006003202B05D0402B06D043B900F012FC04E001F089FB01E0FFF77CFA10B9034B03221A7008BD00BF28600040B992FF1F0060004008B5084A084B012019781388FA | ||||
| :4018C0000B449BB21380064B00221A70FFF7B6FF044B03221A7008BD4493FF1F4093FF1FCE92FF1FB992FF1F08B50C4B1B78DBB2042B07D0062B09D0022B0DD1BDE8084045 | ||||
| :40190000FFF7D8BFBDE80840FFF746BF0320FFF795FF034B03221A7008BD00BFCE92FF1FB992FF1F08B5054B002201201A70FFF785FF034B03221A7008BD00BFCE92FF1FCA | ||||
| :40194000B992FF1F08B50A4B1A7832B11A78094942F080020A7000221A70074B002201201A70FFF76BFF054B03221A7008BD00BFB892FF1F08600040CE92FF1FB992FF1FC0 | ||||
| :40198000074B1B78DBB2042B05D0062B05D0022B05D1FFF7A1BEFFF7C5BFFFF7D3BF7047CE92FF1F38B51D4C2378DBB2DD0634D518060AD503F00F03012B2ED1FFF74EFF42 | ||||
| :4019C000174B1B78190609D538BD5A0602D5FFF7D7FF03E09D0620D5FFF786FF23781B061BD4104B1A78104B1B7813430F4A13701278934211D10A4A0849154613782078EB | ||||
| :401A0000DBB2000605D41378DBB20B700B7803F00F0328788342F1D138BD38BD28600040B992FF1FCA92FF1F4193FF1F29600040054A00231380054A916819B191680B701D | ||||
| :401A400092685380704700BF4493FF1FBC92FF1F0E4808B503889BB213B9FFF783FE13E00B4B02221A700B4B00221A70FFF7E0FF094AD1799379028843EA012392B2934229 | ||||
| :401A800038BF0380FFF728FE012008BDBC92FF1FCE92FF1FCA92FF1F00600040084B01221A700F3B9B7C074B1A7B02F00302012A1EBFDA7B82F08002DA7301225A73704722 | ||||
| :401AC0000B600040D492FF1F094B02221A700F3B93F82230074B1A7E02F00302012A1EBFDA7E82F08002DA7601225A76704700BF0B600040D492FF1F0B4B04221A700F3B21 | ||||
| :401B000093F83230094B93F8242002F00302012A1EBF93F8272082F0800283F82720012283F82520704700BF0B600040D492FF1F0B4B08221A700F3B93F84230094B93F856 | ||||
| :401B4000302002F00302012A1EBF93F8332082F0800283F83320012283F83120704700BF0B600040D492FF1F7047FFF741BC0000F0B5184B184E19780C27C9B201234FF028 | ||||
| :401B8000000C31B3CA0720D5144A4FEA031E7244947850782040C5070DD507FB03652C79240608D5147804F0FE0414706D790C4CEDB204F80E50840706D507FB036425795F | ||||
| :401BC0002D0658BF84F801C090700133DBB24908D7E7F0BD9F600040D492FF1F70600040FE5F004000F032BF70B50446184B88B003AA03F11006154618685968083303C530 | ||||
| :401C0000B3422A46F7D11B782B70FCB12223237001AD03232846637001F024F9002220461146AB5C08AC04EB131414F8144C03F00F03847008AC234413F8143C0132082AB1 | ||||
| :401C4000C1700371417100F10400EAD108B070BD923B00002DE9F0431C4D01222E460C201F274FF0800E4FF0080C194B00FB02581401234418705F70164998F8059021445B | ||||
| :401C8000B9F1000F07D098F8044024064CBF887081F802C001E081F802E000FB0261CC880132E4B29C71CC88092AC4F30724DC71CC88E4B21C71C988C1F307215971D4D1CB | ||||
| :401CC000054BFF221A70BDE8F08300BFD492FF1F70600040FC5F00400A600040064B074A1B7802EBC30253681A7C824286BF03EBC003586900207047C892FF1FB83B000044 | ||||
| :401D00002DE9F84F424B1A78002A7ED01878414D0138C0B2FFF7E2FFA8463F4AC3681478007ADFF800C1E4B203EBC0000C2600274FF0010E834268D01A78A24263D11CF829 | ||||
| :401D40000420597891425ED19A7893F8039002F07F0206FB02FA05EB0A01CF7093F802B009F0030981F804B093F803B005F80AB0B3F804A0A1F808A093F902A0BAF1000FB6 | ||||
| :401D80000BDAB9F1010F0CBF4FF007094FF00D0981F8059081F801E009E0B9F1010F0CBF4FF005094FF0090981F805904F704FEA02191A4906FB0282494481F802E0B2F806 | ||||
| :401DC00008A0CAF3072A81F800A0B2F808A05FFA8AFA81F801A0B2F806A011495FFA8AFA494481F806A0B2F80690C9F3072981F80790B2F806905FFA89F981F80490D288FA | ||||
| :401E0000C2F307224A71083394E7BDE8F88F00BFCD92FF1FD492FF1FC992FF1FFC5F004070600040BA92FF1F08B5064B18780138C0B2FFF753FF20B143681B7900EBC3008A | ||||
| :401E4000406908BDCD92FF1F00212DE9F84F0B464E4E0C2707FB01F401313219092933554FF000059370494CD3701381937253705371EFD118B1464B1D70464B1D70464B16 | ||||
| :401E80001A78002A7FD0187801250138C0B2FFF725FFA8464368DFF8F8E0DB790C2713F0400F3E4B4FF0000C1A7814BF42F0010202F0FE021A70027AD20007FB0541C368D0 | ||||
| :401EC00003EB02094B4531D093F802A00AF07F06AE4229D10E89B3F804B0B6B25E4538BFA1F808B01E7893F801B01EF80660B3451AD181F804A0DE780E7093F902A0DE78D3 | ||||
| :401F0000BAF1000F06F0030607DA012E0CBF07260D264E7181F8018006E0012E0CBF052609264E7181F801C00833CBE70135092DC3D1C1680A328B1C0A440C20083393423E | ||||
| :401F400009D013F8081C13F80A5C01F07F0100FB01418D72F2E7FFF767FF114B0121186000230C2000FB0142D3801289013113449BB203F00102134409299BB2F2D1BDE88B | ||||
| :401F8000F84FFFF767BEBDE8F88F00BFD492FF1FBA92FF1F4293FF1FCD92FF1FCB92FF1FD092FF1F114B1B7903F07F035A1E072A19D80F490C2202FB031291781B0141F08E | ||||
| :401FC000010191700021D170517841F002015170127912F0800F074A1A4414BF8D2389239370FFF715BC0020704700BF00600040D492FF1FFC5F004030B4194B1A7902F0D8 | ||||
| :402000007F02531E072B27D8164B0C2404FB02339978154D01F0FE0199700021D97029461201505D114400F07F0050555A7802F0FD025A701A795B78120605D5012B01D167 | ||||
| :402040008C7006E00D2303E0012B0CBF082309238B7030BCFFF7DCBB002030BC704700BF00600040D492FF1FFC5F004010B50D4B0D4C21791878C9B20138C0B2FFF72EFE80 | ||||
| :4020800043681B798B4201D2012909D8074A0848535CDBB24354A3780120DBB2535410BD002010BDCD92FF1F00600040BA92FF1F4293FF1F38B5874A874C13780021DBB254 | ||||
| :4020C00021801806517840F188800A2900F20081DFE811F05800FE00FE00FE00FE00FE000B00FE007900FE007D00D3787949012B09D17A4B1A787A4B03EBC2035B685B68FE | ||||
| :402100006360122310E0CB78022B12D18878FFF7E5FD002800F0DC80436863606368DA7863689B7843EA02232380BDE83840FFF78FBCCB78032B21D16A4B00228878D5B29B | ||||
| :40214000854203D3634A92783AB910E0187801320028F7D018780344F0E75E4A62499278097C914203D16148FFF73EFD5F4B1A78002A00F0AD801A78228018E0BDE8384099 | ||||
| :4021800000F012BF13F0030313D0022B40F0A0802380504B0C211B7903F07F02544B01FB02339A78534BD2B21A7000225A706360BBE702222280504A11784E4AC9B2117026 | ||||
| :4021C00053706260B1E7012323804C4BEFE70123238013794A4A1344E9E701390A2977D8DFE801F037764F76067676760A7620009378444ADBB25AE0937803F0FF0153B928 | ||||
| :402200003E4B1A7891425FD019703F4B01201870FFF71AFE58E0481EC0B2FFF75FFD0028EED155E0FFF722FF002851D0294A374913791279DBB2D2B20A70354A3049D25C1E | ||||
| :40224000CB5C9A4240D0304B01221A70FFF758FD3AE003F00303012B2BD009D3022B37D11C4B9B78002B33D1BDE83840FFF7C4BE184B9B78012B2BD11F4A137803F0FD03CA | ||||
| :4022800015E003F00303012B13D008D3022B1FD1104B9B78E3B9BDE83840FFF783BE0D4B9B78012B14D1144A137843F0020313700AE0084B1A795AB998781B791549DBB239 | ||||
| :4022C000CA5C22EA0002CA54BDE83840FFF7A0BA002038BD00600040BC92FF1FC892FF1FB83B00001C3C00008F3C00006093FF1FD492FF1F7992FF1FCB92FF1FCD92FF1FBA | ||||
| :40230000BA92FF1FB892FF1FCC92FF1FC992FF1F4293FF1FCF92FF1F014B1870704700BF72640040014B1878704700BF68650040014B1870704700BF7A650040064A0123C8 | ||||
| :40234000136002F688321268E0211064034A1170A2F540721360704780E100E000E400E0014B1870704700BF7A64004073B515461E460B4C04230022019200920A46014658 | ||||
| :402380001846237000F022FC32462946207800F0DDFB0221207800F0C7FB207802B070BDD080FF1F074A0223136002F688321268E0215064044A11706FF440710A44136017 | ||||
| :4023C000704700BF80E100E001E400E073B515461E460B4C05230022019200920A4601461846237000F0F2FB32462946207800F0ADFB0221207800F097FB207802B070BD84 | ||||
| :40240000D180FF1F064A0423136002F688321268E0219064034A1170A2F202321360704780E100E002E400E0014B04221A60704700E100E0014B04221A60704780E100E013 | ||||
| :40244000014B1870704700BF7B650040014B1870704700BF73640040704738B505460078012428B100F038FD285D0134E4B2F8E738BD08B50D2000F02FFDBDE808400A20C6 | ||||
| :4024800000F02ABD014B1870704700BF7865004010B500F081FD204A044613780A2043F002031370137C43F00203137412F80A3C43F0010302F80A3C937943F0010393712B | ||||
| :4024C00002F5AB52137843F003031370134B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222183B1A70094A137843F0AA | ||||
| :402500000803137000F0ECFB064B10222046BDE810401A6000F044BDAB4300400E5900402F5B004080E200E008B500F035FD0F4A137803F0FE031370A2F5AA521D3A13785D | ||||
| :4025400003F0FD031370137C03F0FD03137412F80A3C03F0FE0302F80A3C937903F0FE039371BDE8084000F01BBD00BF08590040044A137803F03F0343EA8010C0B2107082 | ||||
| :40258000704700BF08590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A8042F210734B4341F2E4 | ||||
| :4025C000883103F6C41393FBF1F305490B60054B1A8070470A590040A43B00004A93FF1F4C93FF1F5093FF1F08B5102000F036FA0721042000F0BCFB0749042000F0AAFB02 | ||||
| :40260000064A0C20137843F006031370FFF7BCFF034B00221A8008BDE1260000095900404893FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040FFF72ABF7B92FF1FA6 | ||||
| :40264000044B1A7802F0FB021A701A7842F001021A7070470859004010B5084B1C7814F0010403D10028F9D0002404E0204600F037FB024B1B78204610BD00BF09590040D9 | ||||
| :40268000034A044B1B881088181A00B2704700BF5093FF1FA25B00400E4A13881BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107300B203FB00F20223F1 | ||||
| :4026C00091FBF3F30028D8BF5B42134493FBF1F000B270474A93FF1F4C93FF1F4893FF1F7047000010B500F057FC214A044613780A2043F001031370137C43F001031374BC | ||||
| :4027000012F80A3C43F0020302F80A3C937943F00203937102F5AA521832137843F003031370144B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CBE | ||||
| :40274000CE2203F8062CA3F597530222123B1A70094A137843F00803137000F0C1FA074B08222046BDE810401A6000F019BC00BFAB43004006590040275B004080E200E0CF | ||||
| :4027800008B500F009FC0F4A137803F0FE031370A2F5AA52153A137803F0FE031370137C03F0FE03137412F80A3C03F0FD0302F80A3C937903F0FD039371BDE8084000F0BB | ||||
| :4027C000EFBB00BF00590040044A137803F03F0343EA8010C0B21070704700BF00590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF095 | ||||
| :40280000000298BF33F910100A4B88BF11461A8042F210734B4341F2883103F6C41393FBF1F305490B60054B1A80704702590040AE3B00005693FF1F5C93FF1F5493FF1FFC | ||||
| :4028400008B5102000F014F90721032000F090FA0749032000F07EFA064A0C20137843F006031370FFF7BCFF034B00221A8008BD39290000015900405893FF1F10B5054C6D | ||||
| :4028800023781BB9FFF7DCFF01232370BDE81040FFF728BF7C92FF1F044B1A7802F0FB021A701A7842F001021A7070470059004010B5084B1C7814F0010403D10028F9D0AE | ||||
| :4028C000002404E0204600F00BFA024B1B78204610BD00BF01590040034A044B1B881088181A00B2704700BF5493FF1FA05B00400E4A13881BB223B111880A2309B25943E7 | ||||
| :4029000001E00B4B19680B4B1B88C01A42F2107300B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F000B270475693FF1F5C93FF1F5893FF1F70470000014B1870E9 | ||||
| :40294000704700BF7B640040014B1870704700BF7F640040014B1870704700BF7C640040014B1870704700BF7E640040F7B516461F460B4C00230325019300930A460146B2 | ||||
| :402980002846257000F022F93A463146207800F0DDF80221207800F0C7F8207803B0F0BDE080FF1FF7B516461F460B4C00230225019300930A4601462846257000F006F917 | ||||
| :4029C0003A463146207800F0C1F82946207800F0ABF8207803B0F0BDE180FF1FF7B516461F460B4C00230125019300930A4601462846257000F0EAF83A463146207800F06F | ||||
| :402A0000A5F80221207800F08FF8207803B0F0BDE280FF1F73B515461E460B4C0023019300930A4601461846237000F0CFF832462946207800F08AF80221207800F074F880 | ||||
| :402A4000207802B070BD00BFE380FF1F024B1878C0F38010704700BF8F450040034A00F0F800137803431370704700BF02410040034A00F0F800137803431370704700BF74 | ||||
| :402A800006410040074A7F23802113705170064A013BDBB202F80839002BF9D1034A1370704700BFE480FF1FF87B00400078004017280FD8084B0001C25C11B142F020028D | ||||
| :402AC00001E002F0DF02C254C25C42F00102C25400207047012070471070004017280BD8064B0001C25C02F0FE02C254C25C02F0DF02C25400207047012070471070004024 | ||||
| :402B000017280DD8074900010B4603441A7942F004021A71435C43F00103435400207047012070471070004017280BD8064A0001835C490003F0F10301F00E0119438154A3 | ||||
| :402B400000207047012070471070004041F6FF73994208BF4FF400519A4208BF4FF4005217289FBFC00000F1804000F5EC4081809ABFC280002001207047000017289FBF6F | ||||
| :402B8000034B00011954002088BF0120704700BF1970004017289FBF054B00011A5C01F007019DBF1143195400200120704700BF1470004017289FBF034B0001185C00F04D | ||||
| :402BC000070088BFFF20704714700040172810B51AD8C00001F07F0100F1804441EAC21204F5EC44D2B222709DF8082003F00F0343EA0213DBB263709DF80C30002003F08B | ||||
| :402C00000F03A370E07010BD012010BD10B500F0C3F90A4A5378182B0AD91478013B5370E30003F1804303F5F0431B78137000E0FF2400F0B5F9204610BD00BFE480FF1F33 | ||||
| :402C4000030610B5044611D400F0A6F9084AE300117803F1804303F5F04319705378147001335370BDE8104000F09AB910BD00BFE480FF1F30B504060CD411F4704509D1B0 | ||||
| :402C8000C40004F1804404F5F0442180A270E370284630BD012030BD03065FBFC00000F1804000F5F04081805ABFC280002001207047000038B50446084DB4F5004F05D988 | ||||
| :402CC000286800F061F9A4F50044F6E7034B58686043BDE8384000F057B900BFEC80FF1F024B1B7A584300F04FB900BFEC80FF1F0E4B00F003001A78490102F0FC02104300 | ||||
| :402D000018701A7801F0600142F080021A701A7802F07F021A701A7802F09F020A431A701A7842F010021A70704700BF83430040014B01221A70704784430040044B00F08C | ||||
| :402D40000F021B6853F8220043F82210704700BF08ED00E0054A00F01F00126800F1100352F8230042F82310704700BF08ED00E000F01F0000F16040490100F56440C9B29B | ||||
| :402D8000017070470F4B10B50F4900240F205C609C60DC601C615C61FFF7D0FF0B4A136843F0040313600A4B4FF47A72DB68B3FBF2F3084A1360084B4FF400421C60C3F883 | ||||
| :402DC000E82010BD8092FF1F312E000010E000E0EC80FF1F14E000E018E000E0024A136843F002031360704710E000E008B5FFF7F5FF034A136843F00103136008BD00BFD3 | ||||
| :402E000010E000E010B5054CA3691BB9FFF7BAFF0123A361BDE81040FFF7E8BF8092FF1F024B1868C0F30040704700BF10E000E038B5FFF7F5FF012808D1054D002455F891 | ||||
| :402E4000243003B198470134052CF8D138BD00BF8492FF1F024B03EB80035868596070478092FF1F134B144A1B78DBB20360127843EA0223114A0360127843EA0243104A07 | ||||
| :402E80000360127843EA026303600E4B0E4A1B78DBB24360127843EA02230C4A4360127843EA02430A4A4360127843EA02634360704700BF0301004904010049EC460040B2 | ||||
| :402EC000020100490101004900010049050100490601004900000000FEB5494652465B460EB40746244909688A46244A12682448022100F071F8030020480068C018204936 | ||||
| :402F000000F06AF8143883460121C9430C460125002600F041F8814651460B7823400B705846013000F030F83800F04028400B78234003430B70584600F026F80136072E00 | ||||
| :402F4000F2D9002001300138013001200B78234003430B705846043000F016F8484600F01FF800BF00BF00BF0EBC894692469B46FEBD00BFAFF30080D480FF1FF880FF1F6B | ||||
| :402F800000C20100000000000230800803D000BF01380046FCD17047EFF3108072B6704780F31088704700BF094A137803F00303012B0AD0022B09D113790C2103F07F021C | ||||
| :402FC000044B01FB02339B7A00E013790020704700600040D492FF1F002902D0B0FBF1F0704708B14FF0FF3000F008B80029F8D00246B0FBF1F000FB11217047704700BFA1 | ||||
| :40300000014B1868704700BF5C81FF1F0E4B70B51E460E4C0025E41AA410A54204D056F8253098470135F8E700F04EFE084B094C1E46E41AA4100025A54204D056F8253071 | ||||
| :4030400098470135F8E770BDD43C0000D43C0000D43C0000DC3C000003460244934202D003F8011BFAE7704730B5141E05469BB0184604DA8B232B604FF0FF301DE04FF432 | ||||
| :403080000273ADF80C300CBF234604F1FF33029305934FF6FF7300910491ADF80E3002461E9B6946284600F073F8431CBCBF8B232B6014B1009B00221A701BB030BD000022 | ||||
| :4030C00007B5009313460A46014603480068FFF7CBFF03B05DF804FB5C81FF1F2DE9F0478E6882469E420C46914698463ED88A8912F4906F3AD02568096902236F1A656977 | ||||
| :4031000005EB450595FBF3F57B1C43449D4238BF1D4653050FD5294600F04AFB064698B13A46216900F0D2FAA38923F4906343F08003A38113E02A4600F098FB064670B9E0 | ||||
| :403140002169504600F0E8FA0C23CAF80030A3894FF0FF3043F04003A381BDE8F08726613E44266046466561ED1BA560464528BF464649463246206800F0B3FAA3680020A9 | ||||
| :403180009B1BA36023681E442660BDE8F08700002DE9F04F9DB003938B8980461C060D4616460DD50B695BB9402100F001FB2860286118B90C23C8F80030CDE040236B6150 | ||||
| :4031C0000023099320238DF82930DFF89CB130238DF82A3037463C4614F8013B1BB9B7EB060910D003E0252BF9D02746F3E74B46324629464046FFF771FF013000F0A780FE | ||||
| :40320000099B4B4409933B78002B00F0A08000234FF0FF3204930793059206938DF853301A930126052221784E4800F041FA671C049B38B14B4A3C46801A06FA00F0184379 | ||||
| :403240000490EFE7D90644BF20228DF853201A0744BF2B228DF8532022782A2A03D0079A00210A200BE0039A111D12680391002A10DA524243F00200079204900BE027468C | ||||
| :403280003B780134303B092B03D800FB02320121F5E701B107923B782E2B1ED17B782A2B0AD1039B02371A1D1B680392002BB8BF4FF0FF33059310E0002319460593781CA7 | ||||
| :4032C0000A2407463A780130303A092A03D804FB01210123F5E703B1059103223978224800F0E6F940B14023CBEB000003FA00F0049B013718430490397806221B487E1CEB | ||||
| :403300008DF8281000F0D4F988B1194B33B9039B073323F007030833039314E003AB00932A46144B04A94046AFF3008007E003AB00932A460F4B04A9404600F093F8B0F12A | ||||
| :40334000FF3F824603D0099B5344099342E7AB895B0601D4099801E04FF0FF301DB0BDE8F08F00BFA33C0000A93C0000AD3C000000000000DD3000002DE9F04791461F4627 | ||||
| :403380000A698B6806469342B8BF1346C9F8003091F843200C46DDF8208012B10133C9F800302368990642BFD9F800300233C9F80030256815F0060510D104F1190A07E05B | ||||
| :4033C0000123524639463046C04701301AD00135E368D9F800209B1A9D42F1DB94F843302268003318BF012392060FD5E118302081F843005A1C94F845102244023382F884 | ||||
| :40340000431003E04FF0FF30BDE8F08704F1430239463046C0470130F4D02268D9F80050E36802F00602042A08BF5D1B2269A3680CBF25EAE57500259342C4BF9B1AED1843 | ||||
| :403440004FF000091A344D4509D00123224639463046C0470130D5D009F10109F3E70020BDE8F0872DE9F04317460A7E85B06E2A984606460C460C9B01F1430E00F0AE8054 | ||||
| :4034800011D8632A22D009D8002A00F0BB80582A40F0CA8081F84520834955E0642A1ED0692A1CD0C0E0732A00F0B08009D86F2A2ED0702A40F0B8800A6842F020020A6091 | ||||
| :4034C0003EE0752A24D0782A3AD0ADE01A6801F14205111D1960136884F84230A8E021681A6811F0800F02D0111D196008E011F0400F02F10401196002D0B2F9003000E045 | ||||
| :403500001368002B3CDA2D225B4284F8432037E021681A6811F0800F02D0111D196007E011F0400F02F10401196001D0138800E01368227E5C496F2A14BF0A2208221BE068 | ||||
| :4035400078225A4984F845202268186812F0800F00F104051D6003D1550601D5038800E00368D00744BF42F0200222601BB9226822F0200222601022002084F8430001E08A | ||||
| :4035800049490A226568002DA56008DB206820F0040020602BB9002D7DD175460CE0002B79D07546B3FBF2F002FB1033CB5C05F8013D03460028F5D1082A0BD12368DA0737 | ||||
| :4035C00008D5236962689A42DEBF302305F8013C05F1FF35C5EB0E0323612EE008681A6810F0800F496903D0101D1860136808E010F0400F02F104001860136801D0198064 | ||||
| :4036000000E0196000232361754616E01A68111D1960156800216268284600F049F808B1401B6060636804E004F1420584F8422001232361002384F84330CDF800803B468C | ||||
| :4036400003AA21463046FFF797FE013002D14FF0FF3026E023692A4639463046C0470130F5D023689B0710D5002504F1190907E001234A4639463046C0470130E7D00135CC | ||||
| :40368000E368039A9B1A9D42F2DBE068039B9842B8BF184605E00B7804F1420584F842308AE705B0BDE8F083923B0000B43C000010B5C9B202449042034605D01C78013064 | ||||
| :4036C0008C42F8D1184610BD002010BD10B5431E0A44914204D011F8014B03F8014FF8E710BD884210B501EB020301D8421E0BE09842FBD28118D21AD34204D013F8014DA2 | ||||
| :4037000001F8014DF8E710BD994204D011F8014B02F8014FF8E710BD38B50546002944D051F8043C0C1F002BB8BFE41800F0D4F81E4A1368114613B96360146030E0A342E7 | ||||
| :403740000DD92268A018834201BF18685B681218226063600C6023E0A24203D813465A68002AF9D118681918A1420BD12168014458188242196013D11068526801441960EE | ||||
| :403780005A600DE002D90C232B6009E021686018824201BF106852680918216062605C602846BDE8384000F098B838BDA092FF1F70B5CD1C25F0030508350C2D38BF0C2534 | ||||
| :4037C000002D064601DBA94202D90C23336046E000F082F8234B1C681A462146A1B10B685B1B0ED40B2B03D90B60CC18CD501EE08C420BBF63684B681360636018BF0C4695 | ||||
| :4038000015E00C464968E9E7174C23681BB9304600F052F820602946304600F04DF8431C18D0C41C24F00304A0420DD12560304600F053F804F10B00231D20F00700C31A48 | ||||
| :403840000ED05A42E25070BD211A304600F034F80130EBD10C233360304600F03EF8002070BD00BFA092FF1F9C92FF1FF8B5074615460E4621B91146BDE8F840FFF798BFAB | ||||
| :403880001AB9FFF749FF2846F8BD00F027F885420ED929463846FFF78BFF044650B131462A46FFF713FF31463846FFF735FF01E03046F8BD2046F8BD38B5064C002305467D | ||||
| :4038C00008462360FDF7F4FB431C02D1236803B12B6038BD8493FF1F7047704751F8040C0028BEBF091851F8043CC0180438704700000000050209020B020D020F021102BB | ||||
| :403900001302150228000000000104000100000000000000000157494E55534200003030303031000000000000000000E0000000000105000100D6000000070000002A0075 | ||||
| :4039400044006500760069006300650049006E0074006500720066006100630065004700550049004400730000009E0000007B00330064003200370035006300660065004E | ||||
| :403980002D0035003400330035002D0034006400640035002D0061006300630061002D003900660062003900390035006500320066003600330038007D0000007B00330058 | ||||
| :4039C00064003200370035006300660065002D0035003400330035002D0034006400640035002D0061006300630061002D00390066006200390039003500650032006600B4 | ||||
| :403A00003600330038007D00000000007265706C792030782530327800686F6D696E6700626567696E6E696E67207365656B2066726F6D20256420746F2025640066696E14 | ||||
| :403A40006973686564207365656B00796573006E6F0057616974696E6720666F72205553422E2E2E00555342207265616479005363616E6E696E67206472697665732E2E1C | ||||
| :403A80002E00647269766520303A20257320647269766520313A20257300636F6D6D616E6420307825303278006661696C2025642B25642B2564203D3D2025642C206E6F40 | ||||
| :403AC00074202564007061737365643D256400756E64657272756E206166746572202564207061636B65747300636F756E743D256420693D256420643D256400636D645FEF | ||||
| :403B0000777269746500703D25642063723D25642063773D256420663D256420773D256420696E6465783D256420756E64657272756E3D256400756E64657272756E210015 | ||||
| :403B4000737563636573730073746172742065726173696E670073746F702065726173696E670069646C650000510040100040510040300000000140001000140140000858 | ||||
| :403B800000400140000A004C01400002005001402000303132333435363738394142434445460000000100000004000000100001000000040000001001000000C03B000072 | ||||
| :403BC000010000008F3C0000000000000000000001000000D83B000001000000613C000004000000FA3B0000000000000000000000000000F83B0000FF0000000102400099 | ||||
| :403C0000FF00000082024000FF00000003034000FF00000084034000FF00020304030904160346006C007500780045006E00670069006E0065002A0343006F0077006C00CE | ||||
| :403C4000610072006B00200054006500630068006E006F006C006F0067006900650073000009022E0001010080320904000004FF00000107050102400000070582024000E5 | ||||
| :403C8000000705030340000A0705840340000A12010002FF0001080912006E0100020180014300232D302B2000686C4C00656667454647003031323334353637383961629E | ||||
| :403CC0006364656600000000F8B500BFF8BC08BC9E467047590000002D110000F8B500BFF8BC08BC9E46704735000000003D0000C880FF1F980000002812000000000000F3 | ||||
| :403D0000000000008893FF1FFFFF0000675000400C00000007000000FFFFFFFF7F8000003F0000000000007D00FA0000400000000090D003000000000000000000000000EE | ||||
| :403D40000000000000000000000000000000000000000000A13C00000000000000000000000000000000000000000000000000000000000000000000000000000000000066 | ||||
| :403D80000000000000000000000000000000000000000000FC80FF1F0000000000000000000000000000000000000000000000000000000000000000000000000000000069 | ||||
| :403DC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C3 | ||||
| :403E00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000082 | ||||
| :403E40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000042 | ||||
| @@ -4098,48 +4098,48 @@ | ||||
| :40FF80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000041 | ||||
| :40FFC0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000001 | ||||
| :0200000480007A | ||||
| :400000000145004008520040015B0040016400400101014003050140030701404E0801404A0901406C0A0140550B01405A0C0140490D01405A0E0140340F0140041701403E | ||||
| :40004000471801405A1901404F1A01404C1B01400C4001400A4101400F4201400D430140044401400C450140064601400C4701400F4801400B490140194C0140074D0140FA | ||||
| :4000800005500140045101407E02080509411080118219026006610A7C4027212A0AE280E640EA05EE10E620EA01EE8C00180220041806E009020A100C010E02100111076F | ||||
| :4000C00012041407150216F8170118801A181B011C181E4020FF260828012A062E072F0630FF330335043B083E01580459045B045C905F0181408210833085E18680870885 | ||||
| :4001000088018A248B108C7C8E828F1091FC92039302961097039B109D209E109FDCA180A210A330A401A648A9E1AA1CAB04AE10B01FB31FB4F0B7E0BA20D608D80BD90B5D | ||||
| :40014000DB04DC99DD90DF01012003A20404055208040AA10B010D080EA80F0210201280135015041680175919011A801B301E402180228424202514260429202B802F0167 | ||||
| :400180003180321433023614370138083B513D2058105980600A68026B046D4078018410884091209358942C9540970199729B599C019F04A240A301A58CA628A792A901F2 | ||||
| :4001C000AA10B010C0FFC2FDC4FFCA15CCEFCE2FD60CD80CDE01E622E804EE8C004801400311044805F10708081009100A200BE10C5A0E200F0E10C01201144818481C02F7 | ||||
| :400200001D201E041F112180224023112448288629F12A782B022DF12E042F04303F310F328033F0344038023B023E1440254520480249FF4AFF4BFF4D204EF0511058045A | ||||
| :40024000590B5A045B045C995D095F01610862406340648066406740800481018220830E8404861088808A048BC08D018E0291EF92029403952F96FC974099019A049B04BE | ||||
| :400280009C049D809E409F2FA0FFA101A302A404A6F9A710A804A901AA08AB08AC01AE02AF20B4FFB51FB7E0BE10D804D904DB04DC90DF01004401020204042405020606B2 | ||||
| :4002C000084809200A800B280D280E800F021180128813081408174918401A041B051F2023502680270829202B822C802E802F28318034403608375138083B513D903E02AA | ||||
| :4003000042044620470849014A0268056E507801830489108A808E409120928093209540965099729A829B519C019D019E209F04A090A160A242A308A405A50CA628A7130E | ||||
| :40034000A840AA01B540C0FFC2FFC4FFCAFDCCF8CEBFD004D208DE01E404E640EE1000800102027E044006100702083E09010A400C400E020F041040111812201320147E22 | ||||
| :400380001703188019021C401D081E04210222012502284029022A082D202F1830FF310833203507371039203E013F05400247EC483049FF4AFF4BFF5004560158045904C1 | ||||
| :4003C0005A045B045C905D095F0162C080368209842D8612880789028B018C3F9209961299019B029C24A104A480A640A840AA80AEC0B040B104B238B301B407B680B7021B | ||||
| :40040000B882B988BE41BF45D80BD904DB04DC09DF01001A010403820408060A07400A700B410C800D280E80102011501711189019A01C80202021402202253026802760C1 | ||||
| :4004400029012D022E202F11302036A939103C803D283F02472056056A806B016C946D806EA06F18768A780189C08A1091309323942895049620974099129E249F45A0205B | ||||
| :40048000A201A480A55CA668A79BA820A950AA80B080B640C0FFC2FDC457CAF1CCF4CEF4D020DE0100020140020C04100550072008040A080E010F10107211041280130203 | ||||
| :4004C000140E150816F018101B201C801E20201021602310244025022680270528102C082D072E0430FF310133703506370838023F445608580459045B045C995D905F0174 | ||||
| :40050000810C82078340840185808604870C88018A028B048C408EA08F02900191FF9457950397FC9840990C9A909B109C019D019E069F02A057A302A50CA7F1A840AB0883 | ||||
| :40054000AD0CAE08AF20B030B1FFB40FB6C0BF01D804D904DC09DF010220034904280540074009180A410C800D080E881004118812801604178119021A401D501E021F114A | ||||
| :400580002112224427802B922C842E602F103102321033043628374139043B413DA83E013F025880630169908A048E048F01C0FFC2FFC4DFCAFBCCF7CEFBD608D808E280A8 | ||||
| :4005C000E404E680EA08EE0B011406410714080109140A120B080CF10E040F201241150A16411714180119041A281C801D0A1E01211422412504264E29042B102D182F0158 | ||||
| :40060000320F3307353836F039083A085608580859045B045C995D905F018210846088018A048C7C8D018E02921C96039A109C409D04A210A401A608AA10AD02AE10B1016E | ||||
| :40064000B21FB304B440B502B620BF15D80BD904DB04DC09DF01012803810524070108100A120B800C200E060F50102011011280135014101501170418081A161E021F885A | ||||
| :4006800020202101221024042518262828022D062E802F0430043240330C35103608374039803D283E403F0258405A205D505F086401650867066A806C016F0378017F01D2 | ||||
| :4006C000814083088501912492489358940C96019702984299339A809B409C059D80A104A280A301A460A508A628A782AC02B048C0EFC2FFC43FCAF8CC78CEF8D67CD870F3 | ||||
| :40070000DE11E204E402E680EE0B01FC02900302042005C106C0072808C10A240B900CFC0E020F901120120313C018011A481B901E901F032290239C2690279029012A9012 | ||||
| :400740002B442E9C2F9031E034E0361F371F3A203B02420245E0480249FF4AFF4BFF4F83580B590B5A045B045C995D095F01821084618501860888618A04921096109A0394 | ||||
| :400780009C409E30A07CA202A61CA820AA50AC80B080B101B260B41FB660BE01BF01D808D904DB04DC09DF01012002C0036204080520074008020A050C400E0A0F50105066 | ||||
| :4007C0001350141015401608170519401B301C041D041E491F4022422780284029242A4830103242380A3B503F044110484059015A985F80600661406202632069806D40BA | ||||
| :4008000078017F018240900A9120921C9356958096019780980199219B059D04A281A302A440AD10B010B580C07FC2FBC4FFCA0FCC0DCE4FD004D61FD80FDE11E004EE085F | ||||
| :400840001A401F083328360437103A406A406B108B20C630CCF0CE1032043380364037023A013E809E40A604CCF0CE60502055108D2096089EC09F02A020A110A644A7809D | ||||
| :40088000A910AA01B420D460EAA08A809EC09F02A002A120A202A640A780AA06AE04B002EA80EE3014107310C404DC01530164108B1090109710B010B410D401D801E4017C | ||||
| :4008C000E808EA041B048301901097029C10C60808080B080E020F408710903097089C10A810AB04AF04C20F240280018A409A209E40A002A120A202AB02AE60AF80C820D3 | ||||
| :40090000E420EA10EED051205202722074029A20A002A120A202D4A0DC80DE2005400B200C800E401F40501056205C106120824084108B40903097209C10AA01AC08AF40A1 | ||||
| :40094000C001C20DC601D406D604D802E60182209E20AD40B120B480EC01EE0201010D010F0111011D0100FF01AB020211050000BF0000A09F001F0000000000000000004A | ||||
| :40098000100000004000000000000000C0000000FF0000B84700470000010000800000028200820000000000000303000300000027001801270018010004000000050000C9 | ||||
| :4009C00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F7 | ||||
| :400A000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B6 | ||||
| :400A40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000076 | ||||
| :400000000145004008520040015B004001650040020101402C0201402D0301400F0501400B0701406308014056090140570A01404A0B0140500C01404A0D0140480E014042 | ||||
| :40004000390F01400415014004170140671801404B190140361A0140471B01400D40014010410140134201400D43014004440140064501400A460140084701400B48014097 | ||||
| :4000800010490140144C01400C4D014006500140045101407E02080109441180180219016009610A7C402721290AE204E6080F011001150126012E012F013001310138026A | ||||
| :4000C00039023E013F01580459045B045F01810883048C018D0E910194029701A404AD04AE04AF0AB004B102B301B402B50CB601B802B908BE51BF04D608D804D909DB0401 | ||||
| :40010000DC90DD90DF01020208080C02100213081540170818081A801B801C80200821012210231026012A802C02300233043708388039023D405840600268026B0C6D4004 | ||||
| :40014000782088028B109840B040C001C214C4A5CA18CC43CE19D608D808DE04E208E68080088201928094809C289E80A201A602B044B380B404B610E604EA01EE44804068 | ||||
| :40018000842094809C209E80A602AA40E211E608EA01EE0C00800121020403020403052106FC0704080109210A020B080C040E100F4010FF11011404152F162019201A0495 | ||||
| :4001C0001B011C041D211EF91F0E220224042608271028042A402B2F2D0F2E02311F336034FF39083A0C3E104003450C470E481149FF4AFF4BFF50045609581859045A044E | ||||
| :400200005B045C995D995F0162C081028407850186388702880189048C028D048E04902091049208940895029610983F99029C089D049E30A105A503A704A802A902AA0417 | ||||
| :40024000AC3FAD02B43FB507B63FBF10D608D804D904DB04DC09DD90DF010010010803010490050909240A420C030E020F24100A15081602172119401A021B501E101F107B | ||||
| :400280002120242025052603272029982B402C022F18300831803202332035983701388039013B183C803D113E0447084F0856085A805F4062806302670269806B026C0881 | ||||
| :4002C0006D116E846F21759076467F01814087018E08908094209581971499049C019DC99E449F03A382A408A682A729C0F7C2FFC4F3CA7FCCFFCEFFD040D618D818DE1080 | ||||
| :40030000E210EA01EE0C0101041205010624084209800A100B200C040D700F80107011081201130414061508170219071A081B081D801E601F102140221023802404250F16 | ||||
| :4003400027F028042B0F2C802D01300F320F348035FF3670380A3B0C3E103F105804590A5B045C995F01824185F186418704888089208A018B118CF18E0291F1924E930218 | ||||
| :40038000954096419711980199109A149BE19F0EA1F1A308A580A641A711A801AA28B00FB10FB3F0B4F0BA02BB02D80BD90BDB04DC99DF010108020203080510076208017B | ||||
| :4003C00009200A220D020E1410021240131414081508188819041A221B821C801D121F1021282501277029892B082D022F103008314033213608376238A039013A043E1454 | ||||
| :4004000068026D407A107E80800481408D108F019108921495809702980899029D109F72A218A440A509A701A809B340B408B502B640C0F7C27FC46FCACFCCFFCE6FDE8298 | ||||
| :40044000E401E8F0EC20EE40020103C4070808050A020B040C380D200F82101011C7120813181602170418081A301B041F302520274128042B042C062E012F043020320715 | ||||
| :40048000330F341837F43B083E04580459085B045C995F0182108303840285628604870489208A108B508DFC8E108F0192039420964097809A109B1C9C409E209F10A07C22 | ||||
| :4004C000A162A201A308A61CA710A940AA10AB30AC02AE08AF10B01FB11FB360B460B780D808D908DC99DF0100A001800204036004020706081009080A800B010C080E8878 | ||||
| :400500001218134215401608180419201A841B201C081EA02105220923112504268429922A242D802E102F20301031083350340136883722380439823B103D0A3E203F4070 | ||||
| :40054000611062106D406F047B037F028A08900292509508968297129C019D329F62A018A444A501A690A721C0DFC27FC4CFCA7FCCFECEFFDE18E020E208EA8000020120A4 | ||||
| :40058000024803C004C20502062407440A030B900E9011FC129013011690170318201AC01B901E901F9020FC21C222012328269027902A9C2B9C2F90321F331F34E037E015 | ||||
| :4005C0003A203B80420647E0482049FF4AFF4BFF4F83580859085A045B045C995D095F0180E28208861088E28A049210942096D09A03A0FCA201A440A630A880AA30AE1C91 | ||||
| :40060000B2E0B41FD808DB04DC09DF01009001C6032005260610072009010A140B420D200E100F40121013121548171218101A241B101C201D201E101F0820022204230148 | ||||
| :4006400029862B08300131103204335039043B1148054A0252015AAA6120628263206A406C097B037F0282018610C07FC27FC4FECA0FCC0FCE07D204D60FD80FDE188A02E6 | ||||
| :40068000A602E604EE02A602B680E401EE020010022003020406063807040802090C0A040BF10C080D0C0F20100813081408150C17101808190C1B401C081F0221802204B3 | ||||
| :4006C000230C250327FC281A29012A202B022DFF2E01303F31FF3E013F01580459045B045F0181238280830C842286CC870188308A028B2F8CC88D0F9123924894C8952367 | ||||
| :40070000970898D499239B049CC89F10A0C8A120A302A4C8A52FA802AB40AC80AE01B080B261B31FB41FB560B760B808B9A0BE11C046C620C808C9FFCAFFCBFFCD20CEF004 | ||||
| :40074000D110D804D904DA04DB04DC99DD09DF01E108E240E340E480E640E7400010010803820490050909080A420B040E020F941002110A120415401721184019181C80B4 | ||||
| :40078000218C2314274029182A022D4A2F0830083361350436413720381039413A043D013F9440404A085010584059205F806C026D4082409080910192029410950896C023 | ||||
| :4007C000971C99049A069B219D099F08A008A105A2C1A3E6A442A580A708B340B610C0FFC2FFC4DFCAF7CCFFCEFFD001D204D61CEE120008060209020D01100411041202D8 | ||||
| :4008000018041F04220428012C063006310132013302340835043A023E143F055608580459045B045C995D905F0181028405881090019236930198019C319E0AAC05AD012B | ||||
| :40084000B00CB102B210B420B501B603BE04BF11D608D804D904DB04DC09DD90DF0101080240051809200A400E820F08100811401280154019231A501C101D101E821F0E2C | ||||
| :4008800020402120220827882F02300232803601382039803F0158205A805F40600862406701680869806F0180408210844887408B018E4090209140941096409708982064 | ||||
| :4008C00099089C409D239F88A002A280A304A608A708B020B410C06CC2DAC48BCA10CC89CE8CD61CD81CE001E622EE021B011F083140330836843B4083408540C630CCF07B | ||||
| :40090000CE10E220E61030803204364037043A083F80848088029740A340A604AE80AF01CCF0CE60E2105004570880049002960897409A049E089F04A002A120A644A80182 | ||||
| :40094000AA04B520D460E680EA80EE208E08900297409A049E08A002A120A640AA04AB0CAE04EA80EEB014407008C404DC0160808740A408B040D802EA011B0482209780E6 | ||||
| :400980009940B008B140B480C608E809EC040B880F4197899940A220AB05AF04C20F24088004900297409A04A002A120AE40C820E480EE4050015120560470027F018301EC | ||||
| :4009C00090029A04A002A120AF40D4E0DC80DE20E620EE40070208080D010E021F10520854085940622095029940A220AF40B101C001C20DC601D407D802EA04800887021E | ||||
| :400A00008E019B02A201A408AF10B008B608E208EA01EC02010109010D010F0111011D0100FF01AB02021105BF0000A09F001F0000000000000000001000000040000000B7 | ||||
| :400A400000000000C0000000FF0000B84700470000010000800000008000800000000000000707000700000027001801270018010004000000050000000000000000000052 | ||||
| :400A80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000036 | ||||
| :400AC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F6 | ||||
| :400B000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B5 | ||||
| @@ -4615,12 +4615,12 @@ | ||||
| :0200000490105A | ||||
| :04000000BC90ACAF55 | ||||
| :0200000490303A | ||||
| :02000000861365 | ||||
| :0200000021B02D | ||||
| :0200000490402A | ||||
| :4000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C0 | ||||
| :400040000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000080 | ||||
| :400080000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000040 | ||||
| :4000C0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000 | ||||
| :0200000490501A | ||||
| :0C00000000012E16106900002E2F967CC7 | ||||
| :0C00000000012E16106900002E3032198D | ||||
| :00000001FF | ||||
| @@ -814,9 +814,9 @@ | ||||
|   </Group> | ||||
|   <Group key="Component"> | ||||
|     <Group key="v1"> | ||||
|       <Data key="cy_boot" value="cy_boot_v5_80" /> | ||||
|       <Data key="cy_boot" value="cy_boot_v6_10" /> | ||||
|       <Data key="Em_EEPROM_Dynamic" value="Em_EEPROM_Dynamic_v2_20" /> | ||||
|       <Data key="LIN_Dynamic" value="LIN_Dynamic_v5_0" /> | ||||
|       <Data key="LIN_Dynamic" value="LIN_Dynamic_v6_0" /> | ||||
|     </Group> | ||||
|   </Group> | ||||
|   <Data key="DataVersionKey" value="2" /> | ||||
| @@ -871,6 +871,7 @@ | ||||
|       <Data key="c5367cde-21d5-4866-9a32-d16abfea0c61" value="WPT" /> | ||||
|       <Data key="d19368c5-6855-41bb-a9ff-808938abef00" value="INDEX" /> | ||||
|       <Data key="e9f14b5a-b2bf-49b8-98f3-d7b5a43ace8d" value="DRVSB" /> | ||||
|       <Data key="e16b5ef8-00d3-40a4-bc1c-194983c8eb3d" value="LOW_CURRENT" /> | ||||
|       <Data key="e851a3b9-efb8-48be-bbb8-b303b216c393" value="INDEX300" /> | ||||
|       <Data key="e51063a9-4fad-40c7-a06b-7cc4b137dc18" value="DSKCHG" /> | ||||
|       <Data key="ea7ee228-8b3f-426c-8bb8-cd7a81937769" value="DIR" /> | ||||
| @@ -4161,6 +4162,11 @@ | ||||
|         <Data key="Port Format" value="12,3" /> | ||||
|       </Group> | ||||
|     </Group> | ||||
|     <Group key="e16b5ef8-00d3-40a4-bc1c-194983c8eb3d"> | ||||
|       <Group key="0"> | ||||
|         <Data key="Port Format" value="3,2" /> | ||||
|       </Group> | ||||
|     </Group> | ||||
|     <Group key="e851a3b9-efb8-48be-bbb8-b303b216c393"> | ||||
|       <Group key="0"> | ||||
|         <Data key="Port Format" value="3,0" /> | ||||
|   | ||||
										
											
												File diff suppressed because it is too large
												Load Diff
											
										
									
								
							| @@ -23,36 +23,49 @@ module Sampler ( | ||||
|  | ||||
| reg [5:0] counter; | ||||
|  | ||||
| reg index_q; | ||||
| reg rdata_q; | ||||
|  | ||||
| reg index_edge; | ||||
| reg rdata_edge; | ||||
|  | ||||
| reg req_toggle; | ||||
|  | ||||
| reg rdata_toggle; | ||||
| reg old_rdata_toggle; | ||||
|  | ||||
| reg index_toggle; | ||||
| reg old_index_toggle; | ||||
|  | ||||
| always @(posedge rdata) | ||||
| begin | ||||
|     rdata_toggle <= ~rdata_toggle; | ||||
| end | ||||
|  | ||||
| always @(posedge index) | ||||
| begin | ||||
|     index_toggle <= ~index_toggle; | ||||
| end | ||||
|  | ||||
| always @(posedge sampleclock) | ||||
| begin | ||||
|     if (reset) | ||||
|     begin | ||||
|         old_rdata_toggle <= 0; | ||||
|         old_index_toggle <= 0; | ||||
|          | ||||
|         index_edge <= 0; | ||||
|         rdata_edge <= 0; | ||||
|         index_q <= 0; | ||||
|         rdata_q <= 0; | ||||
|         counter <= 0; | ||||
|         req_toggle <= 0; | ||||
|     end | ||||
|     else | ||||
|     begin | ||||
|         /* Both index and rdata are active high -- positive-going edges | ||||
|          * indicate the start of an index pulse and read pulse, respectively. | ||||
|          */ | ||||
|         /* If data_toggle or index_toggle have changed state, this means that they've | ||||
|          * gone high since the last sampleclock. */ | ||||
|           | ||||
|         index_edge <= index && !index_q; | ||||
|         index_q <= index; | ||||
|         index_edge <= index_toggle != old_index_toggle; | ||||
|         old_index_toggle <= index_toggle; | ||||
|          | ||||
|         rdata_edge <= rdata && !rdata_q; | ||||
|         rdata_q <= rdata; | ||||
|         rdata_edge <= rdata_toggle != old_rdata_toggle; | ||||
|         old_rdata_toggle <= rdata_toggle; | ||||
|          | ||||
|         if (rdata_edge || index_edge || (counter == 6'h3f)) begin | ||||
|             opcode <= { rdata_edge, index_edge, counter }; | ||||
|   | ||||
| @@ -65,7 +65,11 @@ begin | ||||
|                 if (dataclocked) | ||||
|                 begin | ||||
|                     pulsepending <= opcode[7]; | ||||
|                     countdown <= opcode[5:0] - 1; /* compensate for delay in last tick */ | ||||
|                     if (opcode[5:0] == 0) | ||||
|                         countdown <= 0; | ||||
|                     else | ||||
|                         countdown <= opcode[5:0] - 1; /* compensate for extra tick in state machine */ | ||||
|                      | ||||
|                     state <= STATE_WRITING; | ||||
|                 end | ||||
|             end | ||||
|   | ||||
										
											Binary file not shown.
										
									
								
							| @@ -13,14 +13,18 @@ | ||||
| #define DISKSTATUS_WPT    1 | ||||
| #define DISKSTATUS_DSKCHG 2 | ||||
|  | ||||
| #define STEP_TOWARDS0 1 | ||||
| #define STEP_AWAYFROM0 0 | ||||
| #define STEP_TOWARDS0 0 | ||||
| #define STEP_AWAYFROM0 1 | ||||
|  | ||||
| static bool drive0_present; | ||||
| static bool drive1_present; | ||||
|  | ||||
| static volatile uint32_t clock = 0; /* ms */ | ||||
| static volatile bool index_irq = false; | ||||
| /* Duration in ms. 0 causes every pulse to be an index pulse. Durations since | ||||
|  * last pulse greater than this value imply sector pulse. Otherwise is an index | ||||
|  * pulse. */ | ||||
| static volatile uint32_t hardsec_index_threshold = 0; | ||||
|  | ||||
| static bool motor_on = false; | ||||
| static uint32_t motor_on_time = 0; | ||||
| @@ -69,12 +73,41 @@ static void system_timer_cb(void) | ||||
|  | ||||
| CY_ISR(index_irq_cb) | ||||
| { | ||||
|     index_irq = true; | ||||
|     /* Hard sectored media has sector pulses at the beginning of every sector | ||||
|      * and the index pulse is an extra pulse in the middle of the last sector. | ||||
|      * When the extra pulse is seen, the next sector pulse is also the start of | ||||
|      * the track. */ | ||||
|     static bool hardsec_index_irq_primed = false; | ||||
|     static uint32_t hardsec_last_pulse_time = 0; | ||||
|     uint32_t index_pulse_duration = clock - hardsec_last_pulse_time; | ||||
|  | ||||
|     if (!hardsec_index_threshold) | ||||
|     { | ||||
|         index_irq = true; | ||||
|         hardsec_index_irq_primed = false; | ||||
|     } | ||||
|     else | ||||
|     { | ||||
|         /* It's only an index pulse if the previous pulse is less than | ||||
|          * the threshold. | ||||
|          */ | ||||
|         index_irq = (index_pulse_duration <= hardsec_index_threshold) ? | ||||
|             hardsec_index_irq_primed : false; | ||||
|  | ||||
|         if (index_irq) | ||||
|             hardsec_index_irq_primed = false; | ||||
|         else | ||||
|             hardsec_index_irq_primed = | ||||
|                 index_pulse_duration <= hardsec_index_threshold; | ||||
|  | ||||
|         hardsec_last_pulse_time = clock; | ||||
|     } | ||||
|      | ||||
|     /* Stop writing the instant the index pulse comes along; it may take a few | ||||
|      * moments for the main code to notice the pulse, and we don't want to overwrite | ||||
|      * the beginning of the track. */ | ||||
|     ERASE_REG_Write(0); | ||||
|     if (index_irq) | ||||
|         ERASE_REG_Write(0); | ||||
| } | ||||
|  | ||||
| CY_ISR(capture_dma_finished_irq_cb) | ||||
| @@ -114,7 +147,7 @@ static void set_drive_flags(struct set_drive_frame* flags) | ||||
|      | ||||
|     current_drive_flags = *flags; | ||||
|     DRIVESELECT_REG_Write(flags->drive ? 2 : 1); /* select drive 1 or 0 */ | ||||
|     DENSITY_REG_Write(flags->high_density); /* density bit */ | ||||
|     DENSITY_REG_Write(!flags->high_density); /* double density bit */ | ||||
|     INDEX_REG_Write(flags->index_mode); | ||||
| } | ||||
|  | ||||
| @@ -188,7 +221,7 @@ static int usb_read(int ep, uint8_t buffer[FRAME_SIZE]) | ||||
| static void cmd_get_version(struct any_frame* f) | ||||
| { | ||||
|     DECLARE_REPLY_FRAME(struct version_frame, F_FRAME_GET_VERSION_REPLY); | ||||
|     r.version = FLUXENGINE_VERSION; | ||||
|     r.version = FLUXENGINE_PROTOCOL_VERSION; | ||||
|     send_reply((struct any_frame*) &r); | ||||
| } | ||||
|  | ||||
| @@ -249,6 +282,7 @@ static void seek_to(int track) | ||||
|         CyWdtClear(); | ||||
|     } | ||||
|     CyDelay(STEP_SETTLING_TIME); | ||||
|     TK43_REG_Write(track < 43); /* high if 0..42, low if 43 or up */ | ||||
|     print("finished seek"); | ||||
| } | ||||
|  | ||||
| @@ -267,7 +301,7 @@ static void cmd_recalibrate(void) | ||||
|     send_reply(&r);     | ||||
| } | ||||
|      | ||||
| static void cmd_measure_speed(struct any_frame* f) | ||||
| static void cmd_measure_speed(struct measurespeed_frame* f) | ||||
| { | ||||
|     start_motor(); | ||||
|      | ||||
| @@ -277,7 +311,7 @@ static void cmd_measure_speed(struct any_frame* f) | ||||
|     while (!index_irq) | ||||
|     { | ||||
|         elapsed = clock - start_clock; | ||||
|         if (elapsed > 1000) | ||||
|         if (elapsed > 1500) | ||||
|         { | ||||
|             elapsed = 0; | ||||
|             break; | ||||
| @@ -286,10 +320,14 @@ static void cmd_measure_speed(struct any_frame* f) | ||||
|  | ||||
|     if (elapsed != 0) | ||||
|     { | ||||
|         index_irq = false; | ||||
|         int target_pulse_count = f->hard_sector_count + 1; | ||||
|         start_clock = clock; | ||||
|         while (!index_irq) | ||||
|             elapsed = clock - start_clock; | ||||
|         for (int x=0; x<target_pulse_count; x++) | ||||
|         { | ||||
|             index_irq = false; | ||||
|             while (!index_irq) | ||||
|                 elapsed = clock - start_clock; | ||||
|         } | ||||
|     } | ||||
|      | ||||
|     DECLARE_REPLY_FRAME(struct speed_frame, F_FRAME_MEASURE_SPEED_REPLY); | ||||
| @@ -381,9 +419,9 @@ static void init_capture_dma(void) | ||||
|  | ||||
| static void cmd_read(struct read_frame* f) | ||||
| { | ||||
|     SIDE_REG_Write(f->side); | ||||
|     seek_to(current_track); | ||||
|      | ||||
|     SIDE_REG_Write(f->side); | ||||
|     STEP_REG_Write(f->side); /* for drives which multiplex SIDE and DIR */ | ||||
|     /* Do slow setup *before* we go into the real-time bit. */ | ||||
|      | ||||
|     { | ||||
| @@ -401,10 +439,12 @@ static void cmd_read(struct read_frame* f) | ||||
|          | ||||
|     if (f->synced) | ||||
|     { | ||||
|         hardsec_index_threshold = f->hardsec_threshold_ms; | ||||
|         index_irq = false; | ||||
|         while (!index_irq) | ||||
|             ; | ||||
|         index_irq = false; | ||||
|         hardsec_index_threshold = 0; | ||||
|     } | ||||
|      | ||||
|     dma_writing_to_td = 0; | ||||
| @@ -478,6 +518,7 @@ abort:; | ||||
|     wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM); | ||||
|     deinit_dma(); | ||||
|  | ||||
|     STEP_REG_Write(0); | ||||
|     if (saved_dma_underrun) | ||||
|     { | ||||
|         print("underrun after %d packets"); | ||||
| @@ -523,9 +564,10 @@ static void cmd_write(struct write_frame* f) | ||||
|         return; | ||||
|     } | ||||
|      | ||||
|     SEQUENCER_CONTROL_Write(1); /* put the sequencer into reset */ | ||||
|  | ||||
|     seek_to(current_track);     | ||||
|     SIDE_REG_Write(f->side); | ||||
|     STEP_REG_Write(f->side); /* for drives which multiplex SIDE and DIR */ | ||||
|     SEQUENCER_CONTROL_Write(1); /* put the sequencer into reset */ | ||||
|     { | ||||
|         uint8_t i = CyEnterCriticalSection();         | ||||
|         REPLAY_FIFO_SET_LEVEL_MID; | ||||
| @@ -533,7 +575,6 @@ static void cmd_write(struct write_frame* f) | ||||
|         REPLAY_FIFO_SINGLE_BUFFER_UNSET; | ||||
|         CyExitCriticalSection(i); | ||||
|     } | ||||
|     seek_to(current_track);     | ||||
|  | ||||
|     init_replay_dma(); | ||||
|     bool writing = false; /* to the disk */ | ||||
| @@ -590,7 +631,7 @@ static void cmd_write(struct write_frame* f) | ||||
|  | ||||
|                 /* Wait for the index marker. While this happens, the DMA engine | ||||
|                  * will prime the FIFO. */ | ||||
|  | ||||
|                 hardsec_index_threshold = f->hardsec_threshold_ms; | ||||
|                 index_irq = false; | ||||
|                 while (!index_irq) | ||||
|                     ; | ||||
| @@ -625,6 +666,7 @@ abort: | ||||
|     } | ||||
|      | ||||
|     print("p=%d cr=%d cw=%d f=%d w=%d index=%d underrun=%d", packets, count_read, count_written, finished, writing, index_irq, dma_underrun); | ||||
|     hardsec_index_threshold = 0; | ||||
|     if (!finished) | ||||
|     { | ||||
|         /* There's still some data to read, so just read and blackhole it --- | ||||
| @@ -638,6 +680,7 @@ abort: | ||||
|      | ||||
|     deinit_dma(); | ||||
|      | ||||
|     STEP_REG_Write(0); | ||||
|     if (dma_underrun) | ||||
|     { | ||||
|         print("underrun!"); | ||||
| @@ -653,10 +696,11 @@ abort: | ||||
| static void cmd_erase(struct erase_frame* f) | ||||
| { | ||||
|     SIDE_REG_Write(f->side); | ||||
|     seek_to(current_track);     | ||||
|     seek_to(current_track); | ||||
|     /* Disk is now spinning. */ | ||||
|      | ||||
|     print("start erasing"); | ||||
|     hardsec_index_threshold = f->hardsec_threshold_ms; | ||||
|     index_irq = false; | ||||
|     while (!index_irq) | ||||
|         ; | ||||
| @@ -665,6 +709,7 @@ static void cmd_erase(struct erase_frame* f) | ||||
|     while (!index_irq) | ||||
|         ; | ||||
|     ERASE_REG_Write(0); | ||||
|     hardsec_index_threshold = 0; | ||||
|     print("stop erasing"); | ||||
|  | ||||
|     DECLARE_REPLY_FRAME(struct any_frame, F_FRAME_ERASE_REPLY); | ||||
| @@ -790,7 +835,7 @@ static void handle_command(void) | ||||
|             break; | ||||
|          | ||||
|         case F_FRAME_MEASURE_SPEED_CMD: | ||||
|             cmd_measure_speed(f); | ||||
|             cmd_measure_speed((struct measurespeed_frame*) f); | ||||
|             break; | ||||
|              | ||||
|         case F_FRAME_BULK_WRITE_TEST_CMD: | ||||
| @@ -860,7 +905,6 @@ int main(void) | ||||
|     USBFS_Start(0, USBFS_DWR_VDDD_OPERATION); | ||||
|     USBFS_DisableOutEP(FLUXENGINE_DATA_OUT_EP_NUM); | ||||
|      | ||||
|     detect_drives(); | ||||
|     CyWdtStart(CYWDT_1024_TICKS, CYWDT_LPMODE_DISABLED); | ||||
|      | ||||
|     for (;;) | ||||
| @@ -881,6 +925,8 @@ int main(void) | ||||
|                 CyWdtClear(); | ||||
|             print("USB ready"); | ||||
|             USBFS_EnableOutEP(FLUXENGINE_CMD_OUT_EP_NUM); | ||||
|             print("Scanning drives..."); | ||||
|             detect_drives(); | ||||
|         } | ||||
|          | ||||
|         if (USBFS_GetEPState(FLUXENGINE_CMD_OUT_EP_NUM) == USBFS_OUT_BUFFER_FULL) | ||||
| @@ -892,3 +938,75 @@ int main(void) | ||||
|         } | ||||
|     } | ||||
| } | ||||
|  | ||||
| const uint8_t USBFS_MSOS_CONFIGURATION_DESCR[USBFS_MSOS_CONF_DESCR_LENGTH] = { | ||||
| /*  Length of the descriptor 4 bytes       */   0x28u, 0x00u, 0x00u, 0x00u, | ||||
| /*  Version of the descriptor 2 bytes      */   0x00u, 0x01u, | ||||
| /*  wIndex - Fixed:INDEX_CONFIG_DESCRIPTOR */   0x04u, 0x00u, | ||||
| /*  bCount - Count of device functions.    */   0x01u, | ||||
| /*  Reserved : 7 bytes                     */   0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u, | ||||
| /*  bFirstInterfaceNumber                  */   0x00u, | ||||
| /*  Reserved                               */   0x01u, | ||||
| /*  compatibleId - "WINUSB\0\0"            */   'W', 'I', 'N', 'U', 'S', 'B', 0, 0, | ||||
| /*  subcompatibleID - "00001\0\0"          */   '0', '0', '0', '0', '1', | ||||
|                                                 0x00u, 0x00u, 0x00u, | ||||
| /*  Reserved : 6 bytes                     */   0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u | ||||
| }; | ||||
|  | ||||
| const uint8_t USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[224] = { | ||||
|     /* Length; 4 bytes       */   224, 0, 0, 0, | ||||
|     /* Version; 2 bytes      */   0x00, 0x01, /* 1.0 */ | ||||
|     /* wIndex                */   0x05, 0x00, | ||||
|     /* Number of sections    */   0x01, 0x00, | ||||
|     /* Property section size */   214, 0, 0, 0, | ||||
|     /* Property data type    */   0x07, 0x00, 0x00, 0x00, /* 7 = REG_MULTI_SZ Unicode */ | ||||
|     /* Property name length  */   42, 0, | ||||
|     /* Property name         */   'D', 0, 'e', 0, 'v', 0, 'i', 0, 'c', 0, 'e', 0, | ||||
|                                   'I', 0, 'n', 0, 't', 0, 'e', 0, 'r', 0, 'f', 0, | ||||
|                                   'a', 0, 'c', 0, 'e', 0, 'G', 0, 'U', 0, 'I', 0, | ||||
|                                   'D', 0, 's', 0, 0,   0, | ||||
|     /* Property data length  */   158, 0, 0, 0, | ||||
|     /* GUID #1 data          */   '{', 0, '3', 0, 'd', 0, '2', 0, '7', 0, '5', 0, | ||||
|                                   'c', 0, 'f', 0, 'e', 0, '-', 0, '5', 0, '4', 0, | ||||
|                                   '3', 0, '5', 0, '-', 0, '4', 0, 'd', 0, 'd', 0, | ||||
|                                   '5', 0, '-', 0, 'a', 0, 'c', 0, 'c', 0, 'a', 0, | ||||
|                                   '-', 0, '9', 0, 'f', 0, 'b', 0, '9', 0, '9', 0, | ||||
|                                   '5', 0, 'e', 0, '2', 0, 'f', 0, '6', 0, '3', 0, | ||||
|                                   '8', 0, '}', 0, '\0', 0, | ||||
|     /* GUID #2 data          */   '{', 0, '3', 0, 'd', 0, '2', 0, '7', 0, '5', 0, | ||||
|                                   'c', 0, 'f', 0, 'e', 0, '-', 0, '5', 0, '4', 0, | ||||
|                                   '3', 0, '5', 0, '-', 0, '4', 0, 'd', 0, 'd', 0, | ||||
|                                   '5', 0, '-', 0, 'a', 0, 'c', 0, 'c', 0, 'a', 0, | ||||
|                                   '-', 0, '9', 0, 'f', 0, 'b', 0, '9', 0, '9', 0, | ||||
|                                   '5', 0, 'e', 0, '2', 0, 'f', 0, '6', 0, '3', 0, | ||||
|                                   '8', 0, '}', 0, '\0', 0, '\0', 0 | ||||
| }; | ||||
|  | ||||
| uint8 USBFS_HandleVendorRqst(void) | ||||
| { | ||||
|     if (!(USBFS_bmRequestTypeReg & USBFS_RQST_DIR_D2H)) | ||||
|         return false; | ||||
|  | ||||
|     switch (USBFS_bRequestReg) | ||||
|     { | ||||
|         case USBFS_GET_EXTENDED_CONFIG_DESCRIPTOR: | ||||
|             switch (USBFS_wIndexLoReg) | ||||
|             { | ||||
|                 case 4: | ||||
|                     USBFS_currentTD.pData = (volatile uint8 *) &USBFS_MSOS_CONFIGURATION_DESCR[0u]; | ||||
|                     USBFS_currentTD.count = USBFS_MSOS_CONFIGURATION_DESCR[0u]; | ||||
|                     return USBFS_InitControlRead(); | ||||
|                      | ||||
|                 case 5: | ||||
|                     USBFS_currentTD.pData = (volatile uint8 *) &USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[0u]; | ||||
|                     USBFS_currentTD.count = USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[0u]; | ||||
|                     return USBFS_InitControlRead(); | ||||
|             } | ||||
|  | ||||
|         default: | ||||
|             break; | ||||
|     } | ||||
|  | ||||
|     return true; | ||||
| } | ||||
|  | ||||
|   | ||||
| @@ -1,18 +0,0 @@ | ||||
| const READ = 1 | ||||
| const WRITE = 2 | ||||
|  | ||||
| filename = "Generated_Source\PSoC5\USBFS_descr.c" | ||||
| set fso = CreateObject("Scripting.FileSystemObject") | ||||
|  | ||||
| set file = fso.OpenTextFile(filename, READ) | ||||
| text = file.ReadAll | ||||
| file.Close | ||||
|  | ||||
| set r = New RegExp | ||||
| r.MultiLine = True | ||||
| r.Pattern = "/\* +compatibleID.*\n.*" | ||||
| text = r.replace(text, "'W', 'I', 'N', 'U', 'S', 'B', 0, 0,") | ||||
|  | ||||
| set file = fso.CreateTextFile(filename, True) | ||||
| file.Write text | ||||
| file.Close | ||||
							
								
								
									
										325
									
								
								Makefile
									
									
									
									
									
								
							
							
						
						
									
										325
									
								
								Makefile
									
									
									
									
									
								
							| @@ -1,52 +1,299 @@ | ||||
| PACKAGES = zlib sqlite3 libusb-1.0 | ||||
|  | ||||
| export CFLAGS = --std=c++14 -ffunction-sections -fdata-sections | ||||
| export LDFLAGS = | ||||
|  | ||||
| export COPTFLAGS = -Os | ||||
| export LDOPTFLAGS = -Os -s | ||||
|  | ||||
| export CDBGFLAGS = -O0 -g | ||||
| export LDDBGFLAGS = -O0 -g | ||||
| #Special Windows settings. | ||||
|  | ||||
| ifeq ($(OS), Windows_NT) | ||||
| export CXX = /mingw32/bin/g++ | ||||
| export AR = /mingw32/bin/ar rcs | ||||
| export STRIP = /mingw32/bin/strip | ||||
| export CFLAGS += -I/mingw32/include/libusb-1.0 | ||||
| export LDFLAGS += | ||||
| export LIBS = -static -lz -lsqlite3 -lusb-1.0 | ||||
| export EXTENSION = .exe | ||||
| else | ||||
| 	MINGWBIN = /mingw32/bin | ||||
| 	CCPREFIX = $(MINGWBIN)/ | ||||
| 	LUA = $(MINGWBIN)/lua | ||||
| 	PKG_CONFIG = $(MINGWBIN)/pkg-config | ||||
| 	WX_CONFIG = /usr/bin/sh $(MINGWBIN)/wx-config --static=yes | ||||
| 	PROTOC = $(MINGWBIN)/protoc | ||||
| 	PLATFORM = WINDOWS | ||||
| 	LDFLAGS += \ | ||||
| 		-static | ||||
| 	CXXFLAGS += \ | ||||
| 		-std=c++17 \ | ||||
| 		-fext-numeric-literals \ | ||||
| 		-Wno-deprecated-enum-float-conversion \ | ||||
| 		-Wno-deprecated-enum-enum-conversion | ||||
|  | ||||
| packages-exist = $(shell pkg-config --exists $(PACKAGES) && echo yes) | ||||
| ifneq ($(packages-exist),yes) | ||||
| $(warning These pkg-config packages are installed: $(shell pkg-config --list-all | sort | awk '{print $$1}')) | ||||
| $(error You must have these pkg-config packages installed: $(PACKAGES)) | ||||
| #Required to get the gcc run - time libraries on the path. | ||||
| 	export PATH := $(PATH):$(MINGWBIN) | ||||
| 	EXT ?= .exe | ||||
| endif | ||||
|  | ||||
| export CXX = g++ | ||||
| export AR = ar rcs | ||||
| export STRIP = strip | ||||
| export CFLAGS += $(shell pkg-config --cflags $(PACKAGES)) | ||||
| export LDFLAGS += | ||||
| export LIBS = $(shell pkg-config --libs $(PACKAGES)) | ||||
| export EXTENSION = | ||||
| #Special OSX settings. | ||||
|  | ||||
| ifeq ($(shell uname),Darwin) | ||||
| 	PLATFORM = OSX | ||||
| 	LDFLAGS += \ | ||||
| 		-framework IOKit \ | ||||
| 		-framework Foundation | ||||
| endif | ||||
|  | ||||
| CFLAGS += -Ilib -Idep/fmt -Iarch | ||||
| #Check the Make version. | ||||
|  | ||||
| export OBJDIR = .obj | ||||
|  | ||||
| all: .obj/build.ninja | ||||
| 	@ninja -f .obj/build.ninja | ||||
| ifeq ($(findstring 4.,$(MAKE_VERSION)),) | ||||
| $(error You need GNU Make 4.x for this (if you're on OSX, use gmake).) | ||||
| endif | ||||
|  | ||||
| #Normal settings. | ||||
|  | ||||
| OBJDIR ?= .obj | ||||
| CCPREFIX ?= | ||||
| LUA ?= lua | ||||
| CC ?= $(CCPREFIX)gcc | ||||
| CXX ?= $(CCPREFIX)g++ | ||||
| AR ?= $(CCPREFIX)ar | ||||
| PKG_CONFIG ?= pkg-config | ||||
| WX_CONFIG ?= wx-config | ||||
| PROTOC ?= protoc | ||||
| CFLAGS ?= -g -O3 | ||||
| CXXFLAGS += -std=c++17 | ||||
| LDFLAGS ?= | ||||
| PLATFORM ?= UNIX | ||||
| TESTS ?= yes | ||||
| EXT ?= | ||||
| DESTDIR ?= | ||||
| PREFIX ?= /usr/local | ||||
| BINDIR ?= $(PREFIX)/bin | ||||
|  | ||||
| CFLAGS += \ | ||||
| 	-Iarch \ | ||||
| 	-Ilib \ | ||||
| 	-I. \ | ||||
| 	-I$(OBJDIR)/arch \ | ||||
| 	-I$(OBJDIR)/lib \ | ||||
| 	-I$(OBJDIR) \ | ||||
| 	-Wno-deprecated-declarations \ | ||||
|  | ||||
| LDFLAGS += \ | ||||
| 	-lz \ | ||||
| 	-lfmt | ||||
|  | ||||
| .SUFFIXES: | ||||
| .DELETE_ON_ERROR: | ||||
|  | ||||
| define nl | ||||
|  | ||||
| endef | ||||
|  | ||||
| empty := | ||||
| space := $(empty) $(empty) | ||||
|  | ||||
| use-library = $(eval $(use-library-impl)) | ||||
| define use-library-impl | ||||
| $1: $(call $3_LIB) | ||||
| $1: private LDFLAGS += $(call $3_LDFLAGS) | ||||
| $2: private CFLAGS += $(call $3_CFLAGS) | ||||
| endef | ||||
|  | ||||
| use-pkgconfig = $(eval $(use-pkgconfig-impl)) | ||||
| define use-pkgconfig-impl | ||||
| ifneq ($(strip $(shell $(PKG_CONFIG) $3; echo $$?)),0) | ||||
| $$(error Missing required pkg-config dependency: $3) | ||||
| endif | ||||
|  | ||||
| $(1): private LDFLAGS += $(shell $(PKG_CONFIG) --libs $(3)) | ||||
| $(2): private CFLAGS += $(shell $(PKG_CONFIG) --cflags $(3)) | ||||
| endef | ||||
|  | ||||
| .PHONY: all binaries tests clean install install-bin | ||||
| all: binaries tests docs | ||||
|  | ||||
| PROTOS = \ | ||||
| 	arch/aeslanier/aeslanier.proto \ | ||||
| 	arch/agat/agat.proto \ | ||||
| 	arch/amiga/amiga.proto \ | ||||
| 	arch/apple2/apple2.proto \ | ||||
| 	arch/brother/brother.proto \ | ||||
| 	arch/c64/c64.proto \ | ||||
| 	arch/f85/f85.proto \ | ||||
| 	arch/fb100/fb100.proto \ | ||||
| 	arch/ibm/ibm.proto \ | ||||
| 	arch/macintosh/macintosh.proto \ | ||||
| 	arch/micropolis/micropolis.proto \ | ||||
| 	arch/mx/mx.proto \ | ||||
| 	arch/northstar/northstar.proto \ | ||||
| 	arch/rolandd20/rolandd20.proto \ | ||||
| 	arch/smaky6/smaky6.proto \ | ||||
| 	arch/tids990/tids990.proto \ | ||||
| 	arch/victor9k/victor9k.proto \ | ||||
| 	arch/zilogmcz/zilogmcz.proto \ | ||||
| 	lib/common.proto \ | ||||
| 	lib/config.proto \ | ||||
| 	lib/decoders/decoders.proto \ | ||||
| 	lib/drive.proto \ | ||||
| 	lib/encoders/encoders.proto \ | ||||
| 	lib/fl2.proto \ | ||||
| 	lib/fluxsink/fluxsink.proto \ | ||||
| 	lib/fluxsource/fluxsource.proto \ | ||||
| 	lib/imagereader/imagereader.proto \ | ||||
| 	lib/imagewriter/imagewriter.proto \ | ||||
| 	lib/layout.proto \ | ||||
| 	lib/usb/usb.proto \ | ||||
| 	lib/vfs/vfs.proto \ | ||||
| 	tests/testproto.proto \ | ||||
|  | ||||
| PROTO_HDRS = $(patsubst %.proto, $(OBJDIR)/%.pb.h, $(PROTOS)) | ||||
| PROTO_SRCS = $(patsubst %.proto, $(OBJDIR)/%.pb.cc, $(PROTOS)) | ||||
| PROTO_OBJS = $(patsubst %.cc, %.o, $(PROTO_SRCS)) | ||||
| PROTO_CFLAGS = $(shell $(PKG_CONFIG) --cflags protobuf) | ||||
| $(PROTO_SRCS): | $(PROTO_HDRS) | ||||
| $(PROTO_OBJS): CFLAGS += $(PROTO_CFLAGS) | ||||
| PROTO_LIB = $(OBJDIR)/libproto.a | ||||
| $(PROTO_LIB): $(PROTO_OBJS) | ||||
| PROTO_LDFLAGS = $(shell $(PKG_CONFIG) --libs protobuf) -pthread | ||||
| .PRECIOUS: $(PROTO_HDRS) $(PROTO_SRCS) | ||||
|  | ||||
| include dep/agg/build.mk | ||||
| include dep/libusbp/build.mk | ||||
| include dep/stb/build.mk | ||||
| include dep/emu/build.mk | ||||
| include dep/fatfs/build.mk | ||||
| include dep/adflib/build.mk | ||||
| include dep/hfsutils/build.mk | ||||
| include scripts/build.mk | ||||
|  | ||||
| include lib/build.mk | ||||
| include arch/build.mk | ||||
| include src/build.mk | ||||
| include src/gui/build.mk | ||||
| include tools/build.mk | ||||
| include tests/build.mk | ||||
|  | ||||
| do-encodedecodetest = $(eval $(do-encodedecodetest-impl)) | ||||
| define do-encodedecodetest-impl | ||||
|  | ||||
| tests: $(OBJDIR)/$1$$(subst $$(space),_,$3).flux.encodedecode | ||||
| $(OBJDIR)/$1$$(subst $$(space),_,$3).flux.encodedecode: scripts/encodedecodetest.sh $(FLUXENGINE_BIN) $2 | ||||
| 	@mkdir -p $(dir $$@) | ||||
| 	@echo ENCODEDECODETEST $1 flux $(FLUXENGINE_BIN) $2 $3 | ||||
| 	@scripts/encodedecodetest.sh $1 flux $(FLUXENGINE_BIN) $2 $3 > $$@ | ||||
|  | ||||
| tests: $(OBJDIR)/$1$$(subst $$(space),_,$3).scp.encodedecode | ||||
| $(OBJDIR)/$1$$(subst $$(space),_,$3).scp.encodedecode: scripts/encodedecodetest.sh $(FLUXENGINE_BIN) $2 | ||||
| 	@mkdir -p $(dir $$@) | ||||
| 	@echo ENCODEDECODETEST $1 scp $(FLUXENGINE_BIN) $2 $3 | ||||
| 	@scripts/encodedecodetest.sh $1 scp $(FLUXENGINE_BIN) $2 $3 > $$@ | ||||
|  | ||||
| endef | ||||
|  | ||||
| $(call do-encodedecodetest,agat,,--drive.tpi=96) | ||||
| $(call do-encodedecodetest,amiga,,--drive.tpi=135) | ||||
| $(call do-encodedecodetest,apple2,,--140 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,atarist,,--360 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,atarist,,--370 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,atarist,,--400 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,atarist,,--410 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,atarist,,--720 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,atarist,,--740 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,atarist,,--800 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,atarist,,--820 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,bk) | ||||
| $(call do-encodedecodetest,brother,,--120 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,brother,,--240 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,commodore,scripts/commodore1541_test.textpb,--171 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,commodore,scripts/commodore1541_test.textpb,--192 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,commodore,,--800 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,commodore,,--1620 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,hplif,,--264 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,hplif,,--616 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,hplif,,--770 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,ibm,,--1200 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,ibm,,--1232 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,ibm,,--1440 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,ibm,,--1680 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,ibm,,--180 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,ibm,,--160 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,ibm,,--320 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,ibm,,--360 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,ibm,,--720_96 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,ibm,,--720_135 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,mac,scripts/mac400_test.textpb,--400 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,mac,scripts/mac800_test.textpb,--800 --drive.tpi=135) | ||||
| $(call do-encodedecodetest,n88basic,,--drive.tpi=96) | ||||
| $(call do-encodedecodetest,rx50,,--drive.tpi=96) | ||||
| $(call do-encodedecodetest,tids990,,--drive.tpi=48) | ||||
| $(call do-encodedecodetest,victor9k,,--612 --drive.tpi=96) | ||||
| $(call do-encodedecodetest,victor9k,,--1224 --drive.tpi=96) | ||||
|  | ||||
| do-corpustest = $(eval $(do-corpustest-impl)) | ||||
| define do-corpustest-impl | ||||
|  | ||||
| tests: $(OBJDIR)/corpustest/$2 | ||||
| $(OBJDIR)/corpustest/$2: $(FLUXENGINE_BIN) \ | ||||
| 		../fluxengine-testdata/data/$1 ../fluxengine-testdata/data/$2 | ||||
| 	@mkdir -p $(OBJDIR)/corpustest | ||||
| 	@echo CORPUSTEST $1 $2 $3 | ||||
| 	@$(FLUXENGINE_BIN) read $3 -s ../fluxengine-testdata/data/$1 -o $$@ > $$@.log | ||||
| 	@cmp $$@ ../fluxengine-testdata/data/$2 | ||||
|  | ||||
| endef | ||||
|  | ||||
| ifneq ($(wildcard ../fluxengine-testdata/data),) | ||||
|  | ||||
| $(call do-corpustest,amiga.flux,amiga.adf,amiga --drive.tpi=135) | ||||
| $(call do-corpustest,atarist360.flux,atarist360.st,atarist --360 --drive.tpi=135) | ||||
| $(call do-corpustest,atarist720.flux,atarist720.st,atarist --720 --drive.tpi=135) | ||||
| $(call do-corpustest,brother120.flux,brother120.img,brother --120 --drive.tpi=135) | ||||
| $(call do-corpustest,cmd-fd2000.flux,cmd-fd2000.img,commodore --1620 --drive.tpi=135) | ||||
| $(call do-corpustest,ibm1232.flux,ibm1232.img,ibm --1232 --drive.tpi=96) | ||||
| $(call do-corpustest,ibm1440.flux,ibm1440.img,ibm --1440 --drive.tpi=135) | ||||
| $(call do-corpustest,mac800.flux,mac800.dsk,mac --800 --drive.tpi=135) | ||||
| $(call do-corpustest,micropolis315.flux,micropolis315.img,micropolis --315 --drive.tpi=100) | ||||
| $(call do-corpustest,northstar87-synthetic.flux,northstar87-synthetic.nsi,northstar --87 --drive.tpi=48) | ||||
| $(call do-corpustest,northstar175-synthetic.flux,northstar175-synthetic.nsi,northstar --175 --drive.tpi=48) | ||||
| $(call do-corpustest,northstar350-synthetic.flux,northstar350-synthetic.nsi,northstar --350 --drive.tpi=48) | ||||
| $(call do-corpustest,victor9k_ss.flux,victor9k_ss.img,victor9k --612 --drive.tpi=96) | ||||
| $(call do-corpustest,victor9k_ds.flux,victor9k_ds.img,victor9k --1224 --drive.tpi=96) | ||||
|  | ||||
| endif | ||||
|  | ||||
| $(OBJDIR)/%.a: | ||||
| 	@mkdir -p $(dir $@) | ||||
| 	@echo AR $@ | ||||
| 	@$(AR) rc $@ $^ | ||||
|  | ||||
| %.exe: | ||||
| 	@mkdir -p $(dir $@) | ||||
| 	@echo LINK $@ | ||||
| 	@$(CXX) -o $@ $(filter %.o,$^) $(filter %.a,$^) $(LDFLAGS) $(filter %.a,$^) $(LDFLAGS) | ||||
|  | ||||
| $(OBJDIR)/%.o: %.cpp | ||||
| 	@mkdir -p $(dir $@) | ||||
| 	@echo CXX $< | ||||
| 	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $< | ||||
|  | ||||
| $(OBJDIR)/%.o: %.cc | ||||
| 	@mkdir -p $(dir $@) | ||||
| 	@echo CXX $< | ||||
| 	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $< | ||||
|  | ||||
| $(OBJDIR)/%.o: $(OBJDIR)/%.cc | ||||
| 	@mkdir -p $(dir $@) | ||||
| 	@echo CXX $< | ||||
| 	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $< | ||||
|  | ||||
| $(OBJDIR)/%.o: %.c | ||||
| 	@mkdir -p $(dir $@) | ||||
| 	@echo CC $< | ||||
| 	@$(CC) $(CFLAGS) $(CFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $< | ||||
|  | ||||
| $(OBJDIR)/%.pb.h: %.proto | ||||
| 	@mkdir -p $(dir $@) | ||||
| 	@echo PROTOC $@ | ||||
| 	@$(PROTOC) -I. --cpp_out=$(OBJDIR) $< | ||||
|  | ||||
| clean: | ||||
| 	@echo CLEAN | ||||
| 	@rm -rf $(OBJDIR) | ||||
| 	rm -rf $(OBJDIR) | ||||
|  | ||||
| .obj/build.ninja: mkninja.sh Makefile | ||||
| 	@echo MKNINJA $@ | ||||
| 	@mkdir -p $(OBJDIR) | ||||
| 	@sh $< > $@ | ||||
| install: install-bin # install-man install-docs ... | ||||
|  | ||||
| install-bin: fluxengine$(EXT) fluxengine-gui$(EXT) brother120tool$(EXT) brother240tool$(EXT) upgrade-flux-file$(EXT) | ||||
| 	install -d "$(DESTDIR)$(BINDIR)" | ||||
| 	for target in $^; do \ | ||||
| 		install $$target "$(DESTDIR)$(BINDIR)/$$target"; \ | ||||
| 	done | ||||
|  | ||||
| -include $(OBJS:%.o=%.d) | ||||
|   | ||||
							
								
								
									
										185
									
								
								README.md
									
									
									
									
									
								
							
							
						
						
									
										185
									
								
								README.md
									
									
									
									
									
								
							| @@ -2,7 +2,17 @@ FluxEngine | ||||
| ========== | ||||
|  | ||||
| (If you're reading this on GitHub, the formatting's a bit messed up. [Try the | ||||
| version on cowlark.com instead.](http://cowlark.com/fluxengine/) | ||||
| version on cowlark.com instead.](http://cowlark.com/fluxengine/)) | ||||
|  | ||||
| **Breaking news!** As of 2022-09-09, there's new [filesystem | ||||
| support](doc/filesystem.md). Read (and sometimes write) files directly from | ||||
| (and to) your disks, with eight different file systems! It works in the GUI, | ||||
| too, which is available for Linux (and other Unix clones), Windows and OSX. See | ||||
| the details below. | ||||
|  | ||||
| <div style="text-align: center"> | ||||
| <a href="doc/screenshot.jpg"><img src="doc/screenshot.jpg" style="width:60%" alt="screenshot of the GUI in action"></a> | ||||
| </div> | ||||
|  | ||||
| What? | ||||
| ----- | ||||
| @@ -24,10 +34,13 @@ Don't believe me? Watch the demo reel! | ||||
| <iframe width="373" height="210" src="https://www.youtube.com/embed/m_s1iw8eW7o" frameborder="0" allow="accelerometer; autoplay; encrypted-media; gyroscope; picture-in-picture" allowfullscreen></iframe> | ||||
| </div> | ||||
|  | ||||
| **Important note.** On 2020-04-02 I changed the bytecode format (and firmware). | ||||
| Flux files will need to be upgraded with `fluxengine upgradefluxfile`. The new | ||||
| format should be more reliable and use way, way less bandwidth. Sorry for the | ||||
| inconvenience. | ||||
| **New!** The FluxEngine client software now works with | ||||
| [GreaseWeazle](https://github.com/keirf/Greaseweazle/wiki) hardware. So, if you | ||||
| can't find a PSoC5 development kit, or don't want to use the Cypress Windows | ||||
| tools for programming it, you can use one of these instead. Very nearly all | ||||
| FluxEngine features are available with the GreaseWeazle and it works out-of-the | ||||
| box. See the [dedicated GreaseWeazle documentation page](doc/greaseweazle.md) | ||||
| for more information. | ||||
|  | ||||
| Where? | ||||
| ------ | ||||
| @@ -52,60 +65,83 @@ following friendly articles: | ||||
|   - [Using a FluxEngine](doc/using.md) ∾ what to do with your new hardware ∾ | ||||
|     flux files and image files ∾ knowing what you're doing | ||||
|  | ||||
|   - [Troubleshooting dubious disks](doc/problems.md) ∾ it's not an exact science ∾ | ||||
|     the sector map ∾ clock detection and the histogram | ||||
|   - [Using GreaseWeazle hardware with the FluxEngine client | ||||
|     software](doc/greaseweazle.md) ∾ what works ∾ what doesn't work ∾ where to | ||||
|     go for help | ||||
|  | ||||
|   - [Configuring for your drive](doc/drives.md) ∾ but I don't have a 80 track | ||||
|     drive! ∾ reading and writing 40 track disks ∾ Shugart and Apple II | ||||
|  | ||||
|   - [Direct filesystem access](doc/filesystem.md) ∾ imaging files is a pain | ||||
|     ∾ accessing files directly ∾ features and limitation ∾ it works on disk | ||||
|     images too, you say? | ||||
|      | ||||
|   - [Troubleshooting dubious disks](doc/problems.md) ∾ it's not an exact | ||||
|     science ∾ the sector map ∾ clock detection and the histogram | ||||
|  | ||||
|   - [Disk densities](doc/driveresponse.md) ∾ what's the difference between an HD | ||||
|     and DD disk? ∾ you can't do that with that ∾ measuring your drive's ability to | ||||
|     work with exotic formats ∾ I think my drive is broken | ||||
|  | ||||
| Which? | ||||
| ------ | ||||
|  | ||||
| The current support state is as follows. | ||||
|  | ||||
| Dinosaurs (🦖) have yet to be observed in real life --- I've written the | ||||
| decoder based on Kryoflux (or other) dumps I've found. I don't (yet) have | ||||
| real, physical disks in my hand to test the capture process. | ||||
| Dinosaurs (🦖) have yet to be observed in real life --- I've written the encoder | ||||
| and/or decoder based on Kryoflux (or other) dumps I've found. I don't (yet) have | ||||
| real, physical disks in my hand to test the capture process, or hardware to | ||||
| verify that written disks work. | ||||
|  | ||||
| Unicorns (🦄) are completely real --- this means that I've read actual, | ||||
| physical disks with these formats and so know they work (or had reports from | ||||
| people who've had it work). | ||||
| Unicorns (🦄) are completely real --- this means that I've read actual, physical | ||||
| disks with these formats and/or written real, physical disks and then used them | ||||
| on real hardware, and so know they work (or had reports from people who've had | ||||
| it work). | ||||
|  | ||||
| ### Old disk formats | ||||
| If a filesystem is listed, this means that FluxEngine natively supports that | ||||
| particular filesystem and can read (and sometimes write, support varies) files | ||||
| directly from disks, flux files or disk images. Some formats have multiple | ||||
| choices because they can store multiple types of file system. | ||||
|  | ||||
| | Format                                   | Read? | Write? | Notes | | ||||
| |:-----------------------------------------|:-----:|:------:|-------| | ||||
| | [IBM PC compatible](doc/disk-ibm.md)     |  🦄   |   🦄   | and compatibles (like the Atari ST) | | ||||
| | [Acorn ADFS](doc/disk-acornadfs.md)      |  🦄   |   🦖*  | single- and double- sided           | | ||||
| | [Acorn DFS](doc/disk-acorndfs.md)        |  🦄   |   🦖*  |                                     | | ||||
| | [Ampro Little Board](doc/disk-ampro.md)  |  🦖   |   🦖*   |                                     | | ||||
| | [Apple II DOS 3.3](doc/disk-apple2.md)   |  🦄   |        | doesn't do logical sector remapping | | ||||
| | [Amiga](doc/disk-amiga.md)               |  🦄   |        |                                     | | ||||
| | [Commodore 64 1541](doc/disk-c64.md)     |  🦖   |        | and probably the other GCR formats  | | ||||
| | [Brother 120kB](doc/disk-brother.md)     |  🦄   |        |                                     | | ||||
| | [Brother 240kB](doc/disk-brother.md)     |  🦄   |   🦄   |                                     | | ||||
| | [Brother FB-100](doc/disk-fb100.md)      |  🦖   |        | Tandy Model 100, Husky Hunter, knitting machines | | ||||
| | [Macintosh 800kB](doc/disk-macintosh.md) |  🦖   |        | and probably the 400kB too          | | ||||
| | [TRS-80](doc/disk-trs80.md)              |  🦖   |   🦖*  | a minor variation of the IBM scheme | | ||||
| <!-- FORMATSSTART --> | ||||
| <!-- This section is automatically generated. Do not edit. --> | ||||
|  | ||||
| | Profile | Format | Read? | Write? | Filesystem? | | ||||
| |:--------|:-------|:-----:|:------:|:------------| | ||||
| | [`acornadfs`](doc/disk-acornadfs.md) | Acorn ADFS: BBC Micro, Archimedes | 🦖 |  |  | | ||||
| | [`acorndfs`](doc/disk-acorndfs.md) | Acorn DFS: Acorn Atom, BBC Micro series | 🦄 |  | ACORNDFS  | | ||||
| | [`aeslanier`](doc/disk-aeslanier.md) | AES Lanier "No Problem": 616kB 5.25" 77-track SSDD hard sectored | 🦖 |  |  | | ||||
| | [`agat`](doc/disk-agat.md) | Agat: 840kB 5.25" 80-track DS | 🦖 | 🦖 |  | | ||||
| | [`amiga`](doc/disk-amiga.md) | Amiga: 880kB 3.5" DSDD | 🦄 | 🦄 | AMIGAFFS  | | ||||
| | [`ampro`](doc/disk-ampro.md) | Ampro Little Board: CP/M | 🦖 |  | CPMFS  | | ||||
| | [`apple2`](doc/disk-apple2.md) | Apple II: Prodos, Appledos, and CP/M | 🦄 | 🦄 | APPLEDOS CPMFS PRODOS  | | ||||
| | [`atarist`](doc/disk-atarist.md) | Atari ST: Almost PC compatible | 🦄 | 🦄 |  | | ||||
| | [`bk`](doc/disk-bk.md) | BK: 800kB 5.25"/3.5" 80-track 10-sector DSDD | 🦖 | 🦖 |  | | ||||
| | [`brother`](doc/disk-brother.md) | Brother word processors: GCR family | 🦄 | 🦄 | BROTHER120 FATFS  | | ||||
| | [`commodore`](doc/disk-commodore.md) | Commodore: 1541, 1581, 8050 and variations | 🦄 | 🦄 | CBMFS  | | ||||
| | [`eco1`](doc/disk-eco1.md) | VDS Eco1: CP/M; 1210kB 77-track mixed format DSHD | 🦖 |  | CPMFS  | | ||||
| | [`epsonpf10`](doc/disk-epsonpf10.md) | Epson PF-10: CP/M; 3.5" 40-track DSDD | 🦖 |  | CPMFS  | | ||||
| | [`f85`](doc/disk-f85.md) | Durango F85: 461kB 5.25" 77-track SS | 🦖 |  |  | | ||||
| | [`fb100`](doc/disk-fb100.md) | Brother FB-100: 100kB 3.5" 40-track SSSD | 🦖 |  |  | | ||||
| | [`hplif`](doc/disk-hplif.md) | Hewlett-Packard LIF: a variety of disk formats used by HP | 🦄 | 🦄 | LIF  | | ||||
| | [`ibm`](doc/disk-ibm.md) | IBM PC: Generic PC 3.5"/5.25" disks | 🦄 | 🦄 | FATFS  | | ||||
| | [`icl30`](doc/disk-icl30.md) | ICL Model 30: CP/M; 263kB 35-track DSSD | 🦖 |  | CPMFS  | | ||||
| | [`mac`](doc/disk-mac.md) | Macintosh: 400kB/800kB 3.5" GCR | 🦄 | 🦄 | MACHFS  | | ||||
| | [`micropolis`](doc/disk-micropolis.md) | Micropolis: 100tpi MetaFloppy disks | 🦄 | 🦄 |  | | ||||
| | [`mx`](doc/disk-mx.md) | DVK MX: Soviet-era PDP-11 clone | 🦖 |  |  | | ||||
| | [`n88basic`](doc/disk-n88basic.md) | N88-BASIC: PC8800/PC98 5.25" 77-track 26-sector DSHD | 🦄 | 🦄 |  | | ||||
| | [`northstar`](doc/disk-northstar.md) | Northstar: 5.25" hard sectored | 🦄 | 🦄 |  | | ||||
| | [`psos`](doc/disk-psos.md) | pSOS: 800kB DSDD with PHILE | 🦄 | 🦄 | PHILE  | | ||||
| | [`rolandd20`](doc/disk-rolandd20.md) | Roland D20: 3.5" electronic synthesiser disks | 🦖 |  |  | | ||||
| | [`rx50`](doc/disk-rx50.md) | Digital RX50: 400kB 5.25" 80-track 10-sector SSDD | 🦖 | 🦖 |  | | ||||
| | [`smaky6`](doc/disk-smaky6.md) | Smaky 6: 308kB 5.25" 77-track 16-sector SSDD, hard sectored | 🦖 |  | SMAKY6  | | ||||
| | [`tids990`](doc/disk-tids990.md) | Texas Instruments DS990: 1126kB 8" DSSD | 🦖 | 🦖 |  | | ||||
| | [`tiki`](doc/disk-tiki.md) | Tiki 100: CP/M |  |  | CPMFS  | | ||||
| | [`victor9k`](doc/disk-victor9k.md) | Victor 9000 / Sirius One: 1224kB 5.25" DSDD GCR | 🦖 | 🦖 |  | | ||||
| | [`zilogmcz`](doc/disk-zilogmcz.md) | Zilog MCZ: 320kB 8" 77-track SSSD hard-sectored | 🦖 |  |  | | ||||
| {: .datatable } | ||||
|  | ||||
| `*`: these formats are variations of the generic IBM format, and since the | ||||
| IBM writer is completely generic, it should be configurable for these | ||||
| formats... theoretically. I don't have the hardware to try it. | ||||
|  | ||||
| ### Even older disk formats | ||||
|  | ||||
| These formats are for particularly old, weird architectures, even by the | ||||
| standards of floppy disks. They've largely been implemented from single flux | ||||
| files with no access to physical hardware. Typically the reads were pretty | ||||
| bad and I've had to make a number of guesses as to how things work. They do, | ||||
| at least, check the CRC so what data's there is probably good. | ||||
|  | ||||
| | Format                                   | Read? | Write? | Notes | | ||||
| |:-----------------------------------------|:-----:|:------:|-------| | ||||
| | [AES Superplus / No Problem](doc/disk-aeslanier.md) |  🦖   | | hard sectors! | | ||||
| | [Durango F85](doc/disk-durangof85.md)    |  🦖   |        | 5.25" | | ||||
| | [DVK MX](doc/disk-mx.md)                 |  🦖   |        | Soviet PDP-11 clone | | ||||
| | [Victor 9000](doc/disk-victor9k.md)      |  🦖   |        | 8-inch        | | ||||
| | [Zilog MCZ](doc/disk-zilogmcz.md)        |  🦖   |        | 8-inch _and_ hard sectors | | ||||
| {: .datatable } | ||||
| <!-- FORMATSEND --> | ||||
|  | ||||
| ### Notes | ||||
|  | ||||
| @@ -122,7 +158,7 @@ at least, check the CRC so what data's there is probably good. | ||||
|     There hasn't been a lot of demand for this yet; if you have a pressing | ||||
|     need to write weird disks, [please | ||||
|     ask](https://github.com/davidgiven/fluxengine/issues/new). I haven't | ||||
|     implement write support for PC disks because they're boring and I'm lazy, | ||||
|     implemented write support for PC disks because they're boring and I'm lazy, | ||||
|     and also because they vary so much that figuring out how to specify them | ||||
|     is hard. | ||||
|  | ||||
| @@ -176,18 +212,51 @@ There may or may not be anything interesting there. | ||||
| License | ||||
| ------- | ||||
|  | ||||
| Everything here _except the contents of the `dep` directory_ is © 2019 David | ||||
| Given and is licensed under the MIT open source license. Please see | ||||
| Everything here _except the contents of the `dep` directory_ is © 2022 The | ||||
| FluxEngine Authors (mostly me, David Given; see the VCS history for the other | ||||
| people) and is licensed under the MIT open source license. Please see | ||||
| [COPYING](COPYING) for the full text. The tl;dr is: you can do what you like | ||||
| with it provided you don't claim you wrote it. | ||||
|  | ||||
| As an exception, `dep/fmt` contains a copy of [fmt](http://fmtlib.net), | ||||
| maintained by Victor Zverovich (`vitaut <https://github.com/vitaut>`) and | ||||
| Jonathan Müller (`foonathan <https://github.com/foonathan>`) with | ||||
| contributions from many other people. It is licensed under the terms of the | ||||
| BSD license. Please see the contents of the directory for the full text. | ||||
|  | ||||
| As an exception, `dep/emu` contains parts of the OpenBSD C library | ||||
| code, Todd Miller and William A. Rowe (and probably others). It is licensed | ||||
| code, maintained by Todd Miller and William A. Rowe (and probably others). It is licensed | ||||
| under the terms of the 3-clause BSD license. Please see the contents of the | ||||
| directory for the full text. It's been lightly modified by me. | ||||
|  | ||||
| As an exception, `dep/agg` contains parts of the Anti-Grain Antialiasing | ||||
| library, written by Maxim Semanarev (and others). It is licensed under the | ||||
| terms of the 3-clause BSD license. Please see the contents of the directory for | ||||
| the full text. It's been lightly modified by me. | ||||
|  | ||||
| As an exception, `dep/stb` contains parts of the libstb utility library, | ||||
| written by Sean T Barett (and others). It is public domain/Unlicense/MIT | ||||
| licensed, at your choice. Please see the contents of the directory for the full | ||||
| text. | ||||
|  | ||||
| As an exception, `dep/snowhouse` contains the snowhouse assertion library, | ||||
| taken from https://github.com/banditcpp/snowhouse. It is Boost Standard License | ||||
| 1.0 licensed. Please see the contents of the directory for the full text. Note | ||||
| that this is only used during the build and no code ends up in the output | ||||
| binaries. | ||||
|  | ||||
| As an exception, `dep/libusbp` contains the libusbp library, taken from | ||||
| https://github.com/pololu/libusbp. It is MIT licensed. Please see the contents | ||||
| of the directory for the full text. | ||||
|  | ||||
| As an exception, `dep/fatfs` contains the fatfs library, taken from | ||||
| http://elm-chan.org/fsw/ff/00index_e.html. It is single-clause BSD licensed. | ||||
| Please see the contents of the directory for the full text. | ||||
|  | ||||
| As an exception, `dep/adflib` contains the adflib library, written by Laurent | ||||
| Clevy et al, taken from https://github.com/lclevy/ADFlib. It is GPL 2.0 | ||||
| licensed. Please see the contents of the directory for the full text. | ||||
|  | ||||
| As an exception, `dep/hfsutils` contains a partial copy of the hfsutils | ||||
| package, written by Robert Leslie et al, taken from | ||||
| https://www.mars.org/home/rob/proj/hfs. It is GPL 2.0 licensed. Please see the | ||||
| contents of the directory for the full text. | ||||
|  | ||||
| __Important:__ Because of all these exceptions, if you distribute the | ||||
| FluxEngine package as a whole, you must comply with the terms of _all_ of the | ||||
| licensing terms. This means that __effectively the FluxEngine package is | ||||
| distributable under the terms of the GPL 2.0__. | ||||
|   | ||||
| @@ -2,19 +2,10 @@ | ||||
| #define AESLANIER_H | ||||
|  | ||||
| #define AESLANIER_RECORD_SEPARATOR 0x55555122 | ||||
| #define AESLANIER_SECTOR_LENGTH    256 | ||||
| #define AESLANIER_RECORD_SIZE      (AESLANIER_SECTOR_LENGTH + 5) | ||||
| #define AESLANIER_SECTOR_LENGTH 256 | ||||
| #define AESLANIER_RECORD_SIZE (AESLANIER_SECTOR_LENGTH + 5) | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
|  | ||||
| class AesLanierDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~AesLanierDecoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createAesLanierDecoder( | ||||
|     const DecoderProto& config); | ||||
|  | ||||
| #endif | ||||
|   | ||||
							
								
								
									
										4
									
								
								arch/aeslanier/aeslanier.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										4
									
								
								arch/aeslanier/aeslanier.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,4 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| message AesLanierDecoderProto {} | ||||
|  | ||||
| @@ -6,60 +6,59 @@ | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "sector.h" | ||||
| #include "bytes.h" | ||||
| #include "record.h" | ||||
| #include "fmt/format.h" | ||||
| #include <string.h> | ||||
|  | ||||
| static const FluxPattern SECTOR_PATTERN(32, AESLANIER_RECORD_SEPARATOR); | ||||
|  | ||||
| /* This is actually M2FM, rather than MFM, but it our MFM/FM decoder copes fine with it. */ | ||||
| /* This is actually M2FM, rather than MFM, but it our MFM/FM decoder copes fine | ||||
|  * with it. */ | ||||
|  | ||||
| static Bytes reverse_bits(const Bytes& input) | ||||
| class AesLanierDecoder : public Decoder | ||||
| { | ||||
|     Bytes output; | ||||
|     ByteWriter bw(output); | ||||
|  | ||||
|     for (uint8_t b : input) | ||||
|         bw.write_8(reverse_bits(b)); | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| AbstractDecoder::RecordType AesLanierDecoder::advanceToNextRecord() | ||||
| { | ||||
|     _sector->clock = _fmr->seekToPattern(SECTOR_PATTERN); | ||||
|     if (_fmr->eof() || !_sector->clock) | ||||
|         return UNKNOWN_RECORD; | ||||
|     return SECTOR_RECORD; | ||||
| } | ||||
|  | ||||
| void AesLanierDecoder::decodeSectorRecord() | ||||
| { | ||||
|     /* Skip ID mark. */ | ||||
|  | ||||
|     readRawBits(16); | ||||
|  | ||||
|     const auto& rawbits = readRawBits(AESLANIER_RECORD_SIZE*16); | ||||
|     const auto& bytes = decodeFmMfm(rawbits).slice(0, AESLANIER_RECORD_SIZE); | ||||
|     const auto& reversed = reverse_bits(bytes); | ||||
|  | ||||
|     _sector->logicalTrack = reversed[1]; | ||||
|     _sector->logicalSide = 0; | ||||
|     _sector->logicalSector = reversed[2]; | ||||
|  | ||||
|     /* Check header 'checksum' (which seems far too simple to mean much). */ | ||||
| public: | ||||
|     AesLanierDecoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         uint8_t wanted = reversed[3]; | ||||
|         uint8_t got = reversed[1] + reversed[2]; | ||||
|         if (wanted != got) | ||||
|             return; | ||||
|         return seekToPattern(SECTOR_PATTERN); | ||||
|     } | ||||
|  | ||||
|     /* Check data checksum, which also includes the header and is | ||||
|         * significantly better. */ | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         /* Skip ID mark (we know it's a AESLANIER_RECORD_SEPARATOR). */ | ||||
|  | ||||
|     _sector->data = reversed.slice(1, AESLANIER_SECTOR_LENGTH); | ||||
|     uint16_t wanted = reversed.reader().seek(0x101).read_le16(); | ||||
|     uint16_t got = crc16ref(MODBUS_POLY_REF, _sector->data); | ||||
|     _sector->status = (wanted == got) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|         readRawBits(16); | ||||
|  | ||||
|         const auto& rawbits = readRawBits(AESLANIER_RECORD_SIZE * 16); | ||||
|         const auto& bytes = | ||||
|             decodeFmMfm(rawbits).slice(0, AESLANIER_RECORD_SIZE); | ||||
|         const auto& reversed = bytes.reverseBits(); | ||||
|  | ||||
|         _sector->logicalTrack = reversed[1]; | ||||
|         _sector->logicalSide = 0; | ||||
|         _sector->logicalSector = reversed[2]; | ||||
|  | ||||
|         /* Check header 'checksum' (which seems far too simple to mean much). */ | ||||
|  | ||||
|         { | ||||
|             uint8_t wanted = reversed[3]; | ||||
|             uint8_t got = reversed[1] + reversed[2]; | ||||
|             if (wanted != got) | ||||
|                 return; | ||||
|         } | ||||
|  | ||||
|         /* Check data checksum, which also includes the header and is | ||||
|          * significantly better. */ | ||||
|  | ||||
|         _sector->data = reversed.slice(1, AESLANIER_SECTOR_LENGTH); | ||||
|         uint16_t wanted = reversed.reader().seek(0x101).read_le16(); | ||||
|         uint16_t got = crc16ref(MODBUS_POLY_REF, _sector->data); | ||||
|         _sector->status = (wanted == got) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createAesLanierDecoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new AesLanierDecoder(config)); | ||||
| } | ||||
|   | ||||
							
								
								
									
										20
									
								
								arch/agat/agat.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										20
									
								
								arch/agat/agat.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,20 @@ | ||||
| #include "globals.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "agat.h" | ||||
| #include "bytes.h" | ||||
| #include "fmt/format.h" | ||||
|  | ||||
| uint8_t agatChecksum(const Bytes& bytes) | ||||
| { | ||||
|     uint16_t checksum = 0; | ||||
|  | ||||
|     for (uint8_t b : bytes) | ||||
|     { | ||||
|         if (checksum > 0xff) | ||||
|             checksum = (checksum + 1) & 0xff; | ||||
|  | ||||
|         checksum += b; | ||||
|     } | ||||
|  | ||||
|     return checksum & 0xff; | ||||
| } | ||||
							
								
								
									
										19
									
								
								arch/agat/agat.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										19
									
								
								arch/agat/agat.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,19 @@ | ||||
| #ifndef AGAT_H | ||||
| #define AGAT_H | ||||
|  | ||||
| #define AGAT_SECTOR_SIZE 256 | ||||
|  | ||||
| static constexpr uint64_t SECTOR_ID = 0x8924555549111444; | ||||
| static constexpr uint64_t DATA_ID = 0x8924555514444911; | ||||
|  | ||||
| class Encoder; | ||||
| class EncoderProto; | ||||
| class Decoder; | ||||
| class DecoderProto; | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createAgatDecoder(const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createAgatEncoder(const EncoderProto& config); | ||||
|  | ||||
| extern uint8_t agatChecksum(const Bytes& bytes); | ||||
|  | ||||
| #endif | ||||
							
								
								
									
										19
									
								
								arch/agat/agat.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										19
									
								
								arch/agat/agat.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,19 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message AgatDecoderProto {} | ||||
|  | ||||
| message AgatEncoderProto { | ||||
| 	optional double target_clock_period_us = 1 | ||||
| 		[default=2.00, (help)="Data clock period of target format."]; | ||||
| 	optional double target_rotational_period_ms = 2 | ||||
| 		[default=200.0, (help)="Rotational period of target format."]; | ||||
| 	optional int32 post_index_gap_bytes = 3 | ||||
| 		[default=40, (help)="Post-index gap before first sector header."]; | ||||
| 	optional int32 pre_sector_gap_bytes = 4 | ||||
| 		[default=11, (help)="Gap before each sector header."]; | ||||
| 	optional int32 pre_data_gap_bytes = 5 | ||||
| 		[default=2, (help)="Gap before each sector data record."]; | ||||
| } | ||||
|  | ||||
							
								
								
									
										89
									
								
								arch/agat/decoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										89
									
								
								arch/agat/decoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,89 @@ | ||||
| #include "globals.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "agat.h" | ||||
| #include "crc.h" | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "sector.h" | ||||
| #include "bytes.h" | ||||
| #include "fmt/format.h" | ||||
| #include <string.h> | ||||
|  | ||||
| // clang-format off | ||||
| /* | ||||
|  * data:    X  X  X  X   X  X  X  X   X  -  -  X   -  X  -  X   -  X  X  -   X  -  X  -  = 0xff956a | ||||
|  * flux:   01 01 01 01  01 01 01 01  01 00 10 01  00 01 00 01  00 01 01 00  01 00 01 00  = 0x555549111444 | ||||
|  *  | ||||
|  * data:    X  X  X  X   X  X  X  X   -  X  X  -   X  -  X  -   X  -  -  X   -  X  -  X  = 0xff6a95 | ||||
|  * flux:   01 01 01 01  01 01 01 01  00 01 01 00  01 00 01 00  01 00 10 01  00 01 00 01  = 0x555514444911 | ||||
|  * | ||||
|  * Each pattern is prefixed with this one: | ||||
|  * | ||||
|  * data:          -  -   -  X   -  -   X  - = 0x12 | ||||
|  * flux:    (10) 10 10  10 01  00 10  01 00 = 0xa924 | ||||
|  * magic:   (10) 10 00  10 01  00 10  01 00 = 0x8924 | ||||
|  *                  ^ | ||||
|  * | ||||
|  * This seems to be generated by emitting A4 in MFM and then a single 0 bit to | ||||
|  * shift it out of phase, so the data bits become clock bits and vice versa. | ||||
|  * | ||||
|  *           X - X - - X - -  = 0xA4 | ||||
|  *          0100010010010010  = MFM encoded | ||||
|  *           1000100100100100 = with trailing zero | ||||
|  *            - - - X - - X - = effective bitstream = 0x12 | ||||
|  */ | ||||
| // clang-format on | ||||
|  | ||||
| static const FluxPattern SECTOR_PATTERN(64, SECTOR_ID); | ||||
| static const FluxPattern DATA_PATTERN(64, DATA_ID); | ||||
|  | ||||
| static const FluxMatchers ALL_PATTERNS = {&SECTOR_PATTERN, &DATA_PATTERN}; | ||||
|  | ||||
| class AgatDecoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     AgatDecoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ALL_PATTERNS); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         if (readRaw64() != SECTOR_ID) | ||||
|             return; | ||||
|  | ||||
|         auto bytes = decodeFmMfm(readRawBits(64)).slice(0, 4); | ||||
|         if (bytes[3] != 0x5a) | ||||
|             return; | ||||
|  | ||||
|         _sector->logicalTrack = bytes[1] >> 1; | ||||
|         _sector->logicalSector = bytes[2]; | ||||
|         _sector->logicalSide = bytes[1] & 1; | ||||
|         _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         if (readRaw64() != DATA_ID) | ||||
|             return; | ||||
|  | ||||
|         Bytes bytes = decodeFmMfm(readRawBits((AGAT_SECTOR_SIZE + 2) * 16)) | ||||
|                           .slice(0, AGAT_SECTOR_SIZE + 2); | ||||
|  | ||||
|         if (bytes[AGAT_SECTOR_SIZE + 1] != 0x5a) | ||||
|             return; | ||||
|  | ||||
|         _sector->data = bytes.slice(0, AGAT_SECTOR_SIZE); | ||||
|         uint8_t wantChecksum = bytes[AGAT_SECTOR_SIZE]; | ||||
|         uint8_t gotChecksum = agatChecksum(_sector->data); | ||||
|         _sector->status = | ||||
|             (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createAgatDecoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new AgatDecoder(config)); | ||||
| } | ||||
							
								
								
									
										118
									
								
								arch/agat/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										118
									
								
								arch/agat/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,118 @@ | ||||
| #include "lib/globals.h" | ||||
| #include "lib/decoders/decoders.h" | ||||
| #include "lib/encoders/encoders.h" | ||||
| #include "agat.h" | ||||
| #include "lib/crc.h" | ||||
| #include "lib/readerwriter.h" | ||||
| #include "lib/image.h" | ||||
| #include "lib/layout.h" | ||||
| #include "arch/agat/agat.pb.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
|  | ||||
| class AgatEncoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     AgatEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.agat()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     void writeRawBits(uint64_t data, int width) | ||||
|     { | ||||
|         _cursor += width; | ||||
|         _lastBit = data & 1; | ||||
|         for (int i = 0; i < width; i++) | ||||
|         { | ||||
|             unsigned pos = _cursor - i - 1; | ||||
|             if (pos < _bits.size()) | ||||
|                 _bits[pos] = data & 1; | ||||
|             data >>= 1; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     void writeBytes(const Bytes& bytes) | ||||
|     { | ||||
|         encodeMfm(_bits, _cursor, bytes, _lastBit); | ||||
|     } | ||||
|  | ||||
|     void writeByte(uint8_t byte) | ||||
|     { | ||||
|         Bytes b; | ||||
|         b.writer().write_8(byte); | ||||
|         writeBytes(b); | ||||
|     } | ||||
|  | ||||
|     void writeFillerRawBytes(int count, uint16_t byte) | ||||
|     { | ||||
|         for (int i = 0; i < count; i++) | ||||
|             writeRawBits(byte, 16); | ||||
|     }; | ||||
|  | ||||
|     void writeFillerBytes(int count, uint8_t byte) | ||||
|     { | ||||
|         Bytes b{byte}; | ||||
|         for (int i = 0; i < count; i++) | ||||
|             writeBytes(b); | ||||
|     }; | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         auto trackLayout = Layout::getLayoutOfTrack( | ||||
|             trackInfo->logicalTrack, trackInfo->logicalSide); | ||||
|  | ||||
|         double clockRateUs = _config.target_clock_period_us() / 2.0; | ||||
|         int bitsPerRevolution = | ||||
|             (_config.target_rotational_period_ms() * 1000.0) / clockRateUs; | ||||
|         _bits.resize(bitsPerRevolution); | ||||
|         _cursor = 0; | ||||
|  | ||||
|         writeFillerRawBytes(_config.post_index_gap_bytes(), 0xaaaa); | ||||
|  | ||||
|         for (const auto& sector : sectors) | ||||
|         { | ||||
|             /* Header */ | ||||
|  | ||||
|             writeFillerRawBytes(_config.pre_sector_gap_bytes(), 0xaaaa); | ||||
|             writeRawBits(SECTOR_ID, 64); | ||||
|             writeByte(0x5a); | ||||
|             writeByte((sector->logicalTrack << 1) | sector->logicalSide); | ||||
|             writeByte(sector->logicalSector); | ||||
|             writeByte(0x5a); | ||||
|  | ||||
|             /* Data */ | ||||
|  | ||||
|             writeFillerRawBytes(_config.pre_data_gap_bytes(), 0xaaaa); | ||||
|             auto data = sector->data.slice(0, AGAT_SECTOR_SIZE); | ||||
|             writeRawBits(DATA_ID, 64); | ||||
|             writeBytes(data); | ||||
|             writeByte(agatChecksum(data)); | ||||
|             writeByte(0x5a); | ||||
|         } | ||||
|  | ||||
|         if (_cursor >= _bits.size()) | ||||
|             error("track data overrun"); | ||||
|         fillBitmapTo(_bits, _cursor, _bits.size(), {true, false}); | ||||
|  | ||||
|         auto fluxmap = std::make_unique<Fluxmap>(); | ||||
|         fluxmap->appendBits(_bits, | ||||
|             calculatePhysicalClockPeriod(_config.target_clock_period_us() * 1e3, | ||||
|                 _config.target_rotational_period_ms() * 1e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const AgatEncoderProto& _config; | ||||
|     uint32_t _cursor; | ||||
|     bool _lastBit; | ||||
|     std::vector<bool> _bits; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createAgatEncoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new AgatEncoder(config)); | ||||
| } | ||||
| @@ -1,5 +1,4 @@ | ||||
| #include "globals.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "amiga.h" | ||||
| #include "bytes.h" | ||||
| @@ -19,61 +18,61 @@ uint32_t amigaChecksum(const Bytes& bytes) | ||||
|  | ||||
| static uint8_t everyother(uint16_t x) | ||||
| { | ||||
| 	                  /* aabb ccdd eeff gghh */ | ||||
| 	x &= 0x6666;      /* 0ab0 0cd0 0ef0 0gh0 */ | ||||
| 	x >>= 1;          /* 00ab 00cd 00ef 00gh */ | ||||
| 	x |= x << 2;      /* abab cdcd efef ghgh */ | ||||
| 	x &= 0x3c3c;      /* 00ab cd00 00ef gh00 */ | ||||
| 	x >>= 2;          /* 0000 abcd 0000 efgh */ | ||||
| 	x |= x >> 4;      /* 0000 abcd abcd efgh */ | ||||
| 	return x; | ||||
|     /* aabb ccdd eeff gghh */ | ||||
|     x &= 0x6666; /* 0ab0 0cd0 0ef0 0gh0 */ | ||||
|     x >>= 1;     /* 00ab 00cd 00ef 00gh */ | ||||
|     x |= x << 2; /* abab cdcd efef ghgh */ | ||||
|     x &= 0x3c3c; /* 00ab cd00 00ef gh00 */ | ||||
|     x >>= 2;     /* 0000 abcd 0000 efgh */ | ||||
|     x |= x >> 4; /* 0000 abcd abcd efgh */ | ||||
|     return x; | ||||
| } | ||||
|  | ||||
| Bytes amigaInterleave(const Bytes& input) | ||||
| { | ||||
| 	Bytes output; | ||||
| 	ByteWriter bw(output); | ||||
|     Bytes output; | ||||
|     ByteWriter bw(output); | ||||
|  | ||||
| 	/* Write all odd bits. (Numbering starts at 0...) */ | ||||
|     /* Write all odd bits. (Numbering starts at 0...) */ | ||||
|  | ||||
| 	{ | ||||
| 		ByteReader br(input); | ||||
| 		while (!br.eof()) | ||||
| 		{ | ||||
| 			uint16_t x = br.read_be16(); | ||||
| 			x &= 0xaaaa;       /* a0b0 c0d0 e0f0 g0h0 */ | ||||
| 			x |= x >> 1;       /* aabb ccdd eeff gghh */ | ||||
| 			x = everyother(x); /* 0000 0000 abcd efgh */ | ||||
| 			bw.write_8(x); | ||||
| 		} | ||||
| 	} | ||||
|     { | ||||
|         ByteReader br(input); | ||||
|         while (!br.eof()) | ||||
|         { | ||||
|             uint16_t x = br.read_be16(); | ||||
|             x &= 0xaaaa;       /* a0b0 c0d0 e0f0 g0h0 */ | ||||
|             x |= x >> 1;       /* aabb ccdd eeff gghh */ | ||||
|             x = everyother(x); /* 0000 0000 abcd efgh */ | ||||
|             bw.write_8(x); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| 	/* Write all even bits. */ | ||||
|     /* Write all even bits. */ | ||||
|  | ||||
| 	{ | ||||
| 		ByteReader br(input); | ||||
| 		while (!br.eof()) | ||||
| 		{ | ||||
| 			uint16_t x = br.read_be16(); | ||||
| 			x &= 0x5555;       /* 0a0b 0c0d 0e0f 0g0h */ | ||||
| 			x |= x << 1;       /* aabb ccdd eeff gghh */ | ||||
| 			x = everyother(x); /* 0000 0000 abcd efgh */ | ||||
| 			bw.write_8(x); | ||||
| 		} | ||||
| 	} | ||||
|     { | ||||
|         ByteReader br(input); | ||||
|         while (!br.eof()) | ||||
|         { | ||||
|             uint16_t x = br.read_be16(); | ||||
|             x &= 0x5555;       /* 0a0b 0c0d 0e0f 0g0h */ | ||||
|             x |= x << 1;       /* aabb ccdd eeff gghh */ | ||||
|             x = everyother(x); /* 0000 0000 abcd efgh */ | ||||
|             bw.write_8(x); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| 	return output; | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| Bytes amigaDeinterleave(const uint8_t*& input, size_t len) | ||||
| { | ||||
|     assert(!(len & 1)); | ||||
|     const uint8_t* odds = &input[0]; | ||||
|     const uint8_t* evens = &input[len/2]; | ||||
|     const uint8_t* evens = &input[len / 2]; | ||||
|     Bytes output; | ||||
|     ByteWriter bw(output); | ||||
|  | ||||
|     for (size_t i=0; i<len/2; i++) | ||||
|     for (size_t i = 0; i < len / 2; i++) | ||||
|     { | ||||
|         uint8_t o = *odds++; | ||||
|         uint8_t e = *evens++; | ||||
| @@ -82,11 +81,15 @@ Bytes amigaDeinterleave(const uint8_t*& input, size_t len) | ||||
|          * http://graphics.stanford.edu/~seander/bithacks.html#InterleaveBMN | ||||
|          */ | ||||
|         uint16_t result = | ||||
|             (((e * 0x0101010101010101ULL & 0x8040201008040201ULL) | ||||
|                 * 0x0102040810204081ULL >> 49) & 0x5555) | | ||||
|             (((o * 0x0101010101010101ULL & 0x8040201008040201ULL) | ||||
|                 * 0x0102040810204081ULL >> 48) & 0xAAAA); | ||||
|          | ||||
|             (((e * 0x0101010101010101ULL & 0x8040201008040201ULL) * | ||||
|                      0x0102040810204081ULL >> | ||||
|                  49) & | ||||
|                 0x5555) | | ||||
|             (((o * 0x0101010101010101ULL & 0x8040201008040201ULL) * | ||||
|                      0x0102040810204081ULL >> | ||||
|                  48) & | ||||
|                 0xAAAA); | ||||
|  | ||||
|         bw.write_be16(result); | ||||
|     } | ||||
|  | ||||
| @@ -96,6 +99,6 @@ Bytes amigaDeinterleave(const uint8_t*& input, size_t len) | ||||
|  | ||||
| Bytes amigaDeinterleave(const Bytes& input) | ||||
| { | ||||
| 	const uint8_t* ptr = input.cbegin(); | ||||
| 	return amigaDeinterleave(ptr, input.size()); | ||||
|     const uint8_t* ptr = input.cbegin(); | ||||
|     return amigaDeinterleave(ptr, input.size()); | ||||
| } | ||||
|   | ||||
| @@ -7,33 +7,10 @@ | ||||
|  | ||||
| #define AMIGA_TRACKS_PER_DISK 80 | ||||
| #define AMIGA_SECTORS_PER_TRACK 11 | ||||
| #define AMIGA_RECORD_SIZE 0x21f | ||||
| #define AMIGA_RECORD_SIZE 0x21c | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
| class SectorSet; | ||||
|  | ||||
| class AmigaDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~AmigaDecoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|  | ||||
| 	std::set<unsigned> requiredSectors(Track& track) const; | ||||
| }; | ||||
|  | ||||
| class AmigaEncoder : public AbstractEncoder | ||||
| { | ||||
| public: | ||||
| 	virtual ~AmigaEncoder() {} | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide, const SectorSet& allSectors); | ||||
| }; | ||||
|  | ||||
| extern FlagGroup amigaEncoderFlags; | ||||
| extern std::unique_ptr<Decoder> createAmigaDecoder(const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createAmigaEncoder(const EncoderProto& config); | ||||
|  | ||||
| extern uint32_t amigaChecksum(const Bytes& bytes); | ||||
| extern Bytes amigaInterleave(const Bytes& input); | ||||
|   | ||||
							
								
								
									
										13
									
								
								arch/amiga/amiga.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										13
									
								
								arch/amiga/amiga.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,13 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message AmigaDecoderProto {} | ||||
|  | ||||
| message AmigaEncoderProto { | ||||
| 	optional double clock_rate_us = 1 | ||||
| 		[default=2.00, (help)="Encoded data clock rate."]; | ||||
| 	optional double post_index_gap_ms = 2 | ||||
| 		[default=0.5, (help)="Post-index gap before first sector header."]; | ||||
| } | ||||
|  | ||||
| @@ -2,66 +2,83 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "amiga.h" | ||||
| #include "bytes.h" | ||||
| #include "fmt/format.h" | ||||
| #include "lib/decoders/decoders.pb.h" | ||||
| #include <string.h> | ||||
| #include <algorithm> | ||||
|  | ||||
| /*  | ||||
| /* | ||||
|  * Amiga disks use MFM but it's not quite the same as IBM MFM. They only use | ||||
|  * a single type of record with a different marker byte. | ||||
|  *  | ||||
|  * | ||||
|  * See the big comment in the IBM MFM decoder for the gruesome details of how | ||||
|  * MFM works. | ||||
|  */ | ||||
|           | ||||
|  | ||||
| static const FluxPattern SECTOR_PATTERN(48, AMIGA_SECTOR_RECORD); | ||||
|  | ||||
| AbstractDecoder::RecordType AmigaDecoder::advanceToNextRecord() | ||||
| class AmigaDecoder : public Decoder | ||||
| { | ||||
|     _sector->clock = _fmr->seekToPattern(SECTOR_PATTERN); | ||||
|     if (_fmr->eof() || !_sector->clock) | ||||
|         return UNKNOWN_RECORD; | ||||
|     return SECTOR_RECORD; | ||||
| } | ||||
| public: | ||||
|     AmigaDecoder(const DecoderProto& config): | ||||
|         Decoder(config), | ||||
|         _config(config.amiga()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| void AmigaDecoder::decodeSectorRecord() | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(SECTOR_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         if (readRaw48() != AMIGA_SECTOR_RECORD) | ||||
|             return; | ||||
|  | ||||
|         const auto& rawbits = readRawBits(AMIGA_RECORD_SIZE * 16); | ||||
|         if (rawbits.size() < (AMIGA_RECORD_SIZE * 16)) | ||||
|             return; | ||||
|         const auto& rawbytes = toBytes(rawbits).slice(0, AMIGA_RECORD_SIZE * 2); | ||||
|         const auto& bytes = decodeFmMfm(rawbits).slice(0, AMIGA_RECORD_SIZE); | ||||
|  | ||||
|         const uint8_t* ptr = bytes.begin(); | ||||
|  | ||||
|         Bytes header = amigaDeinterleave(ptr, 4); | ||||
|         Bytes recoveryinfo = amigaDeinterleave(ptr, 16); | ||||
|  | ||||
|         _sector->logicalTrack = header[1] >> 1; | ||||
|         _sector->logicalSide = header[1] & 1; | ||||
|         _sector->logicalSector = header[2]; | ||||
|  | ||||
|         uint32_t wantedheaderchecksum = | ||||
|             amigaDeinterleave(ptr, 4).reader().read_be32(); | ||||
|         uint32_t gotheaderchecksum = amigaChecksum(rawbytes.slice(0, 40)); | ||||
|         if (gotheaderchecksum != wantedheaderchecksum) | ||||
|             return; | ||||
|  | ||||
|         uint32_t wanteddatachecksum = | ||||
|             amigaDeinterleave(ptr, 4).reader().read_be32(); | ||||
|         uint32_t gotdatachecksum = amigaChecksum(rawbytes.slice(56, 1024)); | ||||
|  | ||||
|         Bytes data; | ||||
|         data.writer().append(amigaDeinterleave(ptr, 512)).append(recoveryinfo); | ||||
|         _sector->data = data; | ||||
|         _sector->status = (gotdatachecksum == wanteddatachecksum) | ||||
|                               ? Sector::OK | ||||
|                               : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const AmigaDecoderProto& _config; | ||||
|     nanoseconds_t _clock; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createAmigaDecoder(const DecoderProto& config) | ||||
| { | ||||
|     const auto& rawbits = readRawBits(AMIGA_RECORD_SIZE*16); | ||||
| 	if (rawbits.size() < (AMIGA_RECORD_SIZE*16)) | ||||
| 		return; | ||||
|     const auto& rawbytes = toBytes(rawbits).slice(0, AMIGA_RECORD_SIZE*2); | ||||
|     const auto& bytes = decodeFmMfm(rawbits).slice(0, AMIGA_RECORD_SIZE); | ||||
|  | ||||
|     const uint8_t* ptr = bytes.begin() + 3; | ||||
|  | ||||
|     Bytes header = amigaDeinterleave(ptr, 4); | ||||
|     Bytes recoveryinfo = amigaDeinterleave(ptr, 16); | ||||
|  | ||||
|     _sector->logicalTrack = header[1] >> 1; | ||||
|     _sector->logicalSide = header[1] & 1; | ||||
|     _sector->logicalSector = header[2]; | ||||
|  | ||||
|     uint32_t wantedheaderchecksum = amigaDeinterleave(ptr, 4).reader().read_be32(); | ||||
|     uint32_t gotheaderchecksum = amigaChecksum(rawbytes.slice(6, 40)); | ||||
|     if (gotheaderchecksum != wantedheaderchecksum) | ||||
|         return; | ||||
|  | ||||
|     uint32_t wanteddatachecksum = amigaDeinterleave(ptr, 4).reader().read_be32(); | ||||
|     uint32_t gotdatachecksum = amigaChecksum(rawbytes.slice(62, 1024)); | ||||
|  | ||||
|     _sector->data.clear(); | ||||
|     _sector->data.writer().append(amigaDeinterleave(ptr, 512)).append(recoveryinfo); | ||||
|     _sector->status = (gotdatachecksum == wanteddatachecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new AmigaDecoder(config)); | ||||
| } | ||||
|  | ||||
| std::set<unsigned> AmigaDecoder::requiredSectors(Track& track) const | ||||
| { | ||||
| 	static std::set<unsigned> sectors = { 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10 }; | ||||
| 	return sectors; | ||||
| } | ||||
|  | ||||
|   | ||||
| @@ -1,129 +1,149 @@ | ||||
| #include "globals.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "amiga.h" | ||||
| #include "crc.h" | ||||
| #include "sectorset.h" | ||||
| #include "writer.h" | ||||
|  | ||||
| FlagGroup amigaEncoderFlags; | ||||
|  | ||||
| static DoubleFlag clockRateUs( | ||||
| 	{ "--clock-rate" }, | ||||
| 	"Encoded data clock rate (microseconds).", | ||||
| 	2.00); | ||||
|  | ||||
| static DoubleFlag postIndexGapMs( | ||||
| 	{ "--post-index-gap" }, | ||||
| 	"Post-index gap before first sector header (milliseconds).", | ||||
| 	0.5); | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "arch/amiga/amiga.pb.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
|  | ||||
| static bool lastBit; | ||||
|  | ||||
| static int charToInt(char c) | ||||
| { | ||||
| 	if (isdigit(c)) | ||||
| 		return c - '0'; | ||||
| 	return 10 + tolower(c) - 'a'; | ||||
|     if (isdigit(c)) | ||||
|         return c - '0'; | ||||
|     return 10 + tolower(c) - 'a'; | ||||
| } | ||||
|  | ||||
| static void write_bits(std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src) | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src) | ||||
| { | ||||
| 	for (bool bit : src) | ||||
| 	{ | ||||
| 		if (cursor < bits.size()) | ||||
| 			bits[cursor++] = bit; | ||||
| 	} | ||||
|     for (bool bit : src) | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             lastBit = bits[cursor++] = bit; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width) | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width) | ||||
| { | ||||
| 	cursor += width; | ||||
| 	for (int i=0; i<width; i++) | ||||
| 	{ | ||||
| 		unsigned pos = cursor - i - 1; | ||||
| 		if (pos < bits.size()) | ||||
| 			bits[pos] = data & 1; | ||||
| 		data >>= 1; | ||||
| 	} | ||||
|     cursor += width; | ||||
|     lastBit = data & 1; | ||||
|     for (int i = 0; i < width; i++) | ||||
|     { | ||||
|         unsigned pos = cursor - i - 1; | ||||
|         if (pos < bits.size()) | ||||
|             bits[pos] = data & 1; | ||||
|         data >>= 1; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_interleaved_bytes(std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes) | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes) | ||||
| { | ||||
| 	assert(!(bytes.size() & 3)); | ||||
| 	Bytes interleaved = amigaInterleave(bytes); | ||||
| 	encodeMfm(bits, cursor, interleaved, lastBit); | ||||
|     ByteReader br(bytes); | ||||
|     BitReader bitr(br); | ||||
|  | ||||
|     while (!bitr.eof()) | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             bits[cursor++] = bitr.get(); | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_interleaved_bytes(std::vector<bool>& bits, unsigned& cursor, uint32_t data) | ||||
| static void write_sector(std::vector<bool>& bits, | ||||
|     unsigned& cursor, | ||||
|     const std::shared_ptr<const Sector>& sector) | ||||
| { | ||||
| 	Bytes b(4); | ||||
| 	ByteWriter bw(b); | ||||
| 	bw.write_be32(data); | ||||
| 	write_interleaved_bytes(bits, cursor, b); | ||||
|     if ((sector->data.size() != 512) && (sector->data.size() != 528)) | ||||
|         error("unsupported sector size --- you must pick 512 or 528"); | ||||
|  | ||||
|     uint32_t checksum = 0; | ||||
|  | ||||
|     auto write_interleaved_bytes = [&](const Bytes& bytes) | ||||
|     { | ||||
|         Bytes interleaved = amigaInterleave(bytes); | ||||
|         Bytes mfm = encodeMfm(interleaved, lastBit); | ||||
|         checksum ^= amigaChecksum(mfm); | ||||
|         checksum &= 0x55555555; | ||||
|         write_bits(bits, cursor, mfm); | ||||
|     }; | ||||
|  | ||||
|     auto write_interleaved_word = [&](uint32_t word) | ||||
|     { | ||||
|         Bytes b(4); | ||||
|         b.writer().write_be32(word); | ||||
|         write_interleaved_bytes(b); | ||||
|     }; | ||||
|  | ||||
|     write_bits(bits, cursor, 0xaaaa, 2 * 8); | ||||
|     write_bits(bits, cursor, AMIGA_SECTOR_RECORD, 6 * 8); | ||||
|  | ||||
|     checksum = 0; | ||||
|     Bytes header = {0xff, /* Amiga 1.0 format byte */ | ||||
|         (uint8_t)((sector->logicalTrack << 1) | sector->logicalSide), | ||||
|         (uint8_t)sector->logicalSector, | ||||
|         (uint8_t)(AMIGA_SECTORS_PER_TRACK - sector->logicalSector)}; | ||||
|     write_interleaved_bytes(header); | ||||
|     Bytes recoveryInfo(16); | ||||
|     if (sector->data.size() == 528) | ||||
|         recoveryInfo = sector->data.slice(512, 16); | ||||
|     write_interleaved_bytes(recoveryInfo); | ||||
|     write_interleaved_word(checksum); | ||||
|  | ||||
|     Bytes data = sector->data.slice(0, 512); | ||||
|     write_interleaved_word( | ||||
|         amigaChecksum(encodeMfm(amigaInterleave(data), lastBit))); | ||||
|     write_interleaved_bytes(data); | ||||
| } | ||||
|  | ||||
| static void write_sector(std::vector<bool>& bits, unsigned& cursor, const Sector* sector) | ||||
| class AmigaEncoder : public Encoder | ||||
| { | ||||
| 	if ((sector->data.size() != 512) && (sector->data.size() != 528)) | ||||
| 		Error() << "unsupported sector size --- you must pick 512 or 528"; | ||||
|  | ||||
|     write_bits(bits, cursor, AMIGA_SECTOR_RECORD, 6*8); | ||||
|  | ||||
| 	std::vector<bool> headerBits(20*16); | ||||
| 	unsigned headerCursor = 0; | ||||
|  | ||||
| 	Bytes header =  | ||||
| 		{ | ||||
| 			0xff, /* Amiga 1.0 format byte */ | ||||
| 			(uint8_t) ((sector->logicalTrack<<1) | sector->logicalSide), | ||||
| 			(uint8_t) sector->logicalSector, | ||||
| 			(uint8_t) (AMIGA_SECTORS_PER_TRACK - sector->logicalSector) | ||||
| 		}; | ||||
| 	write_interleaved_bytes(headerBits, headerCursor, header); | ||||
| 	Bytes recoveryInfo(16); | ||||
| 	if (sector->data.size() == 528) | ||||
| 		recoveryInfo = sector->data.slice(512, 16); | ||||
| 	write_interleaved_bytes(headerBits, headerCursor, recoveryInfo); | ||||
|  | ||||
| 	std::vector<bool> dataBits(512*16); | ||||
| 	unsigned dataCursor = 0; | ||||
| 	write_interleaved_bytes(dataBits, dataCursor, sector->data); | ||||
|  | ||||
| 	write_bits(bits, cursor, headerBits); | ||||
| 	uint32_t headerChecksum = amigaChecksum(toBytes(headerBits)); | ||||
| 	write_interleaved_bytes(bits, cursor, headerChecksum); | ||||
| 	uint32_t dataChecksum = amigaChecksum(toBytes(dataBits)); | ||||
| 	write_interleaved_bytes(bits, cursor, dataChecksum); | ||||
| 	write_bits(bits, cursor, dataBits); | ||||
| } | ||||
|  | ||||
| std::unique_ptr<Fluxmap> AmigaEncoder::encode( | ||||
| 	int physicalTrack, int physicalSide, const SectorSet& allSectors) | ||||
| { | ||||
| 	if ((physicalTrack < 0) || (physicalTrack >= AMIGA_TRACKS_PER_DISK)) | ||||
| 		return std::unique_ptr<Fluxmap>(); | ||||
|  | ||||
| 	int bitsPerRevolution = 200000.0 / clockRateUs; | ||||
| 	std::vector<bool> bits(bitsPerRevolution); | ||||
| 	unsigned cursor = 0; | ||||
|  | ||||
|     fillBitmapTo(bits, cursor, postIndexGapMs * 1000 / clockRateUs, { true, false }); | ||||
| 	lastBit = false; | ||||
|  | ||||
| 	for (int sectorId=0; sectorId<AMIGA_SECTORS_PER_TRACK; sectorId++) | ||||
| 	{ | ||||
| 		const auto& sectorData = allSectors.get(physicalTrack, physicalSide, sectorId); | ||||
| 		write_sector(bits, cursor, sectorData); | ||||
| public: | ||||
|     AmigaEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.amiga()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| 	if (cursor >= bits.size()) | ||||
| 		Error() << "track data overrun"; | ||||
| 	fillBitmapTo(bits, cursor, bits.size(), { true, false }); | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         /* Number of bits for one nominal revolution of a real 200ms Amiga disk. | ||||
|          */ | ||||
|         int bitsPerRevolution = 200e3 / _config.clock_rate_us(); | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
| 	std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
| 	fluxmap->appendBits(bits, clockRateUs*1e3); | ||||
| 	return fluxmap; | ||||
|         fillBitmapTo(bits, | ||||
|             cursor, | ||||
|             _config.post_index_gap_ms() * 1000 / _config.clock_rate_us(), | ||||
|             {true, false}); | ||||
|         lastBit = false; | ||||
|  | ||||
|         for (const auto& sector : sectors) | ||||
|             write_sector(bits, cursor, sector); | ||||
|  | ||||
|         if (cursor >= bits.size()) | ||||
|             error("track data overrun"); | ||||
|         fillBitmapTo(bits, cursor, bits.size(), {true, false}); | ||||
|  | ||||
|         auto fluxmap = std::make_unique<Fluxmap>(); | ||||
|         fluxmap->appendBits(bits, | ||||
|             calculatePhysicalClockPeriod(_config.clock_rate_us() * 1e3, 200e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const AmigaEncoderProto& _config; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createAmigaEncoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new AmigaEncoder(config)); | ||||
| } | ||||
|  | ||||
|   | ||||
| @@ -1,25 +1,19 @@ | ||||
| #ifndef APPLE2_H | ||||
| #define APPLE2_H | ||||
|  | ||||
| #define APPLE2_SECTOR_RECORD   0xd5aa96 | ||||
| #define APPLE2_DATA_RECORD     0xd5aaad | ||||
| #include <memory.h> | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
|  | ||||
| #define APPLE2_SECTOR_LENGTH   256 | ||||
| #define APPLE2_SECTOR_RECORD 0xd5aa96 | ||||
| #define APPLE2_DATA_RECORD 0xd5aaad | ||||
|  | ||||
| #define APPLE2_SECTOR_LENGTH 256 | ||||
| #define APPLE2_ENCODED_SECTOR_LENGTH 342 | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
|  | ||||
| class Apple2Decoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~Apple2Decoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|     void decodeDataRecord(); | ||||
| }; | ||||
| #define APPLE2_SECTORS 16 | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createApple2Decoder(const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createApple2Encoder(const EncoderProto& config); | ||||
|  | ||||
| #endif | ||||
|  | ||||
|   | ||||
							
								
								
									
										22
									
								
								arch/apple2/apple2.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										22
									
								
								arch/apple2/apple2.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,22 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message Apple2DecoderProto { | ||||
| 	optional uint32 side_one_track_offset = 1 | ||||
| 		[ default = 0, (help) = "offset to apply to track numbers on side 1" ]; | ||||
| } | ||||
|  | ||||
| message Apple2EncoderProto | ||||
| { | ||||
|     /* 245kHz. */ | ||||
|     optional double clock_period_us = 1 | ||||
|         [ default = 4, (help) = "clock rate on the real device" ]; | ||||
|      | ||||
|     /* Apple II disk drives spin at 300rpm. */ | ||||
|     optional double rotational_period_ms = 2 | ||||
|         [ default = 200.0, (help) = "rotational period on the real device" ]; | ||||
|  | ||||
| 	optional uint32 side_one_track_offset = 3 | ||||
| 		[ default = 0, (help) = "offset to apply to track numbers on side 1" ]; | ||||
| } | ||||
| @@ -2,10 +2,11 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "apple2.h" | ||||
| #include "arch/apple2/apple2.pb.h" | ||||
| #include "lib/decoders/decoders.pb.h" | ||||
| #include "bytes.h" | ||||
| #include "fmt/format.h" | ||||
| #include <string.h> | ||||
| @@ -13,22 +14,25 @@ | ||||
|  | ||||
| const FluxPattern SECTOR_RECORD_PATTERN(24, APPLE2_SECTOR_RECORD); | ||||
| const FluxPattern DATA_RECORD_PATTERN(24, APPLE2_DATA_RECORD); | ||||
| const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN }); | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
|     {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN}); | ||||
|  | ||||
| static int decode_data_gcr(uint8_t gcr) | ||||
| { | ||||
|     switch (gcr) | ||||
|     { | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case gcr: return data; | ||||
| 		#include "data_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case gcr:                \ | ||||
|         return data; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| }; | ||||
| } | ||||
|  | ||||
| /* This is extremely inspired by the MESS implementation, written by Nathan Woods | ||||
|  * and R. Belmont: https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp | ||||
| /* This is extremely inspired by the MESS implementation, written by Nathan | ||||
|  * Woods and R. Belmont: | ||||
|  * https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp | ||||
|  */ | ||||
| static Bytes decode_crazy_data(const uint8_t* inp, Sector::Status& status) | ||||
| { | ||||
| @@ -48,9 +52,11 @@ static Bytes decode_crazy_data(const uint8_t* inp, Sector::Status& status) | ||||
|         { | ||||
|             /* 3 * 2 bit */ | ||||
|             output[i + 0] = ((checksum >> 1) & 0x01) | ((checksum << 1) & 0x02); | ||||
|             output[i + 86] = ((checksum >> 3) & 0x01) | ((checksum >> 1) & 0x02); | ||||
|             output[i + 86] = | ||||
|                 ((checksum >> 3) & 0x01) | ((checksum >> 1) & 0x02); | ||||
|             if ((i + 172) < APPLE2_SECTOR_LENGTH) | ||||
|                 output[i + 172] = ((checksum >> 5) & 0x01) | ((checksum >> 3) & 0x02); | ||||
|                 output[i + 172] = | ||||
|                     ((checksum >> 5) & 0x01) | ((checksum >> 3) & 0x02); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -60,53 +66,110 @@ static Bytes decode_crazy_data(const uint8_t* inp, Sector::Status& status) | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| uint8_t combine(uint16_t word) | ||||
| static uint8_t combine(uint16_t word) | ||||
| { | ||||
|     return word & (word >> 7); | ||||
| } | ||||
|  | ||||
| AbstractDecoder::RecordType Apple2Decoder::advanceToNextRecord() | ||||
| class Apple2Decoder : public Decoder | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher); | ||||
| 	if (matcher == &SECTOR_RECORD_PATTERN) | ||||
| 		return RecordType::SECTOR_RECORD; | ||||
| 	if (matcher == &DATA_RECORD_PATTERN) | ||||
| 		return RecordType::DATA_RECORD; | ||||
| 	return RecordType::UNKNOWN_RECORD; | ||||
| } | ||||
| public: | ||||
|     Apple2Decoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
| void Apple2Decoder::decodeSectorRecord() | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         if (readRaw24() != APPLE2_SECTOR_RECORD) | ||||
|             return; | ||||
|  | ||||
|         /* Read header. */ | ||||
|  | ||||
|         auto header = toBytes(readRawBits(8 * 8)).slice(0, 8); | ||||
|         ByteReader br(header); | ||||
|  | ||||
|         uint8_t volume = combine(br.read_be16()); | ||||
|         _sector->logicalTrack = combine(br.read_be16()); | ||||
|         _sector->logicalSide = _sector->physicalSide; | ||||
|         _sector->logicalSector = combine(br.read_be16()); | ||||
|         uint8_t checksum = combine(br.read_be16()); | ||||
|  | ||||
|         // If the checksum is correct, upgrade the sector from MISSING | ||||
|         // to DATA_MISSING in anticipation of its data record | ||||
|         if (checksum == | ||||
|             (volume ^ _sector->logicalTrack ^ _sector->logicalSector)) | ||||
|             _sector->status = | ||||
|                 Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
|  | ||||
|         if (_sector->logicalSide == 1) | ||||
|             _sector->logicalTrack -= _config.apple2().side_one_track_offset(); | ||||
|  | ||||
|         /* Sanity check. */ | ||||
|  | ||||
|         if (_sector->logicalTrack > 100) | ||||
|         { | ||||
|             _sector->status = Sector::MISSING; | ||||
|             return; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         /* Check ID. */ | ||||
|  | ||||
|         if (readRaw24() != APPLE2_DATA_RECORD) | ||||
|             return; | ||||
|  | ||||
|         // Sometimes there's a 1-bit gap between APPLE2_DATA_RECORD and | ||||
|         // the data itself.  This has been seen on real world disks | ||||
|         // such as the Apple II Operating System Kit from Apple2Online. | ||||
|         // However, I haven't seen it described in any of the various | ||||
|         // references. | ||||
|         // | ||||
|         // This extra '0' bit would not affect the real disk interface, | ||||
|         // as it was a '1' reaching the top bit of a shift register | ||||
|         // that triggered a byte to be available, but it affects the | ||||
|         // way the data is read here. | ||||
|         // | ||||
|         // While the floppies tested only seemed to need this applied | ||||
|         // to the first byte of the data record, applying it | ||||
|         // consistently to all of them doesn't seem to hurt, and | ||||
|         // simplifies the code. | ||||
|  | ||||
|         /* Read and decode data. */ | ||||
|  | ||||
|         auto readApple8 = [&]() | ||||
|         { | ||||
|             auto result = 0; | ||||
|             while ((result & 0x80) == 0) | ||||
|             { | ||||
|                 auto b = readRawBits(1); | ||||
|                 if (b.empty()) | ||||
|                     break; | ||||
|                 result = (result << 1) | b[0]; | ||||
|             } | ||||
|             return result; | ||||
|         }; | ||||
|  | ||||
|         constexpr unsigned recordLength = APPLE2_ENCODED_SECTOR_LENGTH + 2; | ||||
|         uint8_t bytes[recordLength]; | ||||
|         for (auto& byte : bytes) | ||||
|         { | ||||
|             byte = readApple8(); | ||||
|         } | ||||
|  | ||||
|         // Upgrade the sector from MISSING to BAD_CHECKSUM. | ||||
|         // If decode_crazy_data succeeds, it upgrades the sector to | ||||
|         // OK. | ||||
|         _sector->status = Sector::BAD_CHECKSUM; | ||||
|         _sector->data = decode_crazy_data(&bytes[0], _sector->status); | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createApple2Decoder(const DecoderProto& config) | ||||
| { | ||||
|     /* Skip ID (as we know it's a APPLE2_SECTOR_RECORD). */ | ||||
|     readRawBits(24); | ||||
|  | ||||
|     /* Read header. */ | ||||
|  | ||||
|     auto header = toBytes(readRawBits(8*8)).slice(0, 8); | ||||
|     ByteReader br(header); | ||||
|  | ||||
|     uint8_t volume = combine(br.read_be16()); | ||||
|     _sector->logicalTrack = combine(br.read_be16()); | ||||
|     _sector->logicalSector = combine(br.read_be16()); | ||||
|     uint8_t checksum = combine(br.read_be16()); | ||||
|     if (checksum == (volume ^ _sector->logicalTrack ^ _sector->logicalSector)) | ||||
|         _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
| } | ||||
|  | ||||
| void Apple2Decoder::decodeDataRecord() | ||||
| { | ||||
|     /* Check ID. */ | ||||
|  | ||||
|     Bytes bytes = toBytes(readRawBits(3*8)).slice(0, 3); | ||||
|     if (bytes.reader().read_be24() != APPLE2_DATA_RECORD) | ||||
|         return; | ||||
|  | ||||
|     /* Read and decode data. */ | ||||
|  | ||||
|     unsigned recordLength = APPLE2_ENCODED_SECTOR_LENGTH + 2; | ||||
|     bytes = toBytes(readRawBits(recordLength*8)).slice(0, recordLength); | ||||
|  | ||||
|     _sector->status = Sector::BAD_CHECKSUM; | ||||
|     _sector->data = decode_crazy_data(&bytes[0], _sector->status); | ||||
|     return std::unique_ptr<Decoder>(new Apple2Decoder(config)); | ||||
| } | ||||
|   | ||||
							
								
								
									
										192
									
								
								arch/apple2/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										192
									
								
								arch/apple2/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,192 @@ | ||||
| #include "globals.h" | ||||
| #include "arch/apple2/apple2.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "sector.h" | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "fmt/format.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
| #include <ctype.h> | ||||
| #include "bytes.h" | ||||
|  | ||||
| static int encode_data_gcr(uint8_t data) | ||||
| { | ||||
|     switch (data) | ||||
|     { | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case data:               \ | ||||
|         return gcr; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| } | ||||
|  | ||||
| class Apple2Encoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     Apple2Encoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.apple2()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const Apple2EncoderProto& _config; | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         int bitsPerRevolution = | ||||
|             (_config.rotational_period_ms() * 1e3) / _config.clock_period_us(); | ||||
|  | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
|         for (const auto& sector : sectors) | ||||
|             writeSector(bits, cursor, *sector); | ||||
|  | ||||
|         if (cursor >= bits.size()) | ||||
|             error("track data overrun by {} bits", cursor - bits.size()); | ||||
|         fillBitmapTo(bits, cursor, bits.size(), {true, false}); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits(bits, | ||||
|             calculatePhysicalClockPeriod(_config.clock_period_us() * 1e3, | ||||
|                 _config.rotational_period_ms() * 1e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     uint8_t volume_id = 254; | ||||
|  | ||||
|     /* This is extremely inspired by the MESS implementation, written by Nathan | ||||
|      * Woods and R. Belmont: | ||||
|      * https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp | ||||
|      * as well as Understanding the Apple II (1983) Chapter 9 | ||||
|      * https://archive.org/details/Understanding_the_Apple_II_1983_Quality_Software/page/n230/mode/1up?view=theater | ||||
|      */ | ||||
|  | ||||
|     void writeSector( | ||||
|         std::vector<bool>& bits, unsigned& cursor, const Sector& sector) const | ||||
|     { | ||||
|         if ((sector.status == Sector::OK) or | ||||
|             (sector.status == Sector::BAD_CHECKSUM)) | ||||
|         { | ||||
|             auto write_bit = [&](bool val) | ||||
|             { | ||||
|                 if (cursor <= bits.size()) | ||||
|                 { | ||||
|                     bits[cursor] = val; | ||||
|                 } | ||||
|                 cursor++; | ||||
|             }; | ||||
|  | ||||
|             auto write_bits = [&](uint32_t bits, int width) | ||||
|             { | ||||
|                 for (int i = width; i--;) | ||||
|                 { | ||||
|                     write_bit(bits & (1u << i)); | ||||
|                 } | ||||
|             }; | ||||
|  | ||||
|             auto write_gcr44 = [&](uint8_t value) | ||||
|             { | ||||
|                 write_bits((value << 7) | value | 0xaaaa, 16); | ||||
|             }; | ||||
|  | ||||
|             auto write_gcr6 = [&](uint8_t value) | ||||
|             { | ||||
|                 write_bits(encode_data_gcr(value), 8); | ||||
|             }; | ||||
|  | ||||
|             // The special "FF40" sequence is used to synchronize the receiving | ||||
|             // shift register. It's written as "1111 1111 00"; FF indicates the | ||||
|             // 8 consecutive 1-bits, while "40" indicates the total number of | ||||
|             // microseconds. | ||||
|             auto write_ff40 = [&](int n = 1) | ||||
|             { | ||||
|                 for (; n--;) | ||||
|                 { | ||||
|                     write_bits(0xff << 2, 10); | ||||
|                 } | ||||
|             }; | ||||
|  | ||||
|             // There is data to encode to disk. | ||||
|             if ((sector.data.size() != APPLE2_SECTOR_LENGTH)) | ||||
|                 error("unsupported sector size {} --- you must pick 256", | ||||
|                     sector.data.size()); | ||||
|  | ||||
|             // Write address syncing leader : A sequence of "FF40"s; 5 of them | ||||
|             // are said to suffice to synchronize the decoder. | ||||
|             // "FF40" indicates that the actual data written is "1111 | ||||
|             // 1111 00" i.e., 8 1s and a total of 40 microseconds | ||||
|             // | ||||
|             // In standard formatting, the first logical sector apparently gets | ||||
|             // extra padding. | ||||
|             write_ff40(sector.logicalSector == 0 ? 32 : 8); | ||||
|  | ||||
|             int track = sector.logicalTrack; | ||||
|             if (sector.logicalSide == 1) | ||||
|                 track += _config.side_one_track_offset(); | ||||
|  | ||||
|             // Write address field: APPLE2_SECTOR_RECORD + sector identifier + | ||||
|             // DE AA EB | ||||
|             write_bits(APPLE2_SECTOR_RECORD, 24); | ||||
|             write_gcr44(volume_id); | ||||
|             write_gcr44(track); | ||||
|             write_gcr44(sector.logicalSector); | ||||
|             write_gcr44(volume_id ^ track ^ sector.logicalSector); | ||||
|             write_bits(0xDEAAEB, 24); | ||||
|  | ||||
|             // Write data syncing leader: FF40 + APPLE2_DATA_RECORD + sector | ||||
|             // data + sum + DE AA EB (+ mystery bits cut off of the scan?) | ||||
|             write_ff40(8); | ||||
|             write_bits(APPLE2_DATA_RECORD, 24); | ||||
|  | ||||
|             // Convert the sector data to GCR, append the checksum, and write it | ||||
|             // out | ||||
|             constexpr auto TWOBIT_COUNT = | ||||
|                 0x56; // Size of the 'twobit' area at the start of the GCR data | ||||
|             uint8_t checksum = 0; | ||||
|             for (int i = 0; i < APPLE2_ENCODED_SECTOR_LENGTH; i++) | ||||
|             { | ||||
|                 int value; | ||||
|                 if (i >= TWOBIT_COUNT) | ||||
|                 { | ||||
|                     value = sector.data[i - TWOBIT_COUNT] >> 2; | ||||
|                 } | ||||
|                 else | ||||
|                 { | ||||
|                     uint8_t tmp = sector.data[i]; | ||||
|                     value = ((tmp & 1) << 1) | ((tmp & 2) >> 1); | ||||
|  | ||||
|                     tmp = sector.data[i + TWOBIT_COUNT]; | ||||
|                     value |= ((tmp & 1) << 3) | ((tmp & 2) << 1); | ||||
|  | ||||
|                     if (i + 2 * TWOBIT_COUNT < APPLE2_SECTOR_LENGTH) | ||||
|                     { | ||||
|                         tmp = sector.data[i + 2 * TWOBIT_COUNT]; | ||||
|                         value |= ((tmp & 1) << 5) | ((tmp & 2) << 3); | ||||
|                     } | ||||
|                 } | ||||
|                 checksum ^= value; | ||||
|                 // assert(checksum & ~0x3f == 0); | ||||
|                 write_gcr6(checksum); | ||||
|                 checksum = value; | ||||
|             } | ||||
|             if (sector.status == Sector::BAD_CHECKSUM) | ||||
|                 checksum ^= 0x3f; | ||||
|             write_gcr6(checksum); | ||||
|             write_bits(0xDEAAEB, 24); | ||||
|         } | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createApple2Encoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new Apple2Encoder(config)); | ||||
| } | ||||
| @@ -3,46 +3,19 @@ | ||||
|  | ||||
| /* Brother word processor format (or at least, one of them) */ | ||||
|  | ||||
| #define BROTHER_SECTOR_RECORD            0xFFFFFD57 | ||||
| #define BROTHER_DATA_RECORD              0xFFFFFDDB | ||||
| #define BROTHER_DATA_RECORD_PAYLOAD      256 | ||||
| #define BROTHER_DATA_RECORD_CHECKSUM     3 | ||||
| #define BROTHER_SECTOR_RECORD 0xFFFFFD57 | ||||
| #define BROTHER_DATA_RECORD 0xFFFFFDDB | ||||
| #define BROTHER_DATA_RECORD_PAYLOAD 256 | ||||
| #define BROTHER_DATA_RECORD_CHECKSUM 3 | ||||
| #define BROTHER_DATA_RECORD_ENCODED_SIZE 415 | ||||
|  | ||||
| #define BROTHER_TRACKS_PER_240KB_DISK    78 | ||||
| #define BROTHER_TRACKS_PER_120KB_DISK    39 | ||||
| #define BROTHER_SECTORS_PER_TRACK        12 | ||||
| #define BROTHER_TRACKS_PER_240KB_DISK 78 | ||||
| #define BROTHER_TRACKS_PER_120KB_DISK 39 | ||||
| #define BROTHER_SECTORS_PER_TRACK 12 | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
|  | ||||
| class BrotherDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~BrotherDecoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|     void decodeDataRecord(); | ||||
| }; | ||||
|  | ||||
| class BrotherEncoder : public AbstractEncoder | ||||
| { | ||||
| public: | ||||
| 	BrotherEncoder(int format, int bias): | ||||
| 		_format(format), | ||||
| 		_bias(bias) | ||||
| 	{} | ||||
|  | ||||
| 	virtual ~BrotherEncoder() {} | ||||
|  | ||||
| private: | ||||
| 	int _format; | ||||
| 	int _bias; | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide, const SectorSet& allSectors); | ||||
| }; | ||||
|  | ||||
| extern FlagGroup brotherEncoderFlags; | ||||
| extern std::unique_ptr<Decoder> createBrotherDecoder( | ||||
|     const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createBrotherEncoder( | ||||
|     const EncoderProto& config); | ||||
|  | ||||
| #endif | ||||
|   | ||||
							
								
								
									
										18
									
								
								arch/brother/brother.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										18
									
								
								arch/brother/brother.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,18 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| message BrotherDecoderProto {} | ||||
|  | ||||
| enum BrotherFormat { | ||||
| 	BROTHER240 = 0; | ||||
| 	BROTHER120 = 1; | ||||
| }; | ||||
|  | ||||
| message BrotherEncoderProto { | ||||
| 	optional double clock_rate_us = 1 [default = 3.83]; | ||||
| 	optional double post_index_gap_ms = 2 [default = 1.0]; | ||||
| 	optional double sector_spacing_ms = 3 [default = 16.2]; | ||||
| 	optional double post_header_spacing_ms = 4 [default = 0.69]; | ||||
|  | ||||
| 	optional BrotherFormat format = 6 [default = BROTHER240]; | ||||
| } | ||||
|  | ||||
| @@ -1,28 +0,0 @@ | ||||
| #ifndef BROTHER_H | ||||
| #define BROTHER_H | ||||
|  | ||||
| /* Brother word processor format (or at least, one of them) */ | ||||
|  | ||||
| #define BROTHER_SECTOR_RECORD 0xFFFFFD57 | ||||
| #define BROTHER_DATA_RECORD   0xFFFFFDDB | ||||
| #define BROTHER_DATA_RECORD_PAYLOAD  256 | ||||
| #define BROTHER_DATA_RECORD_CHECKSUM 3 | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
|  | ||||
| class BrotherDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~BrotherDecoder() {} | ||||
|  | ||||
|     SectorVector decodeToSectors(const RawRecordVector& rawRecords); | ||||
|     int recordMatcher(uint64_t fifo) const; | ||||
| }; | ||||
|  | ||||
| extern void writeBrotherSectorHeader(std::vector<bool>& bits, unsigned& cursor, | ||||
| 		int track, int sector); | ||||
| extern void writeBrotherSectorData(std::vector<bool>& bits, unsigned& cursor, | ||||
| 		const std::vector<uint8_t>& data); | ||||
|  | ||||
| #endif | ||||
| @@ -1,13 +1,13 @@ | ||||
| GCR_ENTRY(0x55, 0) // 00000 | ||||
| GCR_ENTRY(0x57, 1) // 00001 | ||||
| GCR_ENTRY(0x5b, 2) // 00010 | ||||
| GCR_ENTRY(0x5d, 3) // 00011 | ||||
| GCR_ENTRY(0x5f, 4) // 00100  | ||||
| GCR_ENTRY(0x6b, 5) // 00101 | ||||
| GCR_ENTRY(0x6d, 6) // 00110 | ||||
| GCR_ENTRY(0x6f, 7) // 00111 | ||||
| GCR_ENTRY(0x75, 8) // 01000 | ||||
| GCR_ENTRY(0x77, 9) // 01001 | ||||
| GCR_ENTRY(0x55, 0)  // 00000 | ||||
| GCR_ENTRY(0x57, 1)  // 00001 | ||||
| GCR_ENTRY(0x5b, 2)  // 00010 | ||||
| GCR_ENTRY(0x5d, 3)  // 00011 | ||||
| GCR_ENTRY(0x5f, 4)  // 00100 | ||||
| GCR_ENTRY(0x6b, 5)  // 00101 | ||||
| GCR_ENTRY(0x6d, 6)  // 00110 | ||||
| GCR_ENTRY(0x6f, 7)  // 00111 | ||||
| GCR_ENTRY(0x75, 8)  // 01000 | ||||
| GCR_ENTRY(0x77, 9)  // 01001 | ||||
| GCR_ENTRY(0x7b, 10) // 01010 | ||||
| GCR_ENTRY(0x7d, 11) // 01011 | ||||
| GCR_ENTRY(0x7f, 12) // 01100 | ||||
| @@ -30,4 +30,3 @@ GCR_ENTRY(0xef, 28) // 11100 | ||||
| GCR_ENTRY(0xf5, 29) // 11101 | ||||
| GCR_ENTRY(0xf7, 30) // 11110 | ||||
| GCR_ENTRY(0xfb, 31) // 11111 | ||||
|  | ||||
|   | ||||
| @@ -1,10 +1,8 @@ | ||||
| #include "globals.h" | ||||
| #include "sql.h" | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "record.h" | ||||
| #include "brother.h" | ||||
| #include "sector.h" | ||||
| #include "bytes.h" | ||||
| @@ -13,7 +11,8 @@ | ||||
|  | ||||
| const FluxPattern SECTOR_RECORD_PATTERN(32, BROTHER_SECTOR_RECORD); | ||||
| const FluxPattern DATA_RECORD_PATTERN(32, BROTHER_DATA_RECORD); | ||||
| const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN }); | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
|     {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN}); | ||||
|  | ||||
| static std::vector<uint8_t> outputbuffer; | ||||
|  | ||||
| @@ -34,76 +33,89 @@ static int decode_data_gcr(uint8_t gcr) | ||||
| { | ||||
|     switch (gcr) | ||||
|     { | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case gcr: return data; | ||||
| 		#include "data_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case gcr:                \ | ||||
|         return data; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| }; | ||||
| } | ||||
|  | ||||
| static int decode_header_gcr(uint16_t word) | ||||
| { | ||||
| 	switch (word) | ||||
| 	{ | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case gcr: return data; | ||||
| 		#include "header_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| 	}                        | ||||
| 	return -1;              | ||||
|     switch (word) | ||||
|     { | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case gcr:                \ | ||||
|         return data; | ||||
| #include "header_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| } | ||||
|  | ||||
| class BrotherDecoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     BrotherDecoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         if (readRaw32() != BROTHER_SECTOR_RECORD) | ||||
|             return; | ||||
|  | ||||
|         const auto& rawbits = readRawBits(32); | ||||
|         const auto& bytes = toBytes(rawbits).slice(0, 4); | ||||
|  | ||||
|         ByteReader br(bytes); | ||||
|         _sector->logicalTrack = decode_header_gcr(br.read_be16()); | ||||
|         _sector->logicalSector = decode_header_gcr(br.read_be16()); | ||||
|  | ||||
|         /* Sanity check the values read; there's no header checksum and | ||||
|          * occasionally we get garbage due to bit errors. */ | ||||
|         if (_sector->logicalSector > 11) | ||||
|             return; | ||||
|         if (_sector->logicalTrack > 79) | ||||
|             return; | ||||
|  | ||||
|         _sector->status = Sector::DATA_MISSING; | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         if (readRaw32() != BROTHER_DATA_RECORD) | ||||
|             return; | ||||
|  | ||||
|         const auto& rawbits = readRawBits(BROTHER_DATA_RECORD_ENCODED_SIZE * 8); | ||||
|         const auto& rawbytes = | ||||
|             toBytes(rawbits).slice(0, BROTHER_DATA_RECORD_ENCODED_SIZE); | ||||
|  | ||||
|         Bytes bytes; | ||||
|         ByteWriter bw(bytes); | ||||
|         BitWriter bitw(bw); | ||||
|         for (uint8_t b : rawbytes) | ||||
|         { | ||||
|             uint32_t nibble = decode_data_gcr(b); | ||||
|             bitw.push(nibble, 5); | ||||
|         } | ||||
|         bitw.flush(); | ||||
|  | ||||
|         _sector->data = bytes.slice(0, BROTHER_DATA_RECORD_PAYLOAD); | ||||
|         uint32_t realCrc = crcbrother(_sector->data); | ||||
|         uint32_t wantCrc = | ||||
|             bytes.reader().seek(BROTHER_DATA_RECORD_PAYLOAD).read_be24(); | ||||
|         _sector->status = | ||||
|             (realCrc == wantCrc) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| AbstractDecoder::RecordType BrotherDecoder::advanceToNextRecord() | ||||
| std::unique_ptr<Decoder> createBrotherDecoder(const DecoderProto& config) | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher); | ||||
| 	if (matcher == &SECTOR_RECORD_PATTERN) | ||||
| 		return RecordType::SECTOR_RECORD; | ||||
| 	if (matcher == &DATA_RECORD_PATTERN) | ||||
| 		return RecordType::DATA_RECORD; | ||||
| 	return RecordType::UNKNOWN_RECORD; | ||||
| } | ||||
|  | ||||
| void BrotherDecoder::decodeSectorRecord() | ||||
| { | ||||
| 	readRawBits(32); | ||||
| 	const auto& rawbits = readRawBits(32); | ||||
| 	const auto& bytes = toBytes(rawbits).slice(0, 4); | ||||
|  | ||||
| 	ByteReader br(bytes); | ||||
| 	_sector->logicalTrack = decode_header_gcr(br.read_be16()); | ||||
| 	_sector->logicalSector = decode_header_gcr(br.read_be16()); | ||||
|  | ||||
| 	/* Sanity check the values read; there's no header checksum and | ||||
| 		* occasionally we get garbage due to bit errors. */ | ||||
| 	if (_sector->logicalSector > 11) | ||||
| 		return; | ||||
| 	if (_sector->logicalTrack > 79) | ||||
| 		return; | ||||
|  | ||||
| 	_sector->status = Sector::DATA_MISSING; | ||||
| } | ||||
|  | ||||
| void BrotherDecoder::decodeDataRecord() | ||||
| { | ||||
| 	readRawBits(32); | ||||
|  | ||||
| 	const auto& rawbits = readRawBits(BROTHER_DATA_RECORD_ENCODED_SIZE*8); | ||||
| 	const auto& rawbytes = toBytes(rawbits).slice(0, BROTHER_DATA_RECORD_ENCODED_SIZE); | ||||
|  | ||||
| 	Bytes bytes; | ||||
| 	ByteWriter bw(bytes); | ||||
| 	BitWriter bitw(bw); | ||||
| 	for (uint8_t b : rawbytes) | ||||
| 	{ | ||||
| 		uint32_t nibble = decode_data_gcr(b); | ||||
| 		bitw.push(nibble, 5); | ||||
| 	} | ||||
| 	bitw.flush(); | ||||
|  | ||||
| 	_sector->data = bytes.slice(0, BROTHER_DATA_RECORD_PAYLOAD); | ||||
| 	uint32_t realCrc = crcbrother(_sector->data); | ||||
| 	uint32_t wantCrc = bytes.reader().seek(BROTHER_DATA_RECORD_PAYLOAD).read_be24(); | ||||
| 	_sector->status = (realCrc == wantCrc) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new BrotherDecoder(config)); | ||||
| } | ||||
|   | ||||
| @@ -1,183 +1,154 @@ | ||||
| #include "globals.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "brother.h" | ||||
| #include "crc.h" | ||||
| #include "sectorset.h" | ||||
| #include "writer.h" | ||||
|  | ||||
| FlagGroup brotherEncoderFlags; | ||||
|  | ||||
| static DoubleFlag clockRateUs( | ||||
| 	{ "--clock-rate" }, | ||||
| 	"Encoded data clock rate (microseconds).", | ||||
| 	3.83); | ||||
|  | ||||
| static DoubleFlag postIndexGapMs( | ||||
| 	{ "--post-index-gap" }, | ||||
| 	"Post-index gap before first sector header (milliseconds).", | ||||
| 	1.0); | ||||
|  | ||||
| static DoubleFlag sectorSpacingMs( | ||||
| 	{ "--sector-spacing" }, | ||||
| 	"Time between successive sector headers (milliseconds).", | ||||
| 	16.2); | ||||
|  | ||||
| static DoubleFlag postHeaderSpacingMs( | ||||
| 	{ "--post-header-spacing" }, | ||||
| 	"Time between a sector's header and data records (milliseconds).", | ||||
| 	0.69); | ||||
|  | ||||
| static StringFlag sectorSkew( | ||||
| 	{ "--sector-skew" }, | ||||
| 	"Order in which to write sectors.", | ||||
| 	"05a3816b4927"); | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "arch/brother/brother.pb.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
|  | ||||
| static int encode_header_gcr(uint16_t word) | ||||
| { | ||||
| 	switch (word) | ||||
| 	{ | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case data: return gcr; | ||||
| 		#include "header_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| 	}                        | ||||
| 	return -1;              | ||||
| }; | ||||
|     switch (word) | ||||
|     { | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case data:               \ | ||||
|         return gcr; | ||||
| #include "header_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| } | ||||
|  | ||||
| static int encode_data_gcr(uint8_t data) | ||||
| { | ||||
| 	switch (data) | ||||
| 	{ | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case data: return gcr; | ||||
| 		#include "data_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| 	}                        | ||||
| 	return -1;              | ||||
| }; | ||||
|  | ||||
| static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint32_t data, int width) | ||||
| { | ||||
| 	cursor += width; | ||||
| 	for (int i=0; i<width; i++) | ||||
| 	{ | ||||
| 		unsigned pos = cursor - i - 1; | ||||
| 		if (pos < bits.size()) | ||||
| 			bits[pos] = data & 1; | ||||
| 		data >>= 1; | ||||
| 	} | ||||
|     switch (data) | ||||
|     { | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case data:               \ | ||||
|         return gcr; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| } | ||||
|  | ||||
| static void write_sector_header(std::vector<bool>& bits, unsigned& cursor, | ||||
| 		int track, int sector) | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, uint32_t data, int width) | ||||
| { | ||||
| 	write_bits(bits, cursor, 0xffffffff, 31); | ||||
| 	write_bits(bits, cursor, BROTHER_SECTOR_RECORD, 32); | ||||
| 	write_bits(bits, cursor, encode_header_gcr(track), 16); | ||||
| 	write_bits(bits, cursor, encode_header_gcr(sector), 16); | ||||
| 	write_bits(bits, cursor, encode_header_gcr(0x2f), 16); | ||||
|     cursor += width; | ||||
|     for (int i = 0; i < width; i++) | ||||
|     { | ||||
|         unsigned pos = cursor - i - 1; | ||||
|         if (pos < bits.size()) | ||||
|             bits[pos] = data & 1; | ||||
|         data >>= 1; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_sector_data(std::vector<bool>& bits, unsigned& cursor, const Bytes& data) | ||||
| static void write_sector_header( | ||||
|     std::vector<bool>& bits, unsigned& cursor, int track, int sector) | ||||
| { | ||||
| 	write_bits(bits, cursor, 0xffffffff, 32); | ||||
| 	write_bits(bits, cursor, BROTHER_DATA_RECORD, 32); | ||||
|     write_bits(bits, cursor, 0xffffffff, 31); | ||||
|     write_bits(bits, cursor, BROTHER_SECTOR_RECORD, 32); | ||||
|     write_bits(bits, cursor, encode_header_gcr(track), 16); | ||||
|     write_bits(bits, cursor, encode_header_gcr(sector), 16); | ||||
|     write_bits(bits, cursor, encode_header_gcr(0x2f), 16); | ||||
| } | ||||
|  | ||||
| 	uint16_t fifo = 0; | ||||
| 	int width = 0; | ||||
| static void write_sector_data( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const Bytes& data) | ||||
| { | ||||
|     write_bits(bits, cursor, 0xffffffff, 32); | ||||
|     write_bits(bits, cursor, BROTHER_DATA_RECORD, 32); | ||||
|  | ||||
| 	if (data.size() != BROTHER_DATA_RECORD_PAYLOAD) | ||||
| 		Error() << "unsupported sector size"; | ||||
|     uint16_t fifo = 0; | ||||
|     int width = 0; | ||||
|  | ||||
| 	auto write_byte = [&](uint8_t byte) | ||||
| 	{ | ||||
| 		fifo |= (byte << (8 - width)); | ||||
| 		width += 8; | ||||
|     if (data.size() != BROTHER_DATA_RECORD_PAYLOAD) | ||||
|         error("unsupported sector size"); | ||||
|  | ||||
| 		while (width >= 5) | ||||
| 		{ | ||||
| 			uint8_t quintet = fifo >> 11; | ||||
| 			fifo <<= 5; | ||||
| 			width -= 5; | ||||
|     auto write_byte = [&](uint8_t byte) | ||||
|     { | ||||
|         fifo |= (byte << (8 - width)); | ||||
|         width += 8; | ||||
|  | ||||
| 			write_bits(bits, cursor, encode_data_gcr(quintet), 8); | ||||
| 		} | ||||
| 	}; | ||||
|         while (width >= 5) | ||||
|         { | ||||
|             uint8_t quintet = fifo >> 11; | ||||
|             fifo <<= 5; | ||||
|             width -= 5; | ||||
|  | ||||
| 	for (uint8_t byte : data) | ||||
| 		write_byte(byte); | ||||
|             write_bits(bits, cursor, encode_data_gcr(quintet), 8); | ||||
|         } | ||||
|     }; | ||||
|  | ||||
| 	uint32_t realCrc = crcbrother(data); | ||||
| 	write_byte(realCrc>>16); | ||||
| 	write_byte(realCrc>>8); | ||||
| 	write_byte(realCrc); | ||||
| 	write_byte(0x58); /* magic */ | ||||
|     for (uint8_t byte : data) | ||||
|         write_byte(byte); | ||||
|  | ||||
|     uint32_t realCrc = crcbrother(data); | ||||
|     write_byte(realCrc >> 16); | ||||
|     write_byte(realCrc >> 8); | ||||
|     write_byte(realCrc); | ||||
|     write_byte(0x58); /* magic */ | ||||
|     write_byte(0xd4); | ||||
|     while (width != 0) | ||||
|         write_byte(0); | ||||
| } | ||||
|  | ||||
| static int charToInt(char c) | ||||
| class BrotherEncoder : public Encoder | ||||
| { | ||||
| 	if (isdigit(c)) | ||||
| 		return c - '0'; | ||||
| 	return 10 + tolower(c) - 'a'; | ||||
| } | ||||
| public: | ||||
|     BrotherEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.brother()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| std::unique_ptr<Fluxmap> BrotherEncoder::encode( | ||||
| 	int physicalTrack, int physicalSide, const SectorSet& allSectors) | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         int bitsPerRevolution = 200000.0 / _config.clock_rate_us(); | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
|         int sectorCount = 0; | ||||
|         for (const auto& sectorData : sectors) | ||||
|         { | ||||
|             double headerMs = _config.post_index_gap_ms() + | ||||
|                               sectorCount * _config.sector_spacing_ms(); | ||||
|             unsigned headerCursor = headerMs * 1e3 / _config.clock_rate_us(); | ||||
|             double dataMs = headerMs + _config.post_header_spacing_ms(); | ||||
|             unsigned dataCursor = dataMs * 1e3 / _config.clock_rate_us(); | ||||
|  | ||||
|             fillBitmapTo(bits, cursor, headerCursor, {true, false}); | ||||
|             write_sector_header(bits, | ||||
|                 cursor, | ||||
|                 sectorData->logicalTrack, | ||||
|                 sectorData->logicalSector); | ||||
|             fillBitmapTo(bits, cursor, dataCursor, {true, false}); | ||||
|             write_sector_data(bits, cursor, sectorData->data); | ||||
|  | ||||
|             sectorCount++; | ||||
|         } | ||||
|  | ||||
|         if (cursor >= bits.size()) | ||||
|             error("track data overrun"); | ||||
|         fillBitmapTo(bits, cursor, bits.size(), {true, false}); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits(bits, _config.clock_rate_us() * 1e3); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const BrotherEncoderProto& _config; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createBrotherEncoder(const EncoderProto& config) | ||||
| { | ||||
| 	int logicalTrack; | ||||
| 	if (physicalSide != 0) | ||||
| 		return std::unique_ptr<Fluxmap>(); | ||||
| 	physicalTrack -= _bias; | ||||
| 	switch (_format) | ||||
| 	{ | ||||
| 		case 120: | ||||
| 			if ((physicalTrack < 0) || (physicalTrack >= (BROTHER_TRACKS_PER_120KB_DISK*2)) | ||||
| 					|| (physicalTrack & 1)) | ||||
| 				return std::unique_ptr<Fluxmap>(); | ||||
| 			logicalTrack = physicalTrack/2; | ||||
| 			break; | ||||
|  | ||||
| 		case 240: | ||||
| 			if ((physicalTrack < 0) || (physicalTrack >= BROTHER_TRACKS_PER_240KB_DISK)) | ||||
| 				return std::unique_ptr<Fluxmap>(); | ||||
| 			logicalTrack = physicalTrack; | ||||
| 			break; | ||||
| 	} | ||||
|  | ||||
| 	int bitsPerRevolution = 200000.0 / clockRateUs; | ||||
| 	const std::string& skew = sectorSkew.get(); | ||||
| 	std::vector<bool> bits(bitsPerRevolution); | ||||
| 	unsigned cursor = 0; | ||||
|  | ||||
| 	for (int sectorCount=0; sectorCount<BROTHER_SECTORS_PER_TRACK; sectorCount++) | ||||
| 	{ | ||||
| 		int sectorId = charToInt(skew.at(sectorCount)); | ||||
| 		double headerMs = postIndexGapMs + sectorCount*sectorSpacingMs; | ||||
| 		unsigned headerCursor = headerMs*1e3 / clockRateUs; | ||||
| 		double dataMs = headerMs + postHeaderSpacingMs; | ||||
| 		unsigned dataCursor = dataMs*1e3 / clockRateUs; | ||||
|  | ||||
| 		const auto& sectorData = allSectors.get(logicalTrack, 0, sectorId); | ||||
|  | ||||
| 		fillBitmapTo(bits, cursor, headerCursor, { true, false }); | ||||
| 		write_sector_header(bits, cursor, logicalTrack, sectorId); | ||||
| 		fillBitmapTo(bits, cursor, dataCursor, { true, false }); | ||||
| 		write_sector_data(bits, cursor, sectorData->data); | ||||
| 	} | ||||
|  | ||||
| 	if (cursor >= bits.size()) | ||||
| 		Error() << "track data overrun"; | ||||
| 	fillBitmapTo(bits, cursor, bits.size(), { true, false }); | ||||
|  | ||||
| 	// The pre-index gap is not normally reported. | ||||
| 	// std::cerr << "pre-index gap " << 200.0 - (double)cursor*clockRateUs/1e3 << std::endl; | ||||
| 	 | ||||
| 	std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
| 	fluxmap->appendBits(bits, clockRateUs*1e3); | ||||
| 	return fluxmap; | ||||
|     return std::unique_ptr<Encoder>(new BrotherEncoder(config)); | ||||
| } | ||||
|   | ||||
| @@ -76,4 +76,3 @@ GCR_ENTRY(0x6BAB, 74) | ||||
| GCR_ENTRY(0xAD5F, 75) | ||||
| GCR_ENTRY(0xDBED, 76) | ||||
| GCR_ENTRY(0x55BB, 77) | ||||
|  | ||||
|   | ||||
							
								
								
									
										43
									
								
								arch/build.mk
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										43
									
								
								arch/build.mk
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,43 @@ | ||||
| LIBARCH_SRCS = \ | ||||
| 	arch/aeslanier/decoder.cc \ | ||||
| 	arch/agat/agat.cc \ | ||||
| 	arch/agat/decoder.cc \ | ||||
| 	arch/agat/encoder.cc \ | ||||
| 	arch/amiga/amiga.cc \ | ||||
| 	arch/amiga/decoder.cc \ | ||||
| 	arch/amiga/encoder.cc \ | ||||
| 	arch/apple2/decoder.cc \ | ||||
| 	arch/apple2/encoder.cc \ | ||||
| 	arch/brother/decoder.cc \ | ||||
| 	arch/brother/encoder.cc \ | ||||
| 	arch/c64/c64.cc \ | ||||
| 	arch/c64/decoder.cc \ | ||||
| 	arch/c64/encoder.cc \ | ||||
| 	arch/f85/decoder.cc \ | ||||
| 	arch/fb100/decoder.cc \ | ||||
| 	arch/ibm/decoder.cc \ | ||||
| 	arch/ibm/encoder.cc \ | ||||
| 	arch/macintosh/decoder.cc \ | ||||
| 	arch/macintosh/encoder.cc \ | ||||
| 	arch/micropolis/decoder.cc \ | ||||
| 	arch/micropolis/encoder.cc \ | ||||
| 	arch/mx/decoder.cc \ | ||||
| 	arch/northstar/decoder.cc \ | ||||
| 	arch/northstar/encoder.cc \ | ||||
| 	arch/rolandd20/decoder.cc \ | ||||
| 	arch/smaky6/decoder.cc \ | ||||
| 	arch/tids990/decoder.cc \ | ||||
| 	arch/tids990/encoder.cc \ | ||||
| 	arch/victor9k/decoder.cc \ | ||||
| 	arch/victor9k/encoder.cc \ | ||||
| 	arch/zilogmcz/decoder.cc \ | ||||
|  | ||||
| LIBARCH_OBJS = $(patsubst %.cc, $(OBJDIR)/%.o, $(LIBARCH_SRCS)) | ||||
| OBJS += $(LIBARCH_OBJS) | ||||
| $(LIBARCH_SRCS): | $(PROTO_HDRS) | ||||
| $(LIBARCH_SRCS): CFLAGS += $(PROTO_CFLAGS) | ||||
| LIBARCH_LIB = $(OBJDIR)/libarch.a | ||||
| LIBARCH_LDFLAGS = | ||||
| $(LIBARCH_LIB): $(LIBARCH_OBJS) | ||||
|  | ||||
| $(call use-pkgconfig, $(LIBARCH_LIB), $(LIBARCH_OBJS), fmt) | ||||
							
								
								
									
										28
									
								
								arch/c64/c64.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										28
									
								
								arch/c64/c64.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,28 @@ | ||||
| #include "globals.h" | ||||
| #include "c64.h" | ||||
|  | ||||
| /* | ||||
|  *   Track   Sectors/track   # Sectors   Storage in Bytes   Clock rate | ||||
|  *   -----   -------------   ---------   ----------------   ---------- | ||||
|  *    1-17        21            357           7820             3.25 | ||||
|  *   18-24        19            133           7170             3.5 | ||||
|  *   25-30        18            108           6300             3.75 | ||||
|  *   31-40(*)     17             85           6020             4 | ||||
|  *                              --- | ||||
|  *                              683 (for a 35 track image) | ||||
|  * | ||||
|  * The clock rate is normalised for a 200ms drive. | ||||
|  */ | ||||
|  | ||||
| nanoseconds_t clockPeriodForC64Track(unsigned track) | ||||
| { | ||||
|     constexpr double b = 8.0; | ||||
|  | ||||
|     if (track < 17) | ||||
|         return 26.0 / b; | ||||
|     if (track < 24) | ||||
|         return 28.0 / b; | ||||
|     if (track < 30) | ||||
|         return 30.0 / b; | ||||
|     return 32.0 / b; | ||||
| } | ||||
| @@ -1,21 +1,37 @@ | ||||
| #ifndef C64_H | ||||
| #define C64_H | ||||
|  | ||||
| #define C64_SECTOR_RECORD    0xffd49 | ||||
| #define C64_DATA_RECORD      0xffd57 | ||||
| #define C64_SECTOR_LENGTH    256 | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
| #define C64_SECTOR_RECORD 0xffd49 | ||||
| #define C64_DATA_RECORD 0xffd57 | ||||
| #define C64_SECTOR_LENGTH 256 | ||||
|  | ||||
| class Commodore64Decoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~Commodore64Decoder() {} | ||||
| /* Source: http://www.unusedino.de/ec64/technical/formats/g64.html | ||||
|    1. Header sync       FF FF FF FF FF (40 'on' bits, not GCR) | ||||
|    2. Header info       52 54 B5 29 4B 7A 5E 95 55 55 (10 GCR bytes) | ||||
|    3. Header gap        55 55 55 55 55 55 55 55 55 (9 bytes, never read) | ||||
|    4. Data sync         FF FF FF FF FF (40 'on' bits, not GCR) | ||||
|    5. Data block        55...4A (325 GCR bytes) | ||||
|    6. Inter-sector gap  55 55 55 55...55 55 (4 to 12 bytes, never read) | ||||
|    1. Header sync       (SYNC for the next sector) | ||||
| */ | ||||
| #define C64_HEADER_DATA_SYNC 0xFF | ||||
| #define C64_HEADER_BLOCK_ID 0x08 | ||||
| #define C64_DATA_BLOCK_ID 0x07 | ||||
| #define C64_HEADER_GAP 0x55 | ||||
| #define C64_INTER_SECTOR_GAP 0x55 | ||||
| #define C64_PADDING 0x0F | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|     void decodeDataRecord(); | ||||
| }; | ||||
| #define C64_TRACKS_PER_DISK 40 | ||||
| #define C64_BAM_TRACK 17 | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createCommodore64Decoder( | ||||
|     const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createCommodore64Encoder( | ||||
|     const EncoderProto& config); | ||||
|  | ||||
| extern nanoseconds_t clockPeriodForC64Track(unsigned track); | ||||
|  | ||||
| #endif | ||||
|   | ||||
							
								
								
									
										11
									
								
								arch/c64/c64.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										11
									
								
								arch/c64/c64.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,11 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message Commodore64DecoderProto {} | ||||
|  | ||||
| message Commodore64EncoderProto { | ||||
| 	optional double post_index_gap_us = 1 [default=0.0, | ||||
| 		(help) = "post-index gap before first sector header."]; | ||||
| } | ||||
|  | ||||
| @@ -2,7 +2,6 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "c64.h" | ||||
| @@ -14,19 +13,21 @@ | ||||
|  | ||||
| const FluxPattern SECTOR_RECORD_PATTERN(20, C64_SECTOR_RECORD); | ||||
| const FluxPattern DATA_RECORD_PATTERN(20, C64_DATA_RECORD); | ||||
| const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN }); | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
|     {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN}); | ||||
|  | ||||
| static int decode_data_gcr(uint8_t gcr) | ||||
| { | ||||
|     switch (gcr) | ||||
|     { | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case gcr: return data; | ||||
| 		#include "data_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case gcr:                \ | ||||
|         return data; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| }; | ||||
| } | ||||
|  | ||||
| static Bytes decode(const std::vector<bool>& bits) | ||||
| { | ||||
| @@ -38,11 +39,11 @@ static Bytes decode(const std::vector<bool>& bits) | ||||
|     while (ii != bits.end()) | ||||
|     { | ||||
|         uint8_t inputfifo = 0; | ||||
|         for (size_t i=0; i<5; i++) | ||||
|         for (size_t i = 0; i < 5; i++) | ||||
|         { | ||||
|             if (ii == bits.end()) | ||||
|                 break; | ||||
|             inputfifo = (inputfifo<<1) | *ii++; | ||||
|             inputfifo = (inputfifo << 1) | *ii++; | ||||
|         } | ||||
|  | ||||
|         bitw.push(decode_data_gcr(inputfifo), 4); | ||||
| @@ -52,41 +53,50 @@ static Bytes decode(const std::vector<bool>& bits) | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| AbstractDecoder::RecordType Commodore64Decoder::advanceToNextRecord() | ||||
| class Commodore64Decoder : public Decoder | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher); | ||||
| 	if (matcher == &SECTOR_RECORD_PATTERN) | ||||
| 		return RecordType::SECTOR_RECORD; | ||||
| 	if (matcher == &DATA_RECORD_PATTERN) | ||||
| 		return RecordType::DATA_RECORD; | ||||
| 	return RecordType::UNKNOWN_RECORD; | ||||
| } | ||||
| public: | ||||
|     Commodore64Decoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
| void Commodore64Decoder::decodeSectorRecord() | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         if (readRaw20() != C64_SECTOR_RECORD) | ||||
|             return; | ||||
|  | ||||
|         const auto& bits = readRawBits(5 * 10); | ||||
|         const auto& bytes = decode(bits).slice(0, 5); | ||||
|  | ||||
|         uint8_t checksum = bytes[0]; | ||||
|         _sector->logicalSector = bytes[1]; | ||||
|         _sector->logicalSide = 0; | ||||
|         _sector->logicalTrack = bytes[2] - 1; | ||||
|         if (checksum == xorBytes(bytes.slice(1, 4))) | ||||
|             _sector->status = | ||||
|                 Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         if (readRaw20() != C64_DATA_RECORD) | ||||
|             return; | ||||
|  | ||||
|         const auto& bits = readRawBits(259 * 10); | ||||
|         const auto& bytes = decode(bits).slice(0, 259); | ||||
|  | ||||
|         _sector->data = bytes.slice(0, C64_SECTOR_LENGTH); | ||||
|         uint8_t gotChecksum = xorBytes(_sector->data); | ||||
|         uint8_t wantChecksum = bytes[256]; | ||||
|         _sector->status = | ||||
|             (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createCommodore64Decoder(const DecoderProto& config) | ||||
| { | ||||
|     readRawBits(20); | ||||
|  | ||||
|     const auto& bits = readRawBits(5*10); | ||||
|     const auto& bytes = decode(bits).slice(0, 5); | ||||
|  | ||||
|     uint8_t checksum = bytes[0]; | ||||
|     _sector->logicalSector = bytes[1]; | ||||
|     _sector->logicalSide = 0; | ||||
|     _sector->logicalTrack = bytes[2] - 1; | ||||
|     if (checksum == xorBytes(bytes.slice(1, 4))) | ||||
|         _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
| } | ||||
|  | ||||
| void Commodore64Decoder::decodeDataRecord() | ||||
| { | ||||
|     readRawBits(20); | ||||
|  | ||||
|     const auto& bits = readRawBits(259*10); | ||||
|     const auto& bytes = decode(bits).slice(0, 259); | ||||
|  | ||||
|     _sector->data = bytes.slice(0, C64_SECTOR_LENGTH); | ||||
|     uint8_t gotChecksum = xorBytes(_sector->data); | ||||
|     uint8_t wantChecksum = bytes[256]; | ||||
|     _sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new Commodore64Decoder(config)); | ||||
| } | ||||
|   | ||||
							
								
								
									
										338
									
								
								arch/c64/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										338
									
								
								arch/c64/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,338 @@ | ||||
| #include "globals.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "c64.h" | ||||
| #include "crc.h" | ||||
| #include "sector.h" | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "fmt/format.h" | ||||
| #include "arch/c64/c64.pb.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
| #include "lib/layout.h" | ||||
| #include <ctype.h> | ||||
| #include "bytes.h" | ||||
|  | ||||
| static bool lastBit; | ||||
|  | ||||
| static int encode_data_gcr(uint8_t data) | ||||
| { | ||||
|     switch (data) | ||||
|     { | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case data:               \ | ||||
|         return gcr; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| } | ||||
|  | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src) | ||||
| { | ||||
|     for (bool bit : src) // Range-based for loop | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             bits[cursor++] = bit; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width) | ||||
| { | ||||
|     cursor += width; | ||||
|     for (int i = 0; i < width; i++) | ||||
|     { | ||||
|         unsigned pos = cursor - i - 1; | ||||
|         if (pos < bits.size()) | ||||
|             bits[pos] = data & 1; | ||||
|         data >>= 1; | ||||
|     } | ||||
| } | ||||
|  | ||||
| void bindump(std::ostream& stream, std::vector<bool>& buffer) | ||||
| { | ||||
|     size_t pos = 0; | ||||
|  | ||||
|     while ((pos < buffer.size()) and (pos < 520)) | ||||
|     { | ||||
|         stream << fmt::format("{:5d} : ", pos); | ||||
|         for (int i = 0; i < 40; i++) | ||||
|         { | ||||
|             if ((pos + i) < buffer.size()) | ||||
|                 stream << fmt::format("{:01b}", (buffer[pos + i])); | ||||
|             else | ||||
|                 stream << "-- "; | ||||
|             if ((((pos + i + 1) % 8) == 0) and i != 0) | ||||
|                 stream << "  "; | ||||
|         } | ||||
|         stream << std::endl; | ||||
|         pos += 40; | ||||
|     } | ||||
| } | ||||
| static std::vector<bool> encode_data(uint8_t input) | ||||
| { | ||||
|     /* | ||||
|      * Four 8-bit data bytes are converted to four 10-bit GCR bytes at a time by | ||||
|      * the 1541 DOS.  RAM is only an 8-bit storage device though. This hardware | ||||
|      * limitation prevents a 10-bit GCR byte from being stored in a single | ||||
|      * memory location. Four 10-bit GCR bytes total 40 bits - a number evenly | ||||
|      * divisible by our overriding 8-bit constraint. Commodore sub- divides the | ||||
|      * 40 GCR bits into five 8-bit bytes to solve this dilemma. This explains | ||||
|      * why four 8-bit data bytes are converted to GCR form at a time. The | ||||
|      * following step by step example demonstrates how this bit manipulation is | ||||
|      * performed by the DOS. | ||||
|      * | ||||
|      * STEP 1. Four 8-bit Data Bytes | ||||
|      * $08 $10 $00 $12 | ||||
|      * | ||||
|      * STEP 2. Hexadecimal to Binary Conversion | ||||
|      * 1. Binary Equivalents | ||||
|      * $08       $10         $00         $12 | ||||
|      * 00001000  00010000    00000000    00010010 | ||||
|      * | ||||
|      * STEP 3. Binary to GCR Conversion | ||||
|      * 1. Four 8-bit Data Bytes | ||||
|      * 00001000 00010000 00000000 00010010 | ||||
|      * 2. High and Low Nybbles | ||||
|      * 0000 1000 0001 0000 0000 0000 0001 0010 | ||||
|      * 3. High and Low Nybble GCR Equivalents | ||||
|      * 01010 01001 01011 01010 01010 01010 01011 10010 | ||||
|      * 4. Four 10-bit GCR Bytes | ||||
|      * 0101001001 0101101010 0101001010 0101110010 | ||||
|      * | ||||
|      * STEP 4. 10-bit GCR to 8-bit GCR Conversion | ||||
|      *   1. Concatenate Four 10-bit GCR Bytes | ||||
|      *   0101001001010110101001010010100101110010 | ||||
|      *   2. Five 8-bit Subdivisions | ||||
|      *   01010010 01010110 10100101 00101001 01110010 | ||||
|      * | ||||
|      * STEP 5. Binary to Hexadecimal Conversion | ||||
|      * 1. Hexadecimal Equivalents | ||||
|      *   01010010    01010110    10100101    00101001    01110010 | ||||
|      *   $52         $56         $A5         $29         $72 | ||||
|      * | ||||
|      * STEP 6. Four 8-bit Data Bytes are Recorded as Five 8-bit GCR Bytes | ||||
|      *   $08 $10 $00 $12 | ||||
|      * | ||||
|      * are recorded as | ||||
|      *   $52 $56 $A5 $29 $72 | ||||
|      */ | ||||
|  | ||||
|     std::vector<bool> output(10, false); | ||||
|     uint8_t hi = 0; | ||||
|     uint8_t lo = 0; | ||||
|     uint8_t lo_GCR = 0; | ||||
|     uint8_t hi_GCR = 0; | ||||
|  | ||||
|     // Convert the byte in high and low nibble | ||||
|     lo = input >> 4; // get the lo nibble shift the bits 4 to the right | ||||
|     hi = input & 15; // get the hi nibble bij masking the lo bits (00001111) | ||||
|  | ||||
|     lo_GCR = encode_data_gcr(lo); // example value: 0000   GCR = 01010 | ||||
|     hi_GCR = encode_data_gcr(hi); // example value: 1000   GCR = 01001 | ||||
|     // output = [0,1,2,3,4,5,6,7,8,9] | ||||
|     // value  = [0,1,0,1,0,0,1,0,0,1] | ||||
|     //           01010 01001 | ||||
|  | ||||
|     int b = 4; | ||||
|     for (int i = 0; i < 10; i++) | ||||
|     { | ||||
|         if (i < 5)                        // 01234 | ||||
|         {                                 // i = 0 op | ||||
|             output[4 - i] = (lo_GCR & 1); // 01010 | ||||
|  | ||||
|             // 01010 -> & 00001 -> 00000 output[4] = 0 | ||||
|             // 00101 -> & 00001 -> 00001 output[3] = 1 | ||||
|             // 00010 -> & 00001 -> 00000 output[2] = 0 | ||||
|             // 00001 -> & 00001 -> 00001 output[1] = 1 | ||||
|             // 00000 -> & 00001 -> 00000 output[0] = 0 | ||||
|             lo_GCR >>= 1; | ||||
|         } | ||||
|         else | ||||
|         { | ||||
|             output[i + b] = (hi_GCR & 1); // 01001 | ||||
|             // 01001 -> & 00001 -> 00001 output[9] = 1 | ||||
|             // 00100 -> & 00001 -> 00000 output[8] = 0 | ||||
|             // 00010 -> & 00001 -> 00000 output[7] = 0 | ||||
|             // 00001 -> & 00001 -> 00001 output[6] = 1 | ||||
|             // 00000 -> & 00001 -> 00000 output[5] = 0 | ||||
|             hi_GCR >>= 1; | ||||
|             b = b - 2; | ||||
|         } | ||||
|     } | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| class Commodore64Encoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     Commodore64Encoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.c64()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         /* The format ID Character # 1 and # 2 are in the .d64 image only | ||||
|          * present in track 18 sector zero which contains the BAM info in byte | ||||
|          * 162 and 163. it is written in every header of every sector and track. | ||||
|          * headers are not stored in a d64 disk image so we have to get it from | ||||
|          * track 18 which contains the BAM. | ||||
|          */ | ||||
|  | ||||
|         const auto& sectorData = image.get( | ||||
|             C64_BAM_TRACK, 0, 0); // Read de BAM to get the DISK ID bytes | ||||
|         if (sectorData) | ||||
|         { | ||||
|             ByteReader br(sectorData->data); | ||||
|             br.seek(162); // goto position of the first Disk ID Byte | ||||
|             _formatByte1 = br.read_8(); | ||||
|             _formatByte2 = br.read_8(); | ||||
|         } | ||||
|         else | ||||
|             _formatByte1 = _formatByte2 = 0; | ||||
|  | ||||
|         double clockRateUs = clockPeriodForC64Track(trackInfo->logicalTrack); | ||||
|         int bitsPerRevolution = 200000.0 / clockRateUs; | ||||
|  | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
|         fillBitmapTo(bits, | ||||
|             cursor, | ||||
|             _config.post_index_gap_us() / clockRateUs, | ||||
|             {true, false}); | ||||
|         lastBit = false; | ||||
|  | ||||
|         for (const auto& sector : sectors) | ||||
|             writeSector(bits, cursor, sector); | ||||
|  | ||||
|         if (cursor >= bits.size()) | ||||
|             error("track data overrun by {} bits", cursor - bits.size()); | ||||
|         fillBitmapTo(bits, cursor, bits.size(), {true, false}); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits( | ||||
|             bits, calculatePhysicalClockPeriod(clockRateUs * 1e3, 200e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     void writeSector(std::vector<bool>& bits, | ||||
|         unsigned& cursor, | ||||
|         std::shared_ptr<const Sector> sector) const | ||||
|     { | ||||
|         /* Source: http://www.unusedino.de/ec64/technical/formats/g64.html | ||||
|          * 1. Header sync       FF FF FF FF FF (40 'on' bits, not GCR) | ||||
|          * 2. Header info       52 54 B5 29 4B 7A 5E 95 55 55 (10 GCR bytes) | ||||
|          * 3. Header gap        55 55 55 55 55 55 55 55 55 (9 bytes, never read) | ||||
|          * 4. Data sync         FF FF FF FF FF (40 'on' bits, not GCR) | ||||
|          * 5. Data block        55...4A (325 GCR bytes) | ||||
|          * 6. Inter-sector gap  55 55 55 55...55 55 (4 to 12 bytes, never read) | ||||
|          * 1. Header sync       (SYNC for the next sector) | ||||
|          */ | ||||
|         if ((sector->status == Sector::OK) or | ||||
|             (sector->status == Sector::BAD_CHECKSUM)) | ||||
|         { | ||||
|             // There is data to encode to disk. | ||||
|             if ((sector->data.size() != C64_SECTOR_LENGTH)) | ||||
|                 error("unsupported sector size {} --- you must pick 256", | ||||
|                     sector->data.size()); | ||||
|  | ||||
|             // 1. Write header Sync (not GCR) | ||||
|             for (int i = 0; i < 6; i++) | ||||
|                 write_bits( | ||||
|                     bits, cursor, C64_HEADER_DATA_SYNC, 1 * 8); /* sync */ | ||||
|  | ||||
|             // 2. Write Header info 10 GCR bytes | ||||
|             /* | ||||
|              * The 10 byte header info (#2) is GCR encoded and must be decoded | ||||
|              * to it's normal 8 bytes to be understood. Once decoded, its | ||||
|              * breakdown is as follows: | ||||
|              * | ||||
|              * Byte $00 - header block ID           ($08) | ||||
|              *   01 - header block checksum 16  (EOR of $02-$05) | ||||
|              *   02 - Sector | ||||
|              *   03 - Track | ||||
|              *   04 - Format ID byte #2 | ||||
|              *   05 - Format ID byte #1 | ||||
|              *   06-07 - $0F ("off" bytes) | ||||
|              */ | ||||
|             uint8_t encodedTrack = | ||||
|                 ((sector->logicalTrack) + | ||||
|                     1); // C64 track numbering starts with 1. Fluxengine with 0. | ||||
|             uint8_t encodedSector = sector->logicalSector; | ||||
|             // uint8_t formatByte1 = C64_FORMAT_ID_BYTE1; | ||||
|             // uint8_t formatByte2 = C64_FORMAT_ID_BYTE2; | ||||
|             uint8_t headerChecksum = | ||||
|                 (encodedTrack ^ encodedSector ^ _formatByte1 ^ _formatByte2); | ||||
|             write_bits(bits, cursor, encode_data(C64_HEADER_BLOCK_ID)); | ||||
|             write_bits(bits, cursor, encode_data(headerChecksum)); | ||||
|             write_bits(bits, cursor, encode_data(encodedSector)); | ||||
|             write_bits(bits, cursor, encode_data(encodedTrack)); | ||||
|             write_bits(bits, cursor, encode_data(_formatByte2)); | ||||
|             write_bits(bits, cursor, encode_data(_formatByte1)); | ||||
|             write_bits(bits, cursor, encode_data(C64_PADDING)); | ||||
|             write_bits(bits, cursor, encode_data(C64_PADDING)); | ||||
|  | ||||
|             // 3. Write header GAP not GCR | ||||
|             for (int i = 0; i < 9; i++) | ||||
|                 write_bits( | ||||
|                     bits, cursor, C64_HEADER_GAP, 1 * 8); /* header gap */ | ||||
|  | ||||
|             // 4. Write Data sync not GCR | ||||
|             for (int i = 0; i < 6; i++) | ||||
|                 write_bits( | ||||
|                     bits, cursor, C64_HEADER_DATA_SYNC, 1 * 8); /* sync */ | ||||
|  | ||||
|             // 5. Write data block 325 GCR bytes | ||||
|             /* | ||||
|              * The 325 byte data block (#5) is GCR encoded and must be  decoded | ||||
|              * to  its normal 260 bytes to be understood. The data block is made | ||||
|              * up of the following: | ||||
|              * | ||||
|              * Byte    $00 - data block ID ($07) | ||||
|              *      01-100 - 256 bytes data | ||||
|              *      101 - data block checksum (EOR of $01-100) | ||||
|              *      102-103 - $00 ("off" bytes, to make the sector size a | ||||
|              * multiple of 5) | ||||
|              */ | ||||
|  | ||||
|             write_bits(bits, cursor, encode_data(C64_DATA_BLOCK_ID)); | ||||
|             uint8_t dataChecksum = xorBytes(sector->data); | ||||
|             ByteReader br(sector->data); | ||||
|             int i = 0; | ||||
|             for (i = 0; i < C64_SECTOR_LENGTH; i++) | ||||
|             { | ||||
|                 uint8_t val = br.read_8(); | ||||
|                 write_bits(bits, cursor, encode_data(val)); | ||||
|             } | ||||
|             write_bits(bits, cursor, encode_data(dataChecksum)); | ||||
|             write_bits(bits, cursor, encode_data(C64_PADDING)); | ||||
|             write_bits(bits, cursor, encode_data(C64_PADDING)); | ||||
|  | ||||
|             // 6. Write inter-sector gap 9 - 12 bytes nor gcr | ||||
|             for (int i = 0; i < 9; i++) | ||||
|                 write_bits( | ||||
|                     bits, cursor, C64_INTER_SECTOR_GAP, 1 * 8); /* sync */ | ||||
|         } | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const Commodore64EncoderProto& _config; | ||||
|     uint8_t _formatByte1; | ||||
|     uint8_t _formatByte2; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createCommodore64Encoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new Commodore64Encoder(config)); | ||||
| } | ||||
|  | ||||
| // vim: sw=4 ts=4 et | ||||
| @@ -2,7 +2,6 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "f85.h" | ||||
| @@ -14,19 +13,21 @@ | ||||
|  | ||||
| const FluxPattern SECTOR_RECORD_PATTERN(24, F85_SECTOR_RECORD); | ||||
| const FluxPattern DATA_RECORD_PATTERN(24, F85_DATA_RECORD); | ||||
| const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN }); | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
|     {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN}); | ||||
|  | ||||
| static int decode_data_gcr(uint8_t gcr) | ||||
| { | ||||
|     switch (gcr) | ||||
|     { | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case gcr: return data; | ||||
| 		#include "data_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case gcr:                \ | ||||
|         return data; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| }; | ||||
| } | ||||
|  | ||||
| static Bytes decode(const std::vector<bool>& bits) | ||||
| { | ||||
| @@ -38,11 +39,11 @@ static Bytes decode(const std::vector<bool>& bits) | ||||
|     while (ii != bits.end()) | ||||
|     { | ||||
|         uint8_t inputfifo = 0; | ||||
|         for (size_t i=0; i<5; i++) | ||||
|         for (size_t i = 0; i < 5; i++) | ||||
|         { | ||||
|             if (ii == bits.end()) | ||||
|                 break; | ||||
|             inputfifo = (inputfifo<<1) | *ii++; | ||||
|             inputfifo = (inputfifo << 1) | *ii++; | ||||
|         } | ||||
|  | ||||
|         bitw.push(decode_data_gcr(inputfifo), 4); | ||||
| @@ -52,49 +53,58 @@ static Bytes decode(const std::vector<bool>& bits) | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| AbstractDecoder::RecordType DurangoF85Decoder::advanceToNextRecord() | ||||
| class DurangoF85Decoder : public Decoder | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher); | ||||
| 	if (matcher == &SECTOR_RECORD_PATTERN) | ||||
| 		return RecordType::SECTOR_RECORD; | ||||
| 	if (matcher == &DATA_RECORD_PATTERN) | ||||
| 		return RecordType::DATA_RECORD; | ||||
| 	return RecordType::UNKNOWN_RECORD; | ||||
| } | ||||
| public: | ||||
|     DurangoF85Decoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
| void DurangoF85Decoder::decodeSectorRecord() | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         /* Skip sync bits and ID byte. */ | ||||
|  | ||||
|         if (readRaw24() != F85_SECTOR_RECORD) | ||||
|             return; | ||||
|  | ||||
|         /* Read header. */ | ||||
|  | ||||
|         const auto& bytes = decode(readRawBits(6 * 10)); | ||||
|  | ||||
|         _sector->logicalSector = bytes[2]; | ||||
|         _sector->logicalSide = 0; | ||||
|         _sector->logicalTrack = bytes[0]; | ||||
|  | ||||
|         uint16_t wantChecksum = bytes.reader().seek(4).read_be16(); | ||||
|         uint16_t gotChecksum = crc16(CCITT_POLY, 0xef21, bytes.slice(0, 4)); | ||||
|         if (wantChecksum == gotChecksum) | ||||
|             _sector->status = | ||||
|                 Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         /* Skip sync bits ID byte. */ | ||||
|  | ||||
|         if (readRaw24() != F85_DATA_RECORD) | ||||
|             return; | ||||
|  | ||||
|         const auto& bytes = decode(readRawBits((F85_SECTOR_LENGTH + 3) * 10)) | ||||
|                                 .slice(0, F85_SECTOR_LENGTH + 3); | ||||
|         ByteReader br(bytes); | ||||
|  | ||||
|         _sector->data = br.read(F85_SECTOR_LENGTH); | ||||
|         uint16_t wantChecksum = br.read_be16(); | ||||
|         uint16_t gotChecksum = crc16(CCITT_POLY, 0xbf84, _sector->data); | ||||
|         _sector->status = | ||||
|             (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createDurangoF85Decoder(const DecoderProto& config) | ||||
| { | ||||
|     /* Skip sync bits and ID byte. */ | ||||
|  | ||||
|     readRawBits(24); | ||||
|  | ||||
|     /* Read header. */ | ||||
|  | ||||
|     const auto& bytes = decode(readRawBits(6*10)); | ||||
|  | ||||
|     _sector->logicalSector = bytes[2]; | ||||
|     _sector->logicalSide = 0; | ||||
|     _sector->logicalTrack = bytes[0]; | ||||
|  | ||||
|     uint16_t wantChecksum = bytes.reader().seek(4).read_be16(); | ||||
|     uint16_t gotChecksum = crc16(CCITT_POLY, 0xef21, bytes.slice(0, 4)); | ||||
|     if (wantChecksum == gotChecksum) | ||||
|         _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
| } | ||||
|  | ||||
| void DurangoF85Decoder::decodeDataRecord() | ||||
| { | ||||
|     /* Skip sync bits ID byte. */ | ||||
|  | ||||
|     readRawBits(24); | ||||
|  | ||||
|     const auto& bytes = decode(readRawBits((F85_SECTOR_LENGTH+3)*10)) | ||||
|         .slice(0, F85_SECTOR_LENGTH+3); | ||||
|     ByteReader br(bytes); | ||||
|  | ||||
|     _sector->data = br.read(F85_SECTOR_LENGTH); | ||||
|     uint16_t wantChecksum = br.read_be16(); | ||||
|     uint16_t gotChecksum = crc16(CCITT_POLY, 0xbf84, _sector->data); | ||||
|     _sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new DurangoF85Decoder(config)); | ||||
| } | ||||
|   | ||||
| @@ -2,20 +2,10 @@ | ||||
| #define F85_H | ||||
|  | ||||
| #define F85_SECTOR_RECORD 0xffffce /* 1111 1111 1111 1111 1100 1110 */ | ||||
| #define F85_DATA_RECORD 0xffffcb /* 1111 1111 1111 1111 1100 1101 */ | ||||
| #define F85_SECTOR_LENGTH    512 | ||||
| #define F85_DATA_RECORD 0xffffcb   /* 1111 1111 1111 1111 1100 1101 */ | ||||
| #define F85_SECTOR_LENGTH 512 | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
|  | ||||
| class DurangoF85Decoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~DurangoF85Decoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|     void decodeDataRecord(); | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createDurangoF85Decoder( | ||||
|     const DecoderProto& config); | ||||
|  | ||||
| #endif | ||||
|   | ||||
							
								
								
									
										4
									
								
								arch/f85/f85.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										4
									
								
								arch/f85/f85.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,4 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| message F85DecoderProto {} | ||||
|  | ||||
| @@ -2,24 +2,22 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "fb100.h" | ||||
| #include "crc.h" | ||||
| #include "bytes.h" | ||||
| #include "decoders/rawbits.h" | ||||
| #include "track.h" | ||||
| #include "fmt/format.h" | ||||
| #include <string.h> | ||||
| #include <algorithm> | ||||
|  | ||||
| const FluxPattern SECTOR_ID_PATTERN(16, 0xabaa); | ||||
|  | ||||
| /*  | ||||
| /* | ||||
|  * Reverse engineered from a dump of the floppy drive's ROM. I have no idea how | ||||
|  * it works. | ||||
|  *  | ||||
|  * | ||||
|  * LF8BA: | ||||
|  *         clra | ||||
|  *         staa    X00B0 | ||||
| @@ -99,37 +97,46 @@ static uint16_t checksum(const Bytes& bytes) | ||||
|     return (crchi << 8) | crclo; | ||||
| } | ||||
|  | ||||
| AbstractDecoder::RecordType Fb100Decoder::advanceToNextRecord() | ||||
| class Fb100Decoder : public Decoder | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(SECTOR_ID_PATTERN, matcher); | ||||
|     if (matcher == &SECTOR_ID_PATTERN) | ||||
| 		return RecordType::SECTOR_RECORD; | ||||
| 	return RecordType::UNKNOWN_RECORD; | ||||
| public: | ||||
|     Fb100Decoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(SECTOR_ID_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         auto rawbits = readRawBits(FB100_RECORD_SIZE * 16); | ||||
|  | ||||
|         const Bytes bytes = decodeFmMfm(rawbits).slice(0, FB100_RECORD_SIZE); | ||||
|         ByteReader br(bytes); | ||||
|         br.seek(1); | ||||
|         const Bytes id = br.read(FB100_ID_SIZE); | ||||
|         uint16_t wantIdCrc = br.read_be16(); | ||||
|         uint16_t gotIdCrc = checksum(id); | ||||
|         const Bytes payload = br.read(FB100_PAYLOAD_SIZE); | ||||
|         uint16_t wantPayloadCrc = br.read_be16(); | ||||
|         uint16_t gotPayloadCrc = checksum(payload); | ||||
|  | ||||
|         if (wantIdCrc != gotIdCrc) | ||||
|             return; | ||||
|  | ||||
|         uint8_t abssector = id[2]; | ||||
|         _sector->logicalTrack = abssector >> 1; | ||||
|         _sector->logicalSide = 0; | ||||
|         _sector->logicalSector = abssector & 1; | ||||
|         _sector->data.writer().append(id.slice(5, 12)).append(payload); | ||||
|  | ||||
|         _sector->status = (wantPayloadCrc == gotPayloadCrc) | ||||
|                               ? Sector::OK | ||||
|                               : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createFb100Decoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new Fb100Decoder(config)); | ||||
| } | ||||
|  | ||||
| void Fb100Decoder::decodeSectorRecord() | ||||
| { | ||||
|     auto rawbits = readRawBits(FB100_RECORD_SIZE*16); | ||||
|  | ||||
|     const Bytes bytes = decodeFmMfm(rawbits).slice(0, FB100_RECORD_SIZE); | ||||
|     ByteReader br(bytes); | ||||
|     br.seek(1); | ||||
|     const Bytes id = br.read(FB100_ID_SIZE); | ||||
|     uint16_t wantIdCrc = br.read_be16(); | ||||
|     uint16_t gotIdCrc = checksum(id); | ||||
|     const Bytes payload = br.read(FB100_PAYLOAD_SIZE); | ||||
|     uint16_t wantPayloadCrc = br.read_be16(); | ||||
|     uint16_t gotPayloadCrc = checksum(payload); | ||||
|  | ||||
|     if (wantIdCrc != gotIdCrc) | ||||
|         return; | ||||
|  | ||||
|     uint8_t abssector = id[2]; | ||||
|     _sector->logicalTrack = abssector >> 1; | ||||
|     _sector->logicalSide = 0; | ||||
|     _sector->logicalSector = abssector & 1; | ||||
|     _sector->data.writer().append(id.slice(5, 12)).append(payload); | ||||
|  | ||||
|     _sector->status = (wantPayloadCrc == gotPayloadCrc) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
| } | ||||
| @@ -5,18 +5,6 @@ | ||||
| #define FB100_ID_SIZE 17 | ||||
| #define FB100_PAYLOAD_SIZE 0x500 | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
| class Track; | ||||
|  | ||||
| class Fb100Decoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~Fb100Decoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createFb100Decoder(const DecoderProto& config); | ||||
|  | ||||
| #endif | ||||
|  | ||||
|   | ||||
							
								
								
									
										4
									
								
								arch/fb100/fb100.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										4
									
								
								arch/fb100/fb100.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,4 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| message Fb100DecoderProto {} | ||||
|  | ||||
| @@ -5,25 +5,27 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "sector.h" | ||||
| #include "record.h" | ||||
| #include "arch/ibm/ibm.pb.h" | ||||
| #include "proto.h" | ||||
| #include "lib/layout.h" | ||||
| #include <string.h> | ||||
|  | ||||
| static_assert(std::is_trivially_copyable<IbmIdam>::value, | ||||
| 		"IbmIdam is not trivially copyable"); | ||||
|     "IbmIdam is not trivially copyable"); | ||||
|  | ||||
| /* | ||||
|  * The markers at the beginning of records are special, and have | ||||
|  * missing clock pulses, allowing them to be found by the logic. | ||||
|  *  | ||||
|  * | ||||
|  * IAM record: | ||||
|  * flux:   XXXX-XXX-XXXX-X- = 0xf77a | ||||
|  * clock:  X X - X - X X X  = 0xd7 | ||||
|  * data:    X X X X X X - - = 0xfc | ||||
|  *  | ||||
|  * | ||||
|  * (We just ignore this one --- it's useless and optional.) | ||||
|  */ | ||||
|  | ||||
| /*  | ||||
| /* | ||||
|  * IDAM record: | ||||
|  * flux:   XXXX-X-X-XXXXXX- = 0xf57e | ||||
|  * clock:  X X - - - X X X  = 0xc7 | ||||
| @@ -31,7 +33,7 @@ static_assert(std::is_trivially_copyable<IbmIdam>::value, | ||||
|  */ | ||||
| const FluxPattern FM_IDAM_PATTERN(16, 0xf57e); | ||||
|  | ||||
| /*  | ||||
| /* | ||||
|  * DAM1 record: | ||||
|  * flux:   XXXX-X-X-XX-X-X- = 0xf56a | ||||
|  * clock:  X X - - - X X X  = 0xc7 | ||||
| @@ -39,7 +41,7 @@ const FluxPattern FM_IDAM_PATTERN(16, 0xf57e); | ||||
|  */ | ||||
| const FluxPattern FM_DAM1_PATTERN(16, 0xf56a); | ||||
|  | ||||
| /*  | ||||
| /* | ||||
|  * DAM2 record: | ||||
|  * flux:   XXXX-X-X-XX-XXXX = 0xf56f | ||||
|  * clock:  X X - - - X X X  = 0xc7 | ||||
| @@ -47,7 +49,7 @@ const FluxPattern FM_DAM1_PATTERN(16, 0xf56a); | ||||
|  */ | ||||
| const FluxPattern FM_DAM2_PATTERN(16, 0xf56f); | ||||
|  | ||||
| /*  | ||||
| /* | ||||
|  * TRS80DAM1 record: | ||||
|  * flux:   XXXX-X-X-XX-X-XX = 0xf56b | ||||
|  * clock:  X X - - - X X X  = 0xc7 | ||||
| @@ -55,7 +57,7 @@ const FluxPattern FM_DAM2_PATTERN(16, 0xf56f); | ||||
|  */ | ||||
| const FluxPattern FM_TRS80DAM1_PATTERN(16, 0xf56b); | ||||
|  | ||||
| /*  | ||||
| /* | ||||
|  * TRS80DAM2 record: | ||||
|  * flux:   XXXX-X-X-XX-XXX- = 0xf56e | ||||
|  * clock:  X X - - - X X X  = 0xc7 | ||||
| @@ -71,89 +73,178 @@ const FluxPattern FM_TRS80DAM2_PATTERN(16, 0xf56e); | ||||
|  *                       ^^^^^ | ||||
|  * When shifted out of phase, the special 0xa1 byte becomes an illegal | ||||
|  * encoding (you can't do 10 00). So this can't be spoofed by user data. | ||||
|  *  | ||||
|  * | ||||
|  * shifted: 10 00 10 01 00 01 00 1 | ||||
|  *  | ||||
|  * | ||||
|  * It's repeated three times. | ||||
|  */ | ||||
| const FluxPattern MFM_PATTERN(48, 0x448944894489LL); | ||||
|  | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
| const FluxMatchers ANY_RECORD_PATTERN({ | ||||
|     &MFM_PATTERN, | ||||
|     &FM_IDAM_PATTERN, | ||||
|     &FM_DAM1_PATTERN, | ||||
|     &FM_DAM2_PATTERN, | ||||
|     &FM_TRS80DAM1_PATTERN, | ||||
|     &FM_TRS80DAM2_PATTERN, | ||||
| }); | ||||
|  | ||||
| class IbmDecoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     IbmDecoder(const DecoderProto& config): | ||||
|         Decoder(config), | ||||
|         _config(config.ibm()) | ||||
|     { | ||||
|         &MFM_PATTERN, | ||||
|         &FM_IDAM_PATTERN, | ||||
|         &FM_DAM1_PATTERN, | ||||
|         &FM_DAM2_PATTERN, | ||||
|         &FM_TRS80DAM1_PATTERN, | ||||
|         &FM_TRS80DAM2_PATTERN, | ||||
|     } | ||||
| ); | ||||
|  | ||||
| AbstractDecoder::RecordType IbmDecoder::advanceToNextRecord() | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher); | ||||
|  | ||||
|     /* If this is the MFM prefix byte, the the decoder is going to expect three | ||||
|      * extra bytes on the front of the header. */ | ||||
|     _currentHeaderLength = (matcher == &MFM_PATTERN) ? 3 : 0; | ||||
|  | ||||
|     Fluxmap::Position here = tell(); | ||||
|     if (_currentHeaderLength > 0) | ||||
|         readRawBits(_currentHeaderLength*16); | ||||
|     auto idbits = readRawBits(16); | ||||
|     const Bytes idbytes = decodeFmMfm(idbits); | ||||
|     uint8_t id = idbytes.slice(0, 1)[0]; | ||||
|     seek(here); | ||||
|      | ||||
|     switch (id) | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         case IBM_IDAM: | ||||
|             return RecordType::SECTOR_RECORD; | ||||
|  | ||||
|         case IBM_DAM1: | ||||
|         case IBM_DAM2: | ||||
|         case IBM_TRS80DAM1: | ||||
|         case IBM_TRS80DAM2: | ||||
|             return RecordType::DATA_RECORD; | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|     return RecordType::UNKNOWN_RECORD; | ||||
| } | ||||
|  | ||||
| void IbmDecoder::decodeSectorRecord() | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         /* This is really annoying because the IBM record scheme has a | ||||
|          * variable-sized header _and_ the checksum covers this header too. So | ||||
|          * we have to read and decode a byte at a time until we know where the | ||||
|          * record itself starts, saving the bytes for the checksumming later. | ||||
|          */ | ||||
|  | ||||
|         Bytes bytes; | ||||
|         ByteWriter bw(bytes); | ||||
|  | ||||
|         auto readByte = [&]() | ||||
|         { | ||||
|             auto bits = readRawBits(16); | ||||
|             auto bytes = decodeFmMfm(bits).slice(0, 1); | ||||
|             uint8_t byte = bytes[0]; | ||||
|             bw.write_8(byte); | ||||
|             return byte; | ||||
|         }; | ||||
|  | ||||
|         uint8_t id = readByte(); | ||||
|         if (id == 0xa1) | ||||
|         { | ||||
|             readByte(); | ||||
|             readByte(); | ||||
|             id = readByte(); | ||||
|         } | ||||
|         if (id != IBM_IDAM) | ||||
|             return; | ||||
|  | ||||
|         ByteReader br(bytes); | ||||
|         br.seek(bw.pos); | ||||
|  | ||||
|         auto bits = readRawBits(IBM_IDAM_LEN * 16); | ||||
|         bw += decodeFmMfm(bits).slice(0, IBM_IDAM_LEN); | ||||
|  | ||||
|         IbmDecoderProto::TrackdataProto trackdata; | ||||
|         getTrackFormat( | ||||
|             trackdata, _sector->physicalTrack, _sector->physicalSide); | ||||
|  | ||||
|         _sector->logicalTrack = br.read_8(); | ||||
|         _sector->logicalSide = br.read_8(); | ||||
|         _sector->logicalSector = br.read_8(); | ||||
|         _currentSectorSize = 1 << (br.read_8() + 7); | ||||
|  | ||||
|         uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, br.pos)); | ||||
|         uint16_t wantCrc = br.read_be16(); | ||||
|         if (wantCrc == gotCrc) | ||||
|             _sector->status = | ||||
|                 Sector::DATA_MISSING; /* correct but unintuitive */ | ||||
|  | ||||
|         if (trackdata.ignore_side_byte()) | ||||
|             _sector->logicalSide = | ||||
|                 Layout::remapSidePhysicalToLogical(_sector->physicalSide); | ||||
|         _sector->logicalSide ^= trackdata.invert_side_byte(); | ||||
|         if (trackdata.ignore_track_byte()) | ||||
|             _sector->logicalTrack = _sector->physicalTrack; | ||||
|  | ||||
|         for (int sector : trackdata.ignore_sector()) | ||||
|             if (_sector->logicalSector == sector) | ||||
|             { | ||||
|                 _sector->status = Sector::MISSING; | ||||
|                 break; | ||||
|             } | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         /* This is the same deal as the sector record. */ | ||||
|  | ||||
|         Bytes bytes; | ||||
|         ByteWriter bw(bytes); | ||||
|  | ||||
|         auto readByte = [&]() | ||||
|         { | ||||
|             auto bits = readRawBits(16); | ||||
|             auto bytes = decodeFmMfm(bits).slice(0, 1); | ||||
|             uint8_t byte = bytes[0]; | ||||
|             bw.write_8(byte); | ||||
|             return byte; | ||||
|         }; | ||||
|  | ||||
|         uint8_t id = readByte(); | ||||
|         if (id == 0xa1) | ||||
|         { | ||||
|             readByte(); | ||||
|             readByte(); | ||||
|             id = readByte(); | ||||
|         } | ||||
|         if ((id != IBM_DAM1) && (id != IBM_DAM2) && (id != IBM_TRS80DAM1) && | ||||
|             (id != IBM_TRS80DAM2)) | ||||
|             return; | ||||
|  | ||||
|         ByteReader br(bytes); | ||||
|         br.seek(bw.pos); | ||||
|  | ||||
|         auto bits = readRawBits((_currentSectorSize + 2) * 16); | ||||
|         bw += decodeFmMfm(bits).slice(0, _currentSectorSize + 2); | ||||
|  | ||||
|         _sector->data = br.read(_currentSectorSize); | ||||
|         uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, br.pos)); | ||||
|         uint16_t wantCrc = br.read_be16(); | ||||
|         _sector->status = | ||||
|             (wantCrc == gotCrc) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|  | ||||
|         auto layout = Layout::getLayoutOfTrack( | ||||
|             _sector->logicalTrack, _sector->logicalSide); | ||||
|         if (_currentSectorSize != layout->sectorSize) | ||||
|             std::cerr << fmt::format( | ||||
|                 "Warning: configured sector size for t{}.h{}.s{} is {} bytes " | ||||
|                 "but that seen on disk is {} bytes\n", | ||||
|                 _sector->logicalTrack, | ||||
|                 _sector->logicalSide, | ||||
|                 _sector->logicalSector, | ||||
|                 layout->sectorSize, | ||||
|                 _currentSectorSize); | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     void getTrackFormat(IbmDecoderProto::TrackdataProto& trackdata, | ||||
|         unsigned track, | ||||
|         unsigned head) const | ||||
|     { | ||||
|         trackdata.Clear(); | ||||
|         for (const auto& f : _config.trackdata()) | ||||
|         { | ||||
|             if (f.has_track() && (f.track() != track)) | ||||
|                 continue; | ||||
|             if (f.has_head() && (f.head() != head)) | ||||
|                 continue; | ||||
|  | ||||
|             trackdata.MergeFrom(f); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const IbmDecoderProto& _config; | ||||
|     unsigned _currentSectorSize; | ||||
|     unsigned _currentHeaderLength; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createIbmDecoder(const DecoderProto& config) | ||||
| { | ||||
|     unsigned recordSize = _currentHeaderLength + IBM_IDAM_LEN; | ||||
|     auto bits = readRawBits(recordSize*16); | ||||
|     auto bytes = decodeFmMfm(bits).slice(0, recordSize); | ||||
|  | ||||
|     ByteReader br(bytes); | ||||
|     br.seek(_currentHeaderLength); | ||||
|     br.read_8(); /* skip ID byte */ | ||||
|     _sector->logicalTrack = br.read_8(); | ||||
|     _sector->logicalSide = br.read_8(); | ||||
|     _sector->logicalSector = br.read_8() - _sectorBase; | ||||
|     _currentSectorSize = 1 << (br.read_8() + 7); | ||||
|     uint16_t wantCrc = br.read_be16(); | ||||
|     uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, _currentHeaderLength + 5)); | ||||
|     if (wantCrc == gotCrc) | ||||
|         _sector->status = Sector::DATA_MISSING; /* correct but unintuitive */ | ||||
|  | ||||
|     if (_ignoreSideByte) | ||||
|         _sector->logicalSide = _sector->physicalSide; | ||||
| } | ||||
|  | ||||
| void IbmDecoder::decodeDataRecord() | ||||
| { | ||||
|     unsigned recordLength = _currentHeaderLength + _currentSectorSize + 3; | ||||
|     auto bits = readRawBits(recordLength*16); | ||||
|     auto bytes = decodeFmMfm(bits).slice(0, recordLength); | ||||
|  | ||||
|     ByteReader br(bytes); | ||||
|     br.seek(_currentHeaderLength); | ||||
|     br.read_8(); /* skip ID byte */ | ||||
|  | ||||
|     _sector->data = br.read(_currentSectorSize); | ||||
|     uint16_t wantCrc = br.read_be16(); | ||||
|     uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, recordLength-2)); | ||||
|     _sector->status = (wantCrc == gotCrc) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new IbmDecoder(config)); | ||||
| } | ||||
|   | ||||
| @@ -1,12 +1,15 @@ | ||||
| #include "globals.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "ibm.h" | ||||
| #include "crc.h" | ||||
| #include "sectorset.h" | ||||
| #include "writer.h" | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "arch/ibm/ibm.pb.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
| #include "fmt/format.h" | ||||
| #include "lib/proto.h" | ||||
| #include "lib/layout.h" | ||||
| #include <ctype.h> | ||||
|  | ||||
| /* IAM record separator: | ||||
| @@ -38,9 +41,9 @@ | ||||
|  *                       ^^^^^ | ||||
|  * When shifted out of phase, the special 0xa1 byte becomes an illegal | ||||
|  * encoding (you can't do 10 00). So this can't be spoofed by user data. | ||||
|  *  | ||||
|  * | ||||
|  * shifted: 10 00 10 01 00 01 00 1 | ||||
|  *  | ||||
|  * | ||||
|  * It's repeated three times. | ||||
|  */ | ||||
| #define MFM_RECORD_SEPARATOR 0x4489 | ||||
| @@ -56,181 +59,224 @@ | ||||
|  * mfm:     01 01 01 01 01 00 01 01 = 0x5545 | ||||
|  */ | ||||
|  | ||||
| static int charToInt(char c) | ||||
| { | ||||
| 	if (isdigit(c)) | ||||
| 		return c - '0'; | ||||
| 	return 10 + tolower(c) - 'a'; | ||||
| } | ||||
|  | ||||
| void IbmEncoder::writeRawBits(uint32_t data, int width) | ||||
| { | ||||
| 	_cursor += width; | ||||
| 	_lastBit = data & 1; | ||||
| 	for (int i=0; i<width; i++) | ||||
| 	{ | ||||
| 		unsigned pos = _cursor - i - 1; | ||||
| 		if (pos < _bits.size()) | ||||
| 			_bits[pos] = data & 1; | ||||
| 		data >>= 1; | ||||
| 	} | ||||
| } | ||||
|  | ||||
| void IbmEncoder::writeBytes(const Bytes& bytes) | ||||
| { | ||||
| 	if (_parameters.useFm) | ||||
| 		encodeFm(_bits, _cursor, bytes); | ||||
| 	else | ||||
| 		encodeMfm(_bits, _cursor, bytes, _lastBit); | ||||
| } | ||||
|  | ||||
| void IbmEncoder::writeBytes(int count, uint8_t byte) | ||||
| { | ||||
| 	Bytes bytes = { byte }; | ||||
| 	for (int i=0; i<count; i++) | ||||
| 		writeBytes(bytes); | ||||
| } | ||||
|  | ||||
| static uint8_t decodeUint16(uint16_t raw) | ||||
| { | ||||
| 	Bytes b; | ||||
| 	ByteWriter bw(b); | ||||
| 	bw.write_be16(raw); | ||||
| 	return decodeFmMfm(b.toBits())[0]; | ||||
|     Bytes b; | ||||
|     ByteWriter bw(b); | ||||
|     bw.write_be16(raw); | ||||
|     return decodeFmMfm(b.toBits())[0]; | ||||
| } | ||||
|  | ||||
| std::unique_ptr<Fluxmap> IbmEncoder::encode( | ||||
| 	int physicalTrack, int physicalSide, const SectorSet& allSectors) | ||||
| class IbmEncoder : public Encoder | ||||
| { | ||||
| 	double clockRateUs = 1e3 / _parameters.clockRateKhz; | ||||
| 	if (!_parameters.useFm) | ||||
| 		clockRateUs /= 2.0; | ||||
| 	int bitsPerRevolution = (_parameters.trackLengthMs * 1000.0) / clockRateUs; | ||||
| 	_bits.resize(bitsPerRevolution); | ||||
| 	_cursor = 0; | ||||
|  | ||||
| 	uint8_t idamUnencoded = decodeUint16(_parameters.idamByte); | ||||
| 	uint8_t damUnencoded = decodeUint16(_parameters.damByte); | ||||
|  | ||||
| 	uint8_t sectorSize = 0; | ||||
| 	{ | ||||
| 		int s = _parameters.sectorSize >> 7; | ||||
| 		while (s > 1) | ||||
| 		{ | ||||
| 			s >>= 1; | ||||
| 			sectorSize += 1; | ||||
| 		} | ||||
| 	} | ||||
|  | ||||
| 	uint8_t gapFill = _parameters.useFm ? 0x00 : 0x4e; | ||||
|  | ||||
| 	writeBytes(_parameters.gap0, gapFill); | ||||
| 	if (_parameters.emitIam) | ||||
| 	{ | ||||
| 		writeBytes(_parameters.useFm ? 6 : 12, 0x00); | ||||
| 		if (!_parameters.useFm) | ||||
| 		{ | ||||
| 			for (int i=0; i<3; i++) | ||||
| 				writeRawBits(MFM_IAM_SEPARATOR, 16); | ||||
| 		} | ||||
| 		writeRawBits(_parameters.useFm ? FM_IAM_RECORD : MFM_IAM_RECORD, 16); | ||||
| 		writeBytes(_parameters.gap1, gapFill); | ||||
| 	} | ||||
|  | ||||
| 	bool first = true; | ||||
| 	for (char sectorChar : _parameters.sectorSkew) | ||||
| 	{ | ||||
| 		int sectorId = charToInt(sectorChar); | ||||
| 		if (!first) | ||||
| 			writeBytes(_parameters.gap3, gapFill); | ||||
| 		first = false; | ||||
|  | ||||
| 		const auto& sectorData = allSectors.get(physicalTrack, physicalSide, sectorId); | ||||
| 		if (!sectorData) | ||||
| 			Error() << fmt::format("format tried to find sector {} which wasn't in the input file", sectorId); | ||||
|  | ||||
| 		/* Writing the sector and data records are fantastically annoying. | ||||
| 		 * The CRC is calculated from the *very start* of the record, and | ||||
| 		 * include the malformed marker bytes. Our encoder doesn't know | ||||
| 		 * about this, of course, with the result that we have to construct | ||||
| 		 * the unencoded header, calculate the checksum, and then use the | ||||
| 		 * same logic to emit the bytes which require special encoding | ||||
| 		 * before encoding the rest of the header normally. */ | ||||
|  | ||||
| 		{ | ||||
| 			Bytes header; | ||||
| 			ByteWriter bw(header); | ||||
|  | ||||
| 			writeBytes(_parameters.useFm ? 6 : 12, 0x00); | ||||
| 			if (!_parameters.useFm) | ||||
| 			{ | ||||
| 				for (int i=0; i<3; i++) | ||||
| 					bw.write_8(MFM_RECORD_SEPARATOR_BYTE); | ||||
| 			} | ||||
| 			bw.write_8(idamUnencoded); | ||||
| 			bw.write_8(sectorData->logicalTrack); | ||||
| 			bw.write_8(sectorData->logicalSide); | ||||
| 			bw.write_8(sectorData->logicalSector + _parameters.startSectorId); | ||||
| 			bw.write_8(sectorSize); | ||||
| 			uint16_t crc = crc16(CCITT_POLY, header); | ||||
| 			bw.write_be16(crc); | ||||
|  | ||||
| 			int conventionalHeaderStart = 0; | ||||
| 			if (!_parameters.useFm) | ||||
| 			{ | ||||
| 				for (int i=0; i<3; i++) | ||||
| 					writeRawBits(MFM_RECORD_SEPARATOR, 16); | ||||
| 				conventionalHeaderStart += 3; | ||||
|  | ||||
| 			} | ||||
| 			writeRawBits(_parameters.idamByte, 16); | ||||
| 			conventionalHeaderStart += 1; | ||||
|  | ||||
| 			writeBytes(header.slice(conventionalHeaderStart)); | ||||
| 		} | ||||
|  | ||||
| 		writeBytes(_parameters.gap2, gapFill); | ||||
|  | ||||
| 		{ | ||||
| 			Bytes data; | ||||
| 			ByteWriter bw(data); | ||||
|  | ||||
| 			writeBytes(_parameters.useFm ? 6 : 12, 0x00); | ||||
| 			if (!_parameters.useFm) | ||||
| 			{ | ||||
| 				for (int i=0; i<3; i++) | ||||
| 					bw.write_8(MFM_RECORD_SEPARATOR_BYTE); | ||||
| 			} | ||||
| 			bw.write_8(damUnencoded); | ||||
|  | ||||
| 			Bytes truncatedData = sectorData->data.slice(0, _parameters.sectorSize); | ||||
| 			bw += truncatedData; | ||||
| 			hexdump(std::cout, data.slice(0, 64)); | ||||
| 			uint16_t crc = crc16(CCITT_POLY, data); | ||||
| 			bw.write_be16(crc); | ||||
|  | ||||
| 			int conventionalHeaderStart = 0; | ||||
| 			if (!_parameters.useFm) | ||||
| 			{ | ||||
| 				for (int i=0; i<3; i++) | ||||
| 					writeRawBits(MFM_RECORD_SEPARATOR, 16); | ||||
| 				conventionalHeaderStart += 3; | ||||
|  | ||||
| 			} | ||||
| 			writeRawBits(_parameters.damByte, 16); | ||||
| 			conventionalHeaderStart += 1; | ||||
|  | ||||
| 			writeBytes(data.slice(conventionalHeaderStart)); | ||||
| 		} | ||||
| public: | ||||
|     IbmEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.ibm()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| 	if (_cursor >= _bits.size()) | ||||
| 		Error() << "track data overrun"; | ||||
| 	while (_cursor < _bits.size()) | ||||
| 		writeBytes(1, gapFill); | ||||
| private: | ||||
|     void writeRawBits(uint32_t data, int width) | ||||
|     { | ||||
|         _cursor += width; | ||||
|         _lastBit = data & 1; | ||||
|         for (int i = 0; i < width; i++) | ||||
|         { | ||||
|             unsigned pos = _cursor - i - 1; | ||||
|             if (pos < _bits.size()) | ||||
|                 _bits[pos] = data & 1; | ||||
|             data >>= 1; | ||||
|         } | ||||
|     } | ||||
|  | ||||
| 	std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
| 	fluxmap->appendBits(_bits, clockRateUs*1e3); | ||||
| 	return fluxmap; | ||||
|     void getEncoderTrackData(IbmEncoderProto::TrackdataProto& trackdata, | ||||
|         unsigned track, | ||||
|         unsigned head) | ||||
|     { | ||||
|         trackdata.Clear(); | ||||
|         for (const auto& f : _config.trackdata()) | ||||
|         { | ||||
|             if (f.has_track() && (f.track() != track)) | ||||
|                 continue; | ||||
|             if (f.has_head() && (f.head() != head)) | ||||
|                 continue; | ||||
|  | ||||
|             trackdata.MergeFrom(f); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         IbmEncoderProto::TrackdataProto trackdata; | ||||
|         getEncoderTrackData( | ||||
|             trackdata, trackInfo->logicalTrack, trackInfo->logicalSide); | ||||
|  | ||||
|         auto trackLayout = Layout::getLayoutOfTrack( | ||||
|             trackInfo->logicalTrack, trackInfo->logicalSide); | ||||
|  | ||||
|         auto writeBytes = [&](const Bytes& bytes) | ||||
|         { | ||||
|             if (trackdata.use_fm()) | ||||
|                 encodeFm(_bits, _cursor, bytes); | ||||
|             else | ||||
|                 encodeMfm(_bits, _cursor, bytes, _lastBit); | ||||
|         }; | ||||
|  | ||||
|         auto writeFillerRawBytes = [&](int count, uint16_t byte) | ||||
|         { | ||||
|             for (int i = 0; i < count; i++) | ||||
|                 writeRawBits(byte, 16); | ||||
|         }; | ||||
|  | ||||
|         auto writeFillerBytes = [&](int count, uint8_t byte) | ||||
|         { | ||||
|             Bytes b{byte}; | ||||
|             for (int i = 0; i < count; i++) | ||||
|                 writeBytes(b); | ||||
|         }; | ||||
|  | ||||
|         double clockRateUs = trackdata.target_clock_period_us(); | ||||
|         if (!trackdata.use_fm()) | ||||
|             clockRateUs /= 2.0; | ||||
|         int bitsPerRevolution = | ||||
|             (trackdata.target_rotational_period_ms() * 1000.0) / clockRateUs; | ||||
|         _bits.resize(bitsPerRevolution); | ||||
|         _cursor = 0; | ||||
|  | ||||
|         uint8_t idamUnencoded = decodeUint16(trackdata.idam_byte()); | ||||
|         uint8_t damUnencoded = decodeUint16(trackdata.dam_byte()); | ||||
|  | ||||
|         uint8_t sectorSize = 0; | ||||
|         { | ||||
|             int s = trackLayout->sectorSize >> 7; | ||||
|             while (s > 1) | ||||
|             { | ||||
|                 s >>= 1; | ||||
|                 sectorSize += 1; | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         uint16_t gapFill = trackdata.gap_fill_byte(); | ||||
|  | ||||
|         writeFillerRawBytes(trackdata.gap0(), gapFill); | ||||
|         if (trackdata.emit_iam()) | ||||
|         { | ||||
|             writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00); | ||||
|             if (!trackdata.use_fm()) | ||||
|             { | ||||
|                 for (int i = 0; i < 3; i++) | ||||
|                     writeRawBits(MFM_IAM_SEPARATOR, 16); | ||||
|             } | ||||
|             writeRawBits( | ||||
|                 trackdata.use_fm() ? FM_IAM_RECORD : MFM_IAM_RECORD, 16); | ||||
|             writeFillerRawBytes(trackdata.gap1(), gapFill); | ||||
|         } | ||||
|  | ||||
|         bool first = true; | ||||
|         for (const auto& sectorData : sectors) | ||||
|         { | ||||
|             if (!first) | ||||
|                 writeFillerRawBytes(trackdata.gap3(), gapFill); | ||||
|             first = false; | ||||
|  | ||||
|             /* Writing the sector and data records are fantastically annoying. | ||||
|              * The CRC is calculated from the *very start* of the record, and | ||||
|              * include the malformed marker bytes. Our encoder doesn't know | ||||
|              * about this, of course, with the result that we have to construct | ||||
|              * the unencoded header, calculate the checksum, and then use the | ||||
|              * same logic to emit the bytes which require special encoding | ||||
|              * before encoding the rest of the header normally. */ | ||||
|  | ||||
|             { | ||||
|                 Bytes header; | ||||
|                 ByteWriter bw(header); | ||||
|  | ||||
|                 writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00); | ||||
|                 if (!trackdata.use_fm()) | ||||
|                 { | ||||
|                     for (int i = 0; i < 3; i++) | ||||
|                         bw.write_8(MFM_RECORD_SEPARATOR_BYTE); | ||||
|                 } | ||||
|                 bw.write_8(idamUnencoded); | ||||
|                 bw.write_8(sectorData->logicalTrack); | ||||
|                 bw.write_8( | ||||
|                     sectorData->logicalSide ^ trackdata.invert_side_byte()); | ||||
|                 bw.write_8(sectorData->logicalSector); | ||||
|                 bw.write_8(sectorSize); | ||||
|                 uint16_t crc = crc16(CCITT_POLY, header); | ||||
|                 bw.write_be16(crc); | ||||
|  | ||||
|                 int conventionalHeaderStart = 0; | ||||
|                 if (!trackdata.use_fm()) | ||||
|                 { | ||||
|                     for (int i = 0; i < 3; i++) | ||||
|                         writeRawBits(MFM_RECORD_SEPARATOR, 16); | ||||
|                     conventionalHeaderStart += 3; | ||||
|                 } | ||||
|                 writeRawBits(trackdata.idam_byte(), 16); | ||||
|                 conventionalHeaderStart += 1; | ||||
|  | ||||
|                 writeBytes(header.slice(conventionalHeaderStart)); | ||||
|             } | ||||
|  | ||||
|             writeFillerRawBytes(trackdata.gap2(), gapFill); | ||||
|  | ||||
|             { | ||||
|                 Bytes data; | ||||
|                 ByteWriter bw(data); | ||||
|  | ||||
|                 writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00); | ||||
|                 if (!trackdata.use_fm()) | ||||
|                 { | ||||
|                     for (int i = 0; i < 3; i++) | ||||
|                         bw.write_8(MFM_RECORD_SEPARATOR_BYTE); | ||||
|                 } | ||||
|                 bw.write_8(damUnencoded); | ||||
|  | ||||
|                 Bytes truncatedData = | ||||
|                     sectorData->data.slice(0, trackLayout->sectorSize); | ||||
|                 bw += truncatedData; | ||||
|                 uint16_t crc = crc16(CCITT_POLY, data); | ||||
|                 bw.write_be16(crc); | ||||
|  | ||||
|                 int conventionalHeaderStart = 0; | ||||
|                 if (!trackdata.use_fm()) | ||||
|                 { | ||||
|                     for (int i = 0; i < 3; i++) | ||||
|                         writeRawBits(MFM_RECORD_SEPARATOR, 16); | ||||
|                     conventionalHeaderStart += 3; | ||||
|                 } | ||||
|                 writeRawBits(trackdata.dam_byte(), 16); | ||||
|                 conventionalHeaderStart += 1; | ||||
|  | ||||
|                 writeBytes(data.slice(conventionalHeaderStart)); | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         if (_cursor >= _bits.size()) | ||||
|             error("track data overrun"); | ||||
|         while (_cursor < _bits.size()) | ||||
|             writeFillerRawBytes(1, gapFill); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits(_bits, | ||||
|             calculatePhysicalClockPeriod(clockRateUs * 1e3, | ||||
|                 trackdata.target_rotational_period_ms() * 1e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const IbmEncoderProto& _config; | ||||
|     std::vector<bool> _bits; | ||||
|     unsigned _cursor; | ||||
|     bool _lastBit; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createIbmEncoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new IbmEncoder(config)); | ||||
| } | ||||
|  | ||||
|   | ||||
| @@ -1,99 +1,37 @@ | ||||
| #ifndef IBM_H | ||||
| #define IBM_H | ||||
|  | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
|  | ||||
| /* IBM format (i.e. ordinary PC floppies). */ | ||||
|  | ||||
| #define IBM_MFM_SYNC   0xA1   /* sync byte for MFM */ | ||||
| #define IBM_IAM        0xFC   /* start-of-track record */ | ||||
| #define IBM_IAM_LEN    1      /* plus prologue */ | ||||
| #define IBM_IDAM       0xFE   /* sector header */ | ||||
| #define IBM_IDAM_LEN   7      /* plus prologue */ | ||||
| #define IBM_DAM1       0xF8   /* sector data (type 1) */ | ||||
| #define IBM_DAM2       0xFB   /* sector data (type 2) */ | ||||
| #define IBM_TRS80DAM1  0xF9   /* sector data (TRS-80 directory) */ | ||||
| #define IBM_TRS80DAM2  0xFA   /* sector data (TRS-80 directory) */ | ||||
| #define IBM_DAM_LEN    1      /* plus prologue and user data */ | ||||
| #define IBM_MFM_SYNC 0xA1  /* sync byte for MFM */ | ||||
| #define IBM_IAM 0xFC       /* start-of-track record */ | ||||
| #define IBM_IAM_LEN 1      /* plus prologue */ | ||||
| #define IBM_IDAM 0xFE      /* sector header */ | ||||
| #define IBM_IDAM_LEN 7     /* plus prologue */ | ||||
| #define IBM_DAM1 0xF8      /* sector data (type 1) */ | ||||
| #define IBM_DAM2 0xFB      /* sector data (type 2) */ | ||||
| #define IBM_TRS80DAM1 0xF9 /* sector data (TRS-80 directory) */ | ||||
| #define IBM_TRS80DAM2 0xFA /* sector data (TRS-80 directory) */ | ||||
| #define IBM_DAM_LEN 1      /* plus prologue and user data */ | ||||
|  | ||||
| /* Length of a DAM record is determined by the previous sector header. */ | ||||
|  | ||||
| struct IbmIdam | ||||
| { | ||||
|     uint8_t id; | ||||
|     uint8_t cylinder; | ||||
|     uint8_t track; | ||||
|     uint8_t side; | ||||
|     uint8_t sector; | ||||
|     uint8_t sectorSize; | ||||
|     uint8_t crc[2]; | ||||
| }; | ||||
|  | ||||
| class IbmDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     IbmDecoder(unsigned sectorBase, bool ignoreSideByte=false, | ||||
| 			const std::set<unsigned> requiredSectors=std::set<unsigned>()): | ||||
|         _sectorBase(sectorBase), | ||||
|         _ignoreSideByte(ignoreSideByte), | ||||
| 		_requiredSectors(requiredSectors) | ||||
|     {} | ||||
| class Encoder; | ||||
| class Decoder; | ||||
| class DecoderProto; | ||||
| class EncoderProto; | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|     void decodeDataRecord(); | ||||
|  | ||||
| 	std::set<unsigned> requiredSectors(Track& track) const | ||||
| 	{ return _requiredSectors; } | ||||
|  | ||||
| private: | ||||
|     unsigned _sectorBase; | ||||
|     bool _ignoreSideByte; | ||||
| 	std::set<unsigned> _requiredSectors; | ||||
|     unsigned _currentSectorSize; | ||||
|     unsigned _currentHeaderLength; | ||||
| }; | ||||
|  | ||||
| struct IbmParameters | ||||
| { | ||||
| 	int trackLengthMs; | ||||
| 	int sectorSize; | ||||
| 	bool emitIam; | ||||
| 	int startSectorId; | ||||
| 	int clockRateKhz; | ||||
| 	bool useFm; | ||||
| 	uint16_t idamByte; | ||||
| 	uint16_t damByte; | ||||
| 	int gap0; | ||||
| 	int gap1; | ||||
| 	int gap2; | ||||
| 	int gap3; | ||||
| 	std::string sectorSkew; | ||||
| }; | ||||
|  | ||||
| class IbmEncoder : public AbstractEncoder | ||||
| { | ||||
| public: | ||||
| 	IbmEncoder(const IbmParameters& parameters): | ||||
| 		_parameters(parameters) | ||||
| 	{} | ||||
|  | ||||
| 	virtual ~IbmEncoder() {} | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide, const SectorSet& allSectors); | ||||
|  | ||||
| private: | ||||
| 	void writeRawBits(uint32_t data, int width); | ||||
| 	void writeBytes(const Bytes& bytes); | ||||
| 	void writeBytes(int count, uint8_t value); | ||||
| 	void writeSync(); | ||||
| 	 | ||||
| private: | ||||
| 	IbmParameters _parameters; | ||||
| 	std::vector<bool> _bits; | ||||
| 	unsigned _cursor; | ||||
| 	bool _lastBit; | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createIbmDecoder(const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createIbmEncoder(const EncoderProto& config); | ||||
|  | ||||
| #endif | ||||
|   | ||||
							
								
								
									
										43
									
								
								arch/ibm/ibm.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										43
									
								
								arch/ibm/ibm.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,43 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message IbmDecoderProto { | ||||
| 	// Next: 11 | ||||
| 	message TrackdataProto { | ||||
| 		optional int32 track = 7              [(help) = "if set, the format applies only to this track"]; | ||||
| 		optional int32 head = 8                  [(help) = "if set, the format applies only to this head"]; | ||||
|  | ||||
| 		optional bool ignore_side_byte = 2       [default = false, (help) = "ignore side byte in sector header"]; | ||||
| 		optional bool ignore_track_byte = 6      [default = false, (help) = "ignore track byte in sector header"]; | ||||
| 		optional bool invert_side_byte = 4       [default = false, (help) = "invert the side byte in the sector header"]; | ||||
|  | ||||
| 		repeated int32 ignore_sector = 10        [(help) = "sectors with these IDs will not be read"]; | ||||
| 	} | ||||
|  | ||||
| 	repeated TrackdataProto trackdata = 1; | ||||
| } | ||||
|  | ||||
| message IbmEncoderProto { | ||||
| 	// Next: 20 | ||||
| 	message TrackdataProto { | ||||
| 		optional int32 track = 15        [(help) = "if set, the format applies only to this track"]; | ||||
| 		optional int32 head = 16            [(help) = "if set, the format applies only to this head"]; | ||||
|  | ||||
| 		optional bool emit_iam = 3          [default=true, (help) = "whether to emit an IAM record"]; | ||||
| 		optional double target_clock_period_us = 5  [default=4, (help) = "data clock rate on target disk"]; | ||||
| 		optional bool use_fm = 6            [default=false, (help) = "whether to use FM encoding rather than MFM"]; | ||||
| 		optional int32 idam_byte = 7        [default=0x5554, (help) = "16-bit raw bit pattern of IDAM byte"]; | ||||
| 		optional int32 dam_byte = 8         [default=0x5545, (help) = "16-bit raw bit pattern of DAM byte"]; | ||||
| 		optional int32 gap0 = 9             [default=80, (help) = "size of gap 1 (the post-index gap)"]; | ||||
| 		optional int32 gap1 = 10            [default=50, (help) = "size of gap 2 (the post-ID gap)"]; | ||||
| 		optional int32 gap2 = 11            [default=22, (help) = "size of gap 3 (the pre-data gap)"]; | ||||
| 		optional int32 gap3 = 12            [default=80, (help) = "size of gap 4 (the post-data or format gap)"]; | ||||
| 		optional bool invert_side_byte = 19 [default=false, (help) = "invert the side byte before writing"]; | ||||
| 		optional int32 gap_fill_byte = 18   [default=0x9254, (help) = "16-bit raw bit pattern of gap fill byte"]; | ||||
| 		optional double target_rotational_period_ms = 1 [default=200, (help) = "rotational period of target disk"]; | ||||
| 	} | ||||
|  | ||||
| 	repeated TrackdataProto trackdata = 1; | ||||
| } | ||||
|  | ||||
| @@ -2,10 +2,8 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "track.h" | ||||
| #include "macintosh.h" | ||||
| #include "bytes.h" | ||||
| #include "fmt/format.h" | ||||
| @@ -14,22 +12,25 @@ | ||||
|  | ||||
| const FluxPattern SECTOR_RECORD_PATTERN(24, MAC_SECTOR_RECORD); | ||||
| const FluxPattern DATA_RECORD_PATTERN(24, MAC_DATA_RECORD); | ||||
| const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN }); | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
|     {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN}); | ||||
|  | ||||
| static int decode_data_gcr(uint8_t gcr) | ||||
| { | ||||
|     switch (gcr) | ||||
|     { | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case gcr: return data; | ||||
| 		#include "data_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case gcr:                \ | ||||
|         return data; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| }; | ||||
| } | ||||
|  | ||||
| /* This is extremely inspired by the MESS implementation, written by Nathan Woods | ||||
|  * and R. Belmont: https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp | ||||
| /* This is extremely inspired by the MESS implementation, written by Nathan | ||||
|  * Woods and R. Belmont: | ||||
|  * https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp | ||||
|  */ | ||||
| static Bytes decode_crazy_data(const Bytes& input, Sector::Status& status) | ||||
| { | ||||
| @@ -43,7 +44,7 @@ static Bytes decode_crazy_data(const Bytes& input, Sector::Status& status) | ||||
|     uint8_t b2[LOOKUP_LEN + 1]; | ||||
|     uint8_t b3[LOOKUP_LEN + 1]; | ||||
|  | ||||
|     for (int i=0; i<=LOOKUP_LEN; i++) | ||||
|     for (int i = 0; i <= LOOKUP_LEN; i++) | ||||
|     { | ||||
|         uint8_t w4 = br.read_8(); | ||||
|         uint8_t w1 = br.read_8(); | ||||
| @@ -118,91 +119,77 @@ static Bytes decode_crazy_data(const Bytes& input, Sector::Status& status) | ||||
| uint8_t decode_side(uint8_t side) | ||||
| { | ||||
|     /* Mac disks, being weird, use the side byte to encode both the side (in | ||||
|      * bit 5) and also whether we're above track 0x3f (in bit 6). | ||||
|      * bit 5) and also whether we're above track 0x3f (in bit 0). | ||||
|      */ | ||||
|  | ||||
|     return !!(side & 0x40); | ||||
|     return !!(side & 0x20); | ||||
| } | ||||
|  | ||||
| AbstractDecoder::RecordType MacintoshDecoder::advanceToNextRecord() | ||||
| class MacintoshDecoder : public Decoder | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher); | ||||
| 	if (matcher == &SECTOR_RECORD_PATTERN) | ||||
| 		return SECTOR_RECORD; | ||||
| 	if (matcher == &DATA_RECORD_PATTERN) | ||||
| 		return DATA_RECORD; | ||||
| 	return UNKNOWN_RECORD; | ||||
| } | ||||
| public: | ||||
|     MacintoshDecoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
| void MacintoshDecoder::decodeSectorRecord() | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         if (readRaw24() != MAC_SECTOR_RECORD) | ||||
|             return; | ||||
|  | ||||
|         /* Read header. */ | ||||
|  | ||||
|         auto header = toBytes(readRawBits(7 * 8)).slice(0, 7); | ||||
|  | ||||
|         uint8_t encodedTrack = decode_data_gcr(header[0]); | ||||
|         if (encodedTrack != (_sector->physicalTrack & 0x3f)) | ||||
|             return; | ||||
|  | ||||
|         uint8_t encodedSector = decode_data_gcr(header[1]); | ||||
|         uint8_t encodedSide = decode_data_gcr(header[2]); | ||||
|         uint8_t formatByte = decode_data_gcr(header[3]); | ||||
|         uint8_t wantedsum = decode_data_gcr(header[4]); | ||||
|  | ||||
|         if (encodedSector > 11) | ||||
|             return; | ||||
|  | ||||
|         _sector->logicalTrack = _sector->physicalTrack; | ||||
|         _sector->logicalSide = decode_side(encodedSide); | ||||
|         _sector->logicalSector = encodedSector; | ||||
|         uint8_t gotsum = | ||||
|             (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f; | ||||
|         if (wantedsum == gotsum) | ||||
|             _sector->status = | ||||
|                 Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         if (readRaw24() != MAC_DATA_RECORD) | ||||
|             return; | ||||
|  | ||||
|         /* Read data. */ | ||||
|  | ||||
|         readRawBits(8); /* skip spare byte */ | ||||
|         auto inputbuffer = toBytes(readRawBits(MAC_ENCODED_SECTOR_LENGTH * 8)) | ||||
|                                .slice(0, MAC_ENCODED_SECTOR_LENGTH); | ||||
|  | ||||
|         for (unsigned i = 0; i < inputbuffer.size(); i++) | ||||
|             inputbuffer[i] = decode_data_gcr(inputbuffer[i]); | ||||
|  | ||||
|         _sector->status = Sector::BAD_CHECKSUM; | ||||
|         Bytes userData = decode_crazy_data(inputbuffer, _sector->status); | ||||
|         _sector->data.clear(); | ||||
|         _sector->data.writer() | ||||
|             .append(userData.slice(12, 512)) | ||||
|             .append(userData.slice(0, 12)); | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createMacintoshDecoder(const DecoderProto& config) | ||||
| { | ||||
|     /* Skip ID (as we know it's a MAC_SECTOR_RECORD). */ | ||||
|     readRawBits(24); | ||||
|  | ||||
|     /* Read header. */ | ||||
|  | ||||
|     auto header = toBytes(readRawBits(7*8)).slice(0, 7); | ||||
|                  | ||||
|     uint8_t encodedTrack = decode_data_gcr(header[0]); | ||||
|     if (encodedTrack != (_track->physicalTrack & 0x3f)) | ||||
|         return; | ||||
|                  | ||||
|     uint8_t encodedSector = decode_data_gcr(header[1]); | ||||
|     uint8_t encodedSide = decode_data_gcr(header[2]); | ||||
|     uint8_t formatByte = decode_data_gcr(header[3]); | ||||
|     uint8_t wantedsum = decode_data_gcr(header[4]); | ||||
|  | ||||
|     if (encodedSector > 11) | ||||
|         return; | ||||
|  | ||||
|     _sector->logicalTrack = _track->physicalTrack; | ||||
|     _sector->logicalSide = decode_side(encodedSide); | ||||
|     _sector->logicalSector = encodedSector; | ||||
|     uint8_t gotsum = (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f; | ||||
|     if (wantedsum == gotsum) | ||||
|         _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
|     return std::unique_ptr<Decoder>(new MacintoshDecoder(config)); | ||||
| } | ||||
|  | ||||
| void MacintoshDecoder::decodeDataRecord() | ||||
| { | ||||
|     auto id = toBytes(readRawBits(24)).reader().read_be24(); | ||||
|     if (id != MAC_DATA_RECORD) | ||||
|         return; | ||||
|  | ||||
|     /* Read data. */ | ||||
|  | ||||
|     readRawBits(8); /* skip spare byte */ | ||||
|     auto inputbuffer = toBytes(readRawBits(MAC_ENCODED_SECTOR_LENGTH*8)) | ||||
|         .slice(0, MAC_ENCODED_SECTOR_LENGTH); | ||||
|  | ||||
|     for (unsigned i=0; i<inputbuffer.size(); i++) | ||||
|         inputbuffer[i] = decode_data_gcr(inputbuffer[i]); | ||||
|          | ||||
|     _sector->status = Sector::BAD_CHECKSUM; | ||||
|     Bytes userData = decode_crazy_data(inputbuffer, _sector->status); | ||||
|     _sector->data.clear(); | ||||
|     _sector->data.writer().append(userData.slice(12, 512)).append(userData.slice(0, 12)); | ||||
| } | ||||
|  | ||||
| std::set<unsigned> MacintoshDecoder::requiredSectors(Track& track) const | ||||
| { | ||||
| 	int count; | ||||
| 	if (track.physicalTrack < 16) | ||||
| 		count = 12; | ||||
| 	else if (track.physicalTrack < 32) | ||||
| 		count = 11; | ||||
| 	else if (track.physicalTrack < 48) | ||||
| 		count = 10; | ||||
| 	else if (track.physicalTrack < 64) | ||||
| 		count = 9; | ||||
| 	else | ||||
| 		count = 8; | ||||
|  | ||||
| 	std::set<unsigned> sectors; | ||||
| 	while (count--) | ||||
| 		sectors.insert(count); | ||||
| 	return sectors; | ||||
| } | ||||
|  | ||||
|  | ||||
|   | ||||
							
								
								
									
										258
									
								
								arch/macintosh/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										258
									
								
								arch/macintosh/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,258 @@ | ||||
| #include "globals.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "macintosh.h" | ||||
| #include "crc.h" | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "fmt/format.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
| #include "lib/layout.h" | ||||
| #include "arch/macintosh/macintosh.pb.h" | ||||
| #include <ctype.h> | ||||
|  | ||||
| static bool lastBit; | ||||
|  | ||||
| static double clockRateUsForTrack(unsigned track) | ||||
| { | ||||
|     if (track < 16) | ||||
|         return 2.63; | ||||
|     if (track < 32) | ||||
|         return 2.89; | ||||
|     if (track < 48) | ||||
|         return 3.20; | ||||
|     if (track < 64) | ||||
|         return 3.57; | ||||
|     return 3.98; | ||||
| } | ||||
|  | ||||
| static unsigned sectorsForTrack(unsigned track) | ||||
| { | ||||
|     if (track < 16) | ||||
|         return 12; | ||||
|     if (track < 32) | ||||
|         return 11; | ||||
|     if (track < 48) | ||||
|         return 10; | ||||
|     if (track < 64) | ||||
|         return 9; | ||||
|     return 8; | ||||
| } | ||||
|  | ||||
| static int encode_data_gcr(uint8_t gcr) | ||||
| { | ||||
|     switch (gcr) | ||||
|     { | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case data:               \ | ||||
|         return gcr; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| } | ||||
|  | ||||
| /* This is extremely inspired by the MESS implementation, written by Nathan | ||||
|  * Woods and R. Belmont: | ||||
|  * https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp | ||||
|  */ | ||||
| static Bytes encode_crazy_data(const Bytes& input) | ||||
| { | ||||
|     Bytes output; | ||||
|     ByteWriter bw(output); | ||||
|     ByteReader br(input); | ||||
|  | ||||
|     uint8_t w1, w2, w3, w4; | ||||
|  | ||||
|     static const int LOOKUP_LEN = MAC_SECTOR_LENGTH / 3; | ||||
|  | ||||
|     uint8_t b1[LOOKUP_LEN + 1]; | ||||
|     uint8_t b2[LOOKUP_LEN + 1]; | ||||
|     uint8_t b3[LOOKUP_LEN + 1]; | ||||
|  | ||||
|     uint32_t c1 = 0; | ||||
|     uint32_t c2 = 0; | ||||
|     uint32_t c3 = 0; | ||||
|     for (int j = 0;; j++) | ||||
|     { | ||||
|         c1 = (c1 & 0xff) << 1; | ||||
|         if (c1 & 0x0100) | ||||
|             c1++; | ||||
|  | ||||
|         uint8_t val = br.read_8(); | ||||
|         c3 += val; | ||||
|         if (c1 & 0x0100) | ||||
|         { | ||||
|             c3++; | ||||
|             c1 &= 0xff; | ||||
|         } | ||||
|         b1[j] = (val ^ c1) & 0xff; | ||||
|  | ||||
|         val = br.read_8(); | ||||
|         c2 += val; | ||||
|         if (c3 > 0xff) | ||||
|         { | ||||
|             c2++; | ||||
|             c3 &= 0xff; | ||||
|         } | ||||
|         b2[j] = (val ^ c3) & 0xff; | ||||
|  | ||||
|         if (br.pos == 524) | ||||
|             break; | ||||
|  | ||||
|         val = br.read_8(); | ||||
|         c1 += val; | ||||
|         if (c2 > 0xff) | ||||
|         { | ||||
|             c1++; | ||||
|             c2 &= 0xff; | ||||
|         } | ||||
|         b3[j] = (val ^ c2) & 0xff; | ||||
|     } | ||||
|     uint32_t c4 = ((c1 & 0xc0) >> 6) | ((c2 & 0xc0) >> 4) | ((c3 & 0xc0) >> 2); | ||||
|     b3[LOOKUP_LEN] = 0; | ||||
|  | ||||
|     for (int i = 0; i <= LOOKUP_LEN; i++) | ||||
|     { | ||||
|         w1 = b1[i] & 0x3f; | ||||
|         w2 = b2[i] & 0x3f; | ||||
|         w3 = b3[i] & 0x3f; | ||||
|         w4 = ((b1[i] & 0xc0) >> 2); | ||||
|         w4 |= ((b2[i] & 0xc0) >> 4); | ||||
|         w4 |= ((b3[i] & 0xc0) >> 6); | ||||
|  | ||||
|         bw.write_8(w4); | ||||
|         bw.write_8(w1); | ||||
|         bw.write_8(w2); | ||||
|  | ||||
|         if (i != LOOKUP_LEN) | ||||
|             bw.write_8(w3); | ||||
|     } | ||||
|  | ||||
|     bw.write_8(c4 & 0x3f); | ||||
|     bw.write_8(c3 & 0x3f); | ||||
|     bw.write_8(c2 & 0x3f); | ||||
|     bw.write_8(c1 & 0x3f); | ||||
|  | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src) | ||||
| { | ||||
|     for (bool bit : src) | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             bits[cursor++] = bit; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width) | ||||
| { | ||||
|     cursor += width; | ||||
|     for (int i = 0; i < width; i++) | ||||
|     { | ||||
|         unsigned pos = cursor - i - 1; | ||||
|         if (pos < bits.size()) | ||||
|             bits[pos] = data & 1; | ||||
|         data >>= 1; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static uint8_t encode_side(uint8_t track, uint8_t side) | ||||
| { | ||||
|     /* Mac disks, being weird, use the side byte to encode both the side (in | ||||
|      * bit 5) and also whether we're above track 0x3f (in bit 0). | ||||
|      */ | ||||
|  | ||||
|     return (side ? 0x20 : 0x00) | ((track > 0x3f) ? 0x01 : 0x00); | ||||
| } | ||||
|  | ||||
| static void write_sector(std::vector<bool>& bits, | ||||
|     unsigned& cursor, | ||||
|     const std::shared_ptr<const Sector>& sector) | ||||
| { | ||||
|     if ((sector->data.size() != 512) && (sector->data.size() != 524)) | ||||
|         error("unsupported sector size --- you must pick 512 or 524"); | ||||
|  | ||||
|     write_bits(bits, cursor, 0xff, 1 * 8); /* pad byte */ | ||||
|     for (int i = 0; i < 7; i++) | ||||
|         write_bits(bits, cursor, 0xff3fcff3fcffLL, 6 * 8); /* sync */ | ||||
|     write_bits(bits, cursor, MAC_SECTOR_RECORD, 3 * 8); | ||||
|  | ||||
|     uint8_t encodedTrack = sector->logicalTrack & 0x3f; | ||||
|     uint8_t encodedSector = sector->logicalSector; | ||||
|     uint8_t encodedSide = | ||||
|         encode_side(sector->logicalTrack, sector->logicalSide); | ||||
|     uint8_t formatByte = MAC_FORMAT_BYTE; | ||||
|     uint8_t headerChecksum = | ||||
|         (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f; | ||||
|  | ||||
|     write_bits(bits, cursor, encode_data_gcr(encodedTrack), 1 * 8); | ||||
|     write_bits(bits, cursor, encode_data_gcr(encodedSector), 1 * 8); | ||||
|     write_bits(bits, cursor, encode_data_gcr(encodedSide), 1 * 8); | ||||
|     write_bits(bits, cursor, encode_data_gcr(formatByte), 1 * 8); | ||||
|     write_bits(bits, cursor, encode_data_gcr(headerChecksum), 1 * 8); | ||||
|  | ||||
|     write_bits(bits, cursor, 0xdeaaff, 3 * 8); | ||||
|     write_bits(bits, cursor, 0xff3fcff3fcffLL, 6 * 8); /* sync */ | ||||
|     write_bits(bits, cursor, MAC_DATA_RECORD, 3 * 8); | ||||
|     write_bits(bits, cursor, encode_data_gcr(sector->logicalSector), 1 * 8); | ||||
|  | ||||
|     Bytes wireData; | ||||
|     wireData.writer() | ||||
|         .append(sector->data.slice(512, 12)) | ||||
|         .append(sector->data.slice(0, 512)); | ||||
|     for (uint8_t b : encode_crazy_data(wireData)) | ||||
|         write_bits(bits, cursor, encode_data_gcr(b), 1 * 8); | ||||
|  | ||||
|     write_bits(bits, cursor, 0xdeaaff, 3 * 8); | ||||
| } | ||||
|  | ||||
| class MacintoshEncoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     MacintoshEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.macintosh()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         double clockRateUs = clockRateUsForTrack(trackInfo->logicalTrack); | ||||
|         int bitsPerRevolution = 200000.0 / clockRateUs; | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
|         fillBitmapTo(bits, | ||||
|             cursor, | ||||
|             _config.post_index_gap_us() / clockRateUs, | ||||
|             {true, false}); | ||||
|         lastBit = false; | ||||
|  | ||||
|         for (const auto& sector : sectors) | ||||
|             write_sector(bits, cursor, sector); | ||||
|  | ||||
|         if (cursor >= bits.size()) | ||||
|             error("track data overrun by {} bits", cursor - bits.size()); | ||||
|         fillBitmapTo(bits, cursor, bits.size(), {true, false}); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits( | ||||
|             bits, calculatePhysicalClockPeriod(clockRateUs * 1e3, 200e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const MacintoshEncoderProto& _config; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createMacintoshEncoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new MacintoshEncoder(config)); | ||||
| } | ||||
| @@ -1,26 +1,23 @@ | ||||
| #ifndef MACINTOSH_H | ||||
| #define MACINTOSH_H | ||||
|  | ||||
| #define MAC_SECTOR_RECORD   0xd5aa96 /* 1101 0101 1010 1010 1001 0110 */ | ||||
| #define MAC_DATA_RECORD     0xd5aaad /* 1101 0101 1010 1010 1010 1101 */ | ||||
| #define MAC_SECTOR_RECORD 0xd5aa96 /* 1101 0101 1010 1010 1001 0110 */ | ||||
| #define MAC_DATA_RECORD 0xd5aaad   /* 1101 0101 1010 1010 1010 1101 */ | ||||
|  | ||||
| #define MAC_SECTOR_LENGTH   524 /* yes, really */ | ||||
| #define MAC_SECTOR_LENGTH 524 /* yes, really */ | ||||
| #define MAC_ENCODED_SECTOR_LENGTH 703 | ||||
| #define MAC_FORMAT_BYTE 0x22 | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
| #define MAC_TRACKS_PER_DISK 80 | ||||
|  | ||||
| class MacintoshDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~MacintoshDecoder() {} | ||||
| class Encoder; | ||||
| class Decoder; | ||||
| class DecoderProto; | ||||
| class EncoderProto; | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|     void decodeDataRecord(); | ||||
|  | ||||
| 	std::set<unsigned> requiredSectors(Track& track) const; | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createMacintoshDecoder( | ||||
|     const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createMacintoshEncoder( | ||||
|     const EncoderProto& config); | ||||
|  | ||||
| #endif | ||||
|  | ||||
|   | ||||
							
								
								
									
										11
									
								
								arch/macintosh/macintosh.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										11
									
								
								arch/macintosh/macintosh.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,11 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message MacintoshDecoderProto {} | ||||
|  | ||||
| message MacintoshEncoderProto { | ||||
| 	optional double post_index_gap_us = 1 [default = 0.0, | ||||
| 		(help) = "post-index gap before first sector header (microseconds)."]; | ||||
| } | ||||
|  | ||||
							
								
								
									
										207
									
								
								arch/micropolis/decoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										207
									
								
								arch/micropolis/decoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,207 @@ | ||||
| #include "globals.h" | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "micropolis.h" | ||||
| #include "bytes.h" | ||||
| #include "fmt/format.h" | ||||
| #include "lib/decoders/decoders.pb.h" | ||||
|  | ||||
| /* The sector has a preamble of MFM 0x00s and uses 0xFF as a sync pattern. | ||||
|  * | ||||
|  * 00        00        00        F         F | ||||
|  * 0000 0000 0000 0000 0000 0000 0101 0101 0101 0101 | ||||
|  * A    A    A    A    A    A    5    5    5    5 | ||||
|  */ | ||||
| static const FluxPattern SECTOR_SYNC_PATTERN(64, 0xAAAAAAAAAAAA5555LL); | ||||
|  | ||||
| /* Pattern to skip past current SYNC. */ | ||||
| static const FluxPattern SECTOR_ADVANCE_PATTERN(64, 0xAAAAAAAAAAAAAAAALL); | ||||
|  | ||||
| /* Standard Micropolis checksum.  Adds all bytes, with carry. */ | ||||
| uint8_t micropolisChecksum(const Bytes& bytes) | ||||
| { | ||||
|     ByteReader br(bytes); | ||||
|     uint16_t sum = 0; | ||||
|     while (!br.eof()) | ||||
|     { | ||||
|         if (sum > 0xFF) | ||||
|         { | ||||
|             sum -= 0x100 - 1; | ||||
|         } | ||||
|         sum += br.read_8(); | ||||
|     } | ||||
|     /* The last carry is ignored */ | ||||
|     return sum & 0xFF; | ||||
| } | ||||
|  | ||||
| /* Vector MZOS does not use the standard Micropolis checksum. | ||||
|  * The checksum is initially 0. | ||||
|  * For each data byte in the 256-byte payload, rotate left, | ||||
|  * carrying bit 7 to bit 0.  XOR with the current checksum. | ||||
|  * | ||||
|  * Unlike the Micropolis checksum, this does not cover the 12-byte | ||||
|  * header (track, sector, 10 OS-specific bytes.) | ||||
|  */ | ||||
| uint8_t mzosChecksum(const Bytes& bytes) | ||||
| { | ||||
|     ByteReader br(bytes); | ||||
|     uint8_t checksum = 0; | ||||
|     uint8_t databyte; | ||||
|  | ||||
|     while (!br.eof()) | ||||
|     { | ||||
|         databyte = br.read_8(); | ||||
|         checksum ^= ((databyte << 1) | (databyte >> 7)); | ||||
|     } | ||||
|  | ||||
|     return checksum; | ||||
| } | ||||
|  | ||||
| class MicropolisDecoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     MicropolisDecoder(const DecoderProto& config): | ||||
|         Decoder(config), | ||||
|         _config(config.micropolis()) | ||||
|     { | ||||
|         _checksumType = _config.checksum_type(); | ||||
|     } | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         nanoseconds_t now = tell().ns(); | ||||
|  | ||||
|         /* For all but the first sector, seek to the next sector pulse. | ||||
|          * The first sector does not contain the sector pulse in the fluxmap. | ||||
|          */ | ||||
|         if (now != 0) | ||||
|         { | ||||
|             seekToIndexMark(); | ||||
|             now = tell().ns(); | ||||
|         } | ||||
|  | ||||
|         /* Discard a possible partial sector at the end of the track. | ||||
|          * This partial sector could be mistaken for a conflicted sector, if | ||||
|          * whatever data read happens to match the checksum of 0, which is | ||||
|          * rare, but has been observed on some disks. | ||||
|          */ | ||||
|         if (now > (getFluxmapDuration() - 12.5e6)) | ||||
|         { | ||||
|             seekToIndexMark(); | ||||
|             return 0; | ||||
|         } | ||||
|  | ||||
|         nanoseconds_t clock = seekToPattern(SECTOR_SYNC_PATTERN); | ||||
|  | ||||
|         auto syncDelta = tell().ns() - now; | ||||
|         /* Due to the weak nature of the Micropolis SYNC patern, | ||||
|          * it's possible to detect a false SYNC during the gap | ||||
|          * between the sector pulse and the write gate.  If the SYNC | ||||
|          * is detected less than 100uS after the sector pulse, search | ||||
|          * for another valid SYNC. | ||||
|          * | ||||
|          * Reference: Vector Micropolis Disk Controller Board Technical | ||||
|          * Information Manual, pp. 1-16. | ||||
|          */ | ||||
|         if ((syncDelta > 0) && (syncDelta < 100e3)) | ||||
|         { | ||||
|             seekToPattern(SECTOR_ADVANCE_PATTERN); | ||||
|             clock = seekToPattern(SECTOR_SYNC_PATTERN); | ||||
|         } | ||||
|  | ||||
|         _sector->headerStartTime = tell().ns(); | ||||
|  | ||||
|         /* seekToPattern() can skip past the index hole, if this happens | ||||
|          * too close to the end of the Fluxmap, discard the sector. | ||||
|          */ | ||||
|         if (_sector->headerStartTime > (getFluxmapDuration() - 12.5e6)) | ||||
|         { | ||||
|             return 0; | ||||
|         } | ||||
|  | ||||
|         return clock; | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         readRawBits(48); | ||||
|         auto rawbits = readRawBits(MICROPOLIS_ENCODED_SECTOR_SIZE * 16); | ||||
|         auto bytes = | ||||
|             decodeFmMfm(rawbits).slice(0, MICROPOLIS_ENCODED_SECTOR_SIZE); | ||||
|         ByteReader br(bytes); | ||||
|  | ||||
|         int syncByte = br.read_8(); /* sync */ | ||||
|         if (syncByte != 0xFF) | ||||
|             return; | ||||
|  | ||||
|         _sector->logicalTrack = br.read_8(); | ||||
|         _sector->logicalSide = _sector->physicalSide; | ||||
|         _sector->logicalSector = br.read_8(); | ||||
|         if (_sector->logicalSector > 15) | ||||
|             return; | ||||
|         if (_sector->logicalTrack > 76) | ||||
|             return; | ||||
|         if (_sector->logicalTrack != _sector->physicalTrack) | ||||
|             return; | ||||
|  | ||||
|         br.read(10); /* OS data or padding */ | ||||
|         auto data = br.read(MICROPOLIS_PAYLOAD_SIZE); | ||||
|         uint8_t wantChecksum = br.read_8(); | ||||
|  | ||||
|         /* If not specified, automatically determine the checksum type. | ||||
|          * Once the checksum type is determined, it will be used for the | ||||
|          * entire disk. | ||||
|          */ | ||||
|         if (_checksumType == MicropolisDecoderProto::AUTO) | ||||
|         { | ||||
|             /* Calculate both standard Micropolis (MDOS, CP/M, OASIS) and MZOS | ||||
|              * checksums */ | ||||
|             if (wantChecksum == micropolisChecksum(bytes.slice(1, 2 + 266))) | ||||
|             { | ||||
|                 _checksumType = MicropolisDecoderProto::MICROPOLIS; | ||||
|             } | ||||
|             else if (wantChecksum == | ||||
|                      mzosChecksum(bytes.slice( | ||||
|                          MICROPOLIS_HEADER_SIZE, MICROPOLIS_PAYLOAD_SIZE))) | ||||
|             { | ||||
|                 _checksumType = MicropolisDecoderProto::MZOS; | ||||
|                 std::cout << "Note: MZOS checksum detected." << std::endl; | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         uint8_t gotChecksum; | ||||
|  | ||||
|         if (_checksumType == MicropolisDecoderProto::MZOS) | ||||
|         { | ||||
|             gotChecksum = mzosChecksum( | ||||
|                 bytes.slice(MICROPOLIS_HEADER_SIZE, MICROPOLIS_PAYLOAD_SIZE)); | ||||
|         } | ||||
|         else | ||||
|         { | ||||
|             gotChecksum = micropolisChecksum(bytes.slice(1, 2 + 266)); | ||||
|         } | ||||
|  | ||||
|         br.read(5); /* 4 byte ECC and ECC-present flag */ | ||||
|  | ||||
|         if (_config.sector_output_size() == MICROPOLIS_PAYLOAD_SIZE) | ||||
|             _sector->data = data; | ||||
|         else if (_config.sector_output_size() == MICROPOLIS_ENCODED_SECTOR_SIZE) | ||||
|             _sector->data = bytes; | ||||
|         else | ||||
|             error("Sector output size may only be 256 or 275"); | ||||
|         _sector->status = | ||||
|             (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const MicropolisDecoderProto& _config; | ||||
|     MicropolisDecoderProto_ChecksumType | ||||
|         _checksumType; /* -1 = auto, 1 = Micropolis, 2=MZOS */ | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createMicropolisDecoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new MicropolisDecoder(config)); | ||||
| } | ||||
							
								
								
									
										111
									
								
								arch/micropolis/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										111
									
								
								arch/micropolis/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,111 @@ | ||||
| #include "globals.h" | ||||
| #include "micropolis.h" | ||||
| #include "sector.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "image.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
|  | ||||
| static void write_sector(std::vector<bool>& bits, | ||||
|     unsigned& cursor, | ||||
|     const std::shared_ptr<const Sector>& sector) | ||||
| { | ||||
|     if ((sector->data.size() != 256) && | ||||
|         (sector->data.size() != MICROPOLIS_ENCODED_SECTOR_SIZE)) | ||||
|         error("unsupported sector size --- you must pick 256 or 275"); | ||||
|  | ||||
|     int fullSectorSize = 40 + MICROPOLIS_ENCODED_SECTOR_SIZE + 40 + 35; | ||||
|     auto fullSector = std::make_shared<std::vector<uint8_t>>(); | ||||
|     fullSector->reserve(fullSectorSize); | ||||
|     /* sector preamble */ | ||||
|     for (int i = 0; i < 40; i++) | ||||
|         fullSector->push_back(0); | ||||
|     Bytes sectorData; | ||||
|     if (sector->data.size() == MICROPOLIS_ENCODED_SECTOR_SIZE) | ||||
|     { | ||||
|         if (sector->data[0] != 0xFF) | ||||
|             error( | ||||
|                 "275 byte sector doesn't start with sync byte 0xFF. " | ||||
|                 "Corrupted sector"); | ||||
|         uint8_t wantChecksum = sector->data[1 + 2 + 266]; | ||||
|         uint8_t gotChecksum = | ||||
|             micropolisChecksum(sector->data.slice(1, 2 + 266)); | ||||
|         if (wantChecksum != gotChecksum) | ||||
|             std::cerr << "Warning: checksum incorrect. Sector: " | ||||
|                       << sector->logicalSector << std::endl; | ||||
|         sectorData = sector->data; | ||||
|     } | ||||
|     else | ||||
|     { | ||||
|         ByteWriter writer(sectorData); | ||||
|         writer.write_8(0xff); /* Sync */ | ||||
|         writer.write_8(sector->logicalTrack); | ||||
|         writer.write_8(sector->logicalSector); | ||||
|         for (int i = 0; i < 10; i++) | ||||
|             writer.write_8(0); /* Padding */ | ||||
|         writer += sector->data; | ||||
|         writer.write_8(micropolisChecksum(sectorData.slice(1))); | ||||
|         for (int i = 0; i < 5; i++) | ||||
|             writer.write_8(0); /* 4 byte ECC and ECC not present flag */ | ||||
|     } | ||||
|     for (uint8_t b : sectorData) | ||||
|         fullSector->push_back(b); | ||||
|     /* sector postamble */ | ||||
|     for (int i = 0; i < 40; i++) | ||||
|         fullSector->push_back(0); | ||||
|     /* filler */ | ||||
|     for (int i = 0; i < 35; i++) | ||||
|         fullSector->push_back(0); | ||||
|  | ||||
|     if (fullSector->size() != fullSectorSize) | ||||
|         error("sector mismatched length"); | ||||
|     bool lastBit = false; | ||||
|     encodeMfm(bits, cursor, fullSector, lastBit); | ||||
|     /* filler */ | ||||
|     for (int i = 0; i < 5; i++) | ||||
|     { | ||||
|         bits[cursor++] = 1; | ||||
|         bits[cursor++] = 0; | ||||
|     } | ||||
| } | ||||
|  | ||||
| class MicropolisEncoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     MicropolisEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.micropolis()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         int bitsPerRevolution = | ||||
|             (_config.rotational_period_ms() * 1e3) / _config.clock_period_us(); | ||||
|  | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
|         for (const auto& sectorData : sectors) | ||||
|             write_sector(bits, cursor, sectorData); | ||||
|  | ||||
|         if (cursor != bits.size()) | ||||
|             error("track data mismatched length"); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits(bits, | ||||
|             calculatePhysicalClockPeriod(_config.clock_period_us() * 1e3, | ||||
|                 _config.rotational_period_ms() * 1e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const MicropolisEncoderProto& _config; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createMicropolisEncoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new MicropolisEncoder(config)); | ||||
| } | ||||
							
								
								
									
										21
									
								
								arch/micropolis/micropolis.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										21
									
								
								arch/micropolis/micropolis.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,21 @@ | ||||
| #ifndef MICROPOLIS_H | ||||
| #define MICROPOLIS_H | ||||
|  | ||||
| #define MICROPOLIS_PAYLOAD_SIZE (256) | ||||
| #define MICROPOLIS_HEADER_SIZE (1 + 2 + 10) | ||||
| #define MICROPOLIS_ENCODED_SECTOR_SIZE \ | ||||
|     (MICROPOLIS_HEADER_SIZE + MICROPOLIS_PAYLOAD_SIZE + 6) | ||||
|  | ||||
| class Decoder; | ||||
| class Encoder; | ||||
| class EncoderProto; | ||||
| class DecoderProto; | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createMicropolisDecoder( | ||||
|     const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createMicropolisEncoder( | ||||
|     const EncoderProto& config); | ||||
|  | ||||
| extern uint8_t micropolisChecksum(const Bytes& bytes); | ||||
|  | ||||
| #endif | ||||
							
								
								
									
										24
									
								
								arch/micropolis/micropolis.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										24
									
								
								arch/micropolis/micropolis.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,24 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message MicropolisDecoderProto { | ||||
| 	enum ChecksumType { | ||||
| 		AUTO = 0; | ||||
| 		MICROPOLIS = 1; | ||||
| 		MZOS = 2; | ||||
| 	} | ||||
|  | ||||
| 	optional int32 sector_output_size = 1 [default = 256, | ||||
| 		(help) = "How much of the raw sector should be saved. Must be 256 or 275"]; | ||||
| 	optional ChecksumType checksum_type = 2 [default = AUTO, | ||||
| 		(help) = "Checksum type to use: AUTO, MICROPOLIS, MZOS"]; | ||||
| } | ||||
|  | ||||
| message MicropolisEncoderProto { | ||||
|     optional double clock_period_us = 1 | ||||
|         [ default = 2.0, (help) = "clock rate on the real device" ]; | ||||
|     optional double rotational_period_ms = 2 | ||||
|         [ default = 200.0, (help) = "rotational period on the real device" ]; | ||||
| } | ||||
|  | ||||
| @@ -5,8 +5,6 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "sector.h" | ||||
| #include "record.h" | ||||
| #include "track.h" | ||||
| #include <string.h> | ||||
|  | ||||
| const int SECTOR_SIZE = 256; | ||||
| @@ -18,58 +16,68 @@ const int SECTOR_SIZE = 256; | ||||
|  */ | ||||
|  | ||||
| /* FM beginning of track marker: | ||||
|  *         0         0         f         3 decoded nibbles | ||||
|  *  0 0  0 0  0 0  0 0  1 1  1 1  0 0  1 1 | ||||
|  * 1010 1010 1010 1010 1111 1111 1010 1111 | ||||
|  *    a    a    a    a    f    f    a    f | ||||
|  *    a    a    a    a    f    f    a    f encoded nibbles | ||||
|  */ | ||||
| const FluxPattern ID_PATTERN(32, 0xaaaaffaf); | ||||
|  | ||||
| void MxDecoder::beginTrack() | ||||
| class MxDecoder : public Decoder | ||||
| { | ||||
|     _currentSector = -1; | ||||
|     _clock = 0; | ||||
| } | ||||
| public: | ||||
|     MxDecoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
| AbstractDecoder::RecordType MxDecoder::advanceToNextRecord() | ||||
| { | ||||
|     if (_currentSector == -1) | ||||
|     void beginTrack() override | ||||
|     { | ||||
|         /* First sector in the track: look for the sync marker. */ | ||||
|         const FluxMatcher* matcher = nullptr; | ||||
|         _sector->clock = _clock = _fmr->seekToPattern(ID_PATTERN, matcher); | ||||
|         readRawBits(32); /* skip the ID mark */ | ||||
|         _logicalTrack = decodeFmMfm(readRawBits(32)).slice(0, 32).reader().read_be16(); | ||||
|     } | ||||
|     else if (_currentSector == 10) | ||||
|     { | ||||
|         /* That was the last sector on the disk. */ | ||||
|         return UNKNOWN_RECORD; | ||||
|     } | ||||
|     else | ||||
|     { | ||||
|         /* Otherwise we assume the clock from the first sector is still valid. | ||||
|          * The decoder framwork will automatically stop when we hit the end of | ||||
|          * the track. */ | ||||
|         _sector->clock = _clock; | ||||
|         _clock = _sector->clock = seekToPattern(ID_PATTERN); | ||||
|         _currentSector = 0; | ||||
|     } | ||||
|  | ||||
|     _currentSector++; | ||||
|     return SECTOR_RECORD; | ||||
| } | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         if (_currentSector == 11) | ||||
|         { | ||||
|             /* That was the last sector on the disk. */ | ||||
|             return 0; | ||||
|         } | ||||
|         else | ||||
|             return _clock; | ||||
|     } | ||||
|  | ||||
| void MxDecoder::decodeSectorRecord() | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         /* Skip the ID pattern and track word, which is only present on the | ||||
|          * first sector. We don't trust the track word because some driver | ||||
|          * don't write it correctly. */ | ||||
|  | ||||
|         if (_currentSector == 0) | ||||
|             readRawBits(64); | ||||
|  | ||||
|         auto bits = readRawBits((SECTOR_SIZE + 2) * 16); | ||||
|         auto bytes = decodeFmMfm(bits).slice(0, SECTOR_SIZE + 2); | ||||
|  | ||||
|         uint16_t gotChecksum = 0; | ||||
|         ByteReader br(bytes); | ||||
|         for (int i = 0; i < (SECTOR_SIZE / 2); i++) | ||||
|             gotChecksum += br.read_be16(); | ||||
|         uint16_t wantChecksum = br.read_be16(); | ||||
|  | ||||
|         _sector->logicalTrack = _sector->physicalTrack; | ||||
|         _sector->logicalSide = _sector->physicalSide; | ||||
|         _sector->logicalSector = _currentSector; | ||||
|         _sector->data = bytes.slice(0, SECTOR_SIZE).swab(); | ||||
|         _sector->status = | ||||
|             (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|         _currentSector++; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     nanoseconds_t _clock; | ||||
|     int _currentSector; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createMxDecoder(const DecoderProto& config) | ||||
| { | ||||
|     auto bits = readRawBits((SECTOR_SIZE+2)*16); | ||||
|     auto bytes = decodeFmMfm(bits).slice(0, SECTOR_SIZE+2).swab(); | ||||
|  | ||||
|     uint16_t gotChecksum = 0; | ||||
|     ByteReader br(bytes); | ||||
|     for (int i=0; i<(SECTOR_SIZE/2); i++) | ||||
|         gotChecksum += br.read_le16(); | ||||
|     uint16_t wantChecksum = br.read_le16(); | ||||
|  | ||||
|     _sector->logicalTrack = _logicalTrack; | ||||
|     _sector->logicalSide = _track->physicalSide; | ||||
|     _sector->logicalSector = _currentSector; | ||||
|     _sector->data = bytes.slice(0, SECTOR_SIZE); | ||||
|     _sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new MxDecoder(config)); | ||||
| } | ||||
|   | ||||
							
								
								
									
										15
									
								
								arch/mx/mx.h
									
									
									
									
									
								
							
							
						
						
									
										15
									
								
								arch/mx/mx.h
									
									
									
									
									
								
							| @@ -3,19 +3,6 @@ | ||||
|  | ||||
| #include "decoders/decoders.h" | ||||
|  | ||||
| class MxDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~MxDecoder() {} | ||||
|  | ||||
|     void beginTrack(); | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|  | ||||
| private: | ||||
|     nanoseconds_t _clock; | ||||
|     int _currentSector; | ||||
|     int _logicalTrack; | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createMxDecoder(const DecoderProto& config); | ||||
|  | ||||
| #endif | ||||
|   | ||||
							
								
								
									
										4
									
								
								arch/mx/mx.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										4
									
								
								arch/mx/mx.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,4 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| message MxDecoderProto {} | ||||
|  | ||||
							
								
								
									
										186
									
								
								arch/northstar/decoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										186
									
								
								arch/northstar/decoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,186 @@ | ||||
| /* Decoder for North Star 10-sector hard-sectored disks. | ||||
|  * | ||||
|  * Supports both single- and double-density.  For the sector format and | ||||
|  * checksum algorithm, see pp. 33 of the North Star Double Density Controller | ||||
|  * manual: | ||||
|  * | ||||
|  * http://bitsavers.org/pdf/northstar/boards/Northstar_MDS-A-D_1978.pdf | ||||
|  * | ||||
|  * North Star disks do not contain any track/head/sector information | ||||
|  * encoded in the sector record.  For this reason, we have to be absolutely | ||||
|  * sure that the hardSectorId is correct. | ||||
|  */ | ||||
|  | ||||
| #include "globals.h" | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "northstar.h" | ||||
| #include "bytes.h" | ||||
| #include "lib/decoders/decoders.pb.h" | ||||
| #include "fmt/format.h" | ||||
|  | ||||
| #define MFM_ID 0xaaaaaaaaaaaa5545LL | ||||
| #define FM_ID 0xaaaaaaaaaaaaffefLL | ||||
| /* | ||||
|  * MFM sectors have 32 bytes of 00's followed by two sync characters, | ||||
|  * specified in the North Star MDS manual as 0xFBFB. | ||||
|  * | ||||
|  * This is true for most disks; however, I found a few disks, including an | ||||
|  * original North Star DOS/BASIC v2.2.1 DQ disk) that uses 0xFBnn, where | ||||
|  * nn is an incrementing pattern. | ||||
|  * | ||||
|  * 00        00        00        F         B | ||||
|  * 0000 0000 0000 0000 0000 0000 0101 0101 0100 0101 | ||||
|  * A    A    A    A    A    A    5    5    4    5 | ||||
|  */ | ||||
| static const FluxPattern MFM_PATTERN(64, MFM_ID); | ||||
|  | ||||
| /* FM sectors have 16 bytes of 00's followed by 0xFB. | ||||
|  * 00        FB | ||||
|  * 0000 0000 1111 1111 1110 1111 | ||||
|  * A    A    F    F    E    F | ||||
|  */ | ||||
| static const FluxPattern FM_PATTERN(64, FM_ID); | ||||
|  | ||||
| const FluxMatchers ANY_SECTOR_PATTERN({ | ||||
|     &MFM_PATTERN, | ||||
|     &FM_PATTERN, | ||||
| }); | ||||
|  | ||||
| /* Checksum is initially 0. | ||||
|  * For each data byte, XOR with the current checksum. | ||||
|  * Rotate checksum left, carrying bit 7 to bit 0. | ||||
|  */ | ||||
| uint8_t northstarChecksum(const Bytes& bytes) | ||||
| { | ||||
|     ByteReader br(bytes); | ||||
|     uint8_t checksum = 0; | ||||
|  | ||||
|     while (!br.eof()) | ||||
|     { | ||||
|         checksum ^= br.read_8(); | ||||
|         checksum = ((checksum << 1) | ((checksum >> 7))); | ||||
|     } | ||||
|  | ||||
|     return checksum; | ||||
| } | ||||
|  | ||||
| class NorthstarDecoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     NorthstarDecoder(const DecoderProto& config): | ||||
|         Decoder(config), | ||||
|         _config(config.northstar()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
|     /* Search for FM or MFM sector record */ | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         nanoseconds_t now = tell().ns(); | ||||
|  | ||||
|         /* For all but the first sector, seek to the next sector pulse. | ||||
|          * The first sector does not contain the sector pulse in the fluxmap. | ||||
|          */ | ||||
|         if (now != 0) | ||||
|         { | ||||
|             seekToIndexMark(); | ||||
|             now = tell().ns(); | ||||
|         } | ||||
|  | ||||
|         /* Discard a possible partial sector at the end of the track. | ||||
|          * This partial sector could be mistaken for a conflicted sector, if | ||||
|          * whatever data read happens to match the checksum of 0, which is | ||||
|          * rare, but has been observed on some disks. | ||||
|          */ | ||||
|         if (now > (getFluxmapDuration() - 21e6)) | ||||
|         { | ||||
|             seekToIndexMark(); | ||||
|             return 0; | ||||
|         } | ||||
|  | ||||
|         int msSinceIndex = std::round(now / 1e6); | ||||
|  | ||||
|         /* Note that the seekToPattern ignores the sector pulses, so if | ||||
|          * a sector is not found for some reason, the seek will advance | ||||
|          * past one or more sector pulses.  For this reason, calculate | ||||
|          * _hardSectorId after the sector header is found. | ||||
|          */ | ||||
|         nanoseconds_t clock = seekToPattern(ANY_SECTOR_PATTERN); | ||||
|         _sector->headerStartTime = tell().ns(); | ||||
|  | ||||
|         /* Discard a possible partial sector. */ | ||||
|         if (_sector->headerStartTime > (getFluxmapDuration() - 21e6)) | ||||
|         { | ||||
|             return 0; | ||||
|         } | ||||
|  | ||||
|         int sectorFoundTimeRaw = std::round(_sector->headerStartTime / 1e6); | ||||
|         int sectorFoundTime; | ||||
|  | ||||
|         /* Round time to the nearest 20ms */ | ||||
|         if ((sectorFoundTimeRaw % 20) < 10) | ||||
|         { | ||||
|             sectorFoundTime = (sectorFoundTimeRaw / 20) * 20; | ||||
|         } | ||||
|         else | ||||
|         { | ||||
|             sectorFoundTime = ((sectorFoundTimeRaw + 20) / 20) * 20; | ||||
|         } | ||||
|  | ||||
|         /* Calculate the sector ID based on time since the index */ | ||||
|         _hardSectorId = (sectorFoundTime / 20) % 10; | ||||
|  | ||||
|         return clock; | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         uint64_t id = toBytes(readRawBits(64)).reader().read_be64(); | ||||
|         unsigned recordSize, payloadSize, headerSize; | ||||
|  | ||||
|         if (id == MFM_ID) | ||||
|         { | ||||
|             recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_DD; | ||||
|             payloadSize = NORTHSTAR_PAYLOAD_SIZE_DD; | ||||
|             headerSize = NORTHSTAR_HEADER_SIZE_DD; | ||||
|         } | ||||
|         else | ||||
|         { | ||||
|             recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_SD; | ||||
|             payloadSize = NORTHSTAR_PAYLOAD_SIZE_SD; | ||||
|             headerSize = NORTHSTAR_HEADER_SIZE_SD; | ||||
|         } | ||||
|  | ||||
|         auto rawbits = readRawBits(recordSize * 16); | ||||
|         auto bytes = decodeFmMfm(rawbits).slice(0, recordSize); | ||||
|         ByteReader br(bytes); | ||||
|  | ||||
|         _sector->logicalSide = _sector->physicalSide; | ||||
|         _sector->logicalSector = _hardSectorId; | ||||
|         _sector->logicalTrack = _sector->physicalTrack; | ||||
|  | ||||
|         if (headerSize == NORTHSTAR_HEADER_SIZE_DD) | ||||
|         { | ||||
|             br.read_8(); /* MFM second Sync char, usually 0xFB */ | ||||
|         } | ||||
|  | ||||
|         _sector->data = br.read(payloadSize); | ||||
|         uint8_t wantChecksum = br.read_8(); | ||||
|         uint8_t gotChecksum = | ||||
|             northstarChecksum(bytes.slice(headerSize - 1, payloadSize)); | ||||
|         _sector->status = | ||||
|             (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const NorthstarDecoderProto& _config; | ||||
|     uint8_t _hardSectorId; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createNorthstarDecoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new NorthstarDecoder(config)); | ||||
| } | ||||
							
								
								
									
										168
									
								
								arch/northstar/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										168
									
								
								arch/northstar/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,168 @@ | ||||
| #include "globals.h" | ||||
| #include "northstar.h" | ||||
| #include "sector.h" | ||||
| #include "bytes.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "image.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
|  | ||||
| #define GAP_FILL_SIZE_SD 30 | ||||
| #define PRE_HEADER_GAP_FILL_SIZE_SD 9 | ||||
| #define GAP_FILL_SIZE_DD 62 | ||||
| #define PRE_HEADER_GAP_FILL_SIZE_DD 16 | ||||
|  | ||||
| #define GAP1_FILL_BYTE (0x4F) | ||||
| #define GAP2_FILL_BYTE (0x4F) | ||||
|  | ||||
| #define TOTAL_SECTOR_BYTES () | ||||
|  | ||||
| static void write_sector(std::vector<bool>& bits, | ||||
|     unsigned& cursor, | ||||
|     const std::shared_ptr<const Sector>& sector) | ||||
| { | ||||
|     int preambleSize = 0; | ||||
|     int encodedSectorSize = 0; | ||||
|     int gapFillSize = 0; | ||||
|     int preHeaderGapFillSize = 0; | ||||
|  | ||||
|     bool doubleDensity; | ||||
|  | ||||
|     switch (sector->data.size()) | ||||
|     { | ||||
|         case NORTHSTAR_PAYLOAD_SIZE_SD: | ||||
|             preambleSize = NORTHSTAR_PREAMBLE_SIZE_SD; | ||||
|             encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_SD + | ||||
|                                 NORTHSTAR_ENCODED_SECTOR_SIZE_SD + | ||||
|                                 GAP_FILL_SIZE_SD; | ||||
|             gapFillSize = GAP_FILL_SIZE_SD; | ||||
|             preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_SD; | ||||
|             doubleDensity = false; | ||||
|             break; | ||||
|         case NORTHSTAR_PAYLOAD_SIZE_DD: | ||||
|             preambleSize = NORTHSTAR_PREAMBLE_SIZE_DD; | ||||
|             encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_DD + | ||||
|                                 NORTHSTAR_ENCODED_SECTOR_SIZE_DD + | ||||
|                                 GAP_FILL_SIZE_DD; | ||||
|             gapFillSize = GAP_FILL_SIZE_DD; | ||||
|             preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_DD; | ||||
|             doubleDensity = true; | ||||
|             break; | ||||
|         default: | ||||
|             error("unsupported sector size --- you must pick 256 or 512"); | ||||
|             break; | ||||
|     } | ||||
|  | ||||
|     int fullSectorSize = preambleSize + encodedSectorSize; | ||||
|     auto fullSector = std::make_shared<std::vector<uint8_t>>(); | ||||
|     fullSector->reserve(fullSectorSize); | ||||
|  | ||||
|     /* sector gap after index pulse */ | ||||
|     for (int i = 0; i < preHeaderGapFillSize; i++) | ||||
|         fullSector->push_back(GAP1_FILL_BYTE); | ||||
|  | ||||
|     /* sector preamble */ | ||||
|     for (int i = 0; i < preambleSize; i++) | ||||
|         fullSector->push_back(0); | ||||
|  | ||||
|     Bytes sectorData; | ||||
|     if (sector->data.size() == encodedSectorSize) | ||||
|         sectorData = sector->data; | ||||
|     else | ||||
|     { | ||||
|         ByteWriter writer(sectorData); | ||||
|         writer.write_8(0xFB); /* sync character */ | ||||
|         if (doubleDensity == true) | ||||
|         { | ||||
|             writer.write_8(0xFB); /* Double-density has two sync characters */ | ||||
|         } | ||||
|         writer += sector->data; | ||||
|         if (doubleDensity == true) | ||||
|         { | ||||
|             writer.write_8(northstarChecksum(sectorData.slice(2))); | ||||
|         } | ||||
|         else | ||||
|         { | ||||
|             writer.write_8(northstarChecksum(sectorData.slice(1))); | ||||
|         } | ||||
|     } | ||||
|     for (uint8_t b : sectorData) | ||||
|         fullSector->push_back(b); | ||||
|  | ||||
|     if (sector->logicalSector != 9) | ||||
|     { | ||||
|         /* sector postamble */ | ||||
|         for (int i = 0; i < gapFillSize; i++) | ||||
|             fullSector->push_back(GAP2_FILL_BYTE); | ||||
|  | ||||
|         if (fullSector->size() != fullSectorSize) | ||||
|             error("sector mismatched length ({}); expected {}, got {}", | ||||
|                 sector->data.size(), | ||||
|                 fullSector->size(), | ||||
|                 fullSectorSize); | ||||
|     } | ||||
|     else | ||||
|     { | ||||
|         /* sector postamble */ | ||||
|         for (int i = 0; i < gapFillSize; i++) | ||||
|             fullSector->push_back(GAP2_FILL_BYTE); | ||||
|     } | ||||
|  | ||||
|     bool lastBit = false; | ||||
|  | ||||
|     if (doubleDensity == true) | ||||
|     { | ||||
|         encodeMfm(bits, cursor, fullSector, lastBit); | ||||
|     } | ||||
|     else | ||||
|     { | ||||
|         encodeFm(bits, cursor, fullSector); | ||||
|     } | ||||
| } | ||||
|  | ||||
| class NorthstarEncoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     NorthstarEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.northstar()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         int bitsPerRevolution = 100000; | ||||
|         double clockRateUs = _config.clock_period_us(); | ||||
|  | ||||
|         const auto& sector = *sectors.begin(); | ||||
|         if (sector->data.size() == NORTHSTAR_PAYLOAD_SIZE_SD) | ||||
|             bitsPerRevolution /= 2; // FM | ||||
|         else | ||||
|             clockRateUs /= 2.00; | ||||
|  | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
|         for (const auto& sectorData : sectors) | ||||
|             write_sector(bits, cursor, sectorData); | ||||
|  | ||||
|         if (cursor > bits.size()) | ||||
|             error("track data overrun"); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits(bits, | ||||
|             calculatePhysicalClockPeriod( | ||||
|                 clockRateUs * 1e3, _config.rotational_period_ms() * 1e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const NorthstarEncoderProto& _config; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createNorthstarEncoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new NorthstarEncoder(config)); | ||||
| } | ||||
							
								
								
									
										42
									
								
								arch/northstar/northstar.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										42
									
								
								arch/northstar/northstar.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,42 @@ | ||||
| #ifndef NORTHSTAR_H | ||||
| #define NORTHSTAR_H | ||||
|  | ||||
| /* Northstar floppies are 10-hard sectored disks with a sector format as | ||||
|  * follows: | ||||
|  * | ||||
|  * |----------------------------------| | ||||
|  * | SYNC Byte  | Payload  | Checksum | | ||||
|  * |------------+----------+----------| | ||||
|  * | 1 (0xFB)   | 256 (SD) |    1     | | ||||
|  * | 2 (0xFBFB) | 512 (DD) |          | | ||||
|  * |----------------------------------| | ||||
|  * | ||||
|  */ | ||||
|  | ||||
| #define NORTHSTAR_PREAMBLE_SIZE_SD (16) | ||||
| #define NORTHSTAR_PREAMBLE_SIZE_DD (32) | ||||
| #define NORTHSTAR_HEADER_SIZE_SD (1) | ||||
| #define NORTHSTAR_HEADER_SIZE_DD (2) | ||||
| #define NORTHSTAR_PAYLOAD_SIZE_SD (256) | ||||
| #define NORTHSTAR_PAYLOAD_SIZE_DD (512) | ||||
| #define NORTHSTAR_CHECKSUM_SIZE (1) | ||||
| #define NORTHSTAR_ENCODED_SECTOR_SIZE_SD                    \ | ||||
|     (NORTHSTAR_HEADER_SIZE_SD + NORTHSTAR_PAYLOAD_SIZE_SD + \ | ||||
|         NORTHSTAR_CHECKSUM_SIZE) | ||||
| #define NORTHSTAR_ENCODED_SECTOR_SIZE_DD                    \ | ||||
|     (NORTHSTAR_HEADER_SIZE_DD + NORTHSTAR_PAYLOAD_SIZE_DD + \ | ||||
|         NORTHSTAR_CHECKSUM_SIZE) | ||||
|  | ||||
| class Decoder; | ||||
| class Encoder; | ||||
| class EncoderProto; | ||||
| class DecoderProto; | ||||
|  | ||||
| extern uint8_t northstarChecksum(const Bytes& bytes); | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createNorthstarDecoder( | ||||
|     const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createNorthstarEncoder( | ||||
|     const EncoderProto& config); | ||||
|  | ||||
| #endif /* NORTHSTAR */ | ||||
							
								
								
									
										13
									
								
								arch/northstar/northstar.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										13
									
								
								arch/northstar/northstar.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,13 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message NorthstarDecoderProto {} | ||||
|  | ||||
| message NorthstarEncoderProto { | ||||
|     optional double clock_period_us = 1 | ||||
|         [ default = 4.0, (help) = "clock rate on the real device (for FM)" ]; | ||||
|     optional double rotational_period_ms = 2 | ||||
|         [ default = 166.0, (help) = "rotational period on the real device" ]; | ||||
| } | ||||
|  | ||||
							
								
								
									
										51
									
								
								arch/rolandd20/decoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										51
									
								
								arch/rolandd20/decoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,51 @@ | ||||
| #include "lib/globals.h" | ||||
| #include "lib/decoders/decoders.h" | ||||
| #include "lib/crc.h" | ||||
| #include "lib/fluxmap.h" | ||||
| #include "lib/decoders/fluxmapreader.h" | ||||
| #include "lib/sector.h" | ||||
| #include "lib/bytes.h" | ||||
| #include "rolandd20.h" | ||||
| #include <string.h> | ||||
|  | ||||
| /* Sector header record: | ||||
|  * | ||||
|  * BF FF FF FF FF FF FE AB | ||||
|  * | ||||
|  * This encodes to: | ||||
|  * | ||||
|  *    e    d    5    5    5    5    5    5 | ||||
|  * 1110 1101 0101 0101 0101 0101 0101 0101 | ||||
|  *    5    5    5    5    5    5    5    5 | ||||
|  * 0101 0101 0101 0101 0101 0101 0101 0101 | ||||
|  *    5    5    5    5    5    5    5    5 | ||||
|  * 0101 0101 0101 0101 0101 0101 0101 0101 | ||||
|  *    5    5    5    4    4    4    4    5 | ||||
|  * 0101 0101 0101 0100 0100 0100 0100 0101 | ||||
|  */ | ||||
|  | ||||
| static const FluxPattern SECTOR_PATTERN(64, 0xed55555555555555LL); | ||||
|  | ||||
| class RolandD20Decoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     RolandD20Decoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(SECTOR_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         auto rawbits = readRawBits(256); | ||||
|         const auto& bytes = decodeFmMfm(rawbits); | ||||
|         fmt::print("{} ", _sector->clock); | ||||
|         hexdump(std::cout, bytes); | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createRolandD20Decoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new RolandD20Decoder(config)); | ||||
| } | ||||
							
								
								
									
										4
									
								
								arch/rolandd20/rolandd20.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										4
									
								
								arch/rolandd20/rolandd20.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,4 @@ | ||||
| #pragma once | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createRolandD20Decoder( | ||||
|     const DecoderProto& config); | ||||
							
								
								
									
										5
									
								
								arch/rolandd20/rolandd20.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										5
									
								
								arch/rolandd20/rolandd20.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,5 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| message RolandD20DecoderProto {} | ||||
|  | ||||
|  | ||||
							
								
								
									
										154
									
								
								arch/smaky6/decoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										154
									
								
								arch/smaky6/decoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,154 @@ | ||||
| #include "globals.h" | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "smaky6.h" | ||||
| #include "bytes.h" | ||||
| #include "crc.h" | ||||
| #include "fmt/format.h" | ||||
| #include "lib/decoders/decoders.pb.h" | ||||
| #include <string.h> | ||||
| #include <algorithm> | ||||
|  | ||||
| static const FluxPattern SECTOR_PATTERN(32, 0x54892aaa); | ||||
|  | ||||
| class Smaky6Decoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     Smaky6Decoder(const DecoderProto& config): | ||||
|         Decoder(config), | ||||
|         _config(config.smaky6()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     /* Returns the sector ID of the _current_ sector. */ | ||||
|     int advanceToNextSector() | ||||
|     { | ||||
|         auto previous = tell(); | ||||
|         seekToIndexMark(); | ||||
|         auto now = tell(); | ||||
|         if ((now.ns() - previous.ns()) < 9e6) | ||||
|         { | ||||
|             seekToIndexMark(); | ||||
|             auto next = tell(); | ||||
|             if ((next.ns() - now.ns()) < 9e6) | ||||
|             { | ||||
|                 /* We just found sector 0. */ | ||||
|  | ||||
|                 _sectorId = 0; | ||||
|             } | ||||
|             else | ||||
|             { | ||||
|                 /* Spurious... */ | ||||
|  | ||||
|                 seek(now); | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         return _sectorId++; | ||||
|     } | ||||
|  | ||||
| public: | ||||
|     void beginTrack() override | ||||
|     { | ||||
|         /* Find the start-of-track index marks, which will be an interval | ||||
|          * of about 6ms. */ | ||||
|  | ||||
|         seekToIndexMark(); | ||||
|         _sectorId = 99; | ||||
|         for (;;) | ||||
|         { | ||||
|             auto pos = tell(); | ||||
|             advanceToNextSector(); | ||||
|             if (_sectorId < 99) | ||||
|             { | ||||
|                 seek(pos); | ||||
|                 break; | ||||
|             } | ||||
|  | ||||
|             if (eof()) | ||||
|                 return; | ||||
|         } | ||||
|  | ||||
|         /* Now we know where to start counting, start finding sectors. */ | ||||
|  | ||||
|         _sectorStarts.clear(); | ||||
|         for (;;) | ||||
|         { | ||||
|             auto now = tell(); | ||||
|             if (eof()) | ||||
|                 break; | ||||
|  | ||||
|             int id = advanceToNextSector(); | ||||
|             if (id < 16) | ||||
|                 _sectorStarts.push_back(std::make_pair(id, now)); | ||||
|         } | ||||
|  | ||||
|         _sectorIndex = 0; | ||||
|     } | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         if (_sectorIndex == _sectorStarts.size()) | ||||
|         { | ||||
|             seekToIndexMark(); | ||||
|             return 0; | ||||
|         } | ||||
|  | ||||
|         const auto& p = _sectorStarts[_sectorIndex++]; | ||||
|         _sectorId = p.first; | ||||
|         seek(p.second); | ||||
|  | ||||
|         nanoseconds_t clock = seekToPattern(SECTOR_PATTERN); | ||||
|         _sector->headerStartTime = tell().ns(); | ||||
|  | ||||
|         return clock; | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         readRawBits(33); | ||||
|         const auto& rawbits = readRawBits(SMAKY6_RECORD_SIZE * 16); | ||||
|         if (rawbits.size() < SMAKY6_SECTOR_SIZE) | ||||
|             return; | ||||
|         const auto& rawbytes = | ||||
|             toBytes(rawbits).slice(0, SMAKY6_RECORD_SIZE * 16); | ||||
|  | ||||
|         /* The Smaky bytes are stored backwards! Backwards! */ | ||||
|  | ||||
|         const auto& bytes = | ||||
|             decodeFmMfm(rawbits).slice(0, SMAKY6_RECORD_SIZE).reverseBits(); | ||||
|         ByteReader br(bytes); | ||||
|  | ||||
|         uint8_t track = br.read_8(); | ||||
|         Bytes data = br.read(SMAKY6_SECTOR_SIZE); | ||||
|         uint8_t wantedChecksum = br.read_8(); | ||||
|         uint8_t gotChecksum = sumBytes(data) & 0xff; | ||||
|  | ||||
|         if (track != _sector->physicalTrack) | ||||
|             return; | ||||
|  | ||||
|         _sector->logicalTrack = _sector->physicalTrack; | ||||
|         _sector->logicalSide = _sector->physicalSide; | ||||
|         _sector->logicalSector = _sectorId; | ||||
|  | ||||
|         _sector->data = data; | ||||
|         _sector->status = | ||||
|             (wantedChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const Smaky6DecoderProto& _config; | ||||
|     nanoseconds_t _startOfTrack; | ||||
|     std::vector<std::pair<int, Fluxmap::Position>> _sectorStarts; | ||||
|     int _sectorId; | ||||
|     int _sectorIndex; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createSmaky6Decoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new Smaky6Decoder(config)); | ||||
| } | ||||
							
								
								
									
										9
									
								
								arch/smaky6/smaky6.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										9
									
								
								arch/smaky6/smaky6.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,9 @@ | ||||
| #ifndef SMAKY6_H | ||||
| #define SMAKY6_H | ||||
|  | ||||
| #define SMAKY6_SECTOR_SIZE 256 | ||||
| #define SMAKY6_RECORD_SIZE (1 + SMAKY6_SECTOR_SIZE + 1) | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createSmaky6Decoder(const DecoderProto& config); | ||||
|  | ||||
| #endif | ||||
							
								
								
									
										6
									
								
								arch/smaky6/smaky6.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										6
									
								
								arch/smaky6/smaky6.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,6 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message Smaky6DecoderProto {} | ||||
|  | ||||
							
								
								
									
										100
									
								
								arch/tids990/decoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										100
									
								
								arch/tids990/decoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,100 @@ | ||||
| #include "globals.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "tids990/tids990.h" | ||||
| #include "crc.h" | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "sector.h" | ||||
| #include <string.h> | ||||
| #include <fmt/format.h> | ||||
|  | ||||
| /* The Texas Instruments DS990 uses MFM with a scheme similar to a simplified | ||||
|  * version of the IBM record scheme (it's actually easier to parse than IBM). | ||||
|  * There are 26 sectors per track, each holding a rather weird 288 bytes. | ||||
|  */ | ||||
|  | ||||
| /* | ||||
|  * Sector record: | ||||
|  * data:    0  1  0  1  0  1  0  1 .0  0  0  0  1  0  1  0  = 0x550a | ||||
|  * mfm:     00 01 00 01 00 01 00 01.00 10 10 10 01 00 01 00 = 0x11112a44 | ||||
|  * special: 00 01 00 01 00 01 00 01.00 10 00 10 01 00 01 00 = 0x11112244 | ||||
|  *                                        ^^ | ||||
|  * When shifted out of phase, the special 0xa1 byte becomes an illegal | ||||
|  * encoding (you can't do 10 00). So this can't be spoofed by user data. | ||||
|  */ | ||||
| const uint16_t SECTOR_ID = 0x550a; | ||||
| const FluxPattern SECTOR_RECORD_PATTERN(32, 0x11112244); | ||||
|  | ||||
| /* | ||||
|  * Data record: | ||||
|  * data:    0  1  0  1  0  1  0  1 .0  0  0  0  1  0  1  1  = 0x550b | ||||
|  * mfm:     00 01 00 01 00 01 00 01.00 10 10 10 01 00 01 01 = 0x11112a45 | ||||
|  * special: 00 01 00 01 00 01 00 01.00 10 00 10 01 00 01 01 = 0x11112245 | ||||
|  *                                        ^^ | ||||
|  * When shifted out of phase, the special 0xa1 byte becomes an illegal | ||||
|  * encoding (you can't do 10 00). So this can't be spoofed by user data. | ||||
|  */ | ||||
| const uint16_t DATA_ID = 0x550b; | ||||
| const FluxPattern DATA_RECORD_PATTERN(32, 0x11112245); | ||||
|  | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
|     {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN}); | ||||
|  | ||||
| class Tids990Decoder : public Decoder | ||||
| { | ||||
| public: | ||||
|     Tids990Decoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         auto bits = readRawBits(TIDS990_SECTOR_RECORD_SIZE * 16); | ||||
|         auto bytes = decodeFmMfm(bits).slice(0, TIDS990_SECTOR_RECORD_SIZE); | ||||
|  | ||||
|         ByteReader br(bytes); | ||||
|         if (br.read_be16() != SECTOR_ID) | ||||
|             return; | ||||
|  | ||||
|         uint16_t gotChecksum = | ||||
|             crc16(CCITT_POLY, bytes.slice(1, TIDS990_SECTOR_RECORD_SIZE - 3)); | ||||
|  | ||||
|         _sector->logicalSide = br.read_8() >> 3; | ||||
|         _sector->logicalTrack = br.read_8(); | ||||
|         br.read_8(); /* number of sectors per track */ | ||||
|         _sector->logicalSector = br.read_8(); | ||||
|         br.read_be16(); /* sector size */ | ||||
|         uint16_t wantChecksum = br.read_be16(); | ||||
|  | ||||
|         if (wantChecksum == gotChecksum) | ||||
|             _sector->status = | ||||
|                 Sector::DATA_MISSING; /* correct but unintuitive */ | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         auto bits = readRawBits(TIDS990_DATA_RECORD_SIZE * 16); | ||||
|         auto bytes = decodeFmMfm(bits).slice(0, TIDS990_DATA_RECORD_SIZE); | ||||
|  | ||||
|         ByteReader br(bytes); | ||||
|         if (br.read_be16() != DATA_ID) | ||||
|             return; | ||||
|  | ||||
|         uint16_t gotChecksum = | ||||
|             crc16(CCITT_POLY, bytes.slice(1, TIDS990_DATA_RECORD_SIZE - 3)); | ||||
|  | ||||
|         _sector->data = br.read(TIDS990_PAYLOAD_SIZE); | ||||
|         uint16_t wantChecksum = br.read_be16(); | ||||
|         _sector->status = | ||||
|             (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createTids990Decoder(const DecoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Decoder>(new Tids990Decoder(config)); | ||||
| } | ||||
							
								
								
									
										151
									
								
								arch/tids990/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										151
									
								
								arch/tids990/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,151 @@ | ||||
| #include "globals.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "tids990.h" | ||||
| #include "crc.h" | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "arch/tids990/tids990.pb.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
| #include <fmt/format.h> | ||||
|  | ||||
| static int charToInt(char c) | ||||
| { | ||||
|     if (isdigit(c)) | ||||
|         return c - '0'; | ||||
|     return 10 + tolower(c) - 'a'; | ||||
| } | ||||
|  | ||||
| static uint8_t decodeUint16(uint16_t raw) | ||||
| { | ||||
|     Bytes b; | ||||
|     ByteWriter bw(b); | ||||
|     bw.write_be16(raw); | ||||
|     return decodeFmMfm(b.toBits())[0]; | ||||
| } | ||||
|  | ||||
| class Tids990Encoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     Tids990Encoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.tids990()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     void writeRawBits(uint32_t data, int width) | ||||
|     { | ||||
|         _cursor += width; | ||||
|         _lastBit = data & 1; | ||||
|         for (int i = 0; i < width; i++) | ||||
|         { | ||||
|             unsigned pos = _cursor - i - 1; | ||||
|             if (pos < _bits.size()) | ||||
|                 _bits[pos] = data & 1; | ||||
|             data >>= 1; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     void writeBytes(const Bytes& bytes) | ||||
|     { | ||||
|         encodeMfm(_bits, _cursor, bytes, _lastBit); | ||||
|     } | ||||
|  | ||||
|     void writeBytes(int count, uint8_t byte) | ||||
|     { | ||||
|         Bytes bytes = {byte}; | ||||
|         for (int i = 0; i < count; i++) | ||||
|             writeBytes(bytes); | ||||
|     } | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         double clockRateUs = _config.clock_period_us() / 2.0; | ||||
|         int bitsPerRevolution = | ||||
|             (_config.rotational_period_ms() * 1000.0) / clockRateUs; | ||||
|         _bits.resize(bitsPerRevolution); | ||||
|         _cursor = 0; | ||||
|  | ||||
|         uint8_t am1Unencoded = decodeUint16(_config.am1_byte()); | ||||
|         uint8_t am2Unencoded = decodeUint16(_config.am2_byte()); | ||||
|  | ||||
|         writeBytes(_config.gap1_bytes(), 0x55); | ||||
|  | ||||
|         bool first = true; | ||||
|         for (const auto& sectorData : sectors) | ||||
|         { | ||||
|             if (!first) | ||||
|                 writeBytes(_config.gap3_bytes(), 0x55); | ||||
|             first = false; | ||||
|  | ||||
|             /* Writing the sector and data records are fantastically annoying. | ||||
|              * The CRC is calculated from the *very start* of the record, and | ||||
|              * include the malformed marker bytes. Our encoder doesn't know | ||||
|              * about this, of course, with the result that we have to construct | ||||
|              * the unencoded header, calculate the checksum, and then use the | ||||
|              * same logic to emit the bytes which require special encoding | ||||
|              * before encoding the rest of the header normally. */ | ||||
|  | ||||
|             { | ||||
|                 Bytes header; | ||||
|                 ByteWriter bw(header); | ||||
|  | ||||
|                 writeBytes(12, 0x55); | ||||
|                 bw.write_8(am1Unencoded); | ||||
|                 bw.write_8(sectorData->logicalSide << 3); | ||||
|                 bw.write_8(sectorData->logicalTrack); | ||||
|                 bw.write_8(_config.sector_count()); | ||||
|                 bw.write_8(sectorData->logicalSector); | ||||
|                 bw.write_be16(sectorData->data.size()); | ||||
|                 uint16_t crc = crc16(CCITT_POLY, header); | ||||
|                 bw.write_be16(crc); | ||||
|  | ||||
|                 writeRawBits(_config.am1_byte(), 16); | ||||
|                 writeBytes(header.slice(1)); | ||||
|             } | ||||
|  | ||||
|             writeBytes(_config.gap2_bytes(), 0x55); | ||||
|  | ||||
|             { | ||||
|                 Bytes data; | ||||
|                 ByteWriter bw(data); | ||||
|  | ||||
|                 writeBytes(12, 0x55); | ||||
|                 bw.write_8(am2Unencoded); | ||||
|  | ||||
|                 bw += sectorData->data; | ||||
|                 uint16_t crc = crc16(CCITT_POLY, data); | ||||
|                 bw.write_be16(crc); | ||||
|  | ||||
|                 writeRawBits(_config.am2_byte(), 16); | ||||
|                 writeBytes(data.slice(1)); | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         if (_cursor >= _bits.size()) | ||||
|             error("track data overrun"); | ||||
|         while (_cursor < _bits.size()) | ||||
|             writeBytes(1, 0x55); | ||||
|  | ||||
|         auto fluxmap = std::make_unique<Fluxmap>(); | ||||
|         fluxmap->appendBits(_bits, | ||||
|             calculatePhysicalClockPeriod( | ||||
|                 clockRateUs * 1e3, _config.rotational_period_ms() * 1e6)); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const Tids990EncoderProto& _config; | ||||
|     std::vector<bool> _bits; | ||||
|     unsigned _cursor; | ||||
|     bool _lastBit; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createTids990Encoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new Tids990Encoder(config)); | ||||
| } | ||||
							
								
								
									
										18
									
								
								arch/tids990/tids990.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										18
									
								
								arch/tids990/tids990.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,18 @@ | ||||
| #ifndef TIDS990_H | ||||
| #define TIDS990_H | ||||
|  | ||||
| #define TIDS990_PAYLOAD_SIZE 288                            /* bytes */ | ||||
| #define TIDS990_SECTOR_RECORD_SIZE 10                       /* bytes */ | ||||
| #define TIDS990_DATA_RECORD_SIZE (TIDS990_PAYLOAD_SIZE + 4) /* bytes */ | ||||
|  | ||||
| class Encoder; | ||||
| class Decoder; | ||||
| class DecoderProto; | ||||
| class EncoderProto; | ||||
|  | ||||
| extern std::unique_ptr<Decoder> createTids990Decoder( | ||||
|     const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createTids990Encoder( | ||||
|     const EncoderProto& config); | ||||
|  | ||||
| #endif | ||||
							
								
								
									
										25
									
								
								arch/tids990/tids990.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										25
									
								
								arch/tids990/tids990.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,25 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message Tids990DecoderProto {} | ||||
|  | ||||
| message Tids990EncoderProto { | ||||
| 	optional double rotational_period_ms = 1 [ default = 166, | ||||
| 		(help) = "length of a track" ]; | ||||
| 	optional int32 sector_count = 2 [ default = 26, | ||||
| 		(help) = "number of sectors per track" ]; | ||||
| 	optional double clock_period_us = 3 [ default = 2, | ||||
| 		(help) = "clock rate of data to write" ]; | ||||
| 	optional int32 am1_byte = 4 [ default = 0x2244, | ||||
| 		(help) = "16-bit RAW bit pattern to use for the AM1 ID byte" ]; | ||||
| 	optional int32 am2_byte = 5 [ default = 0x2245, | ||||
| 		(help) = "16-bit RAW bit pattern to use for the AM2 ID byte" ]; | ||||
| 	optional int32 gap1_bytes = 6 [ default = 80, | ||||
| 		(help) = "size of gap 1 (the post-index gap)" ]; | ||||
| 	optional int32 gap2_bytes = 7 [ default = 21, | ||||
| 		(help) = "size of gap 2 (the post-ID gap)" ]; | ||||
| 	optional int32 gap3_bytes = 8 [ default = 51, | ||||
| 		(help) = "size of gap 3 (the post-data or format gap)" ]; | ||||
| } | ||||
|  | ||||
| @@ -2,32 +2,32 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "victor9k.h" | ||||
| #include "crc.h" | ||||
| #include "bytes.h" | ||||
| #include "track.h" | ||||
| #include "fmt/format.h" | ||||
| #include <string.h> | ||||
| #include <algorithm> | ||||
|  | ||||
| const FluxPattern SECTOR_RECORD_PATTERN(32, VICTOR9K_SECTOR_RECORD); | ||||
| const FluxPattern DATA_RECORD_PATTERN(32, VICTOR9K_DATA_RECORD); | ||||
| const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN }); | ||||
| const FluxMatchers ANY_RECORD_PATTERN( | ||||
|     {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN}); | ||||
|  | ||||
| static int decode_data_gcr(uint8_t gcr) | ||||
| { | ||||
|     switch (gcr) | ||||
|     { | ||||
| 		#define GCR_ENTRY(gcr, data) \ | ||||
| 			case gcr: return data; | ||||
| 		#include "data_gcr.h" | ||||
| 		#undef GCR_ENTRY | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case gcr:                \ | ||||
|         return data; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| }; | ||||
| } | ||||
|  | ||||
| static Bytes decode(const std::vector<bool>& bits) | ||||
| { | ||||
| @@ -39,11 +39,11 @@ static Bytes decode(const std::vector<bool>& bits) | ||||
|     while (ii != bits.end()) | ||||
|     { | ||||
|         uint8_t inputfifo = 0; | ||||
|         for (size_t i=0; i<5; i++) | ||||
|         for (size_t i = 0; i < 5; i++) | ||||
|         { | ||||
|             if (ii == bits.end()) | ||||
|                 break; | ||||
|             inputfifo = (inputfifo<<1) | *ii++; | ||||
|             inputfifo = (inputfifo << 1) | *ii++; | ||||
|         } | ||||
|  | ||||
|         uint8_t decoded = decode_data_gcr(inputfifo); | ||||
| @@ -54,58 +54,65 @@ static Bytes decode(const std::vector<bool>& bits) | ||||
|     return output; | ||||
| } | ||||
|  | ||||
| AbstractDecoder::RecordType Victor9kDecoder::advanceToNextRecord() | ||||
| class Victor9kDecoder : public Decoder | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
| 	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher); | ||||
| 	if (matcher == &SECTOR_RECORD_PATTERN) | ||||
| 		return SECTOR_RECORD; | ||||
| 	if (matcher == &DATA_RECORD_PATTERN) | ||||
| 		return DATA_RECORD; | ||||
| 	return UNKNOWN_RECORD; | ||||
| } | ||||
| public: | ||||
|     Victor9kDecoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
| void Victor9kDecoder::decodeSectorRecord() | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         return seekToPattern(ANY_RECORD_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         /* Check the ID. */ | ||||
|  | ||||
|         if (readRaw32() != VICTOR9K_SECTOR_RECORD) | ||||
|             return; | ||||
|  | ||||
|         /* Read header. */ | ||||
|  | ||||
|         auto bytes = decode(readRawBits(3 * 10)).slice(0, 3); | ||||
|  | ||||
|         uint8_t rawTrack = bytes[0]; | ||||
|         _sector->logicalSector = bytes[1]; | ||||
|         uint8_t gotChecksum = bytes[2]; | ||||
|  | ||||
|         _sector->logicalTrack = rawTrack & 0x7f; | ||||
|         _sector->logicalSide = rawTrack >> 7; | ||||
|         uint8_t wantChecksum = bytes[0] + bytes[1]; | ||||
|         if ((_sector->logicalSector > 20) || (_sector->logicalTrack > 85) || | ||||
|             (_sector->logicalSide > 1)) | ||||
|             return; | ||||
|  | ||||
|         if (wantChecksum == gotChecksum) | ||||
|             _sector->status = | ||||
|                 Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
|     } | ||||
|  | ||||
|     void decodeDataRecord() override | ||||
|     { | ||||
|         /* Check the ID. */ | ||||
|  | ||||
|         if (readRaw32() != VICTOR9K_DATA_RECORD) | ||||
|             return; | ||||
|  | ||||
|         /* Read data. */ | ||||
|  | ||||
|         auto bytes = decode(readRawBits((VICTOR9K_SECTOR_LENGTH + 4) * 10)) | ||||
|                          .slice(0, VICTOR9K_SECTOR_LENGTH + 4); | ||||
|         ByteReader br(bytes); | ||||
|  | ||||
|         _sector->data = br.read(VICTOR9K_SECTOR_LENGTH); | ||||
|         uint16_t gotChecksum = sumBytes(_sector->data); | ||||
|         uint16_t wantChecksum = br.read_le16(); | ||||
|         _sector->status = | ||||
|             (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createVictor9kDecoder(const DecoderProto& config) | ||||
| { | ||||
|     /* Skip the sync marker bit. */ | ||||
|     readRawBits(23); | ||||
|  | ||||
|     /* Read header. */ | ||||
|  | ||||
|     auto bytes = decode(readRawBits(4*10)).slice(0, 4); | ||||
|  | ||||
|     uint8_t rawTrack = bytes[1]; | ||||
|     _sector->logicalSector = bytes[2]; | ||||
|     uint8_t gotChecksum = bytes[3]; | ||||
|  | ||||
|     _sector->logicalTrack = rawTrack & 0x7f; | ||||
|     _sector->logicalSide = rawTrack >> 7; | ||||
|     uint8_t wantChecksum = bytes[1] + bytes[2]; | ||||
|     if ((_sector->logicalSector > 20) || (_sector->logicalTrack > 85) || (_sector->logicalSide > 1)) | ||||
|         return; | ||||
|                  | ||||
|     if (wantChecksum == gotChecksum) | ||||
|         _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */ | ||||
| } | ||||
|  | ||||
| void Victor9kDecoder::decodeDataRecord() | ||||
| { | ||||
|     /* Skip the sync marker bit. */ | ||||
|     readRawBits(23); | ||||
|  | ||||
|     /* Read data. */ | ||||
|  | ||||
|     auto bytes = decode(readRawBits((VICTOR9K_SECTOR_LENGTH+5)*10)) | ||||
|         .slice(0, VICTOR9K_SECTOR_LENGTH+5); | ||||
|     ByteReader br(bytes); | ||||
|  | ||||
|     /* Check that this is actually a data record. */ | ||||
|      | ||||
|     if (br.read_8() != 8) | ||||
|         return; | ||||
|  | ||||
|     _sector->data = br.read(VICTOR9K_SECTOR_LENGTH); | ||||
|     uint16_t gotChecksum = sumBytes(_sector->data); | ||||
|     uint16_t wantChecksum = br.read_le16(); | ||||
|     _sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new Victor9kDecoder(config)); | ||||
| } | ||||
|   | ||||
							
								
								
									
										210
									
								
								arch/victor9k/encoder.cc
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										210
									
								
								arch/victor9k/encoder.cc
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,210 @@ | ||||
| #include "globals.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "encoders/encoders.h" | ||||
| #include "victor9k.h" | ||||
| #include "crc.h" | ||||
| #include "sector.h" | ||||
| #include "readerwriter.h" | ||||
| #include "image.h" | ||||
| #include "fmt/format.h" | ||||
| #include "arch/victor9k/victor9k.pb.h" | ||||
| #include "lib/encoders/encoders.pb.h" | ||||
| #include "lib/layout.h" | ||||
| #include <ctype.h> | ||||
| #include "bytes.h" | ||||
|  | ||||
| static bool lastBit; | ||||
|  | ||||
| static void write_zero_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, unsigned count) | ||||
| { | ||||
|     while (count--) | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             lastBit = bits[cursor++] = 0; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_one_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, unsigned count) | ||||
| { | ||||
|     while (count--) | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             lastBit = bits[cursor++] = 1; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src) | ||||
| { | ||||
|     for (bool bit : src) | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             lastBit = bits[cursor++] = bit; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width) | ||||
| { | ||||
|     cursor += width; | ||||
|     lastBit = data & 1; | ||||
|     for (int i = 0; i < width; i++) | ||||
|     { | ||||
|         unsigned pos = cursor - i - 1; | ||||
|         if (pos < bits.size()) | ||||
|             bits[pos] = data & 1; | ||||
|         data >>= 1; | ||||
|     } | ||||
| } | ||||
|  | ||||
| static void write_bits( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes) | ||||
| { | ||||
|     ByteReader br(bytes); | ||||
|     BitReader bitr(br); | ||||
|  | ||||
|     while (!bitr.eof()) | ||||
|     { | ||||
|         if (cursor < bits.size()) | ||||
|             bits[cursor++] = bitr.get(); | ||||
|     } | ||||
| } | ||||
|  | ||||
| static int encode_data_gcr(uint8_t data) | ||||
| { | ||||
|     switch (data & 0x0f) | ||||
|     { | ||||
| #define GCR_ENTRY(gcr, data) \ | ||||
|     case data:               \ | ||||
|         return gcr; | ||||
| #include "data_gcr.h" | ||||
| #undef GCR_ENTRY | ||||
|     } | ||||
|     return -1; | ||||
| } | ||||
|  | ||||
| static void write_byte(std::vector<bool>& bits, unsigned& cursor, uint8_t b) | ||||
| { | ||||
|     write_bits(bits, cursor, encode_data_gcr(b >> 4), 5); | ||||
|     write_bits(bits, cursor, encode_data_gcr(b), 5); | ||||
| } | ||||
|  | ||||
| static void write_bytes( | ||||
|     std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes) | ||||
| { | ||||
|     for (uint8_t b : bytes) | ||||
|         write_byte(bits, cursor, b); | ||||
| } | ||||
|  | ||||
| static void write_gap(std::vector<bool>& bits, unsigned& cursor, int length) | ||||
| { | ||||
|     for (int i = 0; i < length / 10; i++) | ||||
|         write_byte(bits, cursor, '0'); | ||||
| } | ||||
|  | ||||
| static void write_sector(std::vector<bool>& bits, | ||||
|     unsigned& cursor, | ||||
|     const Victor9kEncoderProto::TrackdataProto& trackdata, | ||||
|     const Sector& sector) | ||||
| { | ||||
|     write_one_bits(bits, cursor, trackdata.pre_header_sync_bits()); | ||||
|     write_bits(bits, cursor, VICTOR9K_SECTOR_RECORD, 10); | ||||
|  | ||||
|     uint8_t encodedTrack = sector.logicalTrack | (sector.logicalSide << 7); | ||||
|     uint8_t encodedSector = sector.logicalSector; | ||||
|     write_bytes(bits, | ||||
|         cursor, | ||||
|         Bytes{ | ||||
|             encodedTrack, | ||||
|             encodedSector, | ||||
|             (uint8_t)(encodedTrack + encodedSector), | ||||
|         }); | ||||
|  | ||||
|     write_gap(bits, cursor, trackdata.post_header_gap_bits()); | ||||
|  | ||||
|     write_one_bits(bits, cursor, trackdata.pre_data_sync_bits()); | ||||
|     write_bits(bits, cursor, VICTOR9K_DATA_RECORD, 10); | ||||
|  | ||||
|     write_bytes(bits, cursor, sector.data); | ||||
|  | ||||
|     Bytes checksum(2); | ||||
|     checksum.writer().write_le16(sumBytes(sector.data)); | ||||
|     write_bytes(bits, cursor, checksum); | ||||
|     write_gap(bits, cursor, trackdata.post_data_gap_bits()); | ||||
| } | ||||
|  | ||||
| class Victor9kEncoder : public Encoder | ||||
| { | ||||
| public: | ||||
|     Victor9kEncoder(const EncoderProto& config): | ||||
|         Encoder(config), | ||||
|         _config(config.victor9k()) | ||||
|     { | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     void getTrackFormat(Victor9kEncoderProto::TrackdataProto& trackdata, | ||||
|         unsigned track, | ||||
|         unsigned head) | ||||
|     { | ||||
|         trackdata.Clear(); | ||||
|         for (const auto& f : _config.trackdata()) | ||||
|         { | ||||
|             if (f.has_min_track() && (track < f.min_track())) | ||||
|                 continue; | ||||
|             if (f.has_max_track() && (track > f.max_track())) | ||||
|                 continue; | ||||
|             if (f.has_head() && (head != f.head())) | ||||
|                 continue; | ||||
|  | ||||
|             trackdata.MergeFrom(f); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| public: | ||||
|     std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo, | ||||
|         const std::vector<std::shared_ptr<const Sector>>& sectors, | ||||
|         const Image& image) override | ||||
|     { | ||||
|         Victor9kEncoderProto::TrackdataProto trackdata; | ||||
|         getTrackFormat( | ||||
|             trackdata, trackInfo->logicalTrack, trackInfo->logicalSide); | ||||
|  | ||||
|         unsigned bitsPerRevolution = (trackdata.rotational_period_ms() * 1e3) / | ||||
|                                      trackdata.clock_period_us(); | ||||
|         std::vector<bool> bits(bitsPerRevolution); | ||||
|         nanoseconds_t clockPeriod = | ||||
|             calculatePhysicalClockPeriod(trackdata.clock_period_us() * 1e3, | ||||
|                 trackdata.rotational_period_ms() * 1e6); | ||||
|         unsigned cursor = 0; | ||||
|  | ||||
|         fillBitmapTo(bits, | ||||
|             cursor, | ||||
|             trackdata.post_index_gap_us() * 1e3 / clockPeriod, | ||||
|             {true, false}); | ||||
|         lastBit = false; | ||||
|  | ||||
|         for (const auto& sector : sectors) | ||||
|             write_sector(bits, cursor, trackdata, *sector); | ||||
|  | ||||
|         if (cursor >= bits.size()) | ||||
|             error("track data overrun by {} bits", cursor - bits.size()); | ||||
|         fillBitmapTo(bits, cursor, bits.size(), {true, false}); | ||||
|  | ||||
|         std::unique_ptr<Fluxmap> fluxmap(new Fluxmap); | ||||
|         fluxmap->appendBits(bits, clockPeriod); | ||||
|         return fluxmap; | ||||
|     } | ||||
|  | ||||
| private: | ||||
|     const Victor9kEncoderProto& _config; | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Encoder> createVictor9kEncoder(const EncoderProto& config) | ||||
| { | ||||
|     return std::unique_ptr<Encoder>(new Victor9kEncoder(config)); | ||||
| } | ||||
|  | ||||
| // vim: sw=4 ts=4 et | ||||
| @@ -1,22 +1,26 @@ | ||||
| #ifndef VICTOR9K_H | ||||
| #define VICTOR9K_H | ||||
|  | ||||
| #define VICTOR9K_SECTOR_RECORD 0xfffffeab | ||||
| #define VICTOR9K_DATA_RECORD   0xfffffea4 | ||||
| class Encoder; | ||||
| class Decoder; | ||||
| class EncoderProto; | ||||
| class DecoderProto; | ||||
|  | ||||
| /* ... 1101 0101 0111 | ||||
|  *       ^^ ^^^^ ^^^^ ten bit IO byte */ | ||||
| #define VICTOR9K_SECTOR_RECORD 0xfffffd57 | ||||
| #define VICTOR9K_HEADER_ID 0x7 | ||||
|  | ||||
| /* ... 1101 0100 1001 | ||||
|  *       ^^ ^^^^ ^^^^ ten bit IO byte */ | ||||
| #define VICTOR9K_DATA_RECORD 0xfffffd49 | ||||
| #define VICTOR9K_DATA_ID 0x8 | ||||
|  | ||||
| #define VICTOR9K_SECTOR_LENGTH 512 | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
|  | ||||
| class Victor9kDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~Victor9kDecoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
|     void decodeDataRecord(); | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createVictor9kDecoder( | ||||
|     const DecoderProto& config); | ||||
| extern std::unique_ptr<Encoder> createVictor9kEncoder( | ||||
|     const EncoderProto& config); | ||||
|  | ||||
| #endif | ||||
|   | ||||
							
								
								
									
										36
									
								
								arch/victor9k/victor9k.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										36
									
								
								arch/victor9k/victor9k.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,36 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| import "lib/common.proto"; | ||||
|  | ||||
| message Victor9kDecoderProto {} | ||||
|  | ||||
| // NEXT: 12 | ||||
| message Victor9kEncoderProto | ||||
| { | ||||
|     message TrackdataProto | ||||
|     { | ||||
|         optional int32 min_track = 1 | ||||
|             [ (help) = "minimum track this format applies to" ]; | ||||
|         optional int32 max_track = 2 | ||||
|             [ (help) = "maximum track this format applies to" ]; | ||||
|         optional int32 head = 3 | ||||
|             [ (help) = "which head this format applies to" ]; | ||||
|  | ||||
|         optional double rotational_period_ms = 4 | ||||
|             [ (help) = "original rotational period of this track" ]; | ||||
|         optional double clock_period_us = 5 | ||||
|             [ (help) = "original data rate of this track" ]; | ||||
|         optional double post_index_gap_us = 6 | ||||
|             [ (help) = "size of post-index gap" ]; | ||||
|         optional int32 pre_header_sync_bits = 10 | ||||
|             [ (help) = "number of sync bits before the sector header" ]; | ||||
|         optional int32 pre_data_sync_bits = 8 | ||||
|             [ (help) = "number of sync bits before the sector data" ]; | ||||
|         optional int32 post_data_gap_bits = 9 | ||||
|             [ (help) = "size of gap between data and the next header" ]; | ||||
|         optional int32 post_header_gap_bits = 11 | ||||
|             [ (help) = "size of gap between header and the data" ]; | ||||
|     } | ||||
|  | ||||
|     repeated TrackdataProto trackdata = 1; | ||||
| } | ||||
| @@ -2,7 +2,6 @@ | ||||
| #include "fluxmap.h" | ||||
| #include "decoders/fluxmapreader.h" | ||||
| #include "protocol.h" | ||||
| #include "record.h" | ||||
| #include "decoders/decoders.h" | ||||
| #include "sector.h" | ||||
| #include "zilogmcz.h" | ||||
| @@ -14,35 +13,43 @@ | ||||
|  | ||||
| static const FluxPattern SECTOR_START_PATTERN(16, 0xaaab); | ||||
|  | ||||
| AbstractDecoder::RecordType ZilogMczDecoder::advanceToNextRecord() | ||||
| class ZilogMczDecoder : public Decoder | ||||
| { | ||||
| 	const FluxMatcher* matcher = nullptr; | ||||
|     _fmr->seekToIndexMark(); | ||||
| 	_sector->clock = _fmr->seekToPattern(SECTOR_START_PATTERN, matcher); | ||||
| 	if (matcher == &SECTOR_START_PATTERN) | ||||
| 		return SECTOR_RECORD; | ||||
| 	return UNKNOWN_RECORD; | ||||
| } | ||||
| public: | ||||
|     ZilogMczDecoder(const DecoderProto& config): Decoder(config) {} | ||||
|  | ||||
| void ZilogMczDecoder::decodeSectorRecord() | ||||
|     nanoseconds_t advanceToNextRecord() override | ||||
|     { | ||||
|         seekToIndexMark(); | ||||
|         return seekToPattern(SECTOR_START_PATTERN); | ||||
|     } | ||||
|  | ||||
|     void decodeSectorRecord() override | ||||
|     { | ||||
|         readRawBits(14); | ||||
|  | ||||
|         auto rawbits = readRawBits(140 * 16); | ||||
|         auto bytes = decodeFmMfm(rawbits).slice(0, 140); | ||||
|         ByteReader br(bytes); | ||||
|  | ||||
|         _sector->logicalSector = br.read_8() & 0x1f; | ||||
|         _sector->logicalSide = 0; | ||||
|         _sector->logicalTrack = br.read_8() & 0x7f; | ||||
|         if (_sector->logicalSector > 31) | ||||
|             return; | ||||
|         if (_sector->logicalTrack > 80) | ||||
|             return; | ||||
|  | ||||
|         _sector->data = br.read(132); | ||||
|         uint16_t wantChecksum = br.read_be16(); | ||||
|         uint16_t gotChecksum = crc16(MODBUS_POLY, 0x0000, bytes.slice(0, 134)); | ||||
|  | ||||
|         _sector->status = | ||||
|             (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     } | ||||
| }; | ||||
|  | ||||
| std::unique_ptr<Decoder> createZilogMczDecoder(const DecoderProto& config) | ||||
| { | ||||
|     readRawBits(14); | ||||
|  | ||||
|     auto rawbits = readRawBits(140*16); | ||||
|     auto bytes = decodeFmMfm(rawbits).slice(0, 140); | ||||
|     ByteReader br(bytes); | ||||
|  | ||||
|     _sector->logicalSector = br.read_8() & 0x1f; | ||||
|     _sector->logicalSide = 0; | ||||
|     _sector->logicalTrack = br.read_8() & 0x7f; | ||||
|     if (_sector->logicalSector > 31) | ||||
|         return; | ||||
|     if (_sector->logicalTrack > 80) | ||||
|         return; | ||||
|  | ||||
|     _sector->data = br.read(132); | ||||
|     uint16_t wantChecksum = br.read_be16(); | ||||
|     uint16_t gotChecksum = crc16(MODBUS_POLY, 0x0000, bytes.slice(0, 134)); | ||||
|  | ||||
|     _sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM; | ||||
|     return std::unique_ptr<Decoder>(new ZilogMczDecoder(config)); | ||||
| } | ||||
|   | ||||
| @@ -1,18 +1,7 @@ | ||||
| #ifndef ZILOGMCZ_H | ||||
| #define ZILOGMCZ_H | ||||
|  | ||||
| class Sector; | ||||
| class Fluxmap; | ||||
|  | ||||
| class ZilogMczDecoder : public AbstractDecoder | ||||
| { | ||||
| public: | ||||
|     virtual ~ZilogMczDecoder() {} | ||||
|  | ||||
|     RecordType advanceToNextRecord(); | ||||
|     void decodeSectorRecord(); | ||||
| }; | ||||
| extern std::unique_ptr<Decoder> createZilogMczDecoder( | ||||
|     const DecoderProto& config); | ||||
|  | ||||
| #endif | ||||
|  | ||||
|  | ||||
|   | ||||
							
								
								
									
										4
									
								
								arch/zilogmcz/zilogmcz.proto
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										4
									
								
								arch/zilogmcz/zilogmcz.proto
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,4 @@ | ||||
| syntax = "proto2"; | ||||
|  | ||||
| message ZilogMczDecoderProto {} | ||||
|  | ||||
							
								
								
									
										194
									
								
								build.lua
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										194
									
								
								build.lua
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,194 @@ | ||||
| vars.cflags = { "$(CFLAGS)" } | ||||
| vars.cxxflags = { "$(CXXFLAGS)" } | ||||
| vars.ldflags = { "-pthread" } | ||||
|  | ||||
| include "build/protobuf.lua" | ||||
| include "build/dependency.lua" | ||||
| include "build/tests.lua" | ||||
|  | ||||
| dependency { | ||||
| 	name = "fmt_dep", | ||||
| 	pkg_config = "fmt", | ||||
| } | ||||
|  | ||||
| dependency { | ||||
| 	name = "stb_dep", | ||||
| 	pkg_config = "stb", | ||||
| 	fallback = "dep/stb+stb" | ||||
| } | ||||
|  | ||||
| dependency { | ||||
| 	name = "protobuf_dep", | ||||
| 	pkg_config = "protobuf" | ||||
| } | ||||
|  | ||||
| dependency { | ||||
| 	name = "zlib_dep", | ||||
| 	pkg_config = "zlib" | ||||
| } | ||||
|  | ||||
| proto_cc_library { | ||||
| 	name = "config_lib", | ||||
| 	srcs = { | ||||
| 		"./lib/common.proto", | ||||
| 		"./lib/config.proto", | ||||
| 		"./lib/decoders/decoders.proto", | ||||
| 		"./lib/drive.proto", | ||||
| 		"./lib/encoders/encoders.proto", | ||||
| 		"./lib/fl2.proto", | ||||
| 		"./lib/fluxsink/fluxsink.proto", | ||||
| 		"./lib/fluxsource/fluxsource.proto", | ||||
| 		"./lib/imagereader/imagereader.proto", | ||||
| 		"./lib/imagewriter/imagewriter.proto", | ||||
| 		"./lib/mapper.proto", | ||||
| 		"./lib/usb/usb.proto", | ||||
| 		"./arch/aeslanier/aeslanier.proto", | ||||
| 		"./arch/agat/agat.proto", | ||||
| 		"./arch/amiga/amiga.proto", | ||||
| 		"./arch/apple2/apple2.proto", | ||||
| 		"./arch/brother/brother.proto", | ||||
| 		"./arch/c64/c64.proto", | ||||
| 		"./arch/f85/f85.proto", | ||||
| 		"./arch/fb100/fb100.proto", | ||||
| 		"./arch/ibm/ibm.proto", | ||||
| 		"./arch/macintosh/macintosh.proto", | ||||
| 		"./arch/micropolis/micropolis.proto", | ||||
| 		"./arch/mx/mx.proto", | ||||
| 		"./arch/northstar/northstar.proto", | ||||
| 		"./arch/rolandd20/rolandd20.proto", | ||||
| 		"./arch/tids990/tids990.proto", | ||||
| 		"./arch/victor9k/victor9k.proto", | ||||
| 		"./arch/zilogmcz/zilogmcz.proto", | ||||
| 	} | ||||
| } | ||||
|  | ||||
| clibrary { | ||||
| 	name = "protocol_lib", | ||||
| 	hdrs = { "./protocol.h" } | ||||
| } | ||||
|  | ||||
| clibrary { | ||||
| 	name = "libfluxengine", | ||||
| 	srcs = { | ||||
| 		"./arch/aeslanier/decoder.cc", | ||||
| 		"./arch/agat/agat.cc", | ||||
| 		"./arch/agat/decoder.cc", | ||||
| 		"./arch/amiga/amiga.cc", | ||||
| 		"./arch/amiga/decoder.cc", | ||||
| 		"./arch/amiga/encoder.cc", | ||||
| 		"./arch/apple2/decoder.cc", | ||||
| 		"./arch/apple2/encoder.cc", | ||||
| 		"./arch/brother/decoder.cc", | ||||
| 		"./arch/brother/encoder.cc", | ||||
| 		"./arch/c64/c64.cc", | ||||
| 		"./arch/c64/decoder.cc", | ||||
| 		"./arch/c64/encoder.cc", | ||||
| 		"./arch/f85/decoder.cc", | ||||
| 		"./arch/fb100/decoder.cc", | ||||
| 		"./arch/ibm/decoder.cc", | ||||
| 		"./arch/ibm/encoder.cc", | ||||
| 		"./arch/macintosh/decoder.cc", | ||||
| 		"./arch/macintosh/encoder.cc", | ||||
| 		"./arch/micropolis/decoder.cc", | ||||
| 		"./arch/micropolis/encoder.cc", | ||||
| 		"./arch/mx/decoder.cc", | ||||
| 		"./arch/northstar/decoder.cc", | ||||
| 		"./arch/northstar/encoder.cc", | ||||
| 		"./arch/rolandd20/rolandd20.cc", | ||||
| 		"./arch/tids990/decoder.cc", | ||||
| 		"./arch/tids990/encoder.cc", | ||||
| 		"./arch/victor9k/decoder.cc", | ||||
| 		"./arch/victor9k/encoder.cc", | ||||
| 		"./arch/zilogmcz/decoder.cc", | ||||
| 		"./lib/bitmap.cc", | ||||
| 		"./lib/bytes.cc", | ||||
| 		"./lib/crc.cc", | ||||
| 		"./lib/csvreader.cc", | ||||
| 		"./lib/decoders/decoders.cc", | ||||
| 		"./lib/decoders/fluxdecoder.cc", | ||||
| 		"./lib/decoders/fluxmapreader.cc", | ||||
| 		"./lib/decoders/fmmfm.cc", | ||||
| 		"./lib/encoders/encoders.cc", | ||||
| 		"./lib/flags.cc", | ||||
| 		"./lib/fluxmap.cc", | ||||
| 		"./lib/fluxsink/aufluxsink.cc", | ||||
| 		"./lib/fluxsink/fl2fluxsink.cc", | ||||
| 		"./lib/fluxsink/fluxsink.cc", | ||||
| 		"./lib/fluxsink/hardwarefluxsink.cc", | ||||
| 		"./lib/fluxsink/scpfluxsink.cc", | ||||
| 		"./lib/fluxsink/vcdfluxsink.cc", | ||||
| 		"./lib/fluxsource/cwffluxsource.cc", | ||||
| 		"./lib/fluxsource/erasefluxsource.cc", | ||||
| 		"./lib/fluxsource/fl2fluxsource.cc", | ||||
| 		"./lib/fluxsource/fluxsource.cc", | ||||
| 		"./lib/fluxsource/hardwarefluxsource.cc", | ||||
| 		"./lib/fluxsource/kryoflux.cc", | ||||
| 		"./lib/fluxsource/kryofluxfluxsource.cc", | ||||
| 		"./lib/fluxsource/scpfluxsource.cc", | ||||
| 		"./lib/fluxsource/testpatternfluxsource.cc", | ||||
| 		"./lib/globals.cc", | ||||
| 		"./lib/hexdump.cc", | ||||
| 		"./lib/image.cc", | ||||
| 		"./lib/imagereader/d64imagereader.cc", | ||||
| 		"./lib/imagereader/d88imagereader.cc", | ||||
| 		"./lib/imagereader/dimimagereader.cc", | ||||
| 		"./lib/imagereader/diskcopyimagereader.cc", | ||||
| 		"./lib/imagereader/fdiimagereader.cc", | ||||
| 		"./lib/imagereader/imagereader.cc", | ||||
| 		"./lib/imagereader/imdimagereader.cc", | ||||
| 		"./lib/imagereader/imgimagereader.cc", | ||||
| 		"./lib/imagereader/jv3imagereader.cc", | ||||
| 		"./lib/imagereader/nfdimagereader.cc", | ||||
| 		"./lib/imagereader/nsiimagereader.cc", | ||||
| 		"./lib/imagereader/td0imagereader.cc", | ||||
| 		"./lib/imagewriter/d64imagewriter.cc", | ||||
| 		"./lib/imagewriter/d88imagewriter.cc", | ||||
| 		"./lib/imagewriter/diskcopyimagewriter.cc", | ||||
| 		"./lib/imagewriter/imagewriter.cc", | ||||
| 		"./lib/imagewriter/imgimagewriter.cc", | ||||
| 		"./lib/imagewriter/ldbsimagewriter.cc", | ||||
| 		"./lib/imagewriter/nsiimagewriter.cc", | ||||
| 		"./lib/imagewriter/rawimagewriter.cc", | ||||
| 		"./lib/imginputoutpututils.cc", | ||||
| 		"./lib/ldbs.cc", | ||||
| 		"./lib/logger.cc", | ||||
| 		"./lib/mapper.cc", | ||||
| 		"./lib/proto.cc", | ||||
| 		"./lib/readerwriter.cc", | ||||
| 		"./lib/sector.cc", | ||||
| 		"./lib/usb/fluxengineusb.cc", | ||||
| 		"./lib/usb/greaseweazle.cc", | ||||
| 		"./lib/usb/greaseweazleusb.cc", | ||||
| 		"./lib/usb/serial.cc", | ||||
| 		"./lib/usb/usb.cc", | ||||
| 		"./lib/usb/usbfinder.cc", | ||||
| 		"./lib/utils.cc", | ||||
| 		"protocol.h", | ||||
| 	}, | ||||
| 	deps = { | ||||
| 		"+config_lib", | ||||
| 		"+protocol_lib", | ||||
| 		"+fmt_dep", | ||||
| 		"+protobuf_dep", | ||||
| 		"+zlib_dep", | ||||
| 		"dep/libusbp+libusbp", | ||||
| 	}, | ||||
| 	dep_cflags = { "-Ilib", "-Iarch", "-I." }, | ||||
| 	vars = { | ||||
| 		["+cflags"] = { "-Ilib", "-Iarch", "-I." } | ||||
| 	} | ||||
| } | ||||
|  | ||||
| installable { | ||||
| 	name = "all", | ||||
| 	map = { | ||||
| 		["fluxengine"] = "src+fluxengine", | ||||
| 		["fluxengine-gui"] = "src/gui+fluxengine", | ||||
| 		["brother120tool"] = "tools+brother120tool", | ||||
| 		["brother240tool"] = "tools+brother240tool", | ||||
| 		["upgrade-flux-file"] = "tools+upgrade-flux-file", | ||||
| 	} | ||||
| } | ||||
|  | ||||
| include "tests/build.lua" | ||||
|  | ||||
							
								
								
									
										251
									
								
								build/build.lua
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										251
									
								
								build/build.lua
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,251 @@ | ||||
| local OBJDIR = "$(OBJDIR)" | ||||
|  | ||||
| local function objdir(e) | ||||
| 	return concatpath(OBJDIR, e.cwd, e.name) | ||||
| end | ||||
|  | ||||
| definerule("normalrule", | ||||
| 	{ | ||||
| 		ins = { type="targets" }, | ||||
| 		deps = { type="targets", default={} }, | ||||
| 		outs = { type="targets", default={} }, | ||||
| 		outleaves = { type="strings" }, | ||||
| 		label = { type="string", optional=true }, | ||||
| 		objdir = { type="string", optional=true }, | ||||
| 		commands = { type="strings" }, | ||||
| 	}, | ||||
| 	function (e) | ||||
| 		local dir = e.objdir or objdir(e) | ||||
| 		local realouts = {} | ||||
| 		for _, v in pairs(e.outleaves) do | ||||
| 			realouts[#realouts+1] = concatpath(dir, v) | ||||
| 		end | ||||
|  | ||||
| 		local vars = inherit(e.vars, { | ||||
| 			dir = dir | ||||
| 		}) | ||||
|  | ||||
| 		local result = simplerule { | ||||
| 			name = e.name, | ||||
| 			ins = e.ins, | ||||
| 			deps = e.deps, | ||||
| 			outs = concat(realouts, filenamesof(e.outs)), | ||||
| 			label = e.label, | ||||
| 			commands = e.commands, | ||||
| 			vars = vars, | ||||
| 		} | ||||
| 		result.dir = dir | ||||
| 		return result | ||||
| 	end | ||||
| ) | ||||
|  | ||||
| local function is_clike(f) | ||||
| 	return f:find("%.c$") or f:find("%.cc$") or f:find("%.cpp$") | ||||
| end | ||||
|  | ||||
| definerule("cfile", | ||||
| 	{ | ||||
| 		srcs = { type="targets" }, | ||||
| 		deps = { type="targets", default={} } | ||||
| 	}, | ||||
| 	function (e) | ||||
| 		local cflags = e.vars.cflags | ||||
| 		local cxxflags = e.vars.cxxflags | ||||
| 		for _, target in ipairs(targetsof(e.deps)) do | ||||
| 			if target.is.clibrary then | ||||
| 				cflags = concat(cflags, target.dep_cflags) | ||||
| 				cxxflags = concat(cxxflags, target.dep_cxxflags) | ||||
| 			end | ||||
| 		end | ||||
|  | ||||
| 		local src = filter(filenamesof(e.srcs), is_clike) | ||||
| 		local cmd | ||||
| 		local cxx = false | ||||
| 		if src[1]:find("%.c$") then | ||||
| 			cmd = "$(CC) -c -o %{outs[1]} %{ins[1]} %{hdrpaths} %{cflags}" | ||||
| 		else | ||||
| 			cmd = "$(CXX) -c -o %{outs[1]} %{ins[1]} %{hdrpaths} %{cflags} %{cxxflags}" | ||||
| 			cxx = true | ||||
| 		end | ||||
|  | ||||
| 		local outleaf = basename(e.name)..".o" | ||||
| 		local rule = normalrule { | ||||
| 			name = e.name, | ||||
| 			cwd = e.cwd, | ||||
| 			ins = e.srcs, | ||||
| 			deps = e.deps, | ||||
| 			outleaves = {outleaf}, | ||||
| 			label = e.label, | ||||
| 			commands = cmd, | ||||
| 			vars = { | ||||
| 				hdrpaths = {}, | ||||
| 				cflags = cflags, | ||||
| 				cxxflags = cxxflags, | ||||
| 			} | ||||
| 		} | ||||
|  | ||||
| 		rule.is.cxxfile = cxx | ||||
| 		return rule | ||||
| 	end | ||||
| ) | ||||
|  | ||||
| local function do_cfiles(e) | ||||
| 	local outs = {} | ||||
| 	local srcs = filenamesof(e.srcs) | ||||
| 	for _, f in ipairs(sorted(filter(srcs, is_clike))) do | ||||
| 		local ofile | ||||
| 		if f:find(OBJDIR, 1, true) == 1 then | ||||
| 			ofile = e.name.."/"..f:sub(#OBJDIR+1)..".o" | ||||
| 		else | ||||
| 			ofile = e.name.."/"..f..".o" | ||||
| 		end | ||||
| 		outs[#outs+1] = cfile { | ||||
| 			name = ofile, | ||||
| 			srcs = { f }, | ||||
| 			deps = e.deps | ||||
| 		} | ||||
| 	end | ||||
| 	return outs | ||||
| end | ||||
|  | ||||
| definerule("clibrary", | ||||
| 	{ | ||||
| 		srcs = { type="targets", default={} }, | ||||
| 		deps = { type="targets", default={} }, | ||||
| 		hdrs = { type="targets", default={} }, | ||||
| 		dep_cflags = { type="strings", default={} }, | ||||
| 		dep_cxxflags = { type="strings", default={} }, | ||||
| 		dep_ldflags = { type="strings", default={} }, | ||||
| 		dep_libs = { type="strings", default={} }, | ||||
| 	}, | ||||
| 	function (e) | ||||
| 		local ins = do_cfiles(e) | ||||
| 		local cxx = false | ||||
| 		for _, f in ipairs(ins) do | ||||
| 			if f.is.cxxfile then | ||||
| 				cxx = true | ||||
| 				break | ||||
| 			end | ||||
| 		end | ||||
|  | ||||
| 		local mkdirs = {} | ||||
| 		local copies = {} | ||||
| 		local outs = {} | ||||
| 		local function copy_file(src, dest) | ||||
| 			mkdirs[#mkdirs+1] = "mkdir -p %{dir}/"..dirname(dest) | ||||
| 			copies[#copies+1] = "cp "..src.." %{dir}/"..dest | ||||
| 			outs[#outs+1] = objdir(e).."/"..dest | ||||
| 		end | ||||
|  | ||||
| 		local deps = {} | ||||
| 		for k, v in pairs(e.hdrs) do | ||||
| 			deps[#deps+1] = v | ||||
| 			if type(k) == "number" then | ||||
| 				v = filenamesof(v) | ||||
| 				for _, v in ipairs(v) do | ||||
| 					if not startswith(e.cwd, v) then | ||||
| 						error(string.format("filename '%s' is not local to '%s' --- ".. | ||||
| 							"you'll have to specify the output filename manually", v, e.cwd)) | ||||
| 					end | ||||
| 					copy_file(v, v:gsub("^"..e.cwd, "")) | ||||
| 				end | ||||
| 			else | ||||
| 				v = filenamesof(v) | ||||
| 				if #v ~= 1 then | ||||
| 					error("each mapped hdrs item can only cope with a single file") | ||||
| 				end | ||||
| 				copy_file(v[1], k) | ||||
| 			end | ||||
| 		end | ||||
|  | ||||
| 		ins = sorted(filenamesof(ins)) | ||||
| 		local has_ar = (#ins ~= 0) | ||||
| 		local lib = normalrule { | ||||
| 			name = e.name, | ||||
| 			cwd = e.cwd, | ||||
| 			ins = sorted(filenamesof(ins)), | ||||
| 			deps = deps, | ||||
| 			outs = outs, | ||||
| 			outleaves = { e.name..".a" }, | ||||
| 			label = e.label, | ||||
| 			commands = { | ||||
| 				sorted(mkdirs), | ||||
| 				sorted(copies), | ||||
| 				has_ar and "rm -f %{outs[1]} && $(AR) cqs %{outs[1]} %{ins}" or {}, | ||||
| 			} | ||||
| 		} | ||||
| 		 | ||||
| 		lib.dep_cflags = concat(e.dep_cflags, "-I"..lib.dir) | ||||
| 		lib.dep_cxxflags = e.dep_cxxflags | ||||
| 		lib.dep_ldflags = e.dep_ldflags | ||||
| 		lib.dep_libs = concat(e.dep_libs, has_ar and matching(filenamesof(lib), "%.a$") or {}) | ||||
| 		lib.dep_cxx = cxx | ||||
|  | ||||
| 		for _, d in pairs(targetsof(e.deps)) do | ||||
| 			lib.dep_cflags = concat(lib.dep_cflags, d.dep_cflags) | ||||
| 			lib.dep_cxxflags = concat(lib.dep_cxxflags, d.dep_cxxflags) | ||||
| 			lib.dep_ldflags = concat(lib.dep_ldflags, d.dep_ldflags) | ||||
| 			lib.dep_libs = concat(lib.dep_libs, d.dep_libs) | ||||
| 			lib.dep_cxx = lib.dep_cxx or d.dep_cxx | ||||
| 		end | ||||
|  | ||||
| 		return lib | ||||
| 	end | ||||
| ) | ||||
|  | ||||
| definerule("cprogram", | ||||
| 	{ | ||||
| 		srcs = { type="targets", default={} }, | ||||
| 		deps = { type="targets", default={} }, | ||||
| 	}, | ||||
| 	function (e) | ||||
| 		local deps = e.deps | ||||
| 		local ins = {} | ||||
| 		local cxx = false | ||||
|  | ||||
| 		if (#e.srcs > 0) then | ||||
| 			local objs = do_cfiles(e) | ||||
| 			for _, obj in pairs(objs) do | ||||
| 				if obj.is.cxxfile then | ||||
| 					cxx = true | ||||
| 				end | ||||
| 				ins[#ins+1] = obj | ||||
| 			end | ||||
| 		end | ||||
|  | ||||
| 		local libs = {} | ||||
| 		local cflags = {} | ||||
| 		local cxxflags = {} | ||||
| 		local ldflags = {} | ||||
| 		for _, lib in pairs(e.deps) do | ||||
| 			cflags = concat(cflags, lib.dep_cflags) | ||||
| 			cxxflags = concat(cxxflags, lib.dep_cxxflags) | ||||
| 			ldflags = concat(ldflags, lib.dep_ldflags) | ||||
| 			libs = concat(libs, lib.dep_libs) | ||||
| 			cxx = cxx or lib.dep_cxx | ||||
| 		end | ||||
|  | ||||
| 		local command | ||||
| 		if cxx then | ||||
| 			command = "$(CXX) $(LDFLAGS) %{ldflags} -o %{outs[1]} %{ins} %{libs} %{libs}" | ||||
| 		else | ||||
| 			command = "$(CC) $(LDFLAGS) %{ldflags} -o %{outs[1]} %{ins} %{libs} %{libs}" | ||||
| 		end | ||||
|  | ||||
| 		return normalrule { | ||||
| 			name = e.name, | ||||
| 			cwd = e.cwd, | ||||
| 			deps = deps, | ||||
| 			ins = ins, | ||||
| 			outleaves = { e.name }, | ||||
| 			commands = { command }, | ||||
| 			vars = { | ||||
| 				cflags = cflags, | ||||
| 				cxxflags = cxxflags, | ||||
| 				ldflags = ldflags, | ||||
| 				libs = libs, | ||||
| 			} | ||||
| 		} | ||||
| 	end | ||||
| ) | ||||
|  | ||||
							
								
								
									
										18
									
								
								build/tests.lua
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										18
									
								
								build/tests.lua
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,18 @@ | ||||
| definerule("test", | ||||
| 	{ | ||||
| 		srcs = { type="targets", default={} }, | ||||
| 	}, | ||||
| 	function (e) | ||||
| 		if vars.TESTS == "yes" then | ||||
| 			normalrule { | ||||
| 				name = e.name, | ||||
| 				ins = e.srcs, | ||||
| 				outleaves = { "log.txt" }, | ||||
| 				commands = { | ||||
| 					"%{ins} > %{outs}", | ||||
| 				} | ||||
| 			} | ||||
| 		end | ||||
| 	end | ||||
| ) | ||||
|  | ||||
							
								
								
									
										45
									
								
								dep/adflib/.gitignore
									
									
									
									
										vendored
									
									
										Normal file
									
								
							
							
						
						
									
										45
									
								
								dep/adflib/.gitignore
									
									
									
									
										vendored
									
									
										Normal file
									
								
							| @@ -0,0 +1,45 @@ | ||||
| # Object files | ||||
| *.o | ||||
| *.lo | ||||
|  | ||||
| # Libraries | ||||
| .libs | ||||
| *.lib | ||||
| *.a | ||||
| *.la | ||||
|  | ||||
| # Shared objects (inc. Windows DLLs) | ||||
| *.dll | ||||
| *.so | ||||
| *.so.* | ||||
| *.dylib | ||||
|  | ||||
| # Executables | ||||
| *.exe | ||||
| *.out | ||||
| *.app | ||||
|  | ||||
| # generated by autogen.sh | ||||
| INSTALL | ||||
| Makefile.in | ||||
| aclocal.m4 | ||||
| autom4te.cache | ||||
| compile | ||||
| config.guess | ||||
| config.h.in | ||||
| config.sub | ||||
| configure | ||||
| depcomp | ||||
| install-sh | ||||
| ltmain.sh | ||||
| missing | ||||
|  | ||||
| # generated by configure | ||||
| .deps | ||||
| Makefile | ||||
| adflib.pc | ||||
| config.h | ||||
| config.log | ||||
| config.status | ||||
| libtool | ||||
| stamp-h1 | ||||
							
								
								
									
										13
									
								
								dep/adflib/AUTHORS
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										13
									
								
								dep/adflib/AUTHORS
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,13 @@ | ||||
|  | ||||
| The main developper is  | ||||
|  Laurent Clévy (laurent.clevy@club-internet.fr) | ||||
|  | ||||
| Contributors are: | ||||
|  Bjarne Viksoe  | ||||
|    (C++ wrapper, lot of bug fixes) | ||||
|  Gary Harris  | ||||
|    (bug fixes and W32 support) | ||||
|  Dan Sutherland  | ||||
|    (bug fixes and W32 support) | ||||
|  | ||||
| See CHANGES.txt for detailed contributions. | ||||
							
								
								
									
										339
									
								
								dep/adflib/COPYING
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										339
									
								
								dep/adflib/COPYING
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,339 @@ | ||||
| 		    GNU GENERAL PUBLIC LICENSE | ||||
| 		       Version 2, June 1991 | ||||
|  | ||||
|  Copyright (C) 1989, 1991 Free Software Foundation, Inc., | ||||
|  51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA | ||||
|  Everyone is permitted to copy and distribute verbatim copies | ||||
|  of this license document, but changing it is not allowed. | ||||
|  | ||||
| 			    Preamble | ||||
|  | ||||
|   The licenses for most software are designed to take away your | ||||
| freedom to share and change it.  By contrast, the GNU General Public | ||||
| License is intended to guarantee your freedom to share and change free | ||||
| software--to make sure the software is free for all its users.  This | ||||
| General Public License applies to most of the Free Software | ||||
| Foundation's software and to any other program whose authors commit to | ||||
| using it.  (Some other Free Software Foundation software is covered by | ||||
| the GNU Lesser General Public License instead.)  You can apply it to | ||||
| your programs, too. | ||||
|  | ||||
|   When we speak of free software, we are referring to freedom, not | ||||
| price.  Our General Public Licenses are designed to make sure that you | ||||
| have the freedom to distribute copies of free software (and charge for | ||||
| this service if you wish), that you receive source code or can get it | ||||
| if you want it, that you can change the software or use pieces of it | ||||
| in new free programs; and that you know you can do these things. | ||||
|  | ||||
|   To protect your rights, we need to make restrictions that forbid | ||||
| anyone to deny you these rights or to ask you to surrender the rights. | ||||
| These restrictions translate to certain responsibilities for you if you | ||||
| distribute copies of the software, or if you modify it. | ||||
|  | ||||
|   For example, if you distribute copies of such a program, whether | ||||
| gratis or for a fee, you must give the recipients all the rights that | ||||
| you have.  You must make sure that they, too, receive or can get the | ||||
| source code.  And you must show them these terms so they know their | ||||
| rights. | ||||
|  | ||||
|   We protect your rights with two steps: (1) copyright the software, and | ||||
| (2) offer you this license which gives you legal permission to copy, | ||||
| distribute and/or modify the software. | ||||
|  | ||||
|   Also, for each author's protection and ours, we want to make certain | ||||
| that everyone understands that there is no warranty for this free | ||||
| software.  If the software is modified by someone else and passed on, we | ||||
| want its recipients to know that what they have is not the original, so | ||||
| that any problems introduced by others will not reflect on the original | ||||
| authors' reputations. | ||||
|  | ||||
|   Finally, any free program is threatened constantly by software | ||||
| patents.  We wish to avoid the danger that redistributors of a free | ||||
| program will individually obtain patent licenses, in effect making the | ||||
| program proprietary.  To prevent this, we have made it clear that any | ||||
| patent must be licensed for everyone's free use or not licensed at all. | ||||
|  | ||||
|   The precise terms and conditions for copying, distribution and | ||||
| modification follow. | ||||
|  | ||||
| 		    GNU GENERAL PUBLIC LICENSE | ||||
|    TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION | ||||
|  | ||||
|   0. This License applies to any program or other work which contains | ||||
| a notice placed by the copyright holder saying it may be distributed | ||||
| under the terms of this General Public License.  The "Program", below, | ||||
| refers to any such program or work, and a "work based on the Program" | ||||
| means either the Program or any derivative work under copyright law: | ||||
| that is to say, a work containing the Program or a portion of it, | ||||
| either verbatim or with modifications and/or translated into another | ||||
| language.  (Hereinafter, translation is included without limitation in | ||||
| the term "modification".)  Each licensee is addressed as "you". | ||||
|  | ||||
| Activities other than copying, distribution and modification are not | ||||
| covered by this License; they are outside its scope.  The act of | ||||
| running the Program is not restricted, and the output from the Program | ||||
| is covered only if its contents constitute a work based on the | ||||
| Program (independent of having been made by running the Program). | ||||
| Whether that is true depends on what the Program does. | ||||
|  | ||||
|   1. You may copy and distribute verbatim copies of the Program's | ||||
| source code as you receive it, in any medium, provided that you | ||||
| conspicuously and appropriately publish on each copy an appropriate | ||||
| copyright notice and disclaimer of warranty; keep intact all the | ||||
| notices that refer to this License and to the absence of any warranty; | ||||
| and give any other recipients of the Program a copy of this License | ||||
| along with the Program. | ||||
|  | ||||
| You may charge a fee for the physical act of transferring a copy, and | ||||
| you may at your option offer warranty protection in exchange for a fee. | ||||
|  | ||||
|   2. You may modify your copy or copies of the Program or any portion | ||||
| of it, thus forming a work based on the Program, and copy and | ||||
| distribute such modifications or work under the terms of Section 1 | ||||
| above, provided that you also meet all of these conditions: | ||||
|  | ||||
|     a) You must cause the modified files to carry prominent notices | ||||
|     stating that you changed the files and the date of any change. | ||||
|  | ||||
|     b) You must cause any work that you distribute or publish, that in | ||||
|     whole or in part contains or is derived from the Program or any | ||||
|     part thereof, to be licensed as a whole at no charge to all third | ||||
|     parties under the terms of this License. | ||||
|  | ||||
|     c) If the modified program normally reads commands interactively | ||||
|     when run, you must cause it, when started running for such | ||||
|     interactive use in the most ordinary way, to print or display an | ||||
|     announcement including an appropriate copyright notice and a | ||||
|     notice that there is no warranty (or else, saying that you provide | ||||
|     a warranty) and that users may redistribute the program under | ||||
|     these conditions, and telling the user how to view a copy of this | ||||
|     License.  (Exception: if the Program itself is interactive but | ||||
|     does not normally print such an announcement, your work based on | ||||
|     the Program is not required to print an announcement.) | ||||
|  | ||||
| These requirements apply to the modified work as a whole.  If | ||||
| identifiable sections of that work are not derived from the Program, | ||||
| and can be reasonably considered independent and separate works in | ||||
| themselves, then this License, and its terms, do not apply to those | ||||
| sections when you distribute them as separate works.  But when you | ||||
| distribute the same sections as part of a whole which is a work based | ||||
| on the Program, the distribution of the whole must be on the terms of | ||||
| this License, whose permissions for other licensees extend to the | ||||
| entire whole, and thus to each and every part regardless of who wrote it. | ||||
|  | ||||
| Thus, it is not the intent of this section to claim rights or contest | ||||
| your rights to work written entirely by you; rather, the intent is to | ||||
| exercise the right to control the distribution of derivative or | ||||
| collective works based on the Program. | ||||
|  | ||||
| In addition, mere aggregation of another work not based on the Program | ||||
| with the Program (or with a work based on the Program) on a volume of | ||||
| a storage or distribution medium does not bring the other work under | ||||
| the scope of this License. | ||||
|  | ||||
|   3. You may copy and distribute the Program (or a work based on it, | ||||
| under Section 2) in object code or executable form under the terms of | ||||
| Sections 1 and 2 above provided that you also do one of the following: | ||||
|  | ||||
|     a) Accompany it with the complete corresponding machine-readable | ||||
|     source code, which must be distributed under the terms of Sections | ||||
|     1 and 2 above on a medium customarily used for software interchange; or, | ||||
|  | ||||
|     b) Accompany it with a written offer, valid for at least three | ||||
|     years, to give any third party, for a charge no more than your | ||||
|     cost of physically performing source distribution, a complete | ||||
|     machine-readable copy of the corresponding source code, to be | ||||
|     distributed under the terms of Sections 1 and 2 above on a medium | ||||
|     customarily used for software interchange; or, | ||||
|  | ||||
|     c) Accompany it with the information you received as to the offer | ||||
|     to distribute corresponding source code.  (This alternative is | ||||
|     allowed only for noncommercial distribution and only if you | ||||
|     received the program in object code or executable form with such | ||||
|     an offer, in accord with Subsection b above.) | ||||
|  | ||||
| The source code for a work means the preferred form of the work for | ||||
| making modifications to it.  For an executable work, complete source | ||||
| code means all the source code for all modules it contains, plus any | ||||
| associated interface definition files, plus the scripts used to | ||||
| control compilation and installation of the executable.  However, as a | ||||
| special exception, the source code distributed need not include | ||||
| anything that is normally distributed (in either source or binary | ||||
| form) with the major components (compiler, kernel, and so on) of the | ||||
| operating system on which the executable runs, unless that component | ||||
| itself accompanies the executable. | ||||
|  | ||||
| If distribution of executable or object code is made by offering | ||||
| access to copy from a designated place, then offering equivalent | ||||
| access to copy the source code from the same place counts as | ||||
| distribution of the source code, even though third parties are not | ||||
| compelled to copy the source along with the object code. | ||||
|  | ||||
|   4. You may not copy, modify, sublicense, or distribute the Program | ||||
| except as expressly provided under this License.  Any attempt | ||||
| otherwise to copy, modify, sublicense or distribute the Program is | ||||
| void, and will automatically terminate your rights under this License. | ||||
| However, parties who have received copies, or rights, from you under | ||||
| this License will not have their licenses terminated so long as such | ||||
| parties remain in full compliance. | ||||
|  | ||||
|   5. You are not required to accept this License, since you have not | ||||
| signed it.  However, nothing else grants you permission to modify or | ||||
| distribute the Program or its derivative works.  These actions are | ||||
| prohibited by law if you do not accept this License.  Therefore, by | ||||
| modifying or distributing the Program (or any work based on the | ||||
| Program), you indicate your acceptance of this License to do so, and | ||||
| all its terms and conditions for copying, distributing or modifying | ||||
| the Program or works based on it. | ||||
|  | ||||
|   6. Each time you redistribute the Program (or any work based on the | ||||
| Program), the recipient automatically receives a license from the | ||||
| original licensor to copy, distribute or modify the Program subject to | ||||
| these terms and conditions.  You may not impose any further | ||||
| restrictions on the recipients' exercise of the rights granted herein. | ||||
| You are not responsible for enforcing compliance by third parties to | ||||
| this License. | ||||
|  | ||||
|   7. If, as a consequence of a court judgment or allegation of patent | ||||
| infringement or for any other reason (not limited to patent issues), | ||||
| conditions are imposed on you (whether by court order, agreement or | ||||
| otherwise) that contradict the conditions of this License, they do not | ||||
| excuse you from the conditions of this License.  If you cannot | ||||
| distribute so as to satisfy simultaneously your obligations under this | ||||
| License and any other pertinent obligations, then as a consequence you | ||||
| may not distribute the Program at all.  For example, if a patent | ||||
| license would not permit royalty-free redistribution of the Program by | ||||
| all those who receive copies directly or indirectly through you, then | ||||
| the only way you could satisfy both it and this License would be to | ||||
| refrain entirely from distribution of the Program. | ||||
|  | ||||
| If any portion of this section is held invalid or unenforceable under | ||||
| any particular circumstance, the balance of the section is intended to | ||||
| apply and the section as a whole is intended to apply in other | ||||
| circumstances. | ||||
|  | ||||
| It is not the purpose of this section to induce you to infringe any | ||||
| patents or other property right claims or to contest validity of any | ||||
| such claims; this section has the sole purpose of protecting the | ||||
| integrity of the free software distribution system, which is | ||||
| implemented by public license practices.  Many people have made | ||||
| generous contributions to the wide range of software distributed | ||||
| through that system in reliance on consistent application of that | ||||
| system; it is up to the author/donor to decide if he or she is willing | ||||
| to distribute software through any other system and a licensee cannot | ||||
| impose that choice. | ||||
|  | ||||
| This section is intended to make thoroughly clear what is believed to | ||||
| be a consequence of the rest of this License. | ||||
|  | ||||
|   8. If the distribution and/or use of the Program is restricted in | ||||
| certain countries either by patents or by copyrighted interfaces, the | ||||
| original copyright holder who places the Program under this License | ||||
| may add an explicit geographical distribution limitation excluding | ||||
| those countries, so that distribution is permitted only in or among | ||||
| countries not thus excluded.  In such case, this License incorporates | ||||
| the limitation as if written in the body of this License. | ||||
|  | ||||
|   9. The Free Software Foundation may publish revised and/or new versions | ||||
| of the General Public License from time to time.  Such new versions will | ||||
| be similar in spirit to the present version, but may differ in detail to | ||||
| address new problems or concerns. | ||||
|  | ||||
| Each version is given a distinguishing version number.  If the Program | ||||
| specifies a version number of this License which applies to it and "any | ||||
| later version", you have the option of following the terms and conditions | ||||
| either of that version or of any later version published by the Free | ||||
| Software Foundation.  If the Program does not specify a version number of | ||||
| this License, you may choose any version ever published by the Free Software | ||||
| Foundation. | ||||
|  | ||||
|   10. If you wish to incorporate parts of the Program into other free | ||||
| programs whose distribution conditions are different, write to the author | ||||
| to ask for permission.  For software which is copyrighted by the Free | ||||
| Software Foundation, write to the Free Software Foundation; we sometimes | ||||
| make exceptions for this.  Our decision will be guided by the two goals | ||||
| of preserving the free status of all derivatives of our free software and | ||||
| of promoting the sharing and reuse of software generally. | ||||
|  | ||||
| 			    NO WARRANTY | ||||
|  | ||||
|   11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY | ||||
| FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN | ||||
| OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES | ||||
| PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED | ||||
| OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF | ||||
| MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS | ||||
| TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE | ||||
| PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, | ||||
| REPAIR OR CORRECTION. | ||||
|  | ||||
|   12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING | ||||
| WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR | ||||
| REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, | ||||
| INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING | ||||
| OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED | ||||
| TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY | ||||
| YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER | ||||
| PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE | ||||
| POSSIBILITY OF SUCH DAMAGES. | ||||
|  | ||||
| 		     END OF TERMS AND CONDITIONS | ||||
|  | ||||
| 	    How to Apply These Terms to Your New Programs | ||||
|  | ||||
|   If you develop a new program, and you want it to be of the greatest | ||||
| possible use to the public, the best way to achieve this is to make it | ||||
| free software which everyone can redistribute and change under these terms. | ||||
|  | ||||
|   To do so, attach the following notices to the program.  It is safest | ||||
| to attach them to the start of each source file to most effectively | ||||
| convey the exclusion of warranty; and each file should have at least | ||||
| the "copyright" line and a pointer to where the full notice is found. | ||||
|  | ||||
|     <one line to give the program's name and a brief idea of what it does.> | ||||
|     Copyright (C) <year>  <name of author> | ||||
|  | ||||
|     This program is free software; you can redistribute it and/or modify | ||||
|     it under the terms of the GNU General Public License as published by | ||||
|     the Free Software Foundation; either version 2 of the License, or | ||||
|     (at your option) any later version. | ||||
|  | ||||
|     This program is distributed in the hope that it will be useful, | ||||
|     but WITHOUT ANY WARRANTY; without even the implied warranty of | ||||
|     MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the | ||||
|     GNU General Public License for more details. | ||||
|  | ||||
|     You should have received a copy of the GNU General Public License along | ||||
|     with this program; if not, write to the Free Software Foundation, Inc., | ||||
|     51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. | ||||
|  | ||||
| Also add information on how to contact you by electronic and paper mail. | ||||
|  | ||||
| If the program is interactive, make it output a short notice like this | ||||
| when it starts in an interactive mode: | ||||
|  | ||||
|     Gnomovision version 69, Copyright (C) year name of author | ||||
|     Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'. | ||||
|     This is free software, and you are welcome to redistribute it | ||||
|     under certain conditions; type `show c' for details. | ||||
|  | ||||
| The hypothetical commands `show w' and `show c' should show the appropriate | ||||
| parts of the General Public License.  Of course, the commands you use may | ||||
| be called something other than `show w' and `show c'; they could even be | ||||
| mouse-clicks or menu items--whatever suits your program. | ||||
|  | ||||
| You should also get your employer (if you work as a programmer) or your | ||||
| school, if any, to sign a "copyright disclaimer" for the program, if | ||||
| necessary.  Here is a sample; alter the names: | ||||
|  | ||||
|   Yoyodyne, Inc., hereby disclaims all copyright interest in the program | ||||
|   `Gnomovision' (which makes passes at compilers) written by James Hacker. | ||||
|  | ||||
|   <signature of Ty Coon>, 1 April 1989 | ||||
|   Ty Coon, President of Vice | ||||
|  | ||||
| This General Public License does not permit incorporating your program into | ||||
| proprietary programs.  If your program is a subroutine library, you may | ||||
| consider it more useful to permit linking proprietary applications with the | ||||
| library.  If this is what you want to do, use the GNU Lesser General | ||||
| Public License instead of this License. | ||||
							
								
								
									
										128
									
								
								dep/adflib/README
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										128
									
								
								dep/adflib/README
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,128 @@ | ||||
|  | ||||
|  | ||||
| The ADFlib is a free, portable and open implementation of the Amiga filesystem. | ||||
|  | ||||
| initial release in 1999 | ||||
|  | ||||
| It supports : | ||||
| - floppy dumps | ||||
| - multiple partitions harddisk dumps | ||||
| - UAE hardfiles | ||||
| - WinNT devices with the 'native driver' written by Dan Sutherland | ||||
| - mount/unmount/create a device (real one or a dump file), | ||||
| - mount/unmount/create a volume (partition), | ||||
| - create/open/close/delete/rename/undel a file, | ||||
| - read/write bytes from/to a file, | ||||
| - create/delete/rename/move/undel a directory, | ||||
| - get directory contents, change current directory, get parent directory | ||||
| - use dir cache to get directory contents. | ||||
|  | ||||
|  | ||||
| It is written in portable C, and support the WinNT platform to access | ||||
| real drives. | ||||
|  | ||||
| See also :  | ||||
| https://packages.debian.org/source/sid/unadf | ||||
| https://www.cvedetails.com/cve/CVE-2016-1243/ | ||||
| https://www.cvedetails.com/cve/CVE-2016-1244/ | ||||
|  | ||||
| --- | ||||
|  | ||||
| unADF is a unzip like for .ADF files : | ||||
|  | ||||
|  | ||||
| unadf [-lrcsp -v n] dumpname.adf [files-with-path] [-d extractdir] | ||||
|     -l : lists root directory contents | ||||
|     -r : lists directory tree contents | ||||
|     -c : use dircache data (must be used with -l) | ||||
|     -s : display entries logical block pointer (must be used with -l) | ||||
|     -m : display file comments, if exists (must be used with -l) | ||||
|  | ||||
|     -v n : mount volume #n instead of default #0 volume | ||||
|  | ||||
|     -p : send extracted files to pipe (unadf -p dump.adf Pics/pic1.gif | xv -) | ||||
|     -d dir : extract to 'dir' directory | ||||
|  | ||||
|  | ||||
|  | ||||
| Credits: | ||||
| -------- | ||||
|  | ||||
| main design and code             Laurent Clevy | ||||
| Bug fixes and C++ wrapper        Bjarke Viksoe (adfwrapper.h) | ||||
| WinNT native driver              Dan Sutherland and Gary Harris | ||||
|  | ||||
|  | ||||
| New versions and contact e-mail can be found at :  | ||||
|  | ||||
| http://lclevy.free.fr/adflib | ||||
|  | ||||
|  | ||||
|  | ||||
| COMPILATION | ||||
| ----------- | ||||
|  | ||||
| The following commands should automatically detect the system  | ||||
| configuration and build the library and examples/unadf,  | ||||
| the ADF extractor binary. | ||||
|  | ||||
| 	./autogen.sh | ||||
| 	./configure | ||||
| 	make | ||||
|  | ||||
|  | ||||
|  | ||||
| FEATURES NEEDING FURTHER TESTS | ||||
| ------------------------------ | ||||
|  | ||||
| * Native driver | ||||
|  | ||||
| The NATIV_DIR variable is used to choose the (only one) target platform | ||||
| of the native driver. The default is : | ||||
|  | ||||
| NATIV_DIR = ./Generic | ||||
|  | ||||
| This one do not give access to any real device. The other one available is | ||||
| Win32, to access real devices under WinNT. | ||||
|  | ||||
|  | ||||
| * Win32DLL | ||||
|  | ||||
| The 'prefix.h' is used to create the Win32 DLL version of the library. | ||||
| If the WIN32DLL variable is defined in the library code, public functions | ||||
| are preceded by the '__declspec(dllexport)' directive. If this same | ||||
| variable is defined, the '__declspec(dllimport)' is put before the functions | ||||
| prototypes in the 'adflib.h' library include file. | ||||
|  | ||||
|  | ||||
|  | ||||
|  | ||||
| FILES | ||||
| ----- | ||||
|  | ||||
| AUTHORS   Contributors | ||||
| README			The file you are reading | ||||
| TODO			Future improvements and bugfixes | ||||
| CHANGES			Detailed changes | ||||
| src/			main library files | ||||
| src/win32/		WinNT native driver | ||||
| src/generic/		native files templates | ||||
| boot/			Bootblocks that might by used to put on floppy disks | ||||
| doc/			The library developpers documentation  | ||||
| doc/FAQ/		The Amiga Filesystem explained | ||||
| examples/		unadf.c | ||||
|  | ||||
|  | ||||
| Possible bugs | ||||
| ------------- | ||||
|  | ||||
| - in dircache updates | ||||
| - when a volume is becoming full | ||||
| - lost memory releases | ||||
|  | ||||
|  | ||||
| Please report any bugs or mistakes in the documentation ! | ||||
|  | ||||
|  | ||||
|  | ||||
| Have fun anyway ! | ||||
							
								
								
									
										2
									
								
								dep/adflib/UPSTREAM.md
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										2
									
								
								dep/adflib/UPSTREAM.md
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,2 @@ | ||||
| This is head of git downloaded from https://github.com/lclevy/ADFlib on | ||||
| 2022-08-28. | ||||
							
								
								
									
										37
									
								
								dep/adflib/adf_nativ.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										37
									
								
								dep/adflib/adf_nativ.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,37 @@ | ||||
| #ifndef ADF_NATIV_H | ||||
| #define ADF_NATIV_H | ||||
|  | ||||
| #ifdef __cplusplus | ||||
| extern "C" { | ||||
| #endif | ||||
|  | ||||
| #include "adf_str.h" | ||||
|  | ||||
| #define NATIVE_FILE 8001 | ||||
|  | ||||
| struct nativeDevice | ||||
| { | ||||
| 	FILE* fd; | ||||
| }; | ||||
|  | ||||
| struct nativeFunctions | ||||
| { | ||||
|     /* called by adfMount() */ | ||||
|     RETCODE (*adfInitDevice)(struct Device*, char*, BOOL); | ||||
|     /* called by adfReadBlock() */ | ||||
|     RETCODE (*adfNativeReadSector)(struct Device*, int32_t, int, uint8_t*); | ||||
|     /* called by adfWriteBlock() */ | ||||
|     RETCODE (*adfNativeWriteSector)(struct Device*, int32_t, int, uint8_t*); | ||||
|     /* called by adfMount() */ | ||||
|     BOOL (*adfIsDevNative)(char*); | ||||
|     /* called by adfUnMount() */ | ||||
|     RETCODE (*adfReleaseDevice)(struct Device*); | ||||
| }; | ||||
|  | ||||
| extern void adfInitNativeFct(); | ||||
|  | ||||
| #ifdef __cplusplus | ||||
| } | ||||
| #endif | ||||
|  | ||||
| #endif | ||||
							
								
								
									
										22
									
								
								dep/adflib/build.mk
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										22
									
								
								dep/adflib/build.mk
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,22 @@ | ||||
| ADFLIB_SRCS = \ | ||||
| 	dep/adflib/src/adf_bitm.c \ | ||||
| 	dep/adflib/src/adf_cache.c \ | ||||
| 	dep/adflib/src/adf_dir.c \ | ||||
| 	dep/adflib/src/adf_disk.c \ | ||||
| 	dep/adflib/src/adf_dump.c \ | ||||
| 	dep/adflib/src/adf_env.c \ | ||||
| 	dep/adflib/src/adf_file.c \ | ||||
| 	dep/adflib/src/adf_hd.c \ | ||||
| 	dep/adflib/src/adf_link.c \ | ||||
| 	dep/adflib/src/adf_raw.c \ | ||||
| 	dep/adflib/src/adf_salv.c \ | ||||
| 	dep/adflib/src/adf_util.c \ | ||||
|  | ||||
| ADFLIB_OBJS = $(patsubst %.c, $(OBJDIR)/%.o, $(ADFLIB_SRCS)) | ||||
| $(ADFLIB_OBJS): CFLAGS += -Idep/adflib/src -Idep/adflib | ||||
| ADFLIB_LIB = $(OBJDIR)/libadflib.a | ||||
| $(ADFLIB_LIB): $(ADFLIB_OBJS) | ||||
| ADFLIB_CFLAGS = -Idep/adflib/src | ||||
| ADFLIB_LDFLAGS = | ||||
| OBJS += $(ADFLIB_OBJS) | ||||
|  | ||||
							
								
								
									
										2
									
								
								dep/adflib/config.h
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										2
									
								
								dep/adflib/config.h
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,2 @@ | ||||
| /* empty config.h to keep the source happy */ | ||||
|  | ||||
							
								
								
									
										44
									
								
								dep/adflib/src/Makefile.am
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										44
									
								
								dep/adflib/src/Makefile.am
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,44 @@ | ||||
| NATIVE_DIR = generic | ||||
|  | ||||
| lib_LTLIBRARIES = libadf.la | ||||
|  | ||||
| libadf_la_SOURCES = adf_hd.c \ | ||||
|                     adf_disk.c \ | ||||
|                     adf_raw.c \ | ||||
|                     adf_bitm.c \ | ||||
|                     adf_dump.c \ | ||||
|                     adf_util.c \ | ||||
|                     adf_env.c \ | ||||
|                     $(NATIVE_DIR)/adf_nativ.c \ | ||||
|                     adf_dir.c \ | ||||
|                     adf_file.c \ | ||||
|                     adf_cache.c \ | ||||
|                     adf_link.c \ | ||||
|                     adf_salv.c | ||||
|  | ||||
| include_HEADERS = adf_defs.h \ | ||||
|                   adf_blk.h \ | ||||
|                   adf_err.h \ | ||||
|                   adf_str.h \ | ||||
|                   adflib.h \ | ||||
|                   adf_bitm.h \ | ||||
|                   adf_cache.h \ | ||||
|                   adf_dir.h \ | ||||
|                   adf_disk.h \ | ||||
|                   adf_dump.h \ | ||||
|                   adf_env.h \ | ||||
|                   adf_file.h \ | ||||
|                   adf_hd.h \ | ||||
|                   adf_link.h \ | ||||
|                   adf_raw.h \ | ||||
|                   adf_salv.h \ | ||||
|                   adf_util.h \ | ||||
|                   defendian.h \ | ||||
|                   hd_blk.h \ | ||||
|                   prefix.h \ | ||||
|                   $(NATIVE_DIR)/adf_nativ.h | ||||
|  | ||||
| libadf_la_LDFLAGS = -version-info 0:12:0 | ||||
| AM_CPPFLAGS = -D_XOPEN_SOURCE -D_SVID_SOURCE -D_BSD_SOURCE -D_DEFAULT_SOURCE -D_GNU_SOURCE -I$(srcdir) -I$(srcdir)/$(NATIVE_DIR) | ||||
| AM_CFLAGS = -std=c99 -pedantic -Wall | ||||
|  | ||||
							
								
								
									
										561
									
								
								dep/adflib/src/adf_bitm.c
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										561
									
								
								dep/adflib/src/adf_bitm.c
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,561 @@ | ||||
| /* | ||||
|  *  ADF Library. (C) 1997-2002 Laurent Clevy | ||||
|  * | ||||
|  *  adf_bitm.c | ||||
|  * | ||||
|  *  $Id$ | ||||
|  * | ||||
|  *  bitmap code | ||||
|  * | ||||
|  *  This file is part of ADFLib. | ||||
|  * | ||||
|  *  ADFLib is free software; you can redistribute it and/or modify | ||||
|  *  it under the terms of the GNU General Public License as published by | ||||
|  *  the Free Software Foundation; either version 2 of the License, or | ||||
|  *  (at your option) any later version. | ||||
|  * | ||||
|  *  ADFLib is distributed in the hope that it will be useful, | ||||
|  *  but WITHOUT ANY WARRANTY; without even the implied warranty of | ||||
|  *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the | ||||
|  *  GNU General Public License for more details. | ||||
|  * | ||||
|  *  You should have received a copy of the GNU General Public License | ||||
|  *  along with Foobar; if not, write to the Free Software | ||||
|  *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA | ||||
|  * | ||||
|  */ | ||||
|  | ||||
| #include <stdlib.h> | ||||
| #include <string.h> | ||||
|  | ||||
| #include"adf_raw.h" | ||||
| #include"adf_bitm.h" | ||||
| #include"adf_err.h" | ||||
| #include"adf_disk.h" | ||||
| #include"adf_util.h" | ||||
| #include"defendian.h" | ||||
|  | ||||
| extern uint32_t bitMask[32]; | ||||
|  | ||||
| extern struct Env adfEnv; | ||||
|  | ||||
| /* | ||||
|  * adfUpdateBitmap | ||||
|  * | ||||
|  */ | ||||
| RETCODE adfUpdateBitmap(struct Volume *vol) | ||||
| { | ||||
| 	int i; | ||||
|     struct bRootBlock root; | ||||
|  | ||||
| /*printf("adfUpdateBitmap\n");*/ | ||||
|          | ||||
|     if (adfReadRootBlock(vol, vol->rootBlock,&root)!=RC_OK) | ||||
| 		return RC_ERROR; | ||||
|  | ||||
|     root.bmFlag = BM_INVALID; | ||||
|     if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK) | ||||
| 		return RC_ERROR; | ||||
|  | ||||
|     for(i=0; i<vol->bitmapSize; i++) | ||||
|     if (vol->bitmapBlocksChg[i]) { | ||||
|         if (adfWriteBitmapBlock(vol, vol->bitmapBlocks[i], vol->bitmapTable[i])!=RC_OK) | ||||
| 			return RC_ERROR; | ||||
|   	    vol->bitmapBlocksChg[i] = FALSE; | ||||
|     } | ||||
|  | ||||
|     root.bmFlag = BM_VALID; | ||||
|     adfTime2AmigaTime(adfGiveCurrentTime(),&(root.days),&(root.mins),&(root.ticks)); | ||||
|     if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK) | ||||
| 		return RC_ERROR; | ||||
|  | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfCountFreeBlocks | ||||
|  * | ||||
|  */ | ||||
| int32_t adfCountFreeBlocks(struct Volume* vol) | ||||
| { | ||||
|     int32_t freeBlocks; | ||||
|     int j; | ||||
|  | ||||
| 	freeBlocks = 0L; | ||||
|     for(j=vol->firstBlock+2; j<=(vol->lastBlock - vol->firstBlock); j++) | ||||
|         if ( adfIsBlockFree(vol,j) ) | ||||
|             freeBlocks++; | ||||
|  | ||||
|     return freeBlocks; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfReadBitmap | ||||
|  * | ||||
|  */ | ||||
| RETCODE adfReadBitmap(struct Volume* vol, int32_t nBlock, struct bRootBlock* root) | ||||
| { | ||||
| 	int32_t mapSize, nSect; | ||||
| 	int32_t j, i; | ||||
| 	struct bBitmapExtBlock bmExt; | ||||
|  | ||||
|     mapSize = nBlock / (127*32); | ||||
|     if ( (nBlock%(127*32))!=0 ) | ||||
|         mapSize++; | ||||
|     vol->bitmapSize = mapSize; | ||||
|  | ||||
|     vol->bitmapTable = (struct bBitmapBlock**) malloc(sizeof(struct bBitmapBlock*)*mapSize); | ||||
|     if (!vol->bitmapTable) {  | ||||
| 		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapTable"); | ||||
|         return RC_MALLOC; | ||||
|     } | ||||
| 	vol->bitmapBlocks = (SECTNUM*) malloc(sizeof(SECTNUM)*mapSize); | ||||
|     if (!vol->bitmapBlocks) { | ||||
|         free(vol->bitmapTable); | ||||
| 		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks"); | ||||
|         return RC_MALLOC; | ||||
|     } | ||||
| 	vol->bitmapBlocksChg = (BOOL*) malloc(sizeof(BOOL)*mapSize); | ||||
|     if (!vol->bitmapBlocksChg) {  | ||||
|         free(vol->bitmapTable); free(vol->bitmapBlocks); | ||||
| 		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks"); | ||||
|         return RC_MALLOC; | ||||
|     } | ||||
|     for(i=0; i<mapSize; i++) { | ||||
|         vol->bitmapBlocksChg[i] = FALSE; | ||||
|  | ||||
| 		vol->bitmapTable[i] = (struct bBitmapBlock*)malloc(sizeof(struct bBitmapBlock)); | ||||
| 		if (!vol->bitmapTable[i]) { | ||||
|             free(vol->bitmapBlocksChg); free(vol->bitmapBlocks); | ||||
|             for(j=0; j<i; j++)  | ||||
|                 free(vol->bitmapTable[j]); | ||||
|             free(vol->bitmapTable); | ||||
| 	        (*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks"); | ||||
|             return RC_MALLOC; | ||||
|         } | ||||
|     } | ||||
|  | ||||
| 	j=0; i=0; | ||||
|     /* bitmap pointers in rootblock : 0 <= i <BM_SIZE */ | ||||
| 	while(i<BM_SIZE && root->bmPages[i]!=0) { | ||||
| 		vol->bitmapBlocks[j] = nSect = root->bmPages[i]; | ||||
|         if ( !isSectNumValid(vol,nSect) ) { | ||||
| 			(*adfEnv.wFct)("adfReadBitmap : sector out of range"); | ||||
|         } | ||||
|  | ||||
| 		if (adfReadBitmapBlock(vol, nSect, vol->bitmapTable[j])!=RC_OK) { | ||||
|             adfFreeBitmap(vol); | ||||
|             return RC_ERROR; | ||||
| 		} | ||||
| 		j++; i++; | ||||
| 	} | ||||
| 	nSect = root->bmExt; | ||||
| 	while(nSect!=0) { | ||||
|         /* bitmap pointers in bitmapExtBlock, j <= mapSize */ | ||||
|         if (adfReadBitmapExtBlock(vol, nSect, &bmExt)!=RC_OK) { | ||||
|             adfFreeBitmap(vol); | ||||
|             return RC_ERROR; | ||||
|         } | ||||
| 		i=0; | ||||
| 		while(i<127 && j<mapSize) { | ||||
|             nSect = bmExt.bmPages[i]; | ||||
|             if ( !isSectNumValid(vol,nSect) ) | ||||
|                 (*adfEnv.wFct)("adfReadBitmap : sector out of range"); | ||||
| 			vol->bitmapBlocks[j] = nSect; | ||||
|  | ||||
| 			if (adfReadBitmapBlock(vol, nSect, vol->bitmapTable[j])!=RC_OK) { | ||||
|                 adfFreeBitmap(vol); | ||||
|                 return RC_ERROR; | ||||
|             } | ||||
| 			i++; j++; | ||||
| 		} | ||||
| 		nSect = bmExt.nextBlock; | ||||
| 	} | ||||
|  | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfIsBlockFree | ||||
|  * | ||||
|  */ | ||||
| BOOL adfIsBlockFree(struct Volume* vol, SECTNUM nSect) | ||||
| { | ||||
|     int sectOfMap = nSect-2; | ||||
|     int block = sectOfMap/(127*32); | ||||
|     int indexInMap = (sectOfMap/32)%127; | ||||
| 	 | ||||
| /*printf("sect=%d block=%d ind=%d,  ",sectOfMap,block,indexInMap); | ||||
| printf("bit=%d,  ",sectOfMap%32); | ||||
| printf("bitm=%x,  ",bitMask[ sectOfMap%32]); | ||||
| printf("res=%x,  ",vol->bitmapTable[ block ]->map[ indexInMap ] | ||||
|         & bitMask[ sectOfMap%32 ]); | ||||
| */ | ||||
|     return ( (vol->bitmapTable[ block ]->map[ indexInMap ] | ||||
|         & bitMask[ sectOfMap%32 ])!=0 ); | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfSetBlockFree OK | ||||
|  * | ||||
|  */ | ||||
| void adfSetBlockFree(struct Volume* vol, SECTNUM nSect) | ||||
| { | ||||
|     uint32_t oldValue; | ||||
|     int sectOfMap = nSect-2; | ||||
|     int block = sectOfMap/(127*32); | ||||
|     int indexInMap = (sectOfMap/32)%127; | ||||
|  | ||||
| /*printf("sect=%d block=%d ind=%d,  ",sectOfMap,block,indexInMap); | ||||
| printf("bit=%d,  ",sectOfMap%32); | ||||
| *printf("bitm=%x,  ",bitMask[ sectOfMap%32]);*/ | ||||
|  | ||||
|     oldValue = vol->bitmapTable[ block ]->map[ indexInMap ]; | ||||
| /*printf("old=%x,  ",oldValue);*/ | ||||
|     vol->bitmapTable[ block ]->map[ indexInMap ] | ||||
| 	    = oldValue | bitMask[ sectOfMap%32 ]; | ||||
| /*printf("new=%x,  ",vol->bitmapTable[ block ]->map[ indexInMap ]);*/ | ||||
|  | ||||
|     vol->bitmapBlocksChg[ block ] = TRUE; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfSetBlockUsed | ||||
|  * | ||||
|  */ | ||||
| void adfSetBlockUsed(struct Volume* vol, SECTNUM nSect) | ||||
| { | ||||
|     uint32_t oldValue; | ||||
|     int sectOfMap = nSect-2; | ||||
|     int block = sectOfMap/(127*32); | ||||
|     int indexInMap = (sectOfMap/32)%127; | ||||
|  | ||||
|     oldValue = vol->bitmapTable[ block ]->map[ indexInMap ]; | ||||
|  | ||||
|     vol->bitmapTable[ block ]->map[ indexInMap ] | ||||
| 	    = oldValue & (~bitMask[ sectOfMap%32 ]); | ||||
|     vol->bitmapBlocksChg[ block ] = TRUE; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfGet1FreeBlock | ||||
|  * | ||||
|  */ | ||||
| SECTNUM adfGet1FreeBlock(struct Volume *vol) { | ||||
|     SECTNUM block[1]; | ||||
|     if (!adfGetFreeBlocks(vol,1,block)) | ||||
|         return(-1); | ||||
|     else | ||||
|         return(block[0]); | ||||
| } | ||||
|  | ||||
| /* | ||||
|  * adfGetFreeBlocks | ||||
|  * | ||||
|  */ | ||||
| BOOL adfGetFreeBlocks(struct Volume* vol, int nbSect, SECTNUM* sectList) | ||||
| { | ||||
| 	int i, j; | ||||
|     BOOL diskFull; | ||||
|     int32_t block = vol->rootBlock; | ||||
|  | ||||
|     i = 0; | ||||
|     diskFull = FALSE; | ||||
| /*printf("lastblock=%ld\n",vol->lastBlock);*/ | ||||
| 	while( i<nbSect && !diskFull ) { | ||||
|         if ( adfIsBlockFree(vol, block) ) { | ||||
|             sectList[i] = block; | ||||
| 			i++; | ||||
|         } | ||||
| /*        if ( block==vol->lastBlock ) | ||||
|             block = vol->firstBlock+2;*/ | ||||
|         if ( (block+vol->firstBlock)==vol->lastBlock ) | ||||
|             block = 2; | ||||
|         else if (block==vol->rootBlock-1) | ||||
|             diskFull = TRUE; | ||||
|         else | ||||
|             block++; | ||||
|     } | ||||
|  | ||||
|     if (!diskFull) | ||||
|         for(j=0; j<nbSect; j++) | ||||
|             adfSetBlockUsed( vol, sectList[j] ); | ||||
|  | ||||
|     return (i==nbSect); | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfCreateBitmap | ||||
|  * | ||||
|  * create bitmap structure in vol | ||||
|  */ | ||||
| RETCODE adfCreateBitmap(struct Volume *vol) | ||||
| { | ||||
|     int32_t nBlock, mapSize ; | ||||
|     int i, j; | ||||
|  | ||||
|     nBlock = vol->lastBlock - vol->firstBlock +1 - 2; | ||||
|  | ||||
|     mapSize = nBlock / (127*32); | ||||
|     if ( (nBlock%(127*32))!=0 ) | ||||
|         mapSize++; | ||||
|     vol->bitmapSize = mapSize; | ||||
|  | ||||
|     vol->bitmapTable = (struct bBitmapBlock**)malloc( sizeof(struct bBitmapBlock*)*mapSize ); | ||||
|     if (!vol->bitmapTable) { | ||||
|         (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapTable"); | ||||
|         return RC_MALLOC; | ||||
|     } | ||||
|  | ||||
| 	vol->bitmapBlocksChg = (BOOL*) malloc(sizeof(BOOL)*mapSize); | ||||
|     if (!vol->bitmapBlocksChg) { | ||||
|         free(vol->bitmapTable); | ||||
|         (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapBlocksChg"); | ||||
|         return RC_MALLOC; | ||||
|     } | ||||
|  | ||||
| 	vol->bitmapBlocks = (SECTNUM*) malloc(sizeof(SECTNUM)*mapSize); | ||||
|     if (!vol->bitmapBlocks) { | ||||
|         free(vol->bitmapTable); free(vol->bitmapBlocksChg); | ||||
|         (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapBlocks"); | ||||
|         return RC_MALLOC; | ||||
|     } | ||||
|  | ||||
|     for(i=0; i<mapSize; i++) { | ||||
|         vol->bitmapTable[i] = (struct bBitmapBlock*)malloc(sizeof(struct bBitmapBlock)); | ||||
|         if (!vol->bitmapTable[i]) { | ||||
|             free(vol->bitmapTable); free(vol->bitmapBlocksChg); | ||||
|             for(j=0; j<i; j++)  | ||||
|                 free(vol->bitmapTable[j]); | ||||
|             free(vol->bitmapTable); | ||||
| 			(*adfEnv.eFct)("adfCreateBitmap : malloc"); | ||||
|             return RC_MALLOC; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     for(i=vol->firstBlock+2; i<=(vol->lastBlock - vol->firstBlock); i++) | ||||
|         adfSetBlockFree(vol, i); | ||||
|  | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfWriteNewBitmap | ||||
|  * | ||||
|  * write ext blocks and bitmap | ||||
|  * | ||||
|  * uses vol->bitmapSize,  | ||||
|  */ | ||||
| RETCODE adfWriteNewBitmap(struct Volume *vol) | ||||
| { | ||||
|     struct bBitmapExtBlock bitme; | ||||
|     SECTNUM *bitExtBlock; | ||||
|     int n, i, k; | ||||
|     int nExtBlock; | ||||
|     int nBlock; | ||||
|     SECTNUM *sectList; | ||||
|     struct bRootBlock root; | ||||
|  | ||||
|     sectList=(SECTNUM*)malloc(sizeof(SECTNUM)*vol->bitmapSize); | ||||
|     if (!sectList) { | ||||
| 		(*adfEnv.eFct)("adfCreateBitmap : sectList"); | ||||
|         return RC_MALLOC; | ||||
|     } | ||||
|  | ||||
|     if (!adfGetFreeBlocks(vol, vol->bitmapSize, sectList)) { | ||||
|         free(sectList); | ||||
| 		return RC_ERROR; | ||||
|     } | ||||
| 	 | ||||
|     if (adfReadRootBlock(vol, vol->rootBlock, &root)!=RC_OK) { | ||||
|         free(sectList); | ||||
| 		return RC_ERROR; | ||||
|     } | ||||
|     nBlock = 0; | ||||
|     n = min( vol->bitmapSize, BM_SIZE ); | ||||
|     for(i=0; i<n; i++) { | ||||
|         root.bmPages[i] = vol->bitmapBlocks[i] = sectList[i]; | ||||
|     } | ||||
|     nBlock = n; | ||||
|  | ||||
|     /* for devices with more than 25*127 blocks == hards disks */ | ||||
|     if (vol->bitmapSize>BM_SIZE) { | ||||
|  | ||||
|         nExtBlock = (vol->bitmapSize-BM_SIZE)/127; | ||||
|         if ((vol->bitmapSize-BM_SIZE)%127) | ||||
|             nExtBlock++; | ||||
|  | ||||
|         bitExtBlock=(SECTNUM*)malloc(sizeof(SECTNUM)*nExtBlock); | ||||
|         if (!bitExtBlock) { | ||||
|             free(sectList); | ||||
| 			adfEnv.eFct("adfWriteNewBitmap : malloc failed"); | ||||
|             return RC_MALLOC; | ||||
|         } | ||||
|  | ||||
|         if (!adfGetFreeBlocks(vol, nExtBlock, bitExtBlock)) {   | ||||
|            free(sectList); free(bitExtBlock); | ||||
|            return RC_MALLOC; | ||||
|         } | ||||
|  | ||||
|         k = 0; | ||||
|         root.bmExt = bitExtBlock[ k ]; | ||||
|         while( nBlock<vol->bitmapSize ) { | ||||
|             i=0; | ||||
|             while( i<127 && nBlock<vol->bitmapSize ) { | ||||
|                 bitme.bmPages[i] = vol->bitmapBlocks[nBlock] = sectList[i]; | ||||
|                 i++; | ||||
|                 nBlock++; | ||||
|             } | ||||
|             if ( k+1<nExtBlock ) | ||||
|                 bitme.nextBlock = bitExtBlock[ k+1 ]; | ||||
|             else | ||||
|                 bitme.nextBlock = 0; | ||||
|             if (adfWriteBitmapExtBlock(vol, bitExtBlock[ k ], &bitme)!=RC_OK) { | ||||
|                 free(sectList); free(bitExtBlock); | ||||
| 				return RC_ERROR; | ||||
|             } | ||||
|             k++; | ||||
|         } | ||||
|         free( bitExtBlock ); | ||||
|  | ||||
|     } | ||||
|     free( sectList); | ||||
|  | ||||
|     if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK) | ||||
|         return RC_ERROR; | ||||
|      | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
| /* | ||||
|  * adfReadBitmapBlock | ||||
|  * | ||||
|  * ENDIAN DEPENDENT | ||||
|  */ | ||||
| RETCODE | ||||
| adfReadBitmapBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapBlock* bitm) | ||||
| { | ||||
| 	uint8_t buf[LOGICAL_BLOCK_SIZE]; | ||||
|  | ||||
| /*printf("bitmap %ld\n",nSect);*/ | ||||
| 	if (adfReadBlock(vol, nSect, buf)!=RC_OK) | ||||
| 		return RC_ERROR; | ||||
|  | ||||
| 	memcpy(bitm, buf, LOGICAL_BLOCK_SIZE); | ||||
| #ifdef LITT_ENDIAN | ||||
|     /* big to little = 68000 to x86 */ | ||||
|     swapEndian((uint8_t*)bitm, SWBL_BITMAP); | ||||
| #endif | ||||
|  | ||||
| 	if (bitm->checkSum!=adfNormalSum(buf,0,LOGICAL_BLOCK_SIZE)) | ||||
| 		(*adfEnv.wFct)("adfReadBitmapBlock : invalid checksum"); | ||||
|  | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfWriteBitmapBlock | ||||
|  * | ||||
|  * OK | ||||
|  */ | ||||
| RETCODE | ||||
| adfWriteBitmapBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapBlock* bitm) | ||||
| { | ||||
|     uint8_t buf[LOGICAL_BLOCK_SIZE]; | ||||
| 	uint32_t newSum; | ||||
| 	 | ||||
| 	memcpy(buf,bitm,LOGICAL_BLOCK_SIZE); | ||||
| #ifdef LITT_ENDIAN | ||||
|     /* little to big */ | ||||
|     swapEndian(buf, SWBL_BITMAP); | ||||
| #endif | ||||
|  | ||||
| 	newSum = adfNormalSum(buf, 0, LOGICAL_BLOCK_SIZE); | ||||
|     swLong(buf,newSum); | ||||
|  | ||||
| /*	dumpBlock((uint8_t*)buf);*/ | ||||
| 	if (adfWriteBlock(vol, nSect, (uint8_t*)buf)!=RC_OK) | ||||
| 		return RC_ERROR; | ||||
|  | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfReadBitmapExtBlock | ||||
|  * | ||||
|  * ENDIAN DEPENDENT | ||||
|  */ | ||||
| RETCODE | ||||
| adfReadBitmapExtBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapExtBlock* bitme) | ||||
| { | ||||
| 	uint8_t buf[LOGICAL_BLOCK_SIZE]; | ||||
|  | ||||
| 	if (adfReadBlock(vol, nSect, buf)!=RC_OK) | ||||
| 		return RC_ERROR; | ||||
|  | ||||
| 	memcpy(bitme, buf, LOGICAL_BLOCK_SIZE); | ||||
| #ifdef LITT_ENDIAN | ||||
|     swapEndian((uint8_t*)bitme, SWBL_BITMAP); | ||||
| #endif | ||||
|  | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfWriteBitmapExtBlock | ||||
|  * | ||||
|  */ | ||||
| RETCODE | ||||
| adfWriteBitmapExtBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapExtBlock* bitme) | ||||
| { | ||||
| 	uint8_t buf[LOGICAL_BLOCK_SIZE]; | ||||
| 	 | ||||
| 	memcpy(buf,bitme, LOGICAL_BLOCK_SIZE); | ||||
| #ifdef LITT_ENDIAN | ||||
|     /* little to big */ | ||||
|     swapEndian(buf, SWBL_BITMAPE); | ||||
| #endif | ||||
|  | ||||
| /*	dumpBlock((uint8_t*)buf);*/ | ||||
| 	if (adfWriteBlock(vol, nSect, (uint8_t*)buf)!=RC_OK) | ||||
| 		return RC_ERROR; | ||||
|  | ||||
|     return RC_OK; | ||||
| } | ||||
|  | ||||
|  | ||||
| /* | ||||
|  * adfFreeBitmap | ||||
|  * | ||||
|  */ | ||||
| void adfFreeBitmap(struct Volume* vol) | ||||
| { | ||||
|     int i; | ||||
|  | ||||
|     for(i=0; i<vol->bitmapSize; i++) | ||||
|         free(vol->bitmapTable[i]); | ||||
|     vol->bitmapSize = 0; | ||||
|  | ||||
|     free(vol->bitmapTable); | ||||
| 	vol->bitmapTable = 0; | ||||
|  | ||||
|     free(vol->bitmapBlocks); | ||||
| 	vol->bitmapBlocks = 0; | ||||
|  | ||||
|     free(vol->bitmapBlocksChg); | ||||
| 	vol->bitmapBlocksChg = 0; | ||||
| } | ||||
|  | ||||
|  | ||||
| /*#######################################################################################*/ | ||||
Some files were not shown because too many files have changed in this diff Show More
		Reference in New Issue
	
	Block a user