In the explorer, show data from all reads, not just the first (unless you're on

real hardware).

.appveyor.yml

@@ -1,41 +0,0 @@
-version: '{branch}.{build}'
-clone_depth: 1
-skip_tags: true
-
-environment:
-  MSYSTEM: MINGW32
-
-init:
-  - git config --global core.autocrlf input
-
-install:
-  - set PATH=c:\msys64\mingw32\bin;c:\msys64\usr\bin;c:\msys64\bin;%PATH%
-  - echo %PATH%
-  - pacman -S --noconfirm --needed make ninja mingw-w64-i686-libusb mingw-w64-i686-sqlite3 mingw-w64-i686-zlib mingw-w64-i686-gcc zip
-
-build_script:
-  - make
-  - zip -9 fluxengine.zip fluxengine.exe brother120tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex
-
-artifacts:
-  - path: fluxengine.zip
-    name: fluxengine.zip
-
-deploy:
-  release: FluxEngine Windows client version $(APPVEYOR_BUILD_NUMBER)
-  description: >
-    This is an automatically built version of the FluxEngine Windows client
-    which is generated whenever a significant checkin has happened. It's had
-    no testing whatsoever.
-
-    To use, download it, put it somewhere, and then run it from a cmd window
-    or other command line shell.
-  provider: GitHub
-  auth_token:
-    secure: dfJjj7fWCoDUz+Ni11OcNPB/U3TNJFwNA2AsL++ChFjniUsZLlC6SDWHiL/t4FZo
-  artifact: fluxengine.zip
-  draft: false
-  prerelease: false
-  on:
-    branch: master
-

.clang-format

@@ -0,0 +1,42 @@
+---
+AccessModifierOffset: -4
+AlignAfterOpenBracket: DontAlign
+AlignArrayOfStructures: Left
+AlignEscapedNewlines: Left
+AllowAllArgumentsOnNextLine: 'true'
+AllowAllConstructorInitializersOnNextLine: 'false'
+AllowAllParametersOfDeclarationOnNextLine: 'true'
+AllowShortBlocksOnASingleLine: 'true'
+AllowShortCaseLabelsOnASingleLine: 'false'
+AllowShortFunctionsOnASingleLine: Empty
+AllowShortIfStatementsOnASingleLine: Never
+AllowShortLambdasOnASingleLine: None
+AllowShortLoopsOnASingleLine: 'false'
+AlwaysBreakAfterDefinitionReturnType: None
+AlwaysBreakAfterReturnType: None
+AlwaysBreakBeforeMultilineStrings: 'true'
+AlwaysBreakTemplateDeclarations: 'Yes'
+BinPackArguments: 'false'
+BinPackParameters: 'false'
+BreakConstructorInitializers: 'AfterColon'
+BreakBeforeBraces: Allman
+BreakInheritanceList: AfterColon
+BreakStringLiterals: 'true'
+IndentCaseLabels: 'true'
+IndentWidth: '4'
+ColumnLimit: '80'
+ConstructorInitializerAllOnOneLineOrOnePerLine: 'true'
+IncludeBlocks: Preserve
+IndentWrappedFunctionNames: 'false'
+KeepEmptyLinesAtTheStartOfBlocks: 'true'
+PointerAlignment: Left
+ReflowComments: 'true'
+SortIncludes: 'false'
+SortUsingDeclarations: 'true'
+SpaceAfterTemplateKeyword: 'true'
+SpaceBeforeAssignmentOperators: 'true'
+SpaceBeforeCtorInitializerColon: 'false'
+SpaceBeforeInheritanceColon: 'true'
+SpaceBeforeParens: ControlStatements
+SpaceInEmptyParentheses: 'false'
+...

.github/workflows/ccpp.yml

@@ -0,0 +1,71 @@
+name: C/C++ CI
+
+on: [push]
+
+jobs:
+  build-linux:
+    runs-on: ubuntu-20.04
+    steps:
+    - uses: actions/checkout@v1
+    - name: apt
+      run: sudo apt update && sudo apt install libudev-dev libsqlite3-dev protobuf-compiler libwxgtk3.0-gtk3-dev libfmt-dev
+    - name: make
+      run: CXXFLAGS="-Wp,-D_GLIBCXX_ASSERTIONS" make
+
+  build-macos:
+    runs-on: macos-latest
+    steps:
+    - uses: actions/checkout@v2
+    - name: brew
+      run: brew install sqlite pkg-config libusb protobuf wxwidgets fmt make coreutils
+    - name: make
+      run: gmake
+
+    - name: Upload build artifacts
+      uses: actions/upload-artifact@v2
+      with:
+        name: ${{ github.event.repository.name }}.${{ github.sha }}
+        path: FluxEngine.pkg
+
+  build-windows:
+    runs-on: windows-latest
+    defaults:
+      run:
+        shell: msys2 {0}
+    steps:
+    - uses: msys2/setup-msys2@v2
+      with:
+        update: true
+        msystem: MINGW32
+        install: >-
+          diffutils
+          make
+          mingw-w64-i686-fmt
+          mingw-w64-i686-gcc
+          mingw-w64-i686-libusb
+          mingw-w64-i686-pkg-config
+          mingw-w64-i686-protobuf
+          mingw-w64-i686-sqlite3
+          mingw-w64-i686-wxWidgets
+          mingw-w64-i686-zlib
+          mingw-w64-i686-nsis
+          zip
+    - uses: actions/checkout@v1
+    - name: build
+      run: make
+
+    - name: nsis
+      run: |
+        strip fluxengine.exe -o fluxengine-stripped.exe
+        strip fluxengine-gui.exe -o fluxengine-gui-stripped.exe
+        makensis -v2 -nocd -dOUTFILE=fluxengine-installer.exe extras/windows-installer.nsi
+
+    - name: zip
+      run: |
+        zip -9 fluxengine.zip fluxengine.exe fluxengine-gui.exe upgrade-flux-file.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex fluxengine-installer.exe
+
+    - name: Upload build artifacts
+      uses: actions/upload-artifact@v2
+      with:
+        name: ${{ github.event.repository.name }}.${{ github.sha }}
+        path: fluxengine-windows.zip

.github/workflows/release.yml

@@ -0,0 +1,118 @@
+name: Autorelease
+
+on:
+  push:
+    branches:
+      - "master"
+
+jobs:
+  dev-release:
+    runs-on: windows-latest
+    defaults:
+      run:
+        shell: msys2 {0}
+    steps:
+    - uses: msys2/setup-msys2@v2
+      with:
+        update: true
+        msystem: MINGW32
+        install: >-
+          diffutils
+          make
+          mingw-w64-i686-fmt
+          mingw-w64-i686-gcc
+          mingw-w64-i686-libusb
+          mingw-w64-i686-pkg-config
+          mingw-w64-i686-protobuf
+          mingw-w64-i686-sqlite3
+          mingw-w64-i686-wxWidgets
+          mingw-w64-i686-zlib
+          mingw-w64-i686-nsis
+          zip
+    - uses: actions/checkout@v3
+
+    - name: build
+      run: |
+        make
+
+    - name: nsis
+      run: |
+        strip fluxengine.exe -o fluxengine-stripped.exe
+        strip fluxengine-gui.exe -o fluxengine-gui-stripped.exe
+        makensis -v2 -nocd -dOUTFILE=fluxengine-installer.exe extras/windows-installer.nsi
+
+    - name: zip
+      run: |
+        zip -9 fluxengine.zip fluxengine.exe fluxengine-gui.exe upgrade-flux-file.exe brother120tool.exe brother240tool.exe FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex
+
+    - name: date
+      run: |
+        echo "RELEASE_DATE=$(date --rfc-3339=date)" >> ${GITHUB_ENV}
+
+    - name: tag
+      uses: EndBug/latest-tag@latest
+      with:
+        tag-name: dev
+        force-branch: false
+      env:
+        GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+    - name: delete-old-assets
+      uses: mknejp/delete-release-assets@v1
+      with:
+        token: ${{ github.token }}
+        tag: dev
+        assets: | 
+          fluxengine.zip
+          fluxengine-installer.exe
+        fail-if-no-assets: false
+
+    - name: release
+      uses: softprops/action-gh-release@v1
+      with:
+        name: Development build ${{ env.RELEASE_DATE }}
+        files: |
+          fluxengine.zip
+          fluxengine-installer.exe
+        tag_name: dev
+      env:
+        GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+  build-macos:
+    runs-on: macos-latest
+    steps:
+    - uses: actions/checkout@v2
+    - name: brew
+      run: brew install sqlite pkg-config libusb protobuf wxwidgets fmt make coreutils
+    - name: make
+      run: gmake
+
+    - name: tag
+      uses: EndBug/latest-tag@latest
+      with:
+        tag-name: dev
+        force-branch: false
+      env:
+        GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+    - name: delete-old-assets
+      uses: mknejp/delete-release-assets@v1
+      with:
+        token: ${{ github.token }}
+        tag: dev
+        assets: | 
+          FluxEngine.pkg
+        fail-if-no-assets: false
+
+    - name: release
+      uses: softprops/action-gh-release@v1
+      with:
+        name: Development build ${{ env.RELEASE_DATE }}
+        files: |
+          FluxEngine.pkg
+        tag_name: dev
+      env:
+        GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
+
+
+

.gitignore

@@ -1,2 +1,10 @@
 .obj
 .project
+/.ninja*
+/brother120tool
+/brother120tool-*
+/brother240tool
+/brother240tool-*
+/fluxengine
+/fluxengine-*
+/upgrade-flux-file

.travis.yml

@@ -1,39 +0,0 @@
-language: shell
-git:
-    depth: 1
-
-matrix:
-    include:
-        -
-            os: linux
-            sudo: false
-            dist: xenial
-            compiler: gcc
-            env: CXX=g++-8
-            script:
-            - make
-        -
-            os: osx
-            osx_image: xcode10.2
-            compiler: clang
-            env:
-            - HOMEBREW_NO_INSTALL_CLEANUP=1
-
-addons:
-    apt:
-        sources:
-        - llvm-toolchain-precise-3.8
-        - ubuntu-toolchain-r-test
-        packages:
-        - ninja-build
-        - libusb-1.0-0-dev
-        - libsqlite3-dev
-        - g++-8
-    homebrew:
-        packages:
-        - ninja
-
-script:
-- make
-
-

FluxEngine.cydsn/CortexM3/ARM_GCC_541/Release/FluxEngine.hex

@@ -1,250 +1,250 @@
-:4000000000800020110000003510000035100000064A08B5136843F020031360044B1A6803F53F5302331A6001F022F8E8460040FA46004010B5054C237833B9044B13B181
-:400040000448AFF300800123237010BD6881FF1F0000000098380000084B10B51BB108490848AFF300800848036803B910BD074B002BFBD0BDE81040184700BF0000000071
-:400080006C81FF1F98380000C880FF1F0000000072B6034A13680133136062B6704700BF8881FF1F0A4A0B4B516801310B40002BBEBF03F1FF3363F00F0301335360516800
-:4000C0009368994202BF024B01221A73704700BF8881FF1F0F0000800A4A0B4B916801310B40002BBEBF03F1FF3363F00F030133936091685368994202BF024B01221A7379
-:40010000704700BF8881FF1F0F000080024B012200205A7302F052B98881FF1F10B5C4B2204601F067F90128FAD110BD10B50446094B9A7B987382421CBF0022DA7310F0CE
-:40014000010F14BF0220012002F064FE6008BDE8104002F059BE00BF8881FF1F70B5C4B220460E4601F04EF9314605460246204601F00AFA204601F03DF90128FAD02846D9
-:4001800070BD000038B50B4C257C55B9A07BFFF7CDFF012002F0A8F84FF47A7002F0BAFAE5732368636101232374BDE8384002F0EFBA00BF8881FF1F38B50446C5B22846A0
-:4001C00002F09EF8062002F0BBFA44F00200C0B202F096F8062002F0B3FA284602F090F8BDE83840062002F095BA10B5642402F081F820B10120BDE81040FFF7DDBF0120FF
-:40020000FFF7DAFF013CF2D1F4E7000038B5044D0024285D013402F043FA102CF9D138BDA081FF1F08B502F05DFC002002F066FC02F078FC02F082FC80B208BD10B5044637
-:40024000012002F075F8642002F064FAFFF7EAFF2080002002F06CF8642002F05BFAFFF7E1FF608010BD08B502F068FD002002F071FD02F083FD02F08DFD80B208BD10B5A9
-:400280000446FFF7B2FF322002F044FAFFF7EBFF20800020FFF790FF322002F03BFAFFF7E2FF608010BD0FB400B593B014AB53F8042B402102A8019302F0D6FE02A802F0B4
-:4002C00084F802F08EF813B05DF804EB04B0704710B5044601780648FFF7E5FF0420FFF71DFF62782146BDE81040042001F0DAB8AA38000007B50023ADF804308DF80600B0
-:40030000032301A88DF80530FFF7E2FF03B05DF804FB0000F8B51D4C0646FFF733FFE37B03B156B91A48FFF7BEFFFFF75EFF01200023E073A36202F003FA3246A16A1548D8
-:40034000FFF7B1FF114D0027A36A9E4216D001F0D1FF00B1AF62A36A9E4205DD0020FFF72BFFAB6A013305E005DA0120FFF724FFAB6A013BAB6202F00BFAE5E7322002F041
-:40038000C9F9BDE8F8400448FFF78DBF8881FF1FB7380000BE380000DB3800002DE9F04F9BB062B602F05EFABE49042002F082FABD4801F0ABFFBD4802F04EFDBC4801F07F
-:4003C000DFFF02F02FFC02F001FB002002F022FD01F0FAFF0221002000F0C2FFB54D0321084602F0B5F92E462C4602F0D1F92B7C73B16A692B689B1A41F28832934207D9C7
-:40040000002001F071FF002002F004FD00232B7400F0DEFF18B9A848FFF745FF04E000F0DDFF0028F7D109E000F0D2FF0028FBD0A248FFF738FF032001F0FAF8032000F031
-:40044000D9FF0128D1D1A07BFFF770FE9C490320FFF784FE94F82C109A48FFF724FF94F82C30023B122B00F2DF83DFE813F01300DD031C00DD032200DD033A00DD035E002E
-:40048000DD039301DD031E03DD033D03DD034303DD034F0303238DF828308DF8293008238DF82A302EE394F82E00FFF733FF864B25E3FFF767FE00236373637B002BFCD06F
-:4004C000002373733268637B002BFCD0336807218DF828109B1A04218DF82910ADF82A3010E30220FFF71AFE4FF000090DF1280A4FF480780027C8EB0903DA1907F80A2095
-:400500000137402FF9D10220FFF708FE3A465146022000F0C7FFB8F10108EBD109F10109B9F1400FE4D1694BBAE294F82E0001F0FFFEA06AFFF7EEFE02F002FD644BDFF8C2
-:4005400094811A78002742F004021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F0F0FC0220FFF7D7FD41F6FF734FF480420121022002F051FC84F807
-:400580006C0002F073F808F807000137102FF8D1DFF844A100270AF159081FFA88F90137102F14BF3A4600221AF8010F22440623127E402102F08EF84A4646F243419AF86E
-:4005C000000002F099F809F14009102F1FFA89F9E5D100237373637B002BFCD00027142239460AA8777302F00BFD40230D934FF0FF337760B36037737368DFF8E0903344B4
-:40060000197E96F86C00CDF8309001F0E7FF96F86C0001F0A5FF012196F86C0001F078FF636813B96B7B002BFAD0002794F82FA0A76094F80CB0BBF1000F6AD102F0A8F8EF
-:400640006B7B43B1BAF1010A85F80DB003D160E02B7B002B5DD1A26863689A42F8D04FF0000BA3680AA808EB83135B440A93CBF140030B9300F0F8FA0B9B0137C3F1400304
-:400680009B440D9B5FFA8BFB9BBB022000F0B2FE012825D0637B002B3BD12B7B002BF4D037E000BF910000000D010000A5000000D90000008881FF1FE9380000FC38000085
-:4006C000B481FF1F063900009C3800009E38000093640040A081FF1F9F81FF1FF885FF1F4022B849022000F0DDFE4023CDF830900D93BBF13F0FB4D9A268B34B0132134082
-:40070000002BBEBF03F1FF3363F00F030133A3608FE7042194F86C0001F06CFF94F86C0001F078FF0028F9D10AA800F0D1FA0220FFF7F4FC337B63B90D9A402A06D0C2F135
-:40074000400292B29F49022000F0ACFE0220FFF7E5FC0D9A32F0400203D11146022000F0A1FEFFF753FD237B33B19848FFF79BFD0220FFF7BFFD06E0954B09A81B88ADF8A6
-:400780002430FFF7A5FD627B3946237B9148FFF78AFD4CE29048FFF786FD276B17F03F0701D0032041E2012001F0C8FD95F82E0001F0BEFD02F0C4FB884BDFF824821A78B7
-:4007C00002F0FB021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F0B3FBA86AFFF796FD01214FF4804341F6FF72084601F0A8FD85F86C0001F036FF15
-:4008000008F807000137102FF8D1DFF8D891002709F159031FFA83F807930137102F14BF3A46002219F8010F22440523127E402101F050FF414646F2475299F8000001F0E0
-:400840005BFF08F14008102F1FFA88F8E5D10027BB46B946BA46336B4FF0FF389B09142239460AA877600593C6F80880377302F0C7FB402301200D9300F0DAFECDF81880AD
-:400880006268514B01321340002BBCBF03F1FF3363F00F03A168B8BF01338B4200F0A480BAF1000F07D0237B002B40F0B0806B7B002B40F0AC800B9B002B34D1B9F1000FD0
-:4008C0000BD07F223F495A540133402BFAD10A910B9328E0BAF1000F06D1012000F08AFD01288046F6D107E0237B002B40F08F806B7B002BF1D08AE03249FFF72FFC81462E
-:40090000304B0B9040460A9300F092FEB9F13F0F07F1010706DD059BDB1BD3F1000949EB030900E0C1460B9BDBB16368079A0AA802EB83120D9BC3F1400313440C9300F042
-:40094000D6F90D9B6BB96A681F4B01321340002BBEBF03F1FF3363F00F030133636040230D93A36801333FD16B680F2B3CD14FF00008C5F8088001F015FD85F80C80AB68D9
-:4009800095F86C002B44197E01F028FE95F86C0001F0E6FD012195F86C0001F0B9FD85F80D80637B002BFCD04FF00008012086F80D8001F003FD404601F0C0FCCDF81880BF
-:4009C00015E000BFF885FF1F0F00008015390000A03800002F3900004239000097650040A081FF1F9F81FF1FBAF1000F05D0237B6BB96B7B5BB94FF0010AA368069A934242
-:400A00003FF43EAFAB680BF1010B069338E701F0CFFC012001F092FC002001F0CFFC042194F86C0001F0E6FD94F86C0001F0F2FD0028F9D196F86C0001F080FD737B327BCD
-:400A40000293012303920193CDF800905B463A4605997B48FFF727FCB9F1000F16D1059BBB420ADD012000F0C5FC01288046F6D17449FFF773FB3F2803DC012000F0ECFD97
-:400A800004E0404600F0D4FD0137E8E7FFF7BEFB6D48FFF708FC237B0BB10220C5E06B4B1B8809A8ADF824302DE094F82E0001F03FFCA06AFFF72EFC6548FFF7F4FB0023B0
-:400AC0006373637B002BFCD0012001F077FC00237373637B002BFCD0002001F06FFC5D48FFF7E1FB5C4B0AE00020E073FFF712FC5A4B04E094F82E00FFF718FB584B1B885B
-:400B0000ADF828300AA8FFF7E3FB90E0237C3BB1002001F0E9FB002002F07CF900232B7402F0FEF8002002F0A1F82A2701F0CCFF002001F06FFF3A4600210AA802F060FA3B
-:400B400015238DF828308DF8297001F021FE002001F0CAFB002002F05DF9C82001F0DAFD0DEB0700FFF76AFB0DF13E00FFF787FB01F00EFE012002F04DF9322001F0CAFDD6
-:400B80000DF12E00FFF75AFB0DF14200FFF777FB012001F0A9FB4FF4967001F0BBFD01F0F7FD0DF13600FFF749FB0DF14A00FFF766FB002001F098FB4FF4967001F0AAFDF7
-:400BC00001F0E6FD022002F025F9322001F0A2FD0DF13200FFF732FB0DF14600FFF74FFB012001F081FB4FF4967001F093FD01F0CFFD0DF13A00FFF721FB0DF14E00FFF795
-:400C00003EFB002001F070FB4FF4967001F082FD01F0BEFD002002F0FDF80023E37302F001F801F0D3FE6DE70120FFF763FB032000F0FEFC0B48FFF736FBFFF7D6BB00BFD7
-:400C40004C390000F885FF1F7C390000A23800008B39000099390000A4380000A6380000A8380000A639000010B54268002A2ED0C368002B2BD00368048A591C01601B786C
-:400C8000013A13F0800F817C42601DBF03F0010242EA84030231083114BF43F0020343EA0423817414BF03820382837C072BDCD9028A083B42FA03F38268511C8160137004
-:400CC000C368013BC360837C083B8374CDE710BD07B5827C42B102AA002102F8011D026001224260FFF7C0FF03B05DF804FB30B543686BB3C2685AB3827C072A0CD80468D7
-:400D000090F91050611C01602178013B41EA05210832018243608274827C018AA2F108042141CBB2090608D5C3F3801363F07F03023A03F08103827402E08474002BD7D00A
-:400D40008268511C81601370C368013BC360CFE730BD00002DE9F04172B644F21A118E4B61221A70A3F5F06301221A8019244FF443729C709A80894A1B231370518044F633
-:400D80001F611371D1801372854A864B92E80300062283F8002283E80300522203F580731A70814B814A1B78814EDBB2137040F61802804B00251A8041F2512223F8022C4E
-:400DC00033784FF4F07003F0010343EA450502F0AFF8013C05F003052ED0032DF0D1764B4FF480721A8007221A70744A002548211570917002221D705D7103F8032C042291
-:400E0000DA716F4A6F4C13786F4E43F00F03137012F8013C062743F0030302F8013C2378012243F0800323705B4B1A70674A137843F02003137000E0FEE707FB0563002163
-:400E40009A881868013502F0DBF8072DF5D16048604E002550F8041F05F1105303F1560221F0FF075733C9B20B4452005B0002329A4206D012F802EC12F801CC0EF807C0B6
-:400E8000F5E7B0420D44E5D1534A00231360936013619361514B524F1A68524BDFF890811A60514B1A68514B1A60514A137843F002031370137C43F0020313742378A2F57C
-:400EC000863243F040032370413A137843F010031370484A484B07CA03C31A80474A2833106843F8250C127903F8212C444A07CA03C31A80434AE83B07CA03C31A80424A3D
-:400F0000083307CA03C31A80404A414BA2F5616203CBC2F8100EC2F8141E1378042043F0080313703B4B02F5AA521B783D78DBB298F80060EDB203F007010C321B09117018
-:400F4000F6B2537045F003033B7046F0030388F80030314B48221A70304A402313703049937013729372082382F81F3220220A7048710A722B4A0A20137001F0E1FB2A4B13
-:400F800088F8006044223D70284D1A7094E80F0007C52B80BDE8F081004800408640004070100048004100400F010049A1460040254200402242004004400040064000407B
-:400FC000A2430040A0430040AB390000E8460040FCFFFF47A80000480076004078100048F8460040207600407C100048287600400350014030100048C05100403C10004899
-:4010000044100048501000485C1000483251004068100048CF0100491D51004001590040235B0040585B004076580040B0430040F946004008B501F0B7FF03680C2B00D18C
-:40104000FEE7FEE7084908B50B68084A1844821A802A01DC086005E001F0A6FF0C2303604FF0FF33184608BDCC80FF1F4887FF1F80B51148114B0025C0B1A3F1100192C974
-:4010800022460439161BB74204D051F8046F42F8046BF7E7114653F8046C8C1AA64202D041F8045BF9E701381033E5E701F082FFFFF774F9FEE700BF010000007C3B0000E7
-:4010C000124A134B10B51A60124A134C1368134843F4007313600023032B98BF54F823204FEA830188BF0E4A0133302B4250F3D10C4B1A780C4B1A700C4B084A1A60FFF7EE
-:4011000029FEBDE8104001F0EDB900BF0004FA050CED00E014ED00E0000000000080FF1F35100000BC760040C080FF1F08ED00E0F8B501F005FF4B4A01271378022643F0B3
-:4011400001031370137C484C43F001031374474B02F5E3521F700B3203F8946C1378054603F07F031370002001F0EAFA2378404A03F0F90323701378384603F0DF031370B7
-:4011800023783B43237001F0DBFA282001F0D8FA384B30461A7802F07F021A701A7802F0BF021A7023783343237001F0C9FA2378314A43F0040323700023137053702F4A3E
-:4011C000FF2199540133092BFBD1284601F0BCFE0721172001F0FCFA2949172001F0EAFA0721182001F0F4FA2649182001F0E2FA0721152001F0ECFA2349152001F0DAFA84
-:401200000721052001F0E4FA2049052001F0D2FA0721062001F0DCFA1D49062001F0CAFA0721084601F0D4FA1A49072001F0C2FA0721082001F0CCFA1749082001F0BAFA51
-:401240000021162001F0C4FA1449162001F0B2FA07210C2001F0BCFABDE8F84010490C2001F0A8BAA5430040944300409D60004012600040F8510040846000406D86FF1F9C
-:40128000FF1A000039190000FD1A0000311A00005D1A00008D1A0000C51A0000051B0000791B0000214B224A10B5187000231370204A40201370204A0F2413701F4A13708C
-:4012C0001F4A13701F4A13701F4A13701F4B4FF400021A604FF080721A604FF400121A6020221A601860802018604FF480701860174804704FF480001860164B1A70933BC9
-:4013000019B91A7802F0FE0202E01A7842F001021A70114B03221A70802203F8202C012001F006FE0D4B04221A7010BD8886FF1F8E86FF1F8C86FF1F8D86FF1F8986FF1F59
-:401340007886FF1F8B86FF1F0087FF1F00E100E09E6000409C600040286000401260004070B5074C054623780E461BB9FFF7E0FE0123237031462846BDE87040FFF792BF36
-:401380003886FF1F0A4A002313700A4A13700A4A13700A4A13700A4A13700A4A13700A4A13700A4B03221A70802203F8202C70478E86FF1F8C86FF1F8D86FF1F8986FF1FE9
-:4013C0007886FF1F8B86FF1F0087FF1F28600040014B1878704700BF8D86FF1F044B1A7802F0FF001AB118780022C0B21A7070478C86FF1F024A0C2303FB00204078704778
-:401400009486FF1F431E072B0CD8074A064B00010344805C5B7800F00F0043EA0020023880B2704700207047FC5F00401A4A38B50C2303FB00231B79090C13F0800F00F1B6
-:40144000FF35044619BF8AB24FF480438BB24FF48042032D18D8DFE805F002070C110021084601F01BF80DE00021084600F0FAFF08E00021084600F0D9FF03E00021084667
-:4014800000F0B8FF054B1855EDB2072D03D801F0EDF8034B185538BD9486FF1F6486FF1F6D86FF1F431E072B2DE9F0470446894615465CD82F4F0C2202FB0072D388DFF86E
-:4014C000B8A09BB2C3F500739D424FF00C0303FB007388BFD588DB7884BFC5F50075ADB2254A43EA15230601B354B244EBB28AF80130224B1A5C9846FF2A01D1FFF796FF47
-:401500000C2303FB047200215170B9F1000F28D03DB31B4F385D01F011F811232946FE2218F8040001F0D6F806F5C04278321FFA89F118F8040001F0DFF8124D18F804105D
-:40154000385D01F04BF80121385D00F0E1FF735D43F002037355735D03F0FD037355BDE8F08703FB04746379DBB28AF80230BDE8F08700BF9486FF1FFC5F00406D86FF1F52
-:401580006486FF1F706000402DE9F047044615468846002940D0431E072B3FD8FFF732FFA84203D22046FFF72DFF05461D4E335DFF2B03D141462046FFF738FFDFF868A0C5
-:4015C00027011AF8040000F0B9FF1223FE222946305D01F07FF807F5C0411FFA88F27831305D01F089F8DFF84490315D1AF8040000F0F4FF01211AF8040000F089FF17F823
-:40160000093043F0020307F8093017F8093003F0FD0307F8093002E00D4600E000252846BDE8F0876D86FF1F6486FF1F70600040431E072B0AD8064A0C2303FB002300226A
-:401640005A705A79034BD2B200011A54704700BF9486FF1FFE5F0040431E072B9FBF024B000108221A547047FE5F004030B51A4A1A491B4D0878138803449BB21380194A5D
-:4016800000231488D8B2A4B27CB1082B0CD050680078C0B2E85450680133013050601088013880B21080ECE718460B780E4C082B0E4A00D040B10E4D2B7883F080032B7028
-:4016C0000F232370022301E0022323701370094B1870087030BD00BF0487FF1F0087FF1F006000407C86FF1F7986FF1F8E86FF1F8A86FF1F0187FF1F074B02221A70074B61
-:4017000080221A70064B0F221A70064A00231370054A0120137070478E86FF1F8A86FF1F7986FF1F0087FF1F0187FF1F30B5164B16491B780A8803F00F03023BDBB21A4412
-:4017400092B20A80124C134A0020118889B279B173B15568215C013BC9B229705168DBB20131516011880130013989B21180ECE7094A1370094A137883F080031370084BC8
-:401780000B221A7030BD00BF296000400487FF1F006000407C86FF1F0187FF1F8A86FF1F7986FF1F064A06231370064A01201370054B80221A70054B00221A70704700BFC5
-:4017C0008E86FF1F7986FF1F8A86FF1F0187FF1F054B9A683AB19A68044910709A680988518000229A6070477C86FF1F0487FF1F08B5124B1A78D2B21A701B78DBB21A06C0
-:4018000002D50F4A137008BD0220FFF7E1FF0D4B1B7803F06003202B05D0402B06D043B900F012FC04E001F093FB01E000F046FD10B9034B03221A7008BD00BF2860004013
-:401840007986FF1F0060004008B5084A084B0120197813880B449BB21380064B00221A70FFF7B6FF044B03221A7008BD0487FF1F0087FF1F8E86FF1F7986FF1F08B50C4BB1
-:401880001B78DBB2042B07D0062B09D0022B0DD1BDE80840FFF7D8BFBDE80840FFF746BF0320FFF795FF034B03221A7008BD00BF8E86FF1F7986FF1F08B5054B00220120BE
-:4018C0001A70FFF785FF034B03221A7008BD00BF8E86FF1F7986FF1F08B50A4B1A7832B11A78094942F080020A7000221A70074B002201201A70FFF76BFF054B03221A7051
-:4019000008BD00BF7886FF1F086000408E86FF1F7986FF1F074B1B78DBB2042B05D0062B05D0022B05D1FFF7A1BEFFF7C5BFFFF7D3BF70478E86FF1F38B51D4C2378DBB2D3
-:40194000DD0634D518060AD503F00F03012B2ED1FFF74EFF174B1B78190609D538BD5A0602D5FFF7D7FF03E09D0620D5FFF786FF23781B061BD4104B1A78104B1B7813434F
-:401980000F4A13701278934211D10A4A0849154613782078DBB2000605D41378DBB20B700B7803F00F0328788342F1D138BD38BD286000407986FF1F8A86FF1F0187FF1F96
-:4019C00029600040054A00231380054A916819B191680B7092685380704700BF0487FF1F7C86FF1F0E4808B503889BB213B9FFF783FE13E00B4B02221A700B4B00221A7060
-:401A0000FFF7E0FF094AD1799379028843EA012392B2934238BF0380FFF728FE012008BD7C86FF1F8E86FF1F8A86FF1F00600040084B01221A700F3B9B7C074B1A7B02F05E
-:401A40000302012A1EBFDA7B82F08002DA7301225A7370470B6000409486FF1F094B02221A700F3B93F82230074B1A7E02F00302012A1EBFDA7E82F08002DA7601225A7698
-:401A8000704700BF0B6000409486FF1F0B4B04221A700F3B93F83230094B93F8242002F00302012A1EBF93F8272082F0800283F82720012283F82520704700BF0B600040E2
-:401AC0009486FF1F0B4B08221A700F3B93F84230094B93F8302002F00302012A1EBF93F8332082F0800283F83320012283F83120704700BF0B6000409486FF1F7047FFF79A
-:401B000041BC0000F0B5184B184E19780C27C9B201234FF0000C31B3CA0720D5144A4FEA031E7244947850782040C5070DD507FB03652C79240608D5147804F0FE04147076
-:401B40006D790C4CEDB204F80E50840706D507FB036425792D0658BF84F801C090700133DBB24908D7E7F0BD9F6000409486FF1F70600040FE5F004000F0ACBC70B50446D2
-:401B8000184B88B003AA03F11006154618685968083303C5B3422A46F7D11B782B70FCB12223237001AD03232846637000F08AFE002220461146AB5C08AC04EB131414F80B
-:401BC000144C03F00F03847008AC234413F8143C0132082AC1700371417100F10400EAD108B070BDD53900002DE9F0431C4D01222E460C201F274FF0800E4FF0080C194B78
-:401C000000FB02581401234418705F70164998F805902144B9F1000F07D098F8044024064CBF887081F802C001E081F802E000FB0261CC880132E4B29C71CC88092AC4F3C5
-:401C40000724DC71CC88E4B21C71C988C1F307215971D4D1054BFF221A70BDE8F08300BF9486FF1F70600040FC5F00400A600040064B074A1B7802EBC30253681A7C82427E
-:401C800086BF03EBC0035869002070478886FF1F383A00002DE9F84F424B1A78002A7ED01878414D0138C0B2FFF7E2FFA8463F4AC3681478007ADFF800C1E4B203EBC000E0
-:401CC0000C2600274FF0010E834268D01A78A24263D11CF80420597891425ED19A7893F8039002F07F0206FB02FA05EB0A01CF7093F802B009F0030981F804B093F803B004
-:401D000005F80AB0B3F804A0A1F808A093F902A0BAF1000F0BDAB9F1010F0CBF4FF007094FF00D0981F8059081F801E009E0B9F1010F0CBF4FF005094FF0090981F80590E4
-:401D40004F704FEA02191A4906FB0282494481F802E0B2F808A0CAF3072A81F800A0B2F808A05FFA8AFA81F801A0B2F806A011495FFA8AFA494481F806A0B2F80690C9F3AF
-:401D8000072981F80790B2F806905FFA89F981F80490D288C2F307224A71083394E7BDE8F88F00BF8D86FF1F9486FF1F8986FF1FFC5F0040706000407A86FF1F08B5064BBA
-:401DC00018780138C0B2FFF753FF20B143681B7900EBC300406908BD8D86FF1F00212DE9F84F0B464E4E0C2707FB01F401313219092933554FF000059370494CD370138184
-:401E0000937253705371EFD118B1464B1D70464B1D70464B1A78002A7FD0187801250138C0B2FFF725FFA8464368DFF8F8E0DB790C2713F0400F3E4B4FF0000C1A7814BFE0
-:401E400042F0010202F0FE021A70027AD20007FB0541C36803EB02094B4531D093F802A00AF07F06AE4229D10E89B3F804B0B6B25E4538BFA1F808B01E7893F801B01EF89F
-:401E80000660B3451AD181F804A0DE780E7093F902A0DE78BAF1000F06F0030607DA012E0CBF07260D264E7181F8018006E0012E0CBF052609264E7181F801C00833CBE797
-:401EC0000135092DC3D1C1680A328B1C0A440C200833934209D013F8081C13F80A5C01F07F0100FB01418D72F2E7FFF767FF114B0121186000230C2000FB0142D380128980
-:401F0000013113449BB203F00102134409299BB2F2D1BDE8F84FFFF767BEBDE8F88F00BF9486FF1F7A86FF1F0287FF1F8D86FF1F8B86FF1F9086FF1F114B1B7903F07F0354
-:401F40005A1E072A19D80F490C2202FB031291781B0141F0010191700021D170517841F002015170127912F0800F074A1A4414BF8D2389239370FFF715BC0020704700BF5C
-:401F8000006000409486FF1FFC5F004030B4194B1A7902F07F02531E072B27D8164B0C2404FB02339978154D01F0FE0199700021D97029461201505D114400F07F0050558B
-:401FC0005A7802F0FD025A701A795B78120605D5012B01D18C7006E00D2303E0012B0CBF082309238B7030BCFFF7DCBB002030BC704700BF006000409486FF1FFC5F004052
-:4020000010B50D4B0D4C21791878C9B20138C0B2FFF72EFE43681B798B4201D2012909D8074A0848535CDBB24354A3780120DBB2535410BD002010BD8D86FF1F006000405F
-:402040007A86FF1F0287FF1F38B58A4A8A4C13780021DBB221801806517840F18D800A2900F20581DFE811F05D00030103010301030103010B0003017E0003018200D378C3
-:402080007C49012B09D17D4B1A787D4B03EBC2035B685B686360122310E0CB78022B12D18878FFF7E5FD002800F0E180436863606368DA7863689B7843EA02232380BDE86B
-:4020C0003840FFF78FBCCB78032B26D16D4B00228878D5B2854209D3664A91786A4AEE2908BF1346634A917881B106E0187801320028F1D018780344EAE764499278097CB9
-:40210000914203D16248FFF739FD614B1A78002A00F0AD801A78228018E0BDE8384000F017BF13F0030313D0022B40F0A0802380504B0C211B7903F07F02564B01FB0233E0
-:402140009A78554BD2B21A7000225A706360B6E702222280514A11784F4AC9B2117053706260ACE7012323804D4BEFE70123238013794C4A1344E9E701390A2977D8DFE8F4
-:4021800001F037764F76067676760A7620009378454ADBB25AE0937803F0FF0153B9404B1A7891425FD01970404B01201870FFF715FE58E0481EC0B2FFF75AFD0028EED120
-:4021C00055E0FFF71DFF002851D02A4A384913791279DBB2D2B20A70364A3249D25CCB5C9A4240D0314B01221A70FFF753FD3AE003F00303012B2BD009D3022B37D11D4B5A
-:402200009B78002B33D1BDE83840FFF7BFBE194B9B78012B2BD1214A137803F0FD0315E003F00303012B13D008D3022B1FD1114B9B78E3B9BDE83840FFF77EBE0D4B9B788A
-:40224000012B14D1154A137843F0020313700AE0084B1A795AB998781B791749DBB2CA5C22EA0002CA54BDE83840FFF79BBA002038BD00BF006000407C86FF1F8886FF1FBA
-:40228000383A00009C3A0000243A00000F3B00002087FF1F9486FF1F3986FF1F8B86FF1F8D86FF1F7A86FF1F7886FF1F8C86FF1F8986FF1F0287FF1F8F86FF1F074B1A789F
-:4022C000120609D55B78012B06D1054B054A5A6012781A80FFF786BB00207047006000407C86FF1FFC390000014B1870704700BF72640040014B1878704700BF6D640040CF
-:40230000014B1870704700BF7A650040064A0123136002F688321268E0211064034A1170A2F540721360704780E100E000E400E0014B1870704700BF76650040014B18702D
-:40234000704700BF7965004073B515461E460B4C05230022019200920A4601461846237000F064F932462946207800F01FF90221207800F009F9207802B070BDD080FF1F2E
-:40238000064A0423136002F688321268E0219064034A1170A2F202321360704780E100E002E400E0014B04221A60704700E100E0014B04221A60704780E100E0014B18702F
-:4023C000704700BF7C640040704738B505460078012428B100F054FD285D0134E4B2F8E738BD08B50D2000F04BFDBDE808400A2000F046BDF7B516461F460B4C0023032542
-:40240000019300930A4601462846257000F00EF93A463146207800F0C9F80221207800F0B3F8207803B0F0BDE080FF1FF7B516461F460B4C00230225019300930A4601460C
-:402440002846257000F0F2F83A463146207800F0ADF82946207800F097F8207803B0F0BDE180FF1FF7B516461F460B4C00230125019300930A4601462846257000F0D6F8D2
-:402480003A463146207800F091F80221207800F07BF8207803B0F0BDE280FF1F73B515461E460B4C0023019300930A4601461846237000F0BBF832462946207800F076F8EE
-:4024C0000221207800F060F8207802B070BD00BFE380FF1F024B1878C0F38010704700BF8F450040074A7F23802113705170064A013BDBB202F80839002BF9D1034A137087
-:40250000704700BFE480FF1FF87B00400078004017280FD8084B0001C25C11B142F0200201E002F0DF02C254C25C42F00102C25400207047012070471070004017280BD8C6
-:40254000064B0001C25C02F0FE02C254C25C02F0DF02C25400207047012070471070004017280DD8074900010B4603441A7942F004021A71435C43F00103435400207047C6
-:40258000012070471070004017280BD8064A0001835C490003F0F10301F00E011943815400207047012070471070004041F6FF73994208BF4FF400519A4208BF4FF400524A
-:4025C00017289FBFC00000F1804000F5EC4081809ABFC280002001207047000017289FBF034B00011954002088BF0120704700BF1970004017289FBF054B00011A5C01F0A3
-:4026000007019DBF1143195400200120704700BF1470004017289FBF034B0001185C00F0070088BFFF20704714700040172810B51AD8C00001F07F0100F1804441EAC212E7
-:4026400004F5EC44D2B222709DF8082003F00F0343EA0213DBB263709DF80C30002003F00F03A370E07010BD012010BD10B500F067FC0A4A5378182B0AD91478013B5370BB
-:40268000E30003F1804303F5F0431B78137000E0FF2400F059FC204610BD00BFE480FF1F030610B5044611D400F04AFC084AE300117803F1804303F5F043197053781470D8
-:4026C00001335370BDE8104000F03EBC10BD00BFE480FF1F30B504060CD411F4704509D1C40004F1804404F5F0442180A270E370284630BD012030BD03065FBFC00000F1A2
-:40270000804000F5F04081805ABFC280002001207047000038B50446084DB4F5004F05D9286800F005FCA4F50044F6E7034B58686043BDE8384000F0FBBB00BFEC80FF1F06
-:40274000024B1B7A584300F0F3BB00BFEC80FF1F0E4B00F003001A78490102F0FC02104318701A7801F0600142F080021A701A7802F07F021A701A7802F09F020A431A7055
-:402780001A7842F010021A70704700BF83430040014B01221A70704784430040044B00F00F021B6853F8220043F82210704700BF08ED00E0054A00F01F00126800F11003B2
-:4027C00052F8230042F82310704700BF08ED00E000F01F0000F16040490100F56440C9B2017070470F4B10B50F4900240F205C609C60DC601C615C61FFF7D0FF0B4A136801
-:4028000043F0040313600A4B4FF47A72DB68B3FBF2F3084A1360084B4FF400421C60C3F8E82010BD3C86FF1F9128000010E000E0EC80FF1F14E000E018E000E0024A136882
-:4028400043F002031360704710E000E008B5FFF7F5FF034A136843F00103136008BD00BF10E000E010B5054CA3691BB9FFF7BAFF0123A361BDE81040FFF7E8BF3C86FF1F7A
-:40288000024B1868C0F30040704700BF10E000E038B5FFF7F5FF012808D1054D002455F8243003B198470134052CF8D138BD00BF4086FF1F024B03EB8003586859607047DA
-:4028C0003C86FF1F134B144A1B78DBB20360127843EA0223114A0360127843EA0243104A0360127843EA026303600E4B0E4A1B78DBB24360127843EA02230C4A4360127814
-:4029000043EA02430A4A4360127843EA02634360704700BF0301004904010049EC460040020100490101004900010049050100490601004910B500F003FB204A044613787A
-:402940000A2043F002031370137C43F00203137412F80A3C43F0010302F80A3C937943F00103937102F5AB52137843F003031370134B18221A7013F8012C42F0400203F812
-:40298000012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222183B1A70094A137843F008031370FFF7CAFE064B10222046BDE810401A6000F0C6BAAB430040A7
-:4029C0000E5900402F5B004080E200E008B500F0B7FA0F4A137803F0FE031370A2F5AA521D3A137803F0FD031370137C03F0FD03137412F80A3C03F0FE0302F80A3C9379E7
-:402A000003F0FE039371BDE8084000F09DBA00BF08590040044A137803F03F0343EA8010C0B21070704700BF08590040082804D00A280CBF8223C22300E0422308380E4ACE
-:402A4000C0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A8042F210734B4341F2883103F6C41393FBF1F305490B60054B1A8070470A590040E639000087
-:402A80000A87FF1F0C87FF1F1087FF1F08B5102000F0A6F907210420FFF79AFE07490420FFF788FE064A0C20137843F006031370FFF7BCFF034B00221A8008BD852B0000C5
-:402AC000095900400887FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040FFF72ABF5886FF1F044B1A7802F0FB021A701A7842F001021A7070470859004010B5084B8F
-:402B00001C7814F0010403D10028F9D0002404E02046FFF715FE024B1B78204610BD00BF09590040034A044B1B881088181A00B2704700BF1087FF1FA25B00400E4A138832
-:402B40001BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107300B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F000B270470A87FF1F0C87FF1F31
-:402B80000887FF1F7047000010B500F0D9F9214A044613780A2043F001031370137C43F00103137412F80A3C43F0020302F80A3C937943F00203937102F5AA5218321378E1
-:402BC00043F003031370144B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222123B1A70094A137843F008031370FFF7A3
-:402C00009FFD074B08222046BDE810401A6000F09BB900BFAB43004006590040275B004080E200E008B500F08BF90F4A137803F0FE031370A2F5AA52153A137803F0FE03E6
-:402C40001370137C03F0FE03137412F80A3C03F0FD0302F80A3C937903F0FD039371BDE8084000F071B900BF00590040044A137803F03F0343EA8010C0B21070704700BFAF
-:402C800000590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A8042F210734B4341F2883103F6A9
-:402CC000C41393FBF1F305490B60054B1A80704702590040F03900001687FF1F1C87FF1F1487FF1F08B5102000F084F807210320FFF76EFD07490320FFF75CFD064A0C20F5
-:402D0000137843F006031370FFF7BCFF034B00221A8008BDDD2D0000015900401887FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040FFF728BF5986FF1F044B1A78AB
-:402D400002F0FB021A701A7842F001021A7070470059004010B5084B1C7814F0010403D10028F9D0002404E02046FFF7E9FC024B1B78204610BD00BF01590040034A044B6E
-:402D80001B881088181A00B2704700BF1487FF1FA05B00400E4A13881BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107300B203FB00F2022391FBF3F35E
-:402DC0000028D8BF5B42134493FBF1F000B270471687FF1F1C87FF1F1887FF1F70470000034A00F0F800137803431370704700BF02410040034A00F0F8001378034313704D
-:402E0000704700BF06410040014B1870704700BF78650040014B1870704700BF7564004073B515461E460B4C04230022019200920A46014618462370FFF7F8FB32462946C7
-:402E40002078FFF7B3FB02212078FFF79DFB207802B070BDFC80FF1F074A0223136002F688321268E0215064044A11706FF440710A441360704700BF80E100E001E400E0D2
-:402E8000FEB5494652465B460EB40746244909688A46244A12682448022100F071F8030020480068C018204900F06AF8143883460121C9430C460125002600F041F88146D3
-:402EC00051460B7823400B705846013000F030F83800F04028400B78234003430B70584600F026F80136072EF2D9002001300138013001200B78234003430B705846043044
-:402F000000F016F8484600F01FF800BF00BF00BF0EBC894692469B46FEBD00BFAFF30080D480FF1FF880FF1F00C20100000000000230800803D000BF01380046FCD17047B9
-:402F4000EFF3108072B6704780F31088704700BF094A137803F00303012B0AD0022B09D113790C2103F07F02044B01FB02339B7A00E0137900207047006000409486FF1FBE
-:402F8000002902D0B0FBF1F0704708B14FF0FF3000F008B80029F8D00246B0FBF1F000FB11217047704700BF014B1868704700BF6081FF1F0E4B70B51E460E4C0025E41A3D
-:402FC000A410A54204D056F8253098470135F8E700F0BAFD084B094C1E46E41AA4100025A54204D056F8253098470135F8E770BD543B0000543B0000543B00005C3B00007E
-:4030000003460244934202D003F8011BFAE7704730B5141E05469BB0184604DA8B232B604FF0FF301DE04FF40273ADF80C300CBF234604F1FF33029305934FF6FF730091B5
-:403040000491ADF80E3002461E9B6946284600F073F8431CBCBF8B232B6014B1009B00221A701BB030BD000007B5009313460A46014603480068FFF7CBFF03B05DF804FBCF
-:403080006081FF1F2DE9F0478E6882469E420C46914698463ED88A8912F4906F3AD02568096902236F1A656905EB450595FBF3F57B1C43449D4238BF1D4653050FD52946B8
-:4030C00000F04AFB064698B13A46216900F0D2FAA38923F4906343F08003A38113E02A4600F098FB064670B92169504600F0E8FA0C23CAF80030A3894FF0FF3043F04003B2
-:40310000A381BDE8F08726613E44266046466561ED1BA560464528BF464649463246206800F0B3FAA36800209B1BA36023681E442660BDE8F08700002DE9F04F9DB003938C
-:403140008B8980461C060D4616460DD50B695BB9402100F001FB2860286118B90C23C8F80030CDE040236B610023099320238DF82930DFF89CB130238DF82A3037463C46DB
-:4031800014F8013B1BB9B7EB060910D003E0252BF9D02746F3E74B46324629464046FFF771FF013000F0A780099B4B4409933B78002B00F0A08000234FF0FF3204930793F2
-:4031C000059206938DF853301A930126052221784E4800F041FA671C049B38B14B4A3C46801A06FA00F018430490EFE7D90644BF20228DF853201A0744BF2B228DF853204C
-:4032000022782A2A03D0079A00210A200BE0039A111D12680391002A10DA524243F00200079204900BE027463B780134303B092B03D800FB02320121F5E701B107923B782E
-:403240002E2B1ED17B782A2B0AD1039B02371A1D1B680392002BB8BF4FF0FF33059310E0002319460593781C0A2407463A780130303A092A03D804FB01210123F5E703B1C9
-:40328000059103223978224800F0E6F940B14023CBEB000003FA00F0049B013718430490397806221B487E1C8DF8281000F0D4F988B1194B33B9039B073323F007030833A3
-:4032C000039314E003AB00932A46144B04A94046AFF3008007E003AB00932A460F4B04A9404600F093F8B0F1FF3F824603D0099B5344099342E7AB895B0601D4099801E0D9
-:403300004FF0FF301DB0BDE8F08F00BF233B0000293B00002D3B000000000000853000002DE9F04791461F460A698B6806469342B8BF1346C9F8003091F843200C46DDF8AC
-:40334000208012B10133C9F800302368990642BFD9F800300233C9F80030256815F0060510D104F1190A07E00123524639463046C04701301AD00135E368D9F800209B1AFC
-:403380009D42F1DB94F843302268003318BF012392060FD5E118302081F843005A1C94F845102244023382F8431003E04FF0FF30BDE8F08704F1430239463046C047013097
-:4033C000F4D02268D9F80050E36802F00602042A08BF5D1B2269A3680CBF25EAE57500259342C4BF9B1AED184FF000091A344D4509D00123224639463046C0470130D5D04C
-:4034000009F10109F3E70020BDE8F0872DE9F04317460A7E85B06E2A984606460C460C9B01F1430E00F0AE8011D8632A22D009D8002A00F0BB80582A40F0CA8081F845207B
-:40344000834955E0642A1ED0692A1CD0C0E0732A00F0B08009D86F2A2ED0702A40F0B8800A6842F020020A603EE0752A24D0782A3AD0ADE01A6801F14205111D1960136882
-:4034800084F84230A8E021681A6811F0800F02D0111D196008E011F0400F02F10401196002D0B2F9003000E01368002B3CDA2D225B4284F8432037E021681A6811F0800F13
-:4034C00002D0111D196007E011F0400F02F10401196001D0138800E01368227E5C496F2A14BF0A2208221BE078225A4984F845202268186812F0800F00F104051D6003D1DE
-:40350000550601D5038800E00368D00744BF42F0200222601BB9226822F0200222601022002084F8430001E049490A226568002DA56008DB206820F0040020602BB9002D01
-:403540007DD175460CE0002B79D07546B3FBF2F002FB1033CB5C05F8013D03460028F5D1082A0BD12368DA0708D5236962689A42DEBF302305F8013C05F1FF35C5EB0E0320
-:4035800023612EE008681A6810F0800F496903D0101D1860136808E010F0400F02F104001860136801D0198000E0196000232361754616E01A68111D196015680021626886
-:4035C000284600F049F808B1401B6060636804E004F1420584F8422001232361002384F84330CDF800803B4603AA21463046FFF797FE013002D14FF0FF3026E023692A4686
-:4036000039463046C0470130F5D023689B0710D5002504F1190907E001234A4639463046C0470130E7D00135E368039A9B1A9D42F2DBE068039B9842B8BF184605E00B784F
-:4036400004F1420584F842308AE705B0BDE8F083D5390000343B000010B5C9B202449042034605D01C7801308C42F8D1184610BD002010BD10B5431E0A44914204D011F857
-:40368000014B03F8014FF8E710BD884210B501EB020301D8421E0BE09842FBD28118D21AD34204D013F8014D01F8014DF8E710BD994204D011F8014B02F8014FF8E710BDC8
-:4036C00038B50546002944D051F8043C0C1F002BB8BFE41800F0D4F81E4A1368114613B96360146030E0A3420DD92268A018834201BF18685B681218226063600C6023E047
-:40370000A24203D813465A68002AF9D118681918A1420BD12168014458188242196013D110685268014419605A600DE002D90C232B6009E021686018824201BF1068526820
-:403740000918216062605C602846BDE8384000F098B838BD6086FF1F70B5CD1C25F0030508350C2D38BF0C25002D064601DBA94202D90C23336046E000F082F8234B1C683D
-:403780001A462146A1B10B685B1B0ED40B2B03D90B60CC18CD501EE08C420BBF63684B681360636018BF0C4615E00C464968E9E7174C23681BB9304600F052F8206029460B
-:4037C000304600F04DF8431C18D0C41C24F00304A0420DD12560304600F053F804F10B00231D20F00700C31A0ED05A42E25070BD211A304600F034F80130EBD10C2333605D
-:40380000304600F03EF8002070BD00BF6086FF1F5C86FF1FF8B5074615460E4621B91146BDE8F840FFF798BF1AB9FFF749FF2846F8BD00F027F885420ED929463846FFF704
-:403840008BFF044650B131462A46FFF713FF31463846FFF735FF01E03046F8BD2046F8BD38B5064C0023054608462360FDF7EAFB431C02D1236803B12B6038BD4487FF1F0D
-:403880007047704751F8040C0028BEBF091851F8043CC0180438704700000000050209020B020D020F02110213027265706C792030782530327800686F6D696E6700626584
-:4038C00067696E6E696E67207365656B2066726F6D20256420746F2025640066696E6973686564207365656B0057616974696E6720666F72205553422E2E2E005553422003
-:40390000726561647900636F6D6D616E642030782530327800756E64657272756E206166746572202564207061636B65747300636F756E743D256420693D256420643D254F
-:403940006400636D645F777269746500703D25642063723D25642063773D256420663D256420773D256420696E6465783D256420756E64657272756E3D25640077726974AE
-:40398000652066696E69736865640073746172742065726173696E670073746F702065726173696E670069646C65000051004010004051004030000000014000100014018C
-:4039C00040000800400140000A004C0140000200500140200030313233343536373839414243444546000001000000040000001000010000000400000010000028000000C0
-:403A0000000104000100000000000000000157494E5553420000303030303100000000000000000012034D005300460054003100300030000100000001000000403A00005A
-:403A4000010000000F3B0000000000000000000001000000583A000001000000E13A0000040000007A3A0000000000000000000000000000783A0000FF00000001024000A0
-:403A8000FF00000082024000FF00000003034000FF00000084034000FF00020304030904160346006C007500780045006E00670069006E0065002A0343006F0077006C0050
-:403AC000610072006B00200054006500630068006E006F006C006F0067006900650073000009022E0001010080320904000004FF0000010705010240000007058202400067
-:403B0000000705030340000A0705840340000A12010002FF0001080912006E0100020180014300232D302B2000686C4C00656667454647003031323334353637383961621F
-:403B40006364656600000000F8B500BFF8BC08BC9E46704759000000C1100000F8B500BFF8BC08BC9E46704735000000803B0000C880FF1FA0000000E005000000000000B0
-:403B8000000000004887FF1FFF000000675000400C00000007000000FFFFFFFF7F8000003F0000000000007D00FA0000400000000090D003FF0000000000000000000000BC
-:403BC000000000000000000000000000000000000000000000000000213B000000000000000000000000000000000000000000000000000000000000000000000000000069
-:403C00000000000000000000000000000000000000000000000000000081FF1F000000000000000000000000000000000000000000000000000000000000000000000000E5
-:403C40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000044
-:403C80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000004
-:403CC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C4
-:403D00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000083
-:403D40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000043
-:403D80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000003
+:400000000080002011000000A1100000A1100000064A08B5136843F020031360044B1A6803F53F5302331A6001F058F8E8460040FA46004010B5054C237833B9044B13B173
+:400040000448AFF300800123237010BD6081FF1F00000000F0380000084B10B51BB108490848AFF300800848036803B910BD074B002BFBD0BDE81040184700BF0000000021
+:400080006481FF1FF0380000C880FF1F000000000A4A0B4B116801310B40002BBEBF03F1FF3363F03F030133136011685368994202BF024B01221A72704700BF8081FF1FA4
+:4000C0003F0000800A4A0B4B516801310B40002BBEBF03F1FF3363F03F030133536051681368994202BF024B01221A72704700BF8081FF1F3F000080114BDA68196919B905
+:4001000001221A75597514E09969521A19698A4294BF587D00201875187D094908B1002204E0086982428CBF002201224A75DA689A611B7D13B1002002F082B9704700BF34
+:400140008081FF1F10B5C4B2204601F089F90128FAD110BD08B572B60F4B0F49DA680132DA60DA690132C82A08BF0022DA611A6AD8690132A72A08BF00220A621B6A002BEB
+:400180000CBF02230023002814BF184643F0010002F0DAFB62B608BD8081FF1F38B50446C5B2284602F0C4F8062002F099FD44F00200C0B202F0BCF8062002F091FD284602
+:4001C00002F0B6F8BDE83840062002F073BD10B5642402F0A7F828B9FFF7E0FF013CF8D1204610BD012010BD70B5C4B2054620460E4601F035F9012805D0204601F04EFAE3
+:400200002846FFF79FFF204601F032F9314605460246204601F0EEF9204601F021F90028FAD1284670BD000038B5044D0024285D013402F005FD402CF9D138BDA481FF1F75
+:4002400008B502F0FDF9002002F006FA02F018FA02F022FA80B208BD10B50446012002F07FF8642002F026FDFFF7EAFF2080002002F076F8642002F01DFDFFF7E1FF608047
+:4002800010BD08B502F008FB002002F011FB02F023FB02F02DFB80B208BD10B50446FFF796FF322002F006FDFFF7EBFF20800120FFF774FF322002F0FDFCFFF7E2FF6080A1
+:4002C00010BD0FB400B593B014AB53F8042B402102A8019302F0F4FE02A802F0BEF802F0C8F813B05DF804EB04B0704710B5044601780648FFF7E5FF0420FFF723FF62787E
+:400300002146BDE81040042001F002B90C3A000007B50023ADF804308DF80600032301A88DF80530FFF7E2FF03B05DF804FB000010B5074C94F8643043B1002001F0ECFF79
+:40034000002002F083F8002384F8643010BD00BF8081FF1F38B5124D837895F8672004469A4204D0FFF7E4FF002385F86A302368C5F8653022790B4B1A71A378002B14BF38
+:400380000220012002F062F8E078B0FA80F0400902F0D4FA2079BDE8384002F0DBBA00BF8081FF1FE581FF1F38B50D4C94F8645065B904F16500FFF7CDFF012001F0ACFF17
+:4003C0004FF47A7002F076FC84F86A50E368E366012384F86430BDE8384002F0A9BC00BF8081FF1FF8B5214C0546FFF7DDFF94F86A3003B15DB91E48FFF763FFFFF7E7FE5C
+:400400000120002384F86A00236702F069FC2A46216F1848FFF755FF144E0027236F9D4216D001F07FFF00B13767236F9D4205DD0120FFF7B3FE336F013305E005DA002094
+:40044000FFF7ACFE336F013B336702F071FCE5E7322002F02FFC2A2DCCBF0020012002F07FFABDE8F8400448FFF72BBF8081FF1F193A0000203A00003D3A00002DE9F04F9B
+:4004800099B062B602F0BEFC9F49042002F0E2FC9E4801F053FF9E4801F084FF9D4801F0B1FF02F06DF902F03FF8002001F0CEFF01F0D2FF0221002000F088FF012001F05D
+:4004C00001F9954D0321084602F012FC2E462C4602F02EFC95F8643043B1EA6EEB689B1A41F28832934201D9FFF722FF00F0A6FF18B98A48FFF7E5FE04E000F0A5FF0028D3
+:40050000F7D134E000F09AFF10B902F011FCF9E78348FFF7D6FE032001F0C0F88148FFF7D0FE002386F86730FFF73EFFFFF74FFE86F87400FFF7FCFE012386F86730FFF701
+:4005400033FFFFF744FE86F87500FFF7F1FE96F874007549754B96F87520002A14BF0A461A46002808BF19467148FFF7AAFE032000F076FF0128ABD16E48FFF7EBFE6E49CB
+:400580000320FFF731FE94F876106C48FFF799FE94F87630023B142B00F2D783DFE813F01500D5031E00D5032400D5035000D5037600D503DA00D503C201D5030903D50356
+:4005C0002D03D5033403D5034E0303238DF820308DF8213011238DF822302BE394F87800FFF700FF564B22E340F2DC57FFF7DCFE00232375E068227D02F0FF012AB9EB680B
+:400600001B1ABB42F7DD0B4611E083B10022174696F87810F068277594F814E0BEF1000F02D1EB681B1AF7E701329142F3DA07228DF8202004228DF82120ADF82230F9E2BF
+:400640000220FFF77FFD4FF000080DF1200A02F06FFB4FF480790027C9EB0803DA1907F80A200137402FF9D10220FFF76BFD3A465146022000F04CFFB9F10109EBD108F10F
+:400680000108B8F1400FE2D12E4B38E04FF0010A4FF000080DF1200B02F04AFB4FF0000959460120FFF7A0FD08EB090300270493049B1BF807203B44DBB29A4209D08DE89D
+:4006C0000C0041463B464A461F48FFF7FAFD4FF0000A0137402FEBD109F10109B9F5807FDED108F10108B8F1400FD5D151461748FFF7E7FDBAF1000F00F01C81144B1B883D
+:4007000007A8ADF81C3096E255010000F900000091000000C50000008081FF1F523A0000653A00006F3A00004B3A00004F3A0000823A0000E581FF1FF681FF1F9A3A000052
+:40074000F4380000F6380000A93A0000C53A0000F8380000206FFFF745FE94F8780001F0FFFD94F8780001F0E3FD02F015FCB94BDFF8FC821A78002702F0FB021A701A785F
+:4007800042F001021A701A7802F0FE021A701A7802F0FE021A7002F003FC0220FFF7D2FC012141F6FF734FF48042084601F0DEFD84F8B60002F02AFA08F807000137402FA7
+:4007C000F8D1DFF8B0A200270AF195091FFA89F80137402F14BF3A4600221AF8010F2244062392F82420402102F044FA424646F24E419AF8000002F04FFA08F14008402FB5
+:400800001FFA88F8E4D196F8793053B196F87C30336100233375237D002BFCD000233375336100234FF0FF32236062602372236894F8B600234493F8241002F09FF994F82A
+:40084000B60002F05DF9012194F8B60002F030F92368002BFCD0002398467360D6F80CA0012702F065FAE368B4F87A20CAEB030393420DD367B1042195F8B60002F08AF9BC
+:4008800094F8B60002F096F90028F9D107463072237AFBB96A682B689A4202D1002FE0D118E00220FFF74EFC6968402209EB8111022000F02DFE6A68674B01321340002BCA
+:4008C000BEBF03F1FF3363F03F03013308F101086360C6E70220277AFFF734FC00221146022000F015FE0220FFF72CFCFFB2FFF79BFC002001F01CFD37B15848FFF7E1FC90
+:400900000220FFF705FD06E0554B08A81B88ADF82030FFF7EBFC227D4146237A5148FFF7D0FC15E25048FFF7CCFCD4F87A7017F03F0701D0032009E2286FFFF753FD95F83B
+:40094000780001F00DFD95F8780001F0F1FC012001F098FD02F020FB444BDFF814811A7842F004021A701A7842F001021A701A7802F0FE021A701A7802F0FE021A7002F0BF
+:400980000FFB01214FF4804341F6FF72084601F01DFD85F8B60002F039F908F807000137402FF8D1DFF8CC90002709F195031FFA83F804930137402F14BF3A46002219F8F2
+:4009C000010F2244052392F82420402102F052F9414646F2484299F8000002F05DF908F14008402F1FFA88F8E4D100274FF0FF33376098467360BB463B46D6F87A903772EA
+:400A00005FEA99190CBF4FF0010A4FF0000A2168114A01310A40002ABCBF02F1FF3262F03F026068B8BF013282426FD02BB1227A002A7AD12A7D002A77D12068049A059368
+:400A400002EB8010BAF1000F16D040223F2102F003FB1CE09E6400403F000080CF3A0000FA380000E93A0000FC3A000098640040A481FF1FA381FF1F014601370120FFF7BF
+:400A8000B3FBC7EB0903D3F1000A4AEB030A2168B34A01310A40002ABEBF02F1FF3262F03F02013222606268059B01322ED12A683F2A2BD14FF00008C5F8048001F0B4FCE9
+:400AC00085F808806B6895F8B6002B4493F8241002F054F895F8B60002F012F8012195F8B60001F0E5FF95F87E302B6185F81480237D002BFCD04FF00008012086F814800D
+:400B000001F09EFC404601F0BDFC00E023B1237A5BB92B7D4BB90123626842453FF477AF0BF1010BD5F8048071E701F083FC012001F0A8FC002001F083FC042194F8B6004D
+:400B400002F028F894F8B60002F034F880460028F8D196F8B60001F0C1FF337D327A0293012303920193CDF800A05B463A4649467C48FFF7A6FBC6F81080BAF1000F0BD0C6
+:400B8000FFF752FB002001F0D3FB237A63B17648FFF797FB0220D9E0B945F1D073490120FFF722FB0137F7E77148FFF78AFB714B3DE094F8780001F0D3FB206FFFF712FC19
+:400BC0006D48FFF77EFB94F87930236100232375237D002BFCD0012001F032FC00233375237D002BFCD0002001F02AFC002363483361FFF766FB624B19E0002084F86A0088
+:400C0000FFF7F0FB5F4B12E094F8743023B195F875200AB985F8782094F875201AB113B9012385F878305848FFF794FB574B1B88ADF8203008A8FFF759FB89E0FFF778FB0D
+:400C400001F01CFE002001F0BFFD2A2701F0EAFC002001F08DFC3A46002108A802F0FCF917238DF820308DF8217002F061F8002001F052FB002001F0E9FBC82002F01AF8F3
+:400C80000DF12200FFF7E8FA0DF13600FFF705FB02F04EF8012001F0D9FB322002F00AF80DF12600FFF7D8FA0DF13A00FFF7F5FA012001F031FB4FF4967001F0FBFF02F041
+:400CC00037F80DF12E00FFF7C7FA0DF14200FFF7E4FA002001F020FB4FF4967001F0EAFF02F026F8022001F0B1FB322001F0E2FF0DEB0700FFF7B0FA0DF13E00FFF7CDFAF4
+:400D0000012001F009FB4FF4967001F0D3FF02F00FF80DF13200FFF79FFA0DF14600FFF7BCFA002001F0F8FA4FF4967001F0C2FF01F0FEFF002001F089FB002384F86A302F
+:400D400001F01EFD01F0F0FB74E70120FFF7E0FA032000F0A3FC0E48FFF7B3FAFFF7B8BB3F000080063B0000363B00003892FF1F403B0000FC380000483B0000563B00000F
+:400D8000FE38000000390000F681FF1F02390000633B00000F4B1A78120616D55878C0B2012814D11B79DBB2042B02D0052B05D07047094A094B5A60282203E0084A074B07
+:400DC0005A60E0221A8000F043BE002070470120704700BF0060004004390000BC92FF1F2C3900002DE9F04172B6884B61221A70A3F5F06301221A801924854A9C7092E807
+:400E000003008033062283F8002283E80300522203F580731A707F4B7F4A1B787F4EDBB2137040F618027E4B00251A8041F2512223F8022C33784FF4F07003F0010343EAA4
+:400E4000450502F0A1F8013C05F003052ED0032DF0D1744B4FF480721A8007221A70724A002548211570917002221D705D7103F8032C0422DA716D4A6D4C13786D4E43F060
+:400E80000103137012F8013C062743F0030302F8013C2378012243F0800323705B4B1A70654A137843F02003137000E0FEE707FB056300219A881868013502F0CDF8072D6A
+:400EC000F5D15E485E4E002550F8041F05F1105303F14A0221F0FF074B33C9B20B4452005B0002329A4206D012F802EC12F801CC0EF807C0F5E7B0420D44E5D1514A002390
+:400F000013609360136193614F4B504F1A68504BDFF888811A604F4B1A684F4B1A604F4A137843F002031370137C43F0020313742378A2F5863243F040032370413A1378DD
+:400F400043F010031370464A464B07CA03C31A80454A2833106843F8250C127903F8212C424A07CA03C31A80414AE83B07CA03C31A80404A083307CA03C31A803E4A3F4B11
+:400F8000A2F5616203CBC2F8100EC2F8141E1378042043F008031370394B02F5AA521B783D78DBB298F80060EDB203F007010C321B091170F6B2537045F003033B7046F095
+:400FC000030388F800302F4B48221A702E4A402313702E49937013729372082382F81F3220220A7048710A72294A0A20137001F077FE284B88F8006044223D70264D1A709B
+:4010000094E80F0007C52B80BDE8F08100480040680A00480F010049A146004025420040224200400440004006400040A2430040A0430040683B0000E8460040FCFFFF47E7
+:401040009000004800760040700A0048F846004020760040740A00482876004003500140280A0048C0510040340A00483C0A0048480A0048540A004832510040600A004800
+:40108000CF0100491D51004001590040235B0040585B004076580040B0430040F946004008B501F0ADFF03680C2B00D1FEE7FEE7084908B50B68084A1844821A802A01DC75
+:4010C000086005E001F09CFF0C2303604FF0FF33184608BDCC80FF1F8893FF1F80B51148114B0025C0B1A3F1100192C922460439161BB74204D051F8046F42F8046BF7E7E8
+:40110000114653F8046C8C1AA64202D041F8045BF9E701381033E5E701F078FFFFF7AEF9FEE700BF01000000FC3C0000124A134B10B51A60124A134C1368134843F4007367
+:4011400013600023032B98BF54F823204FEA830188BF0E4A0133302B4250F3D10C4B1A780C4B1A700C4B084A1A60FFF73BFEBDE8104001F087BC00BF0004FA050CED00E0A4
+:4011800014ED00E0000000000080FF1FA1100000BC760040C080FF1F08ED00E0F8B501F0FBFE4B4A01271378022643F001031370137C484C43F001031374474B02F5E352FA
+:4011C0001F700B3203F8946C1378054603F07F031370002001F084FD2378404A03F0F90323701378384603F0DF03137023783B43237001F075FD282001F072FD384B304610
+:401200001A7802F07F021A701A7802F0BF021A7023783343237001F063FD2378314A43F0040323700023137053702F4AFF2199540133092BFBD1284601F0B2FE07211720E7
+:4012400001F096FD2949172001F084FD0721182001F08EFD2649182001F07CFD0721152001F086FD2349152001F074FD0721052001F07EFD2049052001F06CFD072106201F
+:4012800001F076FD1D49062001F064FD0721084601F06EFD1A49072001F05CFD0721082001F066FD1749082001F054FD0021162001F05EFD1449162001F04CFD07210C2014
+:4012C00001F056FDBDE8F84010490C2001F042BDA5430040944300409D60004012600040F851004084600040AD92FF1F6B1B0000A5190000691B00009D1A0000C91A0000BE
+:40130000F91A0000311B0000711B0000E51B0000214B224A10B5187000231370204A40201370204A0F2413701F4A13701F4A13701F4A13701F4A13701F4B4FF400021A60B1
+:401340004FF080721A604FF400121A6020221A601860802018604FF480701860174804704FF480001860164B1A70933B19B91A7802F0FE0202E01A7842F001021A70114B50
+:4013800003221A70802203F8202C012001F0FCFD0D4B04221A7010BDC892FF1FCE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F00E100E09E6000407A
+:4013C0009C600040286000401260004070B5074C054623780E461BB9FFF7E0FE0123237031462846BDE87040FFF792BF7892FF1F0A4A002313700A4A13700A4A13700A4A81
+:4014000013700A4A13700A4A13700A4A13700A4B03221A70802203F8202C7047CE92FF1FCC92FF1FCD92FF1FC992FF1FB892FF1FCB92FF1F4093FF1F28600040014B187898
+:40144000704700BFCD92FF1F044B1A7802F0FF001AB118780022C0B21A707047CC92FF1F024A0C2303FB002040787047D492FF1F431E072B0CD8074A064B00010344805C32
+:401480005B7800F00F0043EA0020023880B2704700207047FC5F00401A4A38B50C2303FB00231B79090C13F0800F00F1FF35044619BF8AB24FF480438BB24FF48042032DA1
+:4014C00018D8DFE805F002070C110021084601F0A1FA0DE00021084601F080FA08E00021084601F05FFA03E00021084601F03EFA054B1855EDB2072D03D801F087FB034B10
+:40150000185538BDD492FF1FA492FF1FAD92FF1F431E072B2DE9F0470446894615465CD82F4F0C2202FB0072D388DFF8B8A09BB2C3F500739D424FF00C0303FB007388BF8A
+:40154000D588DB7884BFC5F50075ADB2254A43EA15230601B354B244EBB28AF80130224B1A5C9846FF2A01D1FFF796FF0C2303FB047200215170B9F1000F28D03DB31B4FEB
+:40158000385D01F0ABFA11232946FE2218F8040001F070FB06F5C04278321FFA89F118F8040001F079FB124D18F80410385D01F0E5FA0121385D01F07BFA735D43F002030D
+:4015C0007355735D03F0FD037355BDE8F08703FB04746379DBB28AF80230BDE8F08700BFD492FF1FFC5F0040AD92FF1FA492FF1F706000402DE9F047044615468846002945
+:4016000040D0431E072B3FD8FFF732FFA84203D22046FFF72DFF05461D4E335DFF2B03D141462046FFF738FFDFF868A027011AF8040001F053FA1223FE222946305D01F087
+:4016400019FB07F5C0411FFA88F27831305D01F023FBDFF84490315D1AF8040001F08EFA01211AF8040001F023FA17F8093043F0020307F8093017F8093003F0FD0307F881
+:40168000093002E00D4600E000252846BDE8F087AD92FF1FA492FF1F70600040431E072B0AD8064A0C2303FB002300225A705A79034BD2B200011A54704700BFD492FF1F5D
+:4016C000FE5F0040431E072B9FBF024B000108221A547047FE5F004030B51A4A1A491B4D0878138803449BB21380194A00231488D8B2A4B27CB1082B0CD050680078C0B2EC
+:40170000E85450680133013050601088013880B21080ECE718460B780E4C082B0E4A00D040B10E4D2B7883F080032B700F232370022301E0022323701370094B18700870CA
+:4017400030BD00BF4493FF1F4093FF1F00600040BC92FF1FB992FF1FCE92FF1FCA92FF1F4193FF1F074B02221A70074B80221A70064B0F221A70064A00231370054A012088
+:4017800013707047CE92FF1FCA92FF1FB992FF1F4093FF1F4193FF1F30B5164B16491B780A8803F00F03023BDBB21A4492B20A80124C134A0020118889B279B173B155682C
+:4017C000215C013BC9B229705168DBB20131516011880130013989B21180ECE7094A1370094A137883F080031370084B0B221A7030BD00BF296000404493FF1F006000400F
+:40180000BC92FF1F4193FF1FCA92FF1FB992FF1F064A06231370064A01201370054B80221A70054B00221A70704700BFCE92FF1FB992FF1FCA92FF1F4193FF1F054B9A68E4
+:401840003AB19A68044910709A680988518000229A607047BC92FF1F4493FF1F08B5124B1A78D2B21A701B78DBB21A0602D50F4A137008BD0220FFF7E1FF0D4B1B7803F0CE
+:401880006003202B05D0402B06D043B900F012FC04E001F089FB01E0FFF77CFA10B9034B03221A7008BD00BF28600040B992FF1F0060004008B5084A084B012019781388FA
+:4018C0000B449BB21380064B00221A70FFF7B6FF044B03221A7008BD4493FF1F4093FF1FCE92FF1FB992FF1F08B50C4B1B78DBB2042B07D0062B09D0022B0DD1BDE8084045
+:40190000FFF7D8BFBDE80840FFF746BF0320FFF795FF034B03221A7008BD00BFCE92FF1FB992FF1F08B5054B002201201A70FFF785FF034B03221A7008BD00BFCE92FF1FCA
+:40194000B992FF1F08B50A4B1A7832B11A78094942F080020A7000221A70074B002201201A70FFF76BFF054B03221A7008BD00BFB892FF1F08600040CE92FF1FB992FF1FC0
+:40198000074B1B78DBB2042B05D0062B05D0022B05D1FFF7A1BEFFF7C5BFFFF7D3BF7047CE92FF1F38B51D4C2378DBB2DD0634D518060AD503F00F03012B2ED1FFF74EFF42
+:4019C000174B1B78190609D538BD5A0602D5FFF7D7FF03E09D0620D5FFF786FF23781B061BD4104B1A78104B1B7813430F4A13701278934211D10A4A0849154613782078EB
+:401A0000DBB2000605D41378DBB20B700B7803F00F0328788342F1D138BD38BD28600040B992FF1FCA92FF1F4193FF1F29600040054A00231380054A916819B191680B701D
+:401A400092685380704700BF4493FF1FBC92FF1F0E4808B503889BB213B9FFF783FE13E00B4B02221A700B4B00221A70FFF7E0FF094AD1799379028843EA012392B2934229
+:401A800038BF0380FFF728FE012008BDBC92FF1FCE92FF1FCA92FF1F00600040084B01221A700F3B9B7C074B1A7B02F00302012A1EBFDA7B82F08002DA7301225A73704722
+:401AC0000B600040D492FF1F094B02221A700F3B93F82230074B1A7E02F00302012A1EBFDA7E82F08002DA7601225A76704700BF0B600040D492FF1F0B4B04221A700F3B21
+:401B000093F83230094B93F8242002F00302012A1EBF93F8272082F0800283F82720012283F82520704700BF0B600040D492FF1F0B4B08221A700F3B93F84230094B93F856
+:401B4000302002F00302012A1EBF93F8332082F0800283F83320012283F83120704700BF0B600040D492FF1F7047FFF741BC0000F0B5184B184E19780C27C9B201234FF028
+:401B8000000C31B3CA0720D5144A4FEA031E7244947850782040C5070DD507FB03652C79240608D5147804F0FE0414706D790C4CEDB204F80E50840706D507FB036425795F
+:401BC0002D0658BF84F801C090700133DBB24908D7E7F0BD9F600040D492FF1F70600040FE5F004000F032BF70B50446184B88B003AA03F11006154618685968083303C530
+:401C0000B3422A46F7D11B782B70FCB12223237001AD03232846637001F024F9002220461146AB5C08AC04EB131414F8144C03F00F03847008AC234413F8143C0132082AB1
+:401C4000C1700371417100F10400EAD108B070BD923B00002DE9F0431C4D01222E460C201F274FF0800E4FF0080C194B00FB02581401234418705F70164998F8059021445B
+:401C8000B9F1000F07D098F8044024064CBF887081F802C001E081F802E000FB0261CC880132E4B29C71CC88092AC4F30724DC71CC88E4B21C71C988C1F307215971D4D1CB
+:401CC000054BFF221A70BDE8F08300BFD492FF1F70600040FC5F00400A600040064B074A1B7802EBC30253681A7C824286BF03EBC003586900207047C892FF1FB83B000044
+:401D00002DE9F84F424B1A78002A7ED01878414D0138C0B2FFF7E2FFA8463F4AC3681478007ADFF800C1E4B203EBC0000C2600274FF0010E834268D01A78A24263D11CF829
+:401D40000420597891425ED19A7893F8039002F07F0206FB02FA05EB0A01CF7093F802B009F0030981F804B093F803B005F80AB0B3F804A0A1F808A093F902A0BAF1000FB6
+:401D80000BDAB9F1010F0CBF4FF007094FF00D0981F8059081F801E009E0B9F1010F0CBF4FF005094FF0090981F805904F704FEA02191A4906FB0282494481F802E0B2F806
+:401DC00008A0CAF3072A81F800A0B2F808A05FFA8AFA81F801A0B2F806A011495FFA8AFA494481F806A0B2F80690C9F3072981F80790B2F806905FFA89F981F80490D288FA
+:401E0000C2F307224A71083394E7BDE8F88F00BFCD92FF1FD492FF1FC992FF1FFC5F004070600040BA92FF1F08B5064B18780138C0B2FFF753FF20B143681B7900EBC3008A
+:401E4000406908BDCD92FF1F00212DE9F84F0B464E4E0C2707FB01F401313219092933554FF000059370494CD3701381937253705371EFD118B1464B1D70464B1D70464B16
+:401E80001A78002A7FD0187801250138C0B2FFF725FFA8464368DFF8F8E0DB790C2713F0400F3E4B4FF0000C1A7814BF42F0010202F0FE021A70027AD20007FB0541C368D0
+:401EC00003EB02094B4531D093F802A00AF07F06AE4229D10E89B3F804B0B6B25E4538BFA1F808B01E7893F801B01EF80660B3451AD181F804A0DE780E7093F902A0DE78D3
+:401F0000BAF1000F06F0030607DA012E0CBF07260D264E7181F8018006E0012E0CBF052609264E7181F801C00833CBE70135092DC3D1C1680A328B1C0A440C20083393423E
+:401F400009D013F8081C13F80A5C01F07F0100FB01418D72F2E7FFF767FF114B0121186000230C2000FB0142D3801289013113449BB203F00102134409299BB2F2D1BDE88B
+:401F8000F84FFFF767BEBDE8F88F00BFD492FF1FBA92FF1F4293FF1FCD92FF1FCB92FF1FD092FF1F114B1B7903F07F035A1E072A19D80F490C2202FB031291781B0141F08E
+:401FC000010191700021D170517841F002015170127912F0800F074A1A4414BF8D2389239370FFF715BC0020704700BF00600040D492FF1FFC5F004030B4194B1A7902F0D8
+:402000007F02531E072B27D8164B0C2404FB02339978154D01F0FE0199700021D97029461201505D114400F07F0050555A7802F0FD025A701A795B78120605D5012B01D167
+:402040008C7006E00D2303E0012B0CBF082309238B7030BCFFF7DCBB002030BC704700BF00600040D492FF1FFC5F004010B50D4B0D4C21791878C9B20138C0B2FFF72EFE80
+:4020800043681B798B4201D2012909D8074A0848535CDBB24354A3780120DBB2535410BD002010BDCD92FF1F00600040BA92FF1F4293FF1F38B5874A874C13780021DBB254
+:4020C00021801806517840F188800A2900F20081DFE811F05800FE00FE00FE00FE00FE000B00FE007900FE007D00D3787949012B09D17A4B1A787A4B03EBC2035B685B68FE
+:402100006360122310E0CB78022B12D18878FFF7E5FD002800F0DC80436863606368DA7863689B7843EA02232380BDE83840FFF78FBCCB78032B21D16A4B00228878D5B29B
+:40214000854203D3634A92783AB910E0187801320028F7D018780344F0E75E4A62499278097C914203D16148FFF73EFD5F4B1A78002A00F0AD801A78228018E0BDE8384099
+:4021800000F012BF13F0030313D0022B40F0A0802380504B0C211B7903F07F02544B01FB02339A78534BD2B21A7000225A706360BBE702222280504A11784E4AC9B2117026
+:4021C00053706260B1E7012323804C4BEFE70123238013794A4A1344E9E701390A2977D8DFE801F037764F76067676760A7620009378444ADBB25AE0937803F0FF0153B928
+:402200003E4B1A7891425FD019703F4B01201870FFF71AFE58E0481EC0B2FFF75FFD0028EED155E0FFF722FF002851D0294A374913791279DBB2D2B20A70354A3049D25C1E
+:40224000CB5C9A4240D0304B01221A70FFF758FD3AE003F00303012B2BD009D3022B37D11C4B9B78002B33D1BDE83840FFF7C4BE184B9B78012B2BD11F4A137803F0FD03CA
+:4022800015E003F00303012B13D008D3022B1FD1104B9B78E3B9BDE83840FFF783BE0D4B9B78012B14D1144A137843F0020313700AE0084B1A795AB998781B791549DBB239
+:4022C000CA5C22EA0002CA54BDE83840FFF7A0BA002038BD00600040BC92FF1FC892FF1FB83B00001C3C00008F3C00006093FF1FD492FF1F7992FF1FCB92FF1FCD92FF1FBA
+:40230000BA92FF1FB892FF1FCC92FF1FC992FF1F4293FF1FCF92FF1F014B1870704700BF72640040014B1878704700BF68650040014B1870704700BF7A650040064A0123C8
+:40234000136002F688321268E0211064034A1170A2F540721360704780E100E000E400E0014B1870704700BF7A64004073B515461E460B4C04230022019200920A46014658
+:402380001846237000F022FC32462946207800F0DDFB0221207800F0C7FB207802B070BDD080FF1F074A0223136002F688321268E0215064044A11706FF440710A44136017
+:4023C000704700BF80E100E001E400E073B515461E460B4C05230022019200920A4601461846237000F0F2FB32462946207800F0ADFB0221207800F097FB207802B070BD84
+:40240000D180FF1F064A0423136002F688321268E0219064034A1170A2F202321360704780E100E002E400E0014B04221A60704700E100E0014B04221A60704780E100E013
+:40244000014B1870704700BF7B650040014B1870704700BF73640040704738B505460078012428B100F038FD285D0134E4B2F8E738BD08B50D2000F02FFDBDE808400A20C6
+:4024800000F02ABD014B1870704700BF7865004010B500F081FD204A044613780A2043F002031370137C43F00203137412F80A3C43F0010302F80A3C937943F0010393712B
+:4024C00002F5AB52137843F003031370134B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CCE2203F8062CA3F597530222183B1A70094A137843F0AA
+:402500000803137000F0ECFB064B10222046BDE810401A6000F044BDAB4300400E5900402F5B004080E200E008B500F035FD0F4A137803F0FE031370A2F5AA521D3A13785D
+:4025400003F0FD031370137C03F0FD03137412F80A3C03F0FE0302F80A3C937903F0FE039371BDE8084000F01BBD00BF08590040044A137803F03F0343EA8010C0B2107082
+:40258000704700BF08590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF0000298BF33F910100A4B88BF11461A8042F210734B4341F2E4
+:4025C000883103F6C41393FBF1F305490B60054B1A8070470A590040A43B00004A93FF1F4C93FF1F5093FF1F08B5102000F036FA0721042000F0BCFB0749042000F0AAFB02
+:40260000064A0C20137843F006031370FFF7BCFF034B00221A8008BDE1260000095900404893FF1F10B5054C23781BB9FFF7DCFF01232370BDE81040FFF72ABF7B92FF1FA6
+:40264000044B1A7802F0FB021A701A7842F001021A7070470859004010B5084B1C7814F0010403D10028F9D0002404E0204600F037FB024B1B78204610BD00BF09590040D9
+:40268000034A044B1B881088181A00B2704700BF5093FF1FA25B00400E4A13881BB223B111880A2309B2594301E00B4B19680B4B1B88C01A42F2107300B203FB00F20223F1
+:4026C00091FBF3F30028D8BF5B42134493FBF1F000B270474A93FF1F4C93FF1F4893FF1F7047000010B500F057FC214A044613780A2043F001031370137C43F001031374BC
+:4027000012F80A3C43F0020302F80A3C937943F00203937102F5AA521832137843F003031370144B18221A7013F8012C42F0400203F8012C13F8012C02F0FC0203F8012CBE
+:40274000CE2203F8062CA3F597530222123B1A70094A137843F00803137000F0C1FA074B08222046BDE810401A6000F019BC00BFAB43004006590040275B004080E200E0CF
+:4027800008B500F009FC0F4A137803F0FE031370A2F5AA52153A137803F0FE031370137C03F0FE03137412F80A3C03F0FD0302F80A3C937903F0FD039371BDE8084000F0BB
+:4027C000EFBB00BF00590040044A137803F03F0343EA8010C0B21070704700BF00590040082804D00A280CBF8223C22300E0422308380E4AC0B20428137098BF0C4B4FF095
+:40280000000298BF33F910100A4B88BF11461A8042F210734B4341F2883103F6C41393FBF1F305490B60054B1A80704702590040AE3B00005693FF1F5C93FF1F5493FF1FFC
+:4028400008B5102000F014F90721032000F090FA0749032000F07EFA064A0C20137843F006031370FFF7BCFF034B00221A8008BD39290000015900405893FF1F10B5054C6D
+:4028800023781BB9FFF7DCFF01232370BDE81040FFF728BF7C92FF1F044B1A7802F0FB021A701A7842F001021A7070470059004010B5084B1C7814F0010403D10028F9D0AE
+:4028C000002404E0204600F00BFA024B1B78204610BD00BF01590040034A044B1B881088181A00B2704700BF5493FF1FA05B00400E4A13881BB223B111880A2309B25943E7
+:4029000001E00B4B19680B4B1B88C01A42F2107300B203FB00F2022391FBF3F30028D8BF5B42134493FBF1F000B270475693FF1F5C93FF1F5893FF1F70470000014B1870E9
+:40294000704700BF7B640040014B1870704700BF7F640040014B1870704700BF7C640040014B1870704700BF7E640040F7B516461F460B4C00230325019300930A460146B2
+:402980002846257000F022F93A463146207800F0DDF80221207800F0C7F8207803B0F0BDE080FF1FF7B516461F460B4C00230225019300930A4601462846257000F006F917
+:4029C0003A463146207800F0C1F82946207800F0ABF8207803B0F0BDE180FF1FF7B516461F460B4C00230125019300930A4601462846257000F0EAF83A463146207800F06F
+:402A0000A5F80221207800F08FF8207803B0F0BDE280FF1F73B515461E460B4C0023019300930A4601461846237000F0CFF832462946207800F08AF80221207800F074F880
+:402A4000207802B070BD00BFE380FF1F024B1878C0F38010704700BF8F450040034A00F0F800137803431370704700BF02410040034A00F0F800137803431370704700BF74
+:402A800006410040074A7F23802113705170064A013BDBB202F80839002BF9D1034A1370704700BFE480FF1FF87B00400078004017280FD8084B0001C25C11B142F020028D
+:402AC00001E002F0DF02C254C25C42F00102C25400207047012070471070004017280BD8064B0001C25C02F0FE02C254C25C02F0DF02C25400207047012070471070004024
+:402B000017280DD8074900010B4603441A7942F004021A71435C43F00103435400207047012070471070004017280BD8064A0001835C490003F0F10301F00E0119438154A3
+:402B400000207047012070471070004041F6FF73994208BF4FF400519A4208BF4FF4005217289FBFC00000F1804000F5EC4081809ABFC280002001207047000017289FBF6F
+:402B8000034B00011954002088BF0120704700BF1970004017289FBF054B00011A5C01F007019DBF1143195400200120704700BF1470004017289FBF034B0001185C00F04D
+:402BC000070088BFFF20704714700040172810B51AD8C00001F07F0100F1804441EAC21204F5EC44D2B222709DF8082003F00F0343EA0213DBB263709DF80C30002003F08B
+:402C00000F03A370E07010BD012010BD10B500F0C3F90A4A5378182B0AD91478013B5370E30003F1804303F5F0431B78137000E0FF2400F0B5F9204610BD00BFE480FF1F33
+:402C4000030610B5044611D400F0A6F9084AE300117803F1804303F5F04319705378147001335370BDE8104000F09AB910BD00BFE480FF1F30B504060CD411F4704509D1B0
+:402C8000C40004F1804404F5F0442180A270E370284630BD012030BD03065FBFC00000F1804000F5F04081805ABFC280002001207047000038B50446084DB4F5004F05D988
+:402CC000286800F061F9A4F50044F6E7034B58686043BDE8384000F057B900BFEC80FF1F024B1B7A584300F04FB900BFEC80FF1F0E4B00F003001A78490102F0FC02104300
+:402D000018701A7801F0600142F080021A701A7802F07F021A701A7802F09F020A431A701A7842F010021A70704700BF83430040014B01221A70704784430040044B00F08C
+:402D40000F021B6853F8220043F82210704700BF08ED00E0054A00F01F00126800F1100352F8230042F82310704700BF08ED00E000F01F0000F16040490100F56440C9B29B
+:402D8000017070470F4B10B50F4900240F205C609C60DC601C615C61FFF7D0FF0B4A136843F0040313600A4B4FF47A72DB68B3FBF2F3084A1360084B4FF400421C60C3F883
+:402DC000E82010BD8092FF1F312E000010E000E0EC80FF1F14E000E018E000E0024A136843F002031360704710E000E008B5FFF7F5FF034A136843F00103136008BD00BFD3
+:402E000010E000E010B5054CA3691BB9FFF7BAFF0123A361BDE81040FFF7E8BF8092FF1F024B1868C0F30040704700BF10E000E038B5FFF7F5FF012808D1054D002455F891
+:402E4000243003B198470134052CF8D138BD00BF8492FF1F024B03EB80035868596070478092FF1F134B144A1B78DBB20360127843EA0223114A0360127843EA0243104A07
+:402E80000360127843EA026303600E4B0E4A1B78DBB24360127843EA02230C4A4360127843EA02430A4A4360127843EA02634360704700BF0301004904010049EC460040B2
+:402EC000020100490101004900010049050100490601004900000000FEB5494652465B460EB40746244909688A46244A12682448022100F071F8030020480068C018204936
+:402F000000F06AF8143883460121C9430C460125002600F041F8814651460B7823400B705846013000F030F83800F04028400B78234003430B70584600F026F80136072E00
+:402F4000F2D9002001300138013001200B78234003430B705846043000F016F8484600F01FF800BF00BF00BF0EBC894692469B46FEBD00BFAFF30080D480FF1FF880FF1F6B
+:402F800000C20100000000000230800803D000BF01380046FCD17047EFF3108072B6704780F31088704700BF094A137803F00303012B0AD0022B09D113790C2103F07F021C
+:402FC000044B01FB02339B7A00E013790020704700600040D492FF1F002902D0B0FBF1F0704708B14FF0FF3000F008B80029F8D00246B0FBF1F000FB11217047704700BFA1
+:40300000014B1868704700BF5C81FF1F0E4B70B51E460E4C0025E41AA410A54204D056F8253098470135F8E700F04EFE084B094C1E46E41AA4100025A54204D056F8253071
+:4030400098470135F8E770BDD43C0000D43C0000D43C0000DC3C000003460244934202D003F8011BFAE7704730B5141E05469BB0184604DA8B232B604FF0FF301DE04FF432
+:403080000273ADF80C300CBF234604F1FF33029305934FF6FF7300910491ADF80E3002461E9B6946284600F073F8431CBCBF8B232B6014B1009B00221A701BB030BD000022
+:4030C00007B5009313460A46014603480068FFF7CBFF03B05DF804FB5C81FF1F2DE9F0478E6882469E420C46914698463ED88A8912F4906F3AD02568096902236F1A656977
+:4031000005EB450595FBF3F57B1C43449D4238BF1D4653050FD5294600F04AFB064698B13A46216900F0D2FAA38923F4906343F08003A38113E02A4600F098FB064670B9E0
+:403140002169504600F0E8FA0C23CAF80030A3894FF0FF3043F04003A381BDE8F08726613E44266046466561ED1BA560464528BF464649463246206800F0B3FAA3680020A9
+:403180009B1BA36023681E442660BDE8F08700002DE9F04F9DB003938B8980461C060D4616460DD50B695BB9402100F001FB2860286118B90C23C8F80030CDE040236B6150
+:4031C0000023099320238DF82930DFF89CB130238DF82A3037463C4614F8013B1BB9B7EB060910D003E0252BF9D02746F3E74B46324629464046FFF771FF013000F0A780FE
+:40320000099B4B4409933B78002B00F0A08000234FF0FF3204930793059206938DF853301A930126052221784E4800F041FA671C049B38B14B4A3C46801A06FA00F0184379
+:403240000490EFE7D90644BF20228DF853201A0744BF2B228DF8532022782A2A03D0079A00210A200BE0039A111D12680391002A10DA524243F00200079204900BE027468C
+:403280003B780134303B092B03D800FB02320121F5E701B107923B782E2B1ED17B782A2B0AD1039B02371A1D1B680392002BB8BF4FF0FF33059310E0002319460593781CA7
+:4032C0000A2407463A780130303A092A03D804FB01210123F5E703B1059103223978224800F0E6F940B14023CBEB000003FA00F0049B013718430490397806221B487E1CEB
+:403300008DF8281000F0D4F988B1194B33B9039B073323F007030833039314E003AB00932A46144B04A94046AFF3008007E003AB00932A460F4B04A9404600F093F8B0F12A
+:40334000FF3F824603D0099B5344099342E7AB895B0601D4099801E04FF0FF301DB0BDE8F08F00BFA33C0000A93C0000AD3C000000000000DD3000002DE9F04791461F4627
+:403380000A698B6806469342B8BF1346C9F8003091F843200C46DDF8208012B10133C9F800302368990642BFD9F800300233C9F80030256815F0060510D104F1190A07E05B
+:4033C0000123524639463046C04701301AD00135E368D9F800209B1A9D42F1DB94F843302268003318BF012392060FD5E118302081F843005A1C94F845102244023382F884
+:40340000431003E04FF0FF30BDE8F08704F1430239463046C0470130F4D02268D9F80050E36802F00602042A08BF5D1B2269A3680CBF25EAE57500259342C4BF9B1AED1843
+:403440004FF000091A344D4509D00123224639463046C0470130D5D009F10109F3E70020BDE8F0872DE9F04317460A7E85B06E2A984606460C460C9B01F1430E00F0AE8054
+:4034800011D8632A22D009D8002A00F0BB80582A40F0CA8081F84520834955E0642A1ED0692A1CD0C0E0732A00F0B08009D86F2A2ED0702A40F0B8800A6842F020020A6091
+:4034C0003EE0752A24D0782A3AD0ADE01A6801F14205111D1960136884F84230A8E021681A6811F0800F02D0111D196008E011F0400F02F10401196002D0B2F9003000E045
+:403500001368002B3CDA2D225B4284F8432037E021681A6811F0800F02D0111D196007E011F0400F02F10401196001D0138800E01368227E5C496F2A14BF0A2208221BE068
+:4035400078225A4984F845202268186812F0800F00F104051D6003D1550601D5038800E00368D00744BF42F0200222601BB9226822F0200222601022002084F8430001E08A
+:4035800049490A226568002DA56008DB206820F0040020602BB9002D7DD175460CE0002B79D07546B3FBF2F002FB1033CB5C05F8013D03460028F5D1082A0BD12368DA0737
+:4035C00008D5236962689A42DEBF302305F8013C05F1FF35C5EB0E0323612EE008681A6810F0800F496903D0101D1860136808E010F0400F02F104001860136801D0198064
+:4036000000E0196000232361754616E01A68111D1960156800216268284600F049F808B1401B6060636804E004F1420584F8422001232361002384F84330CDF800803B468C
+:4036400003AA21463046FFF797FE013002D14FF0FF3026E023692A4639463046C0470130F5D023689B0710D5002504F1190907E001234A4639463046C0470130E7D00135CC
+:40368000E368039A9B1A9D42F2DBE068039B9842B8BF184605E00B7804F1420584F842308AE705B0BDE8F083923B0000B43C000010B5C9B202449042034605D01C78013064
+:4036C0008C42F8D1184610BD002010BD10B5431E0A44914204D011F8014B03F8014FF8E710BD884210B501EB020301D8421E0BE09842FBD28118D21AD34204D013F8014DA2
+:4037000001F8014DF8E710BD994204D011F8014B02F8014FF8E710BD38B50546002944D051F8043C0C1F002BB8BFE41800F0D4F81E4A1368114613B96360146030E0A342E7
+:403740000DD92268A018834201BF18685B681218226063600C6023E0A24203D813465A68002AF9D118681918A1420BD12168014458188242196013D11068526801441960EE
+:403780005A600DE002D90C232B6009E021686018824201BF106852680918216062605C602846BDE8384000F098B838BDA092FF1F70B5CD1C25F0030508350C2D38BF0C2534
+:4037C000002D064601DBA94202D90C23336046E000F082F8234B1C681A462146A1B10B685B1B0ED40B2B03D90B60CC18CD501EE08C420BBF63684B681360636018BF0C4695
+:4038000015E00C464968E9E7174C23681BB9304600F052F820602946304600F04DF8431C18D0C41C24F00304A0420DD12560304600F053F804F10B00231D20F00700C31A48
+:403840000ED05A42E25070BD211A304600F034F80130EBD10C233360304600F03EF8002070BD00BFA092FF1F9C92FF1FF8B5074615460E4621B91146BDE8F840FFF798BFAB
+:403880001AB9FFF749FF2846F8BD00F027F885420ED929463846FFF78BFF044650B131462A46FFF713FF31463846FFF735FF01E03046F8BD2046F8BD38B5064C002305467D
+:4038C00008462360FDF7F4FB431C02D1236803B12B6038BD8493FF1F7047704751F8040C0028BEBF091851F8043CC0180438704700000000050209020B020D020F021102BB
+:403900001302150228000000000104000100000000000000000157494E55534200003030303031000000000000000000E0000000000105000100D6000000070000002A0075
+:4039400044006500760069006300650049006E0074006500720066006100630065004700550049004400730000009E0000007B00330064003200370035006300660065004E
+:403980002D0035003400330035002D0034006400640035002D0061006300630061002D003900660062003900390035006500320066003600330038007D0000007B00330058
+:4039C00064003200370035006300660065002D0035003400330035002D0034006400640035002D0061006300630061002D00390066006200390039003500650032006600B4
+:403A00003600330038007D00000000007265706C792030782530327800686F6D696E6700626567696E6E696E67207365656B2066726F6D20256420746F2025640066696E14
+:403A40006973686564207365656B00796573006E6F0057616974696E6720666F72205553422E2E2E00555342207265616479005363616E6E696E67206472697665732E2E1C
+:403A80002E00647269766520303A20257320647269766520313A20257300636F6D6D616E6420307825303278006661696C2025642B25642B2564203D3D2025642C206E6F40
+:403AC00074202564007061737365643D256400756E64657272756E206166746572202564207061636B65747300636F756E743D256420693D256420643D256400636D645FEF
+:403B0000777269746500703D25642063723D25642063773D256420663D256420773D256420696E6465783D256420756E64657272756E3D256400756E64657272756E210015
+:403B4000737563636573730073746172742065726173696E670073746F702065726173696E670069646C650000510040100040510040300000000140001000140140000858
+:403B800000400140000A004C01400002005001402000303132333435363738394142434445460000000100000004000000100001000000040000001001000000C03B000072
+:403BC000010000008F3C0000000000000000000001000000D83B000001000000613C000004000000FA3B0000000000000000000000000000F83B0000FF0000000102400099
+:403C0000FF00000082024000FF00000003034000FF00000084034000FF00020304030904160346006C007500780045006E00670069006E0065002A0343006F0077006C00CE
+:403C4000610072006B00200054006500630068006E006F006C006F0067006900650073000009022E0001010080320904000004FF00000107050102400000070582024000E5
+:403C8000000705030340000A0705840340000A12010002FF0001080912006E0100020180014300232D302B2000686C4C00656667454647003031323334353637383961629E
+:403CC0006364656600000000F8B500BFF8BC08BC9E467047590000002D110000F8B500BFF8BC08BC9E46704735000000003D0000C880FF1F980000002812000000000000F3
+:403D0000000000008893FF1FFFFF0000675000400C00000007000000FFFFFFFF7F8000003F0000000000007D00FA0000400000000090D003000000000000000000000000EE
+:403D40000000000000000000000000000000000000000000A13C00000000000000000000000000000000000000000000000000000000000000000000000000000000000066
+:403D80000000000000000000000000000000000000000000FC80FF1F0000000000000000000000000000000000000000000000000000000000000000000000000000000069
 :403DC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C3
 :403E00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000082
 :403E40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000042
@@ -4098,72 +4098,72 @@
 :40FF80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000041
 :40FFC0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000001
 :0200000480007A
-:400000000145004008520040015B00400164004001650040410001403E0101404102014054030140470401404C0501404A0601404E0701404A08014051090140430A01409A
-:40004000500B0140520C0140560D0140500E01403A0F0140461401404C1501404A1601405C170140521801405F1901403D1A0140561B01400D4001400E4101400D4201408A
-:400080000C430140074401400C450140074601400F4701400A4801400D490140164C0140044D014008500140045101407E0208420901100211821901600C610A7C40272171
-:4000C0003F01290A0006010302010310050C06010703080509030A020B1C0E010F20110F12011601174019801A011E011F0F2201230A260127052A012C032D402E04300152
-:4001000033C03406353F3B203E115608580459045B045C905D905F0183018AA08C709402980E9B029C40A205A502A650AA0AB0C0B20CB303B403B630D608D80BD904DB0470
-:40014000DC99DD90DF010180020803600440070409220A110E2A10891104134016A01720188019101C401E2A1F1021382304272028022A042B402F10300131083220334088
-:400180003720388039283A013F0158405B105D4061806220668067017D0280C0823084028A108C108D448F40C0CFC2EFC47FCA4BCC2FCE8FD61CD81CDE80E040E205E40512
-:4001C000E622023F043F0A3F0E3F103F16021A101E042001243F2A202E08363F3E4058045B045F01817F820484088701880189018A088B288D318E108F029001953196024A
-:40020000974E98289D409E019F3DA008A201A501A601A714A809AC01B007B10FB218B372B420B620BA0ABE10C206C70EC810C9FFCAFFCBFFCF83D804D904DA04DB04DC9961
-:40024000DD09DF010040010803880492050408100AA20E840F1110011120130A151016801788188019441A901B2D1F8020802104220C23402A0432043340382039043A0193
-:400280003B4049105008588859216004628263206D40812082048408854889048A808D018E108F289020950C9740989099109E259F44A080A104A203A501A608A888A98090
-:4002C000AD02AE01B050B180B202B304B508B730C0FFC2FFC4FFCA02CC0ACE0FD204D60FD80FE241E408E601EA1FEE0100C0010D0440050D090D0A070C180D010E010F185B
-:400300001002110412181312150D162018181B071F0D2218230D2404250D26102804290D2A082C1F2D0D32803303343F351C36403E403F14580459045C095F0181018501E5
-:40034000870289018F019006920993019409950196069B019D01A101A501A901AD01AE03AF02B002B103B204B408B601B8AABE55BF01D804D904DB04DF0100810128080616
-:400380000A080C0A1080110812051540180219A81A021B101D411E201F10202022102440288029042B062C012D112E0430013288332036A1370A388039243B023E403F191C
-:4003C0006C0A800281018340840489408B4090809140920894529510962697119A049C019EA19FCEA0C0A104A30CA511A640A710A80CAA01AF01B040B104C00FC23EC48F76
-:40040000CAFFCCFFCEFFE004E288E681EA04EC08EE0400100101040805010601080209010C020F011002130214021704180319011A041C1C1D011E032202240225012802B9
-:4004400029012C022F01341F3507370739A03E10580459045C905F0180488210837F86498710893F8A028C408D018E308F40900193089401953F98489A209B029C499D3F71
-:40048000A204A320A449A73FAA01AB3FAE01AF04B038B407B540B640B73FBA20BF50D804D904DC09DF010061010804820528080509400B040C200D8A0F081020120113125A
-:4004C00014881584184919201B201E0822202302240425D026C0284429682D102E44311032813308340135503604380239083A813B103C043D013E803F10811882108512C5
-:40050000881289049082940195359644979399809C819EA09F8CA010A210A30CA511A6E8A722AA01AF10B201B410B504B601C0FFC2FFC4FFCA7FCCFFCEFFE081E208E60EAE
-:40054000EA0401020501062009020A180F02101F1103140215021618181819021A011E072004210222102502281829022C042E082F033503363F3F10580459045C095F01DA
-:400580008201831385138604884089038A068E028F02905691039221931096019708987F99039C069F04A007A103A208A406A678A701A806AB03AC11AD03AE26B10FB31078
-:4005C000B47FB50FBE10BF04D608D804D904DB04DC90DD90DF010004010102010308050407040A850B200E420F24111212321404158016801A081E0221052220251028111D
-:400600002B882C022F64302231013204334034013719380139403A143C083D813E1059405C085D0462C0800181028202884089418C208D40918092C09324952096209824F0
-:4006400099279A869B049C81A004A101A208A310A408A510A683AA40B005B310B661C06FC2FFC4DFCAFFCCEFCEFFD608D808E080E228E60AE820EA10000104080519080106
-:400680000B090E1010011504160219011A081C012208262029122A042C013007330334383518370438203F4056085804590B5B045C995D905F0182018301860187018904CD
-:4006C0008A018B038D038E018F04900193019601970198019B019C019F01A101A201A304A601A701AA01AB01AE01AF02B201B507B601BE44BF10D804D904DB04DF010166A1
-:400700000486078808410A240C800E400F641120122213021601171519031A841B101C211D041E201F40200221242208262029202CA02EA02F0130083120379539283C045F
-:400740003D813F3058805D045F0463016D406E407A80831087C0908691819306940196409751986499209A269B1F9D04A0A0A141A380A410A520A691A710A980AB04AC20E9
-:40078000B084B140B304C0FFC2FFC4FFCAF4CCF6CEF6D608D808DE01E004E408ECA00318051806200701081809020B180C040D040E100F10101F110413081402161817070A
-:4007C00018181A011B201C041E08211822182A072C402D1F323F333F36403E40580459045B045C995F0181228220853386188A078B028D028F20901F912893509418958288
-:400800009705981899109A019B089C409D019F80A004A122A208A344A733A802A913AA18AB20AC04AE10B170B23FB307B580B640B708BB0ABE40BF50D804D904DB04DC9924
-:40084000DF01001103100514060108040A400B050D400F6412011312140815401701181019401B041F84200C21582241230225042608280429102B502C802E4031283281A0
-:400880003618370239A03A013B063C803D013F244FC05940640867086D4081408201844088048B048D058E049082910193029680974499A09A229B1D9C049D04A060A410BC
-:4008C000A680A710A810AB14ACA0B120B401B680C0EEC2FFC4DBCA97CCEFCEFFD608E010E2A0E410E640E820EAD0EC10EE400328053807010A200B070D3F100412081418FD
-:40090000174018181A011C041D041E101F30213422072308250226182738280229082A182B102C1F337F363F580459045C995F0181608205850B87F0880D89188BC38D0210
-:400940008F04981099029B059C019E10A101A80AA9F1AB0AAF02B010B180B307B403B540B60CB738B980BB08BE01BF50C024C9FFCAFFCBFFD004D601D80BD904DA04DB0429
-:40098000DC99DD09DF01E080E240E440E56400200510068008040A800B060C100E0A106011101340160819801C801D111E421F512010252126042702280429012B102C04B8
-:4009C0002F4131043240341038123B443D123F6445204702584059806C416D016F1474A0762077097E808040822A87108E40C052C2CFC44FCAB7CC2ACEFFD0A0DE80E08003
-:400A0000E660003F013F063F073F083F0B200D010E3F10011308160217021A101B101C3F1D3F2208233F26042704293F2A202E3F2F3F333F363F3E403F04580459045F0101
-:400A4000810582028406852C86018702880689108E018F05900391139208932095059606980799059C019D0F9E069F10A105A201A401A505A60CA806A905AC06AD08AF0286
-:400A8000B13FB40FBE10BF01D804D904DF01018102200308040805860604084409400A040B500C410F28111012011309142A15011B401F202204260129822A082B0C2D11AD
-:400AC0002E4430443201331034453510380839103B413C043F6189408C088D048E208F05900491119246935196089702982399929A0D9B189C089F04A140A318A601A760CD
-:400B0000A880A966AA05AB10AC10AE80B040B111C0FFC2FFC4FFCAFFCCFFCEFFE402E640E80FEC04EE01000604060A060D020E04110112061602180619021C0120012406CE
-:400B4000250228062C06300132063302340137013A223B0C3E043F40580459045B045C995F01800181808580860289A98D808E01915695809601990C9A049B409D3D9E010B
-:400B80009FC0A001A180A401A580AB03AC01AD30B007B1FFBA02BF01C001C50CC60EC805C9FFCAFFCBFFD004D601D804D904DA04DB04DC09DD09DF01E2C00182022004800A
-:400BC00005290A280B010C240E8210011290140A1502161019021B021C041D031E201F102101258C2608281029822A102B082F203001310832903610370138883B223F80B0
-:400C00004001442045044B045340681069596A466B906F01701071507288735979807B02822083028421858087108A208C108D018F01908992209599964697979816998874
-:400C40009CC99D509EA09F8CA140A2C0A308A50BA608A702B120B210C0FDC2F7C4FDCA4FCCAFCE1FD008E00CE202E422E601EA80EE0802100301050409080D0F100411080B
-:400C800015081A081B0F1C011D031F0C21082203270229082C082F083004310F3201341836023E053F015608580459045B045C095D905F018027842788278B018C208E0CA7
-:400CC000903792C09501962798209A029C209E01A0F3A208A427A837A902AA40AC10AE87B2F0B40FB503BE14C034C620C808C9FFCAFFCBFFCD20CEF0D110D608D804D90455
-:400D0000DA04DB04DC90DD99DF01E108E240E340E480E640E7400004011002010384058006800701082009080A820C020D200E021226130216421A201B101CA01D281E0268
-:400D40001F082110274029202C212F4430403248344035013620370839203C083E5140404104501059405F80628064026A406B036C0278047A2082018310854086048709E0
-:400D800089208B808C028D018E108F109108928293209404953196359788982899209A469E019F59A004A101A22AA468A540A7A8A880B010B104B201C01FC2DFC49FCAF44B
-:400DC000CCF2CEF4D003D618D818E210E472E688E820EE09000E0270060409020A0E0E02102E124116011A011C7F1D01200F2210240E2A082C212E4E307F310235013E01EF
-:400E00003F11580459045B045F018108820885048603880389018E048F089003930F95089603980399089C039D0FA003A108A602A702A908AA01AD03AF0CB60FB70FBF40A7
-:400E4000D608D804D904DB04DC09DD90DF0100040201038805020604072108410A800B280C210D080E021024110212021428170219021E031F802040221027012C212E10D7
-:400E80002F403280344035803601371838203C283D8158805A205C105F40652066806701680A80108740888089208B208C028E408F8190249101929093A894409601982C55
-:400EC00099809A059B1A9E80A034A149A282A308A408A780A824AB2CAC01AD41B344B410C0FFC2FFC47FCAF0CCF8CEF4D63CD830E250E420E651E880EC801A401F083210ED
-:400F0000330837123A106A406B108A108E04C630CCF0CE10300431803440350839013D8085408E109620A604B702CCF0CE60E2405280570889018A80928095019C449D08FB
-:400F4000A580A604AA40D460EE80844485808A1092809C449D08A580A604AF08E210E650EE4014407B028A06C404DC01E001E6045602620296449A02A70AB040B640B708E3
-:400F8000D604D802EA09EE021B08830286809644A602A70AC6080A010B200E200F02861187108A0296449840A280A602B040C20FE404E801238026148B8092809902A6145F
-:400FC000AD08B102C8E0EE101A025A807220750286018E2092809902C640D480DC80DE20E44004100A800E400F021E045280548058405D0485048701941096449840A280E3
-:40100000A810AF01C001C20DC601D407D60182409280B480EC02010109010B010D010F0111011B011D0100FF01AB020211050000BF0000A09F001F000000000000000000E5
-:40104000100000004000000000000000C0000000FF0000B8470047000001000080000002820082000000000000010100010000002700180127001801000400000005000008
+:400000000145004008520040015B004001650040020101402C0201402D0301400F0501400B0701406308014056090140570A01404A0B0140500C01404A0D0140480E014042
+:40004000390F01400415014004170140671801404B190140361A0140471B01400D40014010410140134201400D43014004440140064501400A460140084701400B48014097
+:4000800010490140144C01400C4D014006500140045101407E02080109441180180219016009610A7C402721290AE204E6080F011001150126012E012F013001310138026A
+:4000C00039023E013F01580459045B045F01810883048C018D0E910194029701A404AD04AE04AF0AB004B102B301B402B50CB601B802B908BE51BF04D608D804D909DB0401
+:40010000DC90DD90DF01020208080C02100213081540170818081A801B801C80200821012210231026012A802C02300233043708388039023D405840600268026B0C6D4004
+:40014000782088028B109840B040C001C214C4A5CA18CC43CE19D608D808DE04E208E68080088201928094809C289E80A201A602B044B380B404B610E604EA01EE44804068
+:40018000842094809C209E80A602AA40E211E608EA01EE0C00800121020403020403052106FC0704080109210A020B080C040E100F4010FF11011404152F162019201A0495
+:4001C0001B011C041D211EF91F0E220224042608271028042A402B2F2D0F2E02311F336034FF39083A0C3E104003450C470E481149FF4AFF4BFF50045609581859045A044E
+:400200005B045C995D995F0162C081028407850186388702880189048C028D048E04902091049208940895029610983F99029C089D049E30A105A503A704A802A902AA0417
+:40024000AC3FAD02B43FB507B63FBF10D608D804D904DB04DC09DD90DF010010010803010490050909240A420C030E020F24100A15081602172119401A021B501E101F107B
+:400280002120242025052603272029982B402C022F18300831803202332035983701388039013B183C803D113E0447084F0856085A805F4062806302670269806B026C0881
+:4002C0006D116E846F21759076467F01814087018E08908094209581971499049C019DC99E449F03A382A408A682A729C0F7C2FFC4F3CA7FCCFFCEFFD040D618D818DE1080
+:40030000E210EA01EE0C0101041205010624084209800A100B200C040D700F80107011081201130414061508170219071A081B081D801E601F102140221023802404250F16
+:4003400027F028042B0F2C802D01300F320F348035FF3670380A3B0C3E103F105804590A5B045C995F01824185F186418704888089208A018B118CF18E0291F1924E930218
+:40038000954096419711980199109A149BE19F0EA1F1A308A580A641A711A801AA28B00FB10FB3F0B4F0BA02BB02D80BD90BDB04DC99DF010108020203080510076208017B
+:4003C00009200A220D020E1410021240131414081508188819041A221B821C801D121F1021282501277029892B082D022F103008314033213608376238A039013A043E1454
+:4004000068026D407A107E80800481408D108F019108921495809702980899029D109F72A218A440A509A701A809B340B408B502B640C0F7C27FC46FCACFCCFFCE6FDE8298
+:40044000E401E8F0EC20EE40020103C4070808050A020B040C380D200F82101011C7120813181602170418081A301B041F302520274128042B042C062E012F043020320715
+:40048000330F341837F43B083E04580459085B045C995F0182108303840285628604870489208A108B508DFC8E108F0192039420964097809A109B1C9C409E209F10A07C22
+:4004C000A162A201A308A61CA710A940AA10AB30AC02AE08AF10B01FB11FB360B460B780D808D908DC99DF0100A001800204036004020706081009080A800B010C080E8878
+:400500001218134215401608180419201A841B201C081EA02105220923112504268429922A242D802E102F20301031083350340136883722380439823B103D0A3E203F4070
+:40054000611062106D406F047B037F028A08900292509508968297129C019D329F62A018A444A501A690A721C0DFC27FC4CFCA7FCCFECEFFDE18E020E208EA8000020120A4
+:40058000024803C004C20502062407440A030B900E9011FC129013011690170318201AC01B901E901F9020FC21C222012328269027902A9C2B9C2F90321F331F34E037E015
+:4005C0003A203B80420647E0482049FF4AFF4BFF4F83580859085A045B045C995D095F0180E28208861088E28A049210942096D09A03A0FCA201A440A630A880AA30AE1C91
+:40060000B2E0B41FD808DB04DC09DF01009001C6032005260610072009010A140B420D200E100F40121013121548171218101A241B101C201D201E101F0820022204230148
+:4006400029862B08300131103204335039043B1148054A0252015AAA6120628263206A406C097B037F0282018610C07FC27FC4FECA0FCC0FCE07D204D60FD80FDE188A02E6
+:40068000A602E604EE02A602B680E401EE020010022003020406063807040802090C0A040BF10C080D0C0F20100813081408150C17101808190C1B401C081F0221802204B3
+:4006C000230C250327FC281A29012A202B022DFF2E01303F31FF3E013F01580459045B045F0181238280830C842286CC870188308A028B2F8CC88D0F9123924894C8952367
+:40070000970898D499239B049CC89F10A0C8A120A302A4C8A52FA802AB40AC80AE01B080B261B31FB41FB560B760B808B9A0BE11C046C620C808C9FFCAFFCBFFCD20CEF004
+:40074000D110D804D904DA04DB04DC99DD09DF01E108E240E340E480E640E7400010010803820490050909080A420B040E020F941002110A120415401721184019181C80B4
+:40078000218C2314274029182A022D4A2F0830083361350436413720381039413A043D013F9440404A085010584059205F806C026D4082409080910192029410950896C023
+:4007C000971C99049A069B219D099F08A008A105A2C1A3E6A442A580A708B340B610C0FFC2FFC4DFCAF7CCFFCEFFD001D204D61CEE120008060209020D01100411041202D8
+:4008000018041F04220428012C063006310132013302340835043A023E143F055608580459045B045C995D905F0181028405881090019236930198019C319E0AAC05AD012B
+:40084000B00CB102B210B420B501B603BE04BF11D608D804D904DB04DC09DD90DF0101080240051809200A400E820F08100811401280154019231A501C101D101E821F0E2C
+:4008800020402120220827882F02300232803601382039803F0158205A805F40600862406701680869806F0180408210844887408B018E4090209140941096409708982064
+:4008C00099089C409D239F88A002A280A304A608A708B020B410C06CC2DAC48BCA10CC89CE8CD61CD81CE001E622EE021B011F083140330836843B4083408540C630CCF07B
+:40090000CE10E220E61030803204364037043A083F80848088029740A340A604AE80AF01CCF0CE60E2105004570880049002960897409A049E089F04A002A120A644A80182
+:40094000AA04B520D460E680EA80EE208E08900297409A049E08A002A120A640AA04AB0CAE04EA80EEB014407008C404DC0160808740A408B040D802EA011B0482209780E6
+:400980009940B008B140B480C608E809EC040B880F4197899940A220AB05AF04C20F24088004900297409A04A002A120AE40C820E480EE4050015120560470027F018301EC
+:4009C00090029A04A002A120AF40D4E0DC80DE20E620EE40070208080D010E021F10520854085940622095029940A220AF40B101C001C20DC601D407D802EA04800887021E
+:400A00008E019B02A201A408AF10B008B608E208EA01EC02010109010D010F0111011D0100FF01AB02021105BF0000A09F001F0000000000000000001000000040000000B7
+:400A400000000000C0000000FF0000B84700470000010000800000008000800000000000000707000700000027001801270018010004000000050000000000000000000052
+:400A80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000036
+:400AC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F6
+:400B000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B5
+:400B40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000075
+:400B80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000035
+:400BC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F5
+:400C000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B4
+:400C40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000074
+:400C80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000034
+:400CC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F4
+:400D000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B3
+:400D40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000073
+:400D80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000033
+:400DC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F3
+:400E000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B2
+:400E40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000072
+:400E80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000032
+:400EC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F2
+:400F000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B1
+:400F40000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000071
+:400F80000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000031
+:400FC00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F1
+:4010000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000B0
+:401040000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000070
 :401080000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030
 :4010C00000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000F0
 :4011000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000AF
@@ -4615,12 +4615,12 @@
 :0200000490105A
 :04000000BC90ACAF55
 :0200000490303A
-:020000006F2D62
+:0200000021B02D
 :0200000490402A
 :4000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000C0
 :400040000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000080
 :400080000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000040
 :4000C0000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000
 :0200000490501A
-:0C00000000012E16106900002E317F96C2
+:0C00000000012E16106900002E3032198D
 :00000001FF

FluxEngine.cydsn/FIFOout/FIFOout.v

@@ -20,33 +20,34 @@ module FIFOout (
 wire [7:0] po;
 assign d = po;
 
-localparam STATE_WAIT = 1'b0;
-localparam STATE_READ = 1'b1;
+localparam STATE_WAITFORREQ = 0;
+localparam STATE_READFROMFIFO = 1;
+localparam STATE_WAITFORNREQ = 2;
 
-reg state;
-reg oldreq;
+reg [1:0] state;
+wire readfromfifo;
 
-assign ack = (state != STATE_READ);
+assign ack = (state == STATE_WAITFORNREQ);
+assign readfromfifo = (state == STATE_READFROMFIFO);
 
 always @(posedge clk)
 begin
     case (state)
-        STATE_WAIT:
+        /* opcode is not valid; req is low; wait for req to go high. */
+        STATE_WAITFORREQ:
         begin
-            if (!empty)
-            begin
-                if (req && !oldreq)
-                begin
-                    state <= STATE_READ;
-                end
-                oldreq <= req;
-            end
+            if (!empty && req)
+                state <= STATE_READFROMFIFO;
         end
         
-        STATE_READ:
-        begin
-            state <= STATE_WAIT;
-        end
+        /* Fetch a single value from the FIFO. */
+        STATE_READFROMFIFO:
+            state <= STATE_WAITFORNREQ;
+            
+        /* opcode is valid; ack is high. Wait for req to go low. */
+        STATE_WAITFORNREQ:
+            if (!req)
+                state <= STATE_WAITFORREQ;
     endcase
 end
             
@@ -55,11 +56,11 @@ cy_psoc3_dp #(.cy_dpconfig(
     `CS_ALU_OP_PASS, `CS_SRCA_A0, `CS_SRCB_D0,
     `CS_SHFT_OP_PASS, `CS_A0_SRC_NONE, `CS_A1_SRC_NONE,
     `CS_FEEDBACK_DSBL, `CS_CI_SEL_CFGA, `CS_SI_SEL_CFGA,
-    `CS_CMP_SEL_CFGA, /*CFGRAM0: STATE_WAITFORREQ*/
+    `CS_CMP_SEL_CFGA, /*CFGRAM0: idle */
     `CS_ALU_OP_PASS, `CS_SRCA_A0, `CS_SRCB_D0,
     `CS_SHFT_OP_PASS, `CS_A0_SRC___F0, `CS_A1_SRC_NONE,
     `CS_FEEDBACK_DSBL, `CS_CI_SEL_CFGA, `CS_SI_SEL_CFGA,
-    `CS_CMP_SEL_CFGA, /*CFGRAM1: STATE_LOAD*/
+    `CS_CMP_SEL_CFGA, /*CFGRAM1: read from fifo */
     `CS_ALU_OP_PASS, `CS_SRCA_A0, `CS_SRCB_D0,
     `CS_SHFT_OP_PASS, `CS_A0_SRC_NONE, `CS_A1_SRC_NONE,
     `CS_FEEDBACK_DSBL, `CS_CI_SEL_CFGA, `CS_SI_SEL_CFGA,
@@ -102,7 +103,7 @@ cy_psoc3_dp #(.cy_dpconfig(
 )) dp(
         /*  input                   */  .reset(1'b0),
         /*  input                   */  .clk(clk),
-        /*  input   [02:00]         */  .cs_addr({2'b0, state}),
+        /*  input   [02:00]         */  .cs_addr({2'b0, readfromfifo}),
         /*  input                   */  .route_si(1'b0),
         /*  input                   */  .route_ci(1'b0),
         /*  input                   */  .f0_load(1'b0),

FluxEngine.cydsn/FluxEngine.cydwr

@@ -814,9 +814,9 @@
   </Group>
   <Group key="Component">
     <Group key="v1">
-      <Data key="cy_boot" value="cy_boot_v5_80" />
+      <Data key="cy_boot" value="cy_boot_v6_10" />
       <Data key="Em_EEPROM_Dynamic" value="Em_EEPROM_Dynamic_v2_20" />
-      <Data key="LIN_Dynamic" value="LIN_Dynamic_v5_0" />
+      <Data key="LIN_Dynamic" value="LIN_Dynamic_v6_0" />
     </Group>
   </Group>
   <Data key="DataVersionKey" value="2" />
@@ -848,15 +848,18 @@
       <Data key="efd5f185-0c32-4824-ba72-3ceb5356f5a7" value="Clock_1" />
     </Group>
     <Group key="Pin">
+      <Data key="3e1862bb-be82-47b0-9549-7ebfe76b6f7b" value="Pin_2" />
       <Data key="4a398466-709f-4228-9500-96178658e13e" value="RDATA" />
       <Data key="5a3407c1-b434-4438-a7b4-b9dfd2280495" value="MOTEA" />
       <Data key="8d318d8b-cf7b-4b6b-b02c-ab1c5c49d0ba" value="SW1" />
+      <Data key="8fc20a4f-e4d1-44b3-a5d4-546e8628d61e" value="LED" />
       <Data key="12e00eac-69b5-4717-85c8-25ef6b224d4c" value="DEBUG_PINS" />
       <Data key="41e2d8ed-5494-4d8c-8ff7-f4f789cece51" value="REDWC" />
       <Data key="264be2d3-9481-494b-8d9c-c1905a45e9cc" value="FDD" />
       <Data key="472f8fdb-f772-44fb-8897-cc690694237b" value="WDATA" />
       <Data key="736cb12b-c863-43d4-a8f0-42f06023f8b5" value="SIDE1" />
       <Data key="4249c923-fcff-453b-8629-bec6fddd00c1" value="STEP" />
+      <Data key="27315b0e-6a8c-4b7f-be77-73ab434fa803" value="Pin_1" />
       <Data key="1425177d-0d0e-4468-8bcc-e638e5509a9b" value="UartRx" />
       <Data key="a5d987c6-e45b-45b9-ad93-656fab06d720" value="TRK00" />
       <Data key="a93ef5b3-00f4-42c0-8fad-0e275a7e2537" value="MOTEB" />
@@ -868,6 +871,7 @@
       <Data key="c5367cde-21d5-4866-9a32-d16abfea0c61" value="WPT" />
       <Data key="d19368c5-6855-41bb-a9ff-808938abef00" value="INDEX" />
       <Data key="e9f14b5a-b2bf-49b8-98f3-d7b5a43ace8d" value="DRVSB" />
+      <Data key="e16b5ef8-00d3-40a4-bc1c-194983c8eb3d" value="LOW_CURRENT" />
       <Data key="e851a3b9-efb8-48be-bbb8-b303b216c393" value="INDEX300" />
       <Data key="e51063a9-4fad-40c7-a06b-7cc4b137dc18" value="DSKCHG" />
       <Data key="ea7ee228-8b3f-426c-8bb8-cd7a81937769" value="DIR" />
@@ -3962,6 +3966,11 @@
     </Group>
   </Group>
   <Group key="Pin2">
+    <Group key="3e1862bb-be82-47b0-9549-7ebfe76b6f7b">
+      <Group key="0">
+        <Data key="Port Format" value="0,6" />
+      </Group>
+    </Group>
     <Group key="4a398466-709f-4228-9500-96178658e13e">
       <Group key="0">
         <Data key="Port Format" value="1,5" />
@@ -3977,6 +3986,11 @@
         <Data key="Port Format" value="2,2" />
       </Group>
     </Group>
+    <Group key="8fc20a4f-e4d1-44b3-a5d4-546e8628d61e">
+      <Group key="0">
+        <Data key="Port Format" value="2,1" />
+      </Group>
+    </Group>
     <Group key="12e00eac-69b5-4717-85c8-25ef6b224d4c">
       <Group key="0">
         <Data key="Port Format" value="2,2" />
@@ -4058,6 +4072,11 @@
         <Data key="Port Format" value="1,0" />
       </Group>
     </Group>
+    <Group key="27315b0e-6a8c-4b7f-be77-73ab434fa803">
+      <Group key="0">
+        <Data key="Port Format" value="0,7" />
+      </Group>
+    </Group>
     <Group key="1425177d-0d0e-4468-8bcc-e638e5509a9b">
       <Group key="0">
         <Data key="Port Format" value="12,6" />
@@ -4143,6 +4162,11 @@
         <Data key="Port Format" value="12,3" />
       </Group>
     </Group>
+    <Group key="e16b5ef8-00d3-40a4-bc1c-194983c8eb3d">
+      <Group key="0">
+        <Data key="Port Format" value="3,2" />
+      </Group>
+    </Group>
     <Group key="e851a3b9-efb8-48be-bbb8-b303b216c393">
       <Group key="0">
         <Data key="Port Format" value="3,0" />

FluxEngine.cydsn/Sampler/Sampler.v

@@ -1,7 +1,6 @@
 
 //`#start header` -- edit after this line, do not edit this line
 `include "cypress.v"
-`include "../SuperCounter/SuperCounter.v"
 
 //`#end` -- edit above this line, do not edit this line
 // Generated on 12/11/2019 at 21:18
@@ -9,7 +8,7 @@
 module Sampler (
 	output [2:0] debug_state,
 	output reg [7:0] opcode,
-	output  req,
+	output  reg       req,
 	input   clock,
 	input   index,
 	input   rdata,
@@ -19,113 +18,76 @@ module Sampler (
 
 //`#start body` -- edit after this line, do not edit this line
 
-localparam STATE_RESET = 0;
-localparam STATE_WAITING = 1;
-localparam STATE_INTERVAL = 2;
-localparam STATE_DISPATCH = 3;
-localparam STATE_OPCODE = 4;
-localparam STATE_COUNTING = 5;
+// NOTE: Reset pulse is used in both clock domains, and must be long enough
+// to be detected in both.
 
-reg [2:0] state;
-wire [6:0] counter;
+reg [5:0] counter;
 
-wire countnow;
-assign countnow = (state == STATE_COUNTING);
+reg index_edge;
+reg rdata_edge;
 
-wire counterreset;
-assign counterreset = (state == STATE_INTERVAL) || (state == STATE_OPCODE);
+reg req_toggle;
 
-SuperCounter #(.Delta(1), .ResetValue(0)) Counter
-(
-    /* input */ .clk(clock),
-    /* input */ .reset(counterreset),
-    /* input */ .count(countnow),
-    /* output */ .d(counter)
-);
+reg rdata_toggle;
+reg old_rdata_toggle;
 
-reg oldsampleclock;
-wire sampleclocked;
-assign sampleclocked = !oldsampleclock && sampleclock;
+reg index_toggle;
+reg old_index_toggle;
 
-reg oldindex;
-wire indexed;
-assign indexed = !oldindex && index;
+always @(posedge rdata)
+begin
+    rdata_toggle <= ~rdata_toggle;
+end
 
-wire rdataed;
-reg oldrdata;
-assign rdataed = !oldrdata && rdata;
+always @(posedge index)
+begin
+    index_toggle <= ~index_toggle;
+end
 
-assign req = (state == STATE_INTERVAL) || (state == STATE_OPCODE);
-
-always @(posedge clock)
+always @(posedge sampleclock)
 begin
     if (reset)
     begin
-        state <= STATE_RESET;
-        opcode <= 0;
-        oldsampleclock <= 0;
-        oldindex <= 0;
-        oldrdata <= 0;
+        old_rdata_toggle <= 0;
+        old_index_toggle <= 0;
+        
+        index_edge <= 0;
+        rdata_edge <= 0;
+        counter <= 0;
+        req_toggle <= 0;
     end
     else
-        case (state)
-            STATE_RESET:
-                state <= STATE_WAITING;
-            
-            STATE_WAITING:
-            begin
-                if (rdataed || indexed)
-                begin
-                    opcode <= {0, counter};
-                    state <= STATE_INTERVAL;
-                end
-                else if (sampleclocked)
-                begin
-                    oldsampleclock <= 1;
-                    if (counter == 7'h7f)
-                    begin
-                        opcode <= {0, counter};
-                        state <= STATE_OPCODE;
-                    end
-                    else
-                        state <= STATE_COUNTING;
-                end
-                
-                if (oldrdata && !rdata)
-                    oldrdata <= 0;
-                if (oldindex && !index)
-                    oldindex <= 0;
-                if (oldsampleclock && !sampleclock)
-                    oldsampleclock <= 0;
-            end
-            
-            STATE_INTERVAL: /* interval byte sent here; counter reset */
-                state <= STATE_DISPATCH;
-                
-            STATE_DISPATCH: /* relax after interval byte, dispatch for opcode */
-            begin
-                if (rdataed)
-                begin
-                    oldrdata <= 1;
-                    opcode <= 8'h80;
-                    state <= STATE_OPCODE;
-                end
-                else if (indexed)
-                begin
-                    oldindex <= 1;
-                    opcode <= 8'h81;
-                    state <= STATE_OPCODE;
-                end
-                else
-                    state <= STATE_WAITING;
-            end
-            
-            STATE_OPCODE: /* opcode byte sent here */
-                state <= STATE_WAITING;
-                            
-            STATE_COUNTING:
-                state <= STATE_WAITING;
-        endcase
+    begin
+        /* If data_toggle or index_toggle have changed state, this means that they've
+         * gone high since the last sampleclock. */
+         
+        index_edge <= index_toggle != old_index_toggle;
+        old_index_toggle <= index_toggle;
+        
+        rdata_edge <= rdata_toggle != old_rdata_toggle;
+        old_rdata_toggle <= rdata_toggle;
+        
+        if (rdata_edge || index_edge || (counter == 6'h3f)) begin
+            opcode <= { rdata_edge, index_edge, counter };
+            req_toggle <= ~req_toggle;
+            counter <= 1;   /* remember to count this tick */
+        end else begin
+            counter <= counter + 1;
+        end
+    end
+end
+
+reg req_toggle_q;
+
+always @(posedge clock)
+begin
+    if (reset) begin
+        req_toggle_q <= 0;
+        req <= 0;
+    end else begin
+        req_toggle_q <= req_toggle;
+        req <= (req_toggle != req_toggle_q);
+    end
 end
 
 //`#end` -- edit above this line, do not edit this line

FluxEngine.cydsn/Sequencer/Sequencer.v

@@ -18,21 +18,16 @@ module Sequencer (
 
 //`#start body` -- edit after this line, do not edit this line
 
-localparam STATE_IDLE = 0;
-localparam STATE_LOAD = 1;
-localparam STATE_WAITING = 2;
-localparam STATE_PULSING = 3;
-localparam STATE_INDEXING = 4;
+localparam STATE_LOAD = 0;
+localparam STATE_WRITING = 1;
 
-localparam OPCODE_PULSE = 8'h80;
-localparam OPCODE_INDEX = 8'h81;
+reg state;
+reg [5:0] countdown;
+reg pulsepending;
 
-reg [2:0] state;
-reg [6:0] countdown;
-
-assign req = (state == STATE_LOAD);
-assign wdata = (state == STATE_PULSING);
-assign debug_state = state;
+assign req = (!reset && (state == STATE_LOAD));
+assign wdata = (!reset && (state == STATE_WRITING) && (countdown == 0) && pulsepending);
+assign debug_state = 0;
 
 reg olddataclock;
 wire dataclocked;
@@ -40,9 +35,7 @@ always @(posedge clock) olddataclock <= dataclock;
 assign dataclocked = !olddataclock && dataclock;
 
 reg oldsampleclock;
-wire sampleclocked;
-always @(posedge clock) oldsampleclock <= sampleclock;
-assign sampleclocked = !oldsampleclock && sampleclock;
+reg sampleclocked;
 
 reg oldindex;
 wire indexed;
@@ -53,48 +46,47 @@ always @(posedge clock)
 begin
     if (reset)
     begin
-        state <= STATE_IDLE;
+        state <= STATE_LOAD;
         countdown <= 0;
+        pulsepending <= 0;
+        oldsampleclock <= 0;
     end
     else
+    begin
+        if (!oldsampleclock && sampleclock)
+            sampleclocked <= 1;
+        oldsampleclock <= sampleclock;
+            
         case (state)
-            STATE_IDLE:
-                state <= STATE_LOAD;
-            
             STATE_LOAD:
+            begin
+                /* A posedge on dataclocked indicates that another opcode has
+                 * arrived. */
                 if (dataclocked)
-                    case (opcode)
-                        OPCODE_PULSE:
-                            state <= STATE_PULSING;
-                        
-                        OPCODE_INDEX:
-                            state <= STATE_INDEXING;
-                        
-                        default:
-                        begin
-                            countdown <= opcode[6:0];
-                            state <= STATE_WAITING;
-                        end
-                    endcase
+                begin
+                    pulsepending <= opcode[7];
+                    if (opcode[5:0] == 0)
+                        countdown <= 0;
+                    else
+                        countdown <= opcode[5:0] - 1; /* compensate for extra tick in state machine */
+                    
+                    state <= STATE_WRITING;
+                end
+            end
             
-            STATE_WAITING:
+            STATE_WRITING:
+            begin
                 if (sampleclocked)
                 begin
                     if (countdown == 0)
                         state <= STATE_LOAD;
                     else
                         countdown <= countdown - 1;
+                    sampleclocked <= 0;
                 end
-            
-            STATE_PULSING:
-                state <= STATE_LOAD;
-            
-            STATE_INDEXING:
-                if (indexed)
-                    state <= STATE_LOAD;
-                else
-                    state <= STATE_INDEXING;
+            end
         endcase
+    end
 end
 
 //`#end` -- edit above this line, do not edit this line

FluxEngine.cydsn/main.c

@@ -5,7 +5,6 @@
 #include <setjmp.h>
 #include "project.h"
 #include "../protocol.h"
-#include "../lib/common/crunch.h"
 
 #define MOTOR_ON_TIME 5000 /* milliseconds */
 #define STEP_INTERVAL_TIME 6 /* ms */
@@ -14,19 +13,26 @@
 #define DISKSTATUS_WPT    1
 #define DISKSTATUS_DSKCHG 2
 
-#define STEP_TOWARDS0 1
-#define STEP_AWAYFROM0 0
+#define STEP_TOWARDS0 0
+#define STEP_AWAYFROM0 1
 
-static volatile uint32_t clock = 0;
+static bool drive0_present;
+static bool drive1_present;
+
+static volatile uint32_t clock = 0; /* ms */
 static volatile bool index_irq = false;
+/* Duration in ms. 0 causes every pulse to be an index pulse. Durations since
+ * last pulse greater than this value imply sector pulse. Otherwise is an index
+ * pulse. */
+static volatile uint32_t hardsec_index_threshold = 0;
 
 static bool motor_on = false;
 static uint32_t motor_on_time = 0;
 static bool homed = false;
 static int current_track = 0;
-static uint8_t current_drive_flags = 0;
+static struct set_drive_frame current_drive_flags;
 
-#define BUFFER_COUNT 16
+#define BUFFER_COUNT 64 /* the maximum */
 #define BUFFER_SIZE 64
 static uint8_t td[BUFFER_COUNT];
 static uint8_t dma_buffer[BUFFER_COUNT][BUFFER_SIZE] __attribute__((aligned()));
@@ -41,21 +47,67 @@ static volatile bool dma_underrun = false;
 #define DECLARE_REPLY_FRAME(STRUCT, TYPE) \
     STRUCT r = {.f = { .type = TYPE, .size = sizeof(STRUCT) }}
 
+static void stop_motor(void);
+
 static void system_timer_cb(void)
 {
     CyGlobalIntDisable;
     clock++;
+    
+    static int counter300rpm = 0;
+    counter300rpm++;
+    if (counter300rpm == 200)
+        counter300rpm = 0;
+    
+    static int counter360rpm = 0;
+    counter360rpm++;
+    if (counter360rpm == 167)
+        counter360rpm = 0;
+    
+    FAKE_INDEX_GENERATOR_REG_Write(
+        ((counter300rpm == 0) ? 1 : 0)
+        | ((counter360rpm == 0) ? 2 : 0));
+    
     CyGlobalIntEnable;
 }
 
 CY_ISR(index_irq_cb)
 {
-    index_irq = true;
+    /* Hard sectored media has sector pulses at the beginning of every sector
+     * and the index pulse is an extra pulse in the middle of the last sector.
+     * When the extra pulse is seen, the next sector pulse is also the start of
+     * the track. */
+    static bool hardsec_index_irq_primed = false;
+    static uint32_t hardsec_last_pulse_time = 0;
+    uint32_t index_pulse_duration = clock - hardsec_last_pulse_time;
+
+    if (!hardsec_index_threshold)
+    {
+        index_irq = true;
+        hardsec_index_irq_primed = false;
+    }
+    else
+    {
+        /* It's only an index pulse if the previous pulse is less than
+         * the threshold.
+         */
+        index_irq = (index_pulse_duration <= hardsec_index_threshold) ?
+            hardsec_index_irq_primed : false;
+
+        if (index_irq)
+            hardsec_index_irq_primed = false;
+        else
+            hardsec_index_irq_primed =
+                index_pulse_duration <= hardsec_index_threshold;
+
+        hardsec_last_pulse_time = clock;
+    }
     
     /* Stop writing the instant the index pulse comes along; it may take a few
      * moments for the main code to notice the pulse, and we don't want to overwrite
      * the beginning of the track. */
-    ERASE_REG_Write(0);
+    if (index_irq)
+        ERASE_REG_Write(0);
 }
 
 CY_ISR(capture_dma_finished_irq_cb)
@@ -85,21 +137,25 @@ static void print(const char* msg, ...)
     UART_PutCRLF();
 }
 
-static void set_drive_flags(uint8_t flags)
+static void set_drive_flags(struct set_drive_frame* flags)
 {
-    if (current_drive_flags != flags)
+    if (current_drive_flags.drive != flags->drive)
+    {
+        stop_motor();
         homed = false;
+    }
     
-    current_drive_flags = flags;
-    DRIVESELECT_REG_Write((flags & 1) ? 2 : 1); /* select drive 1 or 0 */
-    DENSITY_REG_Write(flags >> 1); /* density bit */
+    current_drive_flags = *flags;
+    DRIVESELECT_REG_Write(flags->drive ? 2 : 1); /* select drive 1 or 0 */
+    DENSITY_REG_Write(!flags->high_density); /* double density bit */
+    INDEX_REG_Write(flags->index_mode);
 }
 
 static void start_motor(void)
 {
     if (!motor_on)
     {
-        set_drive_flags(current_drive_flags);
+        set_drive_flags(&current_drive_flags);
         MOTOR_REG_Write(1);
         CyDelay(1000);
         homed = false;
@@ -126,6 +182,12 @@ static void wait_until_writeable(int ep)
         ;
 }
 
+static void wait_until_readable(int ep)
+{
+    while (USBFS_GetEPState(ep) != USBFS_OUT_BUFFER_FULL)
+        ;
+}
+
 static void send_reply(struct any_frame* f)
 {
     print("reply 0x%02x", f->f.type);
@@ -143,9 +205,15 @@ static void send_error(int code)
 /* buffer must be big enough for a frame */
 static int usb_read(int ep, uint8_t buffer[FRAME_SIZE])
 {
+    if (USBFS_GetEPState(ep) != USBFS_OUT_BUFFER_FULL)
+    {
+        USBFS_EnableOutEP(ep);
+        wait_until_readable(ep);
+    }
+
     int length = USBFS_GetEPCount(ep);
     USBFS_ReadOutEP(ep, buffer, length);
-    while (USBFS_GetEPState(ep) == USBFS_OUT_BUFFER_FULL)
+    while (USBFS_GetEPState(ep) != USBFS_OUT_BUFFER_EMPTY)
         ;
     return length;
 }
@@ -153,7 +221,7 @@ static int usb_read(int ep, uint8_t buffer[FRAME_SIZE])
 static void cmd_get_version(struct any_frame* f)
 {
     DECLARE_REPLY_FRAME(struct version_frame, F_FRAME_GET_VERSION_REPLY);
-    r.version = FLUXENGINE_VERSION;
+    r.version = FLUXENGINE_PROTOCOL_VERSION;
     send_reply((struct any_frame*) &r);
 }
 
@@ -167,19 +235,19 @@ static void step(int dir)
     CyDelay(STEP_INTERVAL_TIME);
 }
 
-static void home(void)
+/* returns true if it looks like a drive is attached */
+static bool home(void)
 {
     for (int i=0; i<100; i++)
     {
         /* Don't keep stepping forever, because if a drive's
          * not connected bad things happen. */
         if (TRACK0_REG_Read())
-            break;
+            return true;
         step(STEP_TOWARDS0);
     }
     
-    /* Step to -1, which should be a nop, to reset the disk on disk change. */
-    step(STEP_TOWARDS0);
+    return false;
 }
 
 static void seek_to(int track)
@@ -214,6 +282,7 @@ static void seek_to(int track)
         CyWdtClear();
     }
     CyDelay(STEP_SETTLING_TIME);
+    TK43_REG_Write(track < 43); /* high if 0..42, low if 43 or up */
     print("finished seek");
 }
 
@@ -232,30 +301,48 @@ static void cmd_recalibrate(void)
     send_reply(&r);    
 }
     
-static void cmd_measure_speed(struct any_frame* f)
+static void cmd_measure_speed(struct measurespeed_frame* f)
 {
     start_motor();
     
-    index_irq = false;
-    while (!index_irq)
-        ;
     index_irq = false;
     int start_clock = clock;
+    int elapsed = 0;
     while (!index_irq)
-        ;
-    int end_clock = clock;
+    {
+        elapsed = clock - start_clock;
+        if (elapsed > 1500)
+        {
+            elapsed = 0;
+            break;
+        }
+    }
+
+    if (elapsed != 0)
+    {
+        int target_pulse_count = f->hard_sector_count + 1;
+        start_clock = clock;
+        for (int x=0; x<target_pulse_count; x++)
+        {
+            index_irq = false;
+            while (!index_irq)
+                elapsed = clock - start_clock;
+        }
+    }
     
     DECLARE_REPLY_FRAME(struct speed_frame, F_FRAME_MEASURE_SPEED_REPLY);
-    r.period_ms = end_clock - start_clock;
+    r.period_ms = elapsed;
     send_reply((struct any_frame*) &r);    
 }
 
-static void cmd_bulk_test(struct any_frame* f)
+static void cmd_bulk_write_test(struct any_frame* f)
 {
     uint8_t buffer[64];
     
     wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM);
     for (int x=0; x<64; x++)
+    {
+        CyWdtClear();
         for (int y=0; y<256; y++)
         {
             for (unsigned z=0; z<sizeof(buffer); z++)
@@ -264,11 +351,44 @@ static void cmd_bulk_test(struct any_frame* f)
             wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM);
             USBFS_LoadInEP(FLUXENGINE_DATA_IN_EP_NUM, buffer, sizeof(buffer));
         }
+    }
     
-    DECLARE_REPLY_FRAME(struct any_frame, F_FRAME_BULK_TEST_REPLY);
+    DECLARE_REPLY_FRAME(struct any_frame, F_FRAME_BULK_WRITE_TEST_REPLY);
     send_reply(&r);
 }
 
+static void cmd_bulk_read_test(struct any_frame* f)
+{
+    uint8_t buffer[64];
+    
+    bool passed = true;
+    for (int x=0; x<64; x++)
+    {
+        CyWdtClear();
+        for (int y=0; y<256; y++)
+        {
+            usb_read(FLUXENGINE_DATA_OUT_EP_NUM, buffer);
+            for (unsigned z=0; z<sizeof(buffer); z++)
+            {
+                if (buffer[z] != (uint8)(x+y+z))
+                {
+                    print("fail %d+%d+%d == %d, not %d", x, y, z, buffer[z], (uint8)(x+y+z));
+                    passed = false;
+                }
+            }
+        }
+    }
+
+    print("passed=%d", passed);
+    if (passed)
+    {
+        DECLARE_REPLY_FRAME(struct any_frame, F_FRAME_BULK_READ_TEST_REPLY);
+        send_reply(&r);
+    }
+    else
+        send_error(F_ERROR_INVALID_VALUE);
+}
+
 static void deinit_dma(void)
 {
     for (int i=0; i<BUFFER_COUNT; i++)
@@ -278,7 +398,7 @@ static void deinit_dma(void)
 static void init_capture_dma(void)
 {
     dma_channel = SAMPLER_DMA_DmaInitialize(
-        2 /* bytes */,
+        1 /* bytes */,
         true /* request per burst */, 
         HI16(CYDEV_PERIPH_BASE),
         HI16(CYDEV_SRAM_BASE));
@@ -299,14 +419,14 @@ static void init_capture_dma(void)
 
 static void cmd_read(struct read_frame* f)
 {
-    SIDE_REG_Write(f->side);
     seek_to(current_track);
-    
+    SIDE_REG_Write(f->side);
+    STEP_REG_Write(f->side); /* for drives which multiplex SIDE and DIR */
     /* Do slow setup *before* we go into the real-time bit. */
     
     {
         uint8_t i = CyEnterCriticalSection();
-        SAMPLER_FIFO_SET_LEVEL_MID;
+        SAMPLER_FIFO_SET_LEVEL_NORMAL;
         SAMPLER_FIFO_CLEAR;
         SAMPLER_FIFO_SINGLE_BUFFER_UNSET;
         CyExitCriticalSection(i);
@@ -315,16 +435,17 @@ static void cmd_read(struct read_frame* f)
     wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM);
     init_capture_dma();
 
-    /* Wait for the beginning of a rotation. */
+    /* Wait for the beginning of a rotation, if requested. */
         
-    index_irq = false;
-    while (!index_irq)
-        ;
-    index_irq = false;
-    
-    crunch_state_t cs = {};
-    cs.outputptr = usb_buffer;
-    cs.outputlen = BUFFER_SIZE;
+    if (f->synced)
+    {
+        hardsec_index_threshold = f->hardsec_threshold_ms;
+        index_irq = false;
+        while (!index_irq)
+            ;
+        index_irq = false;
+        hardsec_index_threshold = 0;
+    }
     
     dma_writing_to_td = 0;
     dma_reading_from_td = -1;
@@ -337,75 +458,68 @@ static void cmd_read(struct read_frame* f)
     /* Wait for the first DMA transfer to complete, after which we can start the
      * USB transfer. */
 
-    while ((dma_writing_to_td == 0) && !index_irq)
+    while (dma_writing_to_td == 0)
         ;
     dma_reading_from_td = 0;
+    bool dma_running = true;
     
     /* Start transferring. */
 
-    int revolutions = f->revolutions;
-    while (!dma_underrun)
+    uint32_t start_time = clock;
+    for (;;)
     {
         CyWdtClear();
 
-        /* Have we reached the index pulse? */
-        if (index_irq)
-        {
-            index_irq = false;
-            revolutions--;
-            if (revolutions == 0)
-                break;
-        }
+        /* If the sample session is over, stop reading but continue processing until
+         * the DMA chain is empty. */
         
-        /* Wait for the next block to be read. */
-        while (dma_reading_from_td == dma_writing_to_td)
+        if ((clock - start_time) >= f->milliseconds)
         {
-            /* On an underrun, give up immediately. */
-            if (dma_underrun)
-                goto abort;
-        }
-
-        uint8_t dma_buffer_usage = 0;
-        while (dma_buffer_usage < BUFFER_SIZE)
-        {
-            cs.inputptr = dma_buffer[dma_reading_from_td] + dma_buffer_usage;
-            cs.inputlen = BUFFER_SIZE - dma_buffer_usage;
-            crunch(&cs);
-            dma_buffer_usage += BUFFER_SIZE - cs.inputlen;
-            count++;
-            if (cs.outputlen == 0)
+            if (dma_running)
             {
-                while (USBFS_GetEPState(FLUXENGINE_DATA_IN_EP_NUM) != USBFS_IN_BUFFER_EMPTY)
-                {
-                    if (index_irq || dma_underrun)
-                        goto abort;
-                }
-
-                USBFS_LoadInEP(FLUXENGINE_DATA_IN_EP_NUM, usb_buffer, BUFFER_SIZE);
-                cs.outputptr = usb_buffer;
-                cs.outputlen = BUFFER_SIZE;
+                CyDmaChSetRequest(dma_channel, CY_DMA_CPU_TERM_CHAIN);
+                while (CyDmaChGetRequest(dma_channel))
+                    ;
+                dma_running = false;
+                dma_underrun = false;
             }
         }
-        dma_reading_from_td = NEXT_BUFFER(dma_reading_from_td);
+        
+        /* If there's an underrun event, stop immediately. */
+        
+        if (dma_underrun)
+            goto abort;
+        
+        /* If there are no more blocks to be read, check to see if we've finished. */
+        
+        if (dma_reading_from_td == dma_writing_to_td)
+        {
+            /* Also if we've run out of blocks to send. */
+            
+            if (!dma_running)
+                goto abort;
+        }
+        else
+        {
+            /* Otherwise, there's a block waiting, so attempt to send it. */
+            
+            wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM);
+            USBFS_LoadInEP(FLUXENGINE_DATA_IN_EP_NUM, dma_buffer[dma_reading_from_td], BUFFER_SIZE);
+            count++;
+            dma_reading_from_td = NEXT_BUFFER(dma_reading_from_td);
+        }
     }
 abort:;
-    CyDmaChSetRequest(dma_channel, CY_DMA_CPU_TERM_CHAIN);
-    while (CyDmaChGetRequest(dma_channel))
-        ;
+    bool saved_dma_underrun = dma_underrun;
 
-    donecrunch(&cs);
+    /* Terminate the transfer (all transfers are an exact number of fragments). */
+    wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM);
+    USBFS_LoadInEP(FLUXENGINE_DATA_IN_EP_NUM, NULL, 0);
     wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM);
-    if (!dma_underrun)
-    {
-        if (cs.outputlen != BUFFER_SIZE)
-            USBFS_LoadInEP(FLUXENGINE_DATA_IN_EP_NUM, usb_buffer, BUFFER_SIZE-cs.outputlen);
-        wait_until_writeable(FLUXENGINE_DATA_IN_EP_NUM);
-    }
-    if ((cs.outputlen == BUFFER_SIZE) || (cs.outputlen == 0))
-        USBFS_LoadInEP(FLUXENGINE_DATA_IN_EP_NUM, NULL, 0);
     deinit_dma();
 
-    if (dma_underrun)
+    STEP_REG_Write(0);
+    if (saved_dma_underrun)
     {
         print("underrun after %d packets");
         send_error(F_ERROR_UNDERRUN);
@@ -450,35 +564,33 @@ static void cmd_write(struct write_frame* f)
         return;
     }
     
-    SEQUENCER_CONTROL_Write(1); /* put the sequencer into reset */
-
+    seek_to(current_track);    
     SIDE_REG_Write(f->side);
+    STEP_REG_Write(f->side); /* for drives which multiplex SIDE and DIR */
+    SEQUENCER_CONTROL_Write(1); /* put the sequencer into reset */
     {
         uint8_t i = CyEnterCriticalSection();        
-        REPLAY_FIFO_SET_LEVEL_NORMAL;
+        REPLAY_FIFO_SET_LEVEL_MID;
         REPLAY_FIFO_CLEAR;
         REPLAY_FIFO_SINGLE_BUFFER_UNSET;
         CyExitCriticalSection(i);
     }
-    seek_to(current_track);    
 
     init_replay_dma();
     bool writing = false; /* to the disk */
-    bool finished = false;
     int packets = f->bytes_to_write / FRAME_SIZE;
+    bool finished = (packets == 0);
     int count_written = 0;
     int count_read = 0;
     dma_writing_to_td = 0;
     dma_reading_from_td = -1;
     dma_underrun = false;
-
-    crunch_state_t cs = {};
-    cs.outputlen = BUFFER_SIZE;
-    USBFS_EnableOutEP(FLUXENGINE_DATA_OUT_EP_NUM);
     
     int old_reading_from_td = -1;
     for (;;)
     {
+        //CyWdtClear();
+
         /* Read data from USB into the buffers. */
         
         if (NEXT_BUFFER(dma_writing_to_td) != dma_reading_from_td)
@@ -486,54 +598,25 @@ static void cmd_write(struct write_frame* f)
             if (writing && (dma_underrun || index_irq))
                 goto abort;
             
-            /* Read crunched data, if necessary. */
-            
-            if (cs.inputlen == 0)
+            uint8_t* buffer = dma_buffer[dma_writing_to_td];
+            if (finished)
             {
-                if (finished)
-                {
-                    /* There's no more data to read, so fake some. */
-                    
-                    for (int i=0; i<BUFFER_SIZE; i++)
-                        usb_buffer[i+0] = 0x7f;
-                    cs.inputptr = usb_buffer;
-                    cs.inputlen = BUFFER_SIZE;
-                }
-                else
-                {
-                    while (USBFS_GetEPState(FLUXENGINE_DATA_OUT_EP_NUM) != USBFS_OUT_BUFFER_FULL)
-                    {
-                        if (writing && (dma_underrun || index_irq))
-                            goto abort;
-                    }
-
-                    int length = usb_read(FLUXENGINE_DATA_OUT_EP_NUM, usb_buffer);
-                    cs.inputptr = usb_buffer;
-                    cs.inputlen = length;
-                    USBFS_EnableOutEP(FLUXENGINE_DATA_OUT_EP_NUM);
-
-                    count_read++;
-                    if ((length < FRAME_SIZE) || (count_read == packets))
-                        finished = true;
-                }
+                /* There's no more data to read, so fake some. */
+                
+                memset(buffer, 0x3f, BUFFER_SIZE);
             }
-            
-            /* If there *is* data waiting in the buffer, uncrunch it. */
-            
-            if (cs.inputlen != 0)
+            else
             {
-                cs.outputptr = dma_buffer[dma_writing_to_td] + BUFFER_SIZE - cs.outputlen;
-                uncrunch(&cs);
-                if (cs.outputlen == 0)
-                {
-                    /* Completed a DMA buffer; queue it for writing. */
-                    
-                    dma_writing_to_td = NEXT_BUFFER(dma_writing_to_td);
-                    cs.outputlen = BUFFER_SIZE;
-                }
+                (void) usb_read(FLUXENGINE_DATA_OUT_EP_NUM, buffer);
+                count_read++;
+                
+                if (count_read == packets)
+                    finished = true;
             }
+            dma_writing_to_td = NEXT_BUFFER(dma_writing_to_td);
+            
+            /* Once all the buffers are full, start writing. */
             
-            /* If we have a full buffer, start writing. */
             if ((dma_reading_from_td == -1) && (dma_writing_to_td == BUFFER_COUNT-1))
             {
                 dma_reading_from_td = old_reading_from_td = 0;
@@ -548,7 +631,7 @@ static void cmd_write(struct write_frame* f)
 
                 /* Wait for the index marker. While this happens, the DMA engine
                  * will prime the FIFO. */
-                
+                hardsec_index_threshold = f->hardsec_threshold_ms;
                 index_irq = false;
                 while (!index_irq)
                     ;
@@ -559,7 +642,7 @@ static void cmd_write(struct write_frame* f)
                 SEQUENCER_CONTROL_Write(0); /* start writing! */
             }
         }
-        
+
         if (writing && (dma_underrun || index_irq))
             goto abort;
 
@@ -583,31 +666,29 @@ abort:
     }
     
     print("p=%d cr=%d cw=%d f=%d w=%d index=%d underrun=%d", packets, count_read, count_written, finished, writing, index_irq, dma_underrun);
+    hardsec_index_threshold = 0;
     if (!finished)
     {
-        while (count_read < packets)
+        /* There's still some data to read, so just read and blackhole it ---
+         * easier than trying to terminate the connection. */
+        while (count_read != packets)
         {
-            if (USBFS_GetEPState(FLUXENGINE_DATA_OUT_EP_NUM) == USBFS_OUT_BUFFER_FULL)
-            {
-                int length = usb_read(FLUXENGINE_DATA_OUT_EP_NUM, usb_buffer);
-                if (length < FRAME_SIZE)
-                    break;
-                USBFS_EnableOutEP(FLUXENGINE_DATA_OUT_EP_NUM);
-                count_read++;
-            }
+            (void) usb_read(FLUXENGINE_DATA_OUT_EP_NUM, usb_buffer);
+            count_read++;
         }
-        USBFS_DisableOutEP(FLUXENGINE_DATA_OUT_EP_NUM);
     }
     
     deinit_dma();
-    print("write finished");
     
+    STEP_REG_Write(0);
     if (dma_underrun)
     {
+        print("underrun!");
         send_error(F_ERROR_UNDERRUN);
         return;
     }
 
+    print("success");
     DECLARE_REPLY_FRAME(struct any_frame, F_FRAME_WRITE_REPLY);
     send_reply((struct any_frame*) &r);
 }
@@ -615,10 +696,11 @@ abort:
 static void cmd_erase(struct erase_frame* f)
 {
     SIDE_REG_Write(f->side);
-    seek_to(current_track);    
+    seek_to(current_track);
     /* Disk is now spinning. */
     
     print("start erasing");
+    hardsec_index_threshold = f->hardsec_threshold_ms;
     index_irq = false;
     while (!index_irq)
         ;
@@ -627,6 +709,7 @@ static void cmd_erase(struct erase_frame* f)
     while (!index_irq)
         ;
     ERASE_REG_Write(0);
+    hardsec_index_threshold = 0;
     print("stop erasing");
 
     DECLARE_REPLY_FRAME(struct any_frame, F_FRAME_ERASE_REPLY);
@@ -635,7 +718,11 @@ static void cmd_erase(struct erase_frame* f)
 
 static void cmd_set_drive(struct set_drive_frame* f)
 {
-    set_drive_flags(f->drive_flags);
+    if (drive0_present && !drive1_present)
+        f->drive = 0;
+    if (drive1_present && !drive0_present)
+        f->drive = 1;
+    set_drive_flags(f);
     
     DECLARE_REPLY_FRAME(struct any_frame, F_FRAME_SET_DRIVE_REPLY);
     send_reply((struct any_frame*) &r);
@@ -748,11 +835,15 @@ static void handle_command(void)
             break;
         
         case F_FRAME_MEASURE_SPEED_CMD:
-            cmd_measure_speed(f);
+            cmd_measure_speed((struct measurespeed_frame*) f);
             break;
             
-        case F_FRAME_BULK_TEST_CMD:
-            cmd_bulk_test(f);
+        case F_FRAME_BULK_WRITE_TEST_CMD:
+            cmd_bulk_write_test(f);
+            break;
+            
+        case F_FRAME_BULK_READ_TEST_CMD:
+            cmd_bulk_read_test(f);
             break;
             
         case F_FRAME_READ_CMD:
@@ -784,6 +875,21 @@ static void handle_command(void)
     }
 }
 
+static void detect_drives(void)
+{
+    current_drive_flags.drive = 0;
+    start_motor();
+    drive0_present = home();
+    stop_motor();
+    
+    current_drive_flags.drive = 1;
+    start_motor();
+    drive1_present = home();
+    stop_motor();
+    
+    print("drive 0: %s drive 1: %s", drive0_present ? "yes" : "no", drive1_present ? "yes" : "no");
+}
+
 int main(void)
 {
     CyGlobalIntEnable;
@@ -797,11 +903,10 @@ int main(void)
     DRIVESELECT_REG_Write(0);
     UART_Start();
     USBFS_Start(0, USBFS_DWR_VDDD_OPERATION);
+    USBFS_DisableOutEP(FLUXENGINE_DATA_OUT_EP_NUM);
     
     CyWdtStart(CYWDT_1024_TICKS, CYWDT_LPMODE_DISABLED);
     
-    /* UART_PutString("GO\r"); */
-
     for (;;)
     {
         CyWdtClear();
@@ -817,17 +922,91 @@ int main(void)
         {
             print("Waiting for USB...");
             while (!USBFS_GetConfiguration())
-                ;
+                CyWdtClear();
             print("USB ready");
             USBFS_EnableOutEP(FLUXENGINE_CMD_OUT_EP_NUM);
+            print("Scanning drives...");
+            detect_drives();
         }
         
         if (USBFS_GetEPState(FLUXENGINE_CMD_OUT_EP_NUM) == USBFS_OUT_BUFFER_FULL)
         {
-            set_drive_flags(current_drive_flags);
+            set_drive_flags(&current_drive_flags);
             handle_command();
             USBFS_EnableOutEP(FLUXENGINE_CMD_OUT_EP_NUM);
             print("idle");
         }
     }
 }
+
+const uint8_t USBFS_MSOS_CONFIGURATION_DESCR[USBFS_MSOS_CONF_DESCR_LENGTH] = {
+/*  Length of the descriptor 4 bytes       */   0x28u, 0x00u, 0x00u, 0x00u,
+/*  Version of the descriptor 2 bytes      */   0x00u, 0x01u,
+/*  wIndex - Fixed:INDEX_CONFIG_DESCRIPTOR */   0x04u, 0x00u,
+/*  bCount - Count of device functions.    */   0x01u,
+/*  Reserved : 7 bytes                     */   0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u,
+/*  bFirstInterfaceNumber                  */   0x00u,
+/*  Reserved                               */   0x01u,
+/*  compatibleId - "WINUSB\0\0"            */   'W', 'I', 'N', 'U', 'S', 'B', 0, 0,
+/*  subcompatibleID - "00001\0\0"          */   '0', '0', '0', '0', '1',
+                                                0x00u, 0x00u, 0x00u,
+/*  Reserved : 6 bytes                     */   0x00u, 0x00u, 0x00u, 0x00u, 0x00u, 0x00u
+};
+
+const uint8_t USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[224] = {
+    /* Length; 4 bytes       */   224, 0, 0, 0,
+    /* Version; 2 bytes      */   0x00, 0x01, /* 1.0 */
+    /* wIndex                */   0x05, 0x00,
+    /* Number of sections    */   0x01, 0x00,
+    /* Property section size */   214, 0, 0, 0,
+    /* Property data type    */   0x07, 0x00, 0x00, 0x00, /* 7 = REG_MULTI_SZ Unicode */
+    /* Property name length  */   42, 0,
+    /* Property name         */   'D', 0, 'e', 0, 'v', 0, 'i', 0, 'c', 0, 'e', 0,
+                                  'I', 0, 'n', 0, 't', 0, 'e', 0, 'r', 0, 'f', 0,
+                                  'a', 0, 'c', 0, 'e', 0, 'G', 0, 'U', 0, 'I', 0,
+                                  'D', 0, 's', 0, 0,   0,
+    /* Property data length  */   158, 0, 0, 0,
+    /* GUID #1 data          */   '{', 0, '3', 0, 'd', 0, '2', 0, '7', 0, '5', 0,
+                                  'c', 0, 'f', 0, 'e', 0, '-', 0, '5', 0, '4', 0,
+                                  '3', 0, '5', 0, '-', 0, '4', 0, 'd', 0, 'd', 0,
+                                  '5', 0, '-', 0, 'a', 0, 'c', 0, 'c', 0, 'a', 0,
+                                  '-', 0, '9', 0, 'f', 0, 'b', 0, '9', 0, '9', 0,
+                                  '5', 0, 'e', 0, '2', 0, 'f', 0, '6', 0, '3', 0,
+                                  '8', 0, '}', 0, '\0', 0,
+    /* GUID #2 data          */   '{', 0, '3', 0, 'd', 0, '2', 0, '7', 0, '5', 0,
+                                  'c', 0, 'f', 0, 'e', 0, '-', 0, '5', 0, '4', 0,
+                                  '3', 0, '5', 0, '-', 0, '4', 0, 'd', 0, 'd', 0,
+                                  '5', 0, '-', 0, 'a', 0, 'c', 0, 'c', 0, 'a', 0,
+                                  '-', 0, '9', 0, 'f', 0, 'b', 0, '9', 0, '9', 0,
+                                  '5', 0, 'e', 0, '2', 0, 'f', 0, '6', 0, '3', 0,
+                                  '8', 0, '}', 0, '\0', 0, '\0', 0
+};
+
+uint8 USBFS_HandleVendorRqst(void)
+{
+    if (!(USBFS_bmRequestTypeReg & USBFS_RQST_DIR_D2H))
+        return false;
+
+    switch (USBFS_bRequestReg)
+    {
+        case USBFS_GET_EXTENDED_CONFIG_DESCRIPTOR:
+            switch (USBFS_wIndexLoReg)
+            {
+                case 4:
+                    USBFS_currentTD.pData = (volatile uint8 *) &USBFS_MSOS_CONFIGURATION_DESCR[0u];
+                    USBFS_currentTD.count = USBFS_MSOS_CONFIGURATION_DESCR[0u];
+                    return USBFS_InitControlRead();
+                    
+                case 5:
+                    USBFS_currentTD.pData = (volatile uint8 *) &USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[0u];
+                    USBFS_currentTD.count = USBFS_MSOS_EXTENDED_PROPERTIES_DESCR[0u];
+                    return USBFS_InitControlRead();
+            }
+
+        default:
+            break;
+    }
+
+    return true;
+}
+

FluxEngine.cydsn/patcher.vbs

@@ -1,18 +0,0 @@
-const READ = 1
-const WRITE = 2
-
-filename = "Generated_Source\PSoC5\USBFS_descr.c"
-set fso = CreateObject("Scripting.FileSystemObject")
-
-set file = fso.OpenTextFile(filename, READ)
-text = file.ReadAll
-file.Close
-
-set r = New RegExp
-r.MultiLine = True
-r.Pattern = "/\* +compatibleID.*\n.*"
-text = r.replace(text, "'W', 'I', 'N', 'U', 'S', 'B', 0, 0,")
-
-set file = fso.CreateTextFile(filename, True)
-file.Write text
-file.Close

Makefile

@@ -1,40 +1,255 @@
-PACKAGES = zlib sqlite3 libusb-1.0
-
-export CFLAGS = -Os -g --std=c++14 \
-	-ffunction-sections -fdata-sections
-export LDFLAGS = -Os
+# Special Windows settings.
 
 ifeq ($(OS), Windows_NT)
-export CXX = /mingw32/bin/g++
-export AR = /mingw32/bin/ar rcs
-export STRIP = /mingw32/bin/strip
-export CFLAGS += -I/mingw32/include/libusb-1.0
-export LDFLAGS +=
-export LIBS = -static -lz -lsqlite3 -lusb-1.0
-export EXTENSION = .exe
-else
-export CXX = g++
-export AR = ar rcs
-export STRIP = strip
-export CFLAGS += $(shell pkg-config --cflags $(PACKAGES))
-export LDFLAGS +=
-export LIBS = $(shell pkg-config --libs $(PACKAGES))
-export EXTENSION =
+	MINGWBIN = /mingw32/bin
+	CCPREFIX = $(MINGWBIN)/
+	LUA = $(MINGWBIN)/lua
+	PKG_CONFIG = $(MINGWBIN)/pkg-config
+	WX_CONFIG = /usr/bin/sh $(MINGWBIN)/wx-config --static=yes
+	PROTOC = $(MINGWBIN)/protoc
+	PLATFORM = WINDOWS
+	LDFLAGS += \
+		-static
+	CXXFLAGS += \
+		-std=c++17 \
+		-fext-numeric-literals \
+		-Wno-deprecated-enum-float-conversion \
+		-Wno-deprecated-enum-enum-conversion
+
+	# Required to get the gcc run-time libraries on the path.
+	export PATH := $(PATH):$(MINGWBIN)
+	EXT ?= .exe
 endif
 
-CFLAGS += -Ilib -Idep/fmt -Iarch
+# Special OSX settings.
 
-export OBJDIR = .obj
+ifeq ($(shell uname),Darwin)
+	PLATFORM = OSX
+	LDFLAGS += \
+		-framework IOKit \
+		-framework Foundation
+endif
 
-all: .obj/build.ninja
-	@ninja -f .obj/build.ninja -v
+# Check the Make version.
+
+
+ifeq ($(findstring 4.,$(MAKE_VERSION)),)
+$(error You need GNU Make 4.x for this (if you're on OSX, use gmake).)
+endif
+
+# Normal settings.
+
+OBJDIR ?= .obj
+CCPREFIX ?=
+LUA ?= lua
+CC ?= $(CCPREFIX)gcc
+CXX ?= $(CCPREFIX)g++
+AR ?= $(CCPREFIX)ar
+PKG_CONFIG ?= pkg-config
+WX_CONFIG ?= wx-config
+PROTOC ?= protoc
+CFLAGS ?= -g -O0
+CXXFLAGS += -std=c++17
+LDFLAGS ?=
+PLATFORM ?= UNIX
+TESTS ?= yes
+EXT ?=
+DESTDIR ?=
+PREFIX ?= /usr/local
+BINDIR ?= $(PREFIX)/bin
+
+CFLAGS += \
+	-Iarch \
+	-Ilib \
+	-I. \
+	-I$(OBJDIR)/arch \
+	-I$(OBJDIR)/lib \
+	-I$(OBJDIR) \
+
+LDFLAGS += \
+	-lz \
+	-lfmt
+
+.SUFFIXES:
+.DELETE_ON_ERROR:
+
+define nl
+
+endef
+
+use-library = $(eval $(use-library-impl))
+define use-library-impl
+$1: $(call $3_LIB)
+$1: private LDFLAGS += $(call $3_LDFLAGS)
+$2: private CFLAGS += $(call $3_CFLAGS)
+endef
+
+use-pkgconfig = $(eval $(use-pkgconfig-impl))
+define use-pkgconfig-impl
+ifneq ($(strip $(shell $(PKG_CONFIG) $3; echo $$?)),0)
+$$(error Missing required pkg-config dependency: $3)
+endif
+
+$(1): private LDFLAGS += $(shell $(PKG_CONFIG) --libs $(3))
+$(2): private CFLAGS += $(shell $(PKG_CONFIG) --cflags $(3))
+endef
+
+.PHONY: all binaries tests clean install install-bin
+all: binaries tests
+
+PROTOS = \
+	arch/aeslanier/aeslanier.proto \
+	arch/agat/agat.proto \
+	arch/amiga/amiga.proto \
+	arch/apple2/apple2.proto \
+	arch/brother/brother.proto \
+	arch/c64/c64.proto \
+	arch/f85/f85.proto \
+	arch/fb100/fb100.proto \
+	arch/ibm/ibm.proto \
+	arch/macintosh/macintosh.proto \
+	arch/micropolis/micropolis.proto \
+	arch/mx/mx.proto \
+	arch/northstar/northstar.proto \
+	arch/smaky6/smaky6.proto \
+	arch/tids990/tids990.proto \
+	arch/victor9k/victor9k.proto \
+	arch/zilogmcz/zilogmcz.proto \
+	lib/common.proto \
+	lib/config.proto \
+	lib/decoders/decoders.proto \
+	lib/drive.proto \
+	lib/encoders/encoders.proto \
+	lib/fl2.proto \
+	lib/fluxsink/fluxsink.proto \
+	lib/fluxsource/fluxsource.proto \
+	lib/imagereader/imagereader.proto \
+	lib/imagewriter/imagewriter.proto \
+	lib/layout.proto \
+	lib/usb/usb.proto \
+	lib/vfs/vfs.proto \
+	tests/testproto.proto \
+
+PROTO_HDRS = $(patsubst %.proto, $(OBJDIR)/%.pb.h, $(PROTOS))
+PROTO_SRCS = $(patsubst %.proto, $(OBJDIR)/%.pb.cc, $(PROTOS))
+PROTO_OBJS = $(patsubst %.cc, %.o, $(PROTO_SRCS))
+PROTO_CFLAGS = $(shell $(PKG_CONFIG) --cflags protobuf)
+$(PROTO_SRCS): | $(PROTO_HDRS)
+$(PROTO_OBJS): CFLAGS += $(PROTO_CFLAGS)
+PROTO_LIB = $(OBJDIR)/libproto.a
+$(PROTO_LIB): $(PROTO_OBJS)
+PROTO_LDFLAGS = $(shell $(PKG_CONFIG) --libs protobuf) -pthread $(PROTO_LIB)
+.PRECIOUS: $(PROTO_HDRS) $(PROTO_SRCS)
+
+include dep/agg/build.mk
+include dep/libusbp/build.mk
+include dep/stb/build.mk
+include dep/emu/build.mk
+include dep/fatfs/build.mk
+include dep/adflib/build.mk
+include dep/hfsutils/build.mk
+include scripts/build.mk
+
+include lib/build.mk
+include arch/build.mk
+include src/build.mk
+include src/gui/build.mk
+include tools/build.mk
+include tests/build.mk
+
+do-encodedecodetest = $(eval $(do-encodedecodetest-impl))
+define do-encodedecodetest-impl
+
+tests: $(OBJDIR)/$1$3.flux.encodedecode
+$(OBJDIR)/$1$3.flux.encodedecode: scripts/encodedecodetest.sh $(FLUXENGINE_BIN) $2
+	@mkdir -p $(dir $$@)
+	@echo ENCODEDECODETEST .flux $1 $3
+	@scripts/encodedecodetest.sh $1 flux $(FLUXENGINE_BIN) $2 $3 > $$@
+
+tests: $(OBJDIR)/$1$3.scp.encodedecode
+$(OBJDIR)/$1$3.scp.encodedecode: scripts/encodedecodetest.sh $(FLUXENGINE_BIN) $2
+	@mkdir -p $(dir $$@)
+	@echo ENCODEDECODETEST .scp $1 $3
+	@scripts/encodedecodetest.sh $1 scp $(FLUXENGINE_BIN) $2 $3 > $$@
+
+endef
+
+$(call do-encodedecodetest,amiga)
+$(call do-encodedecodetest,apple2)
+$(call do-encodedecodetest,atarist360)
+$(call do-encodedecodetest,atarist370)
+$(call do-encodedecodetest,atarist400)
+$(call do-encodedecodetest,atarist410)
+$(call do-encodedecodetest,atarist720)
+$(call do-encodedecodetest,atarist740)
+$(call do-encodedecodetest,atarist800)
+$(call do-encodedecodetest,atarist820)
+$(call do-encodedecodetest,bk800)
+$(call do-encodedecodetest,brother120)
+$(call do-encodedecodetest,brother240)
+$(call do-encodedecodetest,commodore1541,scripts/commodore1541_test.textpb,--35)
+$(call do-encodedecodetest,commodore1541,scripts/commodore1541_test.textpb,--40)
+$(call do-encodedecodetest,commodore1581)
+$(call do-encodedecodetest,cmd_fd2000)
+$(call do-encodedecodetest,hp9121)
+$(call do-encodedecodetest,ibm1200)
+$(call do-encodedecodetest,ibm1232)
+$(call do-encodedecodetest,ibm1440)
+$(call do-encodedecodetest,ibm180)
+$(call do-encodedecodetest,ibm360)
+$(call do-encodedecodetest,ibm720)
+$(call do-encodedecodetest,mac400,scripts/mac400_test.textpb)
+$(call do-encodedecodetest,mac800,scripts/mac800_test.textpb)
+$(call do-encodedecodetest,n88basic)
+$(call do-encodedecodetest,rx50)
+$(call do-encodedecodetest,tids990)
+$(call do-encodedecodetest,victor9k_ss)
+$(call do-encodedecodetest,victor9k_ds)
+
+$(OBJDIR)/%.a:
+	@mkdir -p $(dir $@)
+	@echo AR $@
+	@$(AR) rc $@ $^
+
+%.exe:
+	@mkdir -p $(dir $@)
+	@echo LINK $@
+	@$(CXX) -o $@ $^ $(LDFLAGS) $(LDFLAGS)
+
+$(OBJDIR)/%.o: %.cpp
+	@mkdir -p $(dir $@)
+	@echo CXX $<
+	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.o: %.cc
+	@mkdir -p $(dir $@)
+	@echo CXX $<
+	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.o: $(OBJDIR)/%.cc
+	@mkdir -p $(dir $@)
+	@echo CXX $<
+	@$(CXX) $(CFLAGS) $(CXXFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.o: %.c
+	@mkdir -p $(dir $@)
+	@echo CC $<
+	@$(CC) $(CFLAGS) $(CFLAGS) -MMD -MP -MF $(@:.o=.d) -c -o $@ $<
+
+$(OBJDIR)/%.pb.h: %.proto
+	@mkdir -p $(dir $@)
+	@echo PROTOC $@
+	@$(PROTOC) -I. --cpp_out=$(OBJDIR) $<
 
 clean:
-	@echo CLEAN
-	@rm -rf $(OBJDIR)
+	rm -rf $(OBJDIR)
 
-.obj/build.ninja: mkninja.sh Makefile
-	@echo MKNINJA $@
-	@mkdir -p $(OBJDIR)
-	@sh $< > $@
+install: install-bin # install-man install-docs ...
 
+install-bin: fluxengine$(EXT) fluxengine-gui$(EXT) brother120tool$(EXT) brother240tool$(EXT) upgrade-flux-file$(EXT)
+	install -d "$(DESTDIR)$(BINDIR)"
+	for target in $^; do \
+		install $$target "$(DESTDIR)$(BINDIR)/$$target"; \
+	done
+
+-include $(OBJS:%.o=%.d)

README.md

@@ -2,7 +2,17 @@ FluxEngine
 ==========
 
 (If you're reading this on GitHub, the formatting's a bit messed up. [Try the
-version on cowlark.com instead.](http://cowlark.com/fluxengine/)
+version on cowlark.com instead.](http://cowlark.com/fluxengine/))
+
+**Breaking news!** As of 2022-09-09, there's new [filesystem
+support](doc/filesystem.md). Read (and sometimes write) files directly from
+(and to) your disks, with eight different file systems! It works in the GUI,
+too, which is available for Linux (and other Unix clones), Windows and OSX. See
+the details below.
+
+<div style="text-align: center">
+<a href="doc/screenshot.jpg"><img src="doc/screenshot.jpg" style="width:60%" alt="screenshot of the GUI in action"></a>
+</div>
 
 What?
 -----
@@ -24,17 +34,13 @@ Don't believe me? Watch the demo reel!
 <iframe width="373" height="210" src="https://www.youtube.com/embed/m_s1iw8eW7o" frameborder="0" allow="accelerometer; autoplay; encrypted-media; gyroscope; picture-in-picture" allowfullscreen></iframe>
 </div>
 
-**Important note.** On 2019-02-09 I did a hardware redesign and moved the pins on
-the board. Sorry for the inconvenience, but it means you don't have to modify
-the board any more to make it work. If you built the hardware prior to then,
-you'll need to adjust it.
-
-**Another important note.** On 2019-07-03 I've revamped the build process and
-the (command line) user interface. It should be much nicer now, not least in
-that there's a single client binary with all the functionality in it. The
-interface is a little different, but not much. The build process is now
-better (simpler). See [the building](doc/building.md) and
-[using](doc/using.md) pages for more details.
+**New!** The FluxEngine client software now works with
+[GreaseWeazle](https://github.com/keirf/Greaseweazle/wiki) hardware. So, if you
+can't find a PSoC5 development kit, or don't want to use the Cypress Windows
+tools for programming it, you can use one of these instead. Very nearly all
+FluxEngine features are available with the GreaseWeazle and it works out-of-the
+box. See the [dedicated GreaseWeazle documentation page](doc/greaseweazle.md)
+for more information.
 
 Where?
 ------
@@ -59,8 +65,23 @@ following friendly articles:
   - [Using a FluxEngine](doc/using.md) ∾ what to do with your new hardware ∾
     flux files and image files ∾ knowing what you're doing
 
-  - [Troubleshooting dubious disks](doc/problems.md) ∾ it's not an exact science ∾
-    the sector map ∾ clock detection and the histogram
+  - [Using GreaseWeazle hardware with the FluxEngine client
+    software](doc/greaseweazle.md) ∾ what works ∾ what doesn't work ∾ where to
+    go for help
+
+  - [Configuring for your drive](doc/drives.md) ∾ but I don't have a 80 track
+    drive! ∾ reading and writing 40 track disks ∾ Shugart and Apple II
+
+  - [Direct filesystem access](doc/filesystem.md) ∾ imaging files is a pain
+    ∾ accessing files directly ∾ features and limitation ∾ it works on disk
+    images too, you say?
+    
+  - [Troubleshooting dubious disks](doc/problems.md) ∾ it's not an exact
+    science ∾ the sector map ∾ clock detection and the histogram
+
+  - [Disk densities](doc/driveresponse.md) ∾ what's the difference between an HD
+    and DD disk? ∾ you can't do that with that ∾ measuring your drive's ability to
+    work with exotic formats ∾ I think my drive is broken
 
 Which?
 ------
@@ -77,22 +98,32 @@ people who've had it work).
 
 ### Old disk formats
 
-| Format                                   | Read? | Write? | Notes |
-|:-----------------------------------------|:-----:|:------:|-------|
-| IBM PC compatible                        |  🦄   |        | and compatibles (like the Atari ST) |
-| [Acorn ADFS](doc/disk-acornadfs.md)      |  🦄   |        | single- and double- sided           |
-| [Acorn DFS](doc/disk-acorndfs.md)        |  🦄   |        |                                     |
-| [Ampro Little Board](doc/disk-ampro.md)  |  🦖   |        |                                     |
-| [Apple II DOS 3.3](doc/disk-apple2.md)   |  🦄   |        | doesn't do logical sector remapping |
-| [Amiga](doc/disk-amiga.md)               |  🦄   |        |                                     |
-| [Commodore 64 1541](doc/disk-c64.md)     |  🦖   |        | and probably the other GCR formats  |
-| [Brother 120kB](doc/disk-brother.md)     |  🦄   |        |                                     |
-| [Brother 240kB](doc/disk-brother.md)     |  🦄   |   🦄   |                                     |
-| [Brother FB-100](doc/disk-fb100.md)      |  🦖   |        | Tandy Model 100, Husky Hunter, knitting machines |
-| [Macintosh 800kB](doc/disk-macintosh.md) |  🦄   |        | and probably the 400kB too          |
-| [TRS-80](doc/disk-trs80.md)              |  🦖   |        | a minor variation of the IBM scheme |
+| Format                                    | Read? | Write? | Notes |
+|:------------------------------------------|:-----:|:------:|-------|
+| [IBM PC compatible](doc/disk-ibm.md)      |  🦄   |   🦄   | and compatibles (like the Atari ST) |
+| [Atari ST](doc/disk-atarist.md)           |  🦄   |   🦄   | technically the same as IBM, almost |
+| [Acorn ADFS](doc/disk-acornadfs.md)       |  🦄   |   🦖*  | single- and double- sided           |
+| [Acorn DFS](doc/disk-acorndfs.md)         |  🦄   |   🦖*  |                                     |
+| [Ampro Little Board](doc/disk-ampro.md)   |  🦖   |   🦖*  |                                     |
+| [Agat](doc/disk-agat.md)                  |  🦖   |        | Soviet Union Apple-II-like computer |
+| [Apple II](doc/disk-apple2.md)            |  🦄   |   🦄   |                                     |
+| [Amiga](doc/disk-amiga.md)                |  🦄   |   🦄   |                                     |
+| [Commodore 64 1541/1581](doc/disk-c64.md) |  🦄   |   🦄   | and probably the other formats      |
+| [Brother 120kB](doc/disk-brother.md)      |  🦄   |   🦄   |                                     |
+| [Brother 240kB](doc/disk-brother.md)      |  🦄   |   🦄   |                                     |
+| [Brother FB-100](doc/disk-fb100.md)       |  🦖   |        | Tandy Model 100, Husky Hunter, knitting machines |
+| [Elektronika BK](doc/disk-bd.md)          |  🦄   |   🦄   | Soviet Union PDP-11 clone           |
+| [Macintosh 400kB/800kB](doc/disk-macintosh.md)  |  🦄   |   🦄   |                                     |
+| [NEC PC-98](doc/disk-ibm.md)              |  🦄   |   🦄   | trimode drive not required          |
+| [Sharp X68000](doc/disk-ibm.md)           |  🦄   |   🦄   |                                     |
+| [Smaky 6](doc/disk-smaky6.md)             |  🦖   |       | 5.25" hard sectored |
+| [TRS-80](doc/disk-trs80.md)               |  🦖   |   🦖*  | a minor variation of the IBM scheme |
 {: .datatable }
 
+`*`: these formats are variations of the generic IBM format, and since the
+IBM writer is completely generic, it should be configurable for these
+formats... theoretically. I don't have the hardware to try it.
+
 ### Even older disk formats
 
 These formats are for particularly old, weird architectures, even by the
@@ -106,8 +137,12 @@ at least, check the CRC so what data's there is probably good.
 | [AES Superplus / No Problem](doc/disk-aeslanier.md) |  🦖   | | hard sectors! |
 | [Durango F85](doc/disk-durangof85.md)    |  🦖   |        | 5.25" |
 | [DVK MX](doc/disk-mx.md)                 |  🦖   |        | Soviet PDP-11 clone |
-| [Victor 9000](doc/disk-victor9k.md)      |  🦖   |        | 8-inch        |
-| [Zilog MCZ](doc/disk-zilogmcz.md)        |  🦖   |        | 8-inch _and_ hard sectors |
+| [VDS Eco1](doc/disk-eco1.md)             |  🦖   |        | 8" mixed format |
+| [Micropolis](doc/disk-micropolis.md)     |  🦄   |        | Micropolis 100tpi drives |
+| [Northstar](doc/disk-northstar.md)       |  🦖   |   🦖   | 5.25" hard sectors |
+| [TI DS990 FD1000](doc/disk-tids990.md)   |  🦄   |  🦄    | 8" |
+| [Victor 9000](doc/disk-victor9k.md)      |  🦖   |        | 5.25" GCR encoded |
+| [Zilog MCZ](doc/disk-zilogmcz.md)        |  🦖   |        | 8" _and_ hard sectors |
 {: .datatable }
 
 ### Notes
@@ -125,7 +160,7 @@ at least, check the CRC so what data's there is probably good.
     There hasn't been a lot of demand for this yet; if you have a pressing
     need to write weird disks, [please
     ask](https://github.com/davidgiven/fluxengine/issues/new). I haven't
-    implement write support for PC disks because they're boring and I'm lazy,
+    implemented write support for PC disks because they're boring and I'm lazy,
     and also because they vary so much that figuring out how to specify them
     is hard.
 
@@ -179,18 +214,53 @@ There may or may not be anything interesting there.
 License
 -------
 
-Everything here _except the contents of the `dep` directory_ is © 2019 David
-Given and is licensed under the MIT open source license. Please see
+Everything here _except the contents of the `dep` directory_ is © 2022 The
+FluxEngine Authors (mostly me, David Given; see the VCS history for the other
+people) and is licensed under the MIT open source license. Please see
 [COPYING](COPYING) for the full text. The tl;dr is: you can do what you like
 with it provided you don't claim you wrote it.
 
-As an exception, `dep/fmt` contains a copy of [fmt](http://fmtlib.net),
-maintained by Victor Zverovich (`vitaut <https://github.com/vitaut>`) and
-Jonathan Müller (`foonathan <https://github.com/foonathan>`) with
-contributions from many other people. It is licensed under the terms of the
-BSD license. Please see the contents of the directory for the full text.
-
 As an exception, `dep/emu` contains parts of the OpenBSD C library
-code, Todd Miller and William A. Rowe (and probably others). It is licensed
+code, maintained by Todd Miller and William A. Rowe (and probably others). It is licensed
 under the terms of the 3-clause BSD license. Please see the contents of the
 directory for the full text. It's been lightly modified by me.
+
+As an exception, `dep/agg` contains parts of the Anti-Grain Antialiasing
+library, written by Maxim Semanarev (and others). It is licensed under the
+terms of the 3-clause BSD license. Please see the contents of the directory for
+the full text. It's been lightly modified by me.
+
+As an exception, `dep/stb` contains parts of the libstb utility library,
+written by Sean T Barett (and others). It is public domain/Unlicense/MIT
+licensed, at your choice. Please see the contents of the directory for the full
+text.
+
+As an exception, `dep/snowhouse` contains the snowhouse assertion library,
+taken from https://github.com/banditcpp/snowhouse. It is Boost Standard License
+1.0 licensed. Please see the contents of the directory for the full text. Note
+that this is only used during the build and no code ends up in the output
+binaries.
+
+As an exception, `dep/libusbp` contains the libusbp library, taken from
+https://github.com/pololu/libusbp. It is MIT licensed. Please see the contents
+of the directory for the full text.
+
+As an exception, `dep/fatfs` contains the fatfs library, taken from
+http://elm-chan.org/fsw/ff/00index_e.html. It is single-clause BSD licensed.
+Please see the contents of the directory for the full text.
+
+As an exception, `dep/adflib` contains the adflib library, written by Laurent
+Clevy et al, taken from https://github.com/lclevy/ADFlib. It is GPL 2.0
+licensed. Please see the contents of the directory for the full text.
+
+As an exception, `dep/hfsutils` contains a partial copy of the hfsutils
+package, written by Robert Leslie et al, taken from
+https://www.mars.org/home/rob/proj/hfs. It is GPL 2.0 licensed. Please see the
+contents of the directory for the full text.
+
+__Important:__ Because of all these exceptions, if you distribute the
+FluxEngine package as a whole, you must comply with the terms of _all_ of the
+licensing terms. This means that __effectively the FluxEngine package is
+distributable under the terms of the GPL 2.0__.
+
+

arch/aeslanier/aeslanier.h

@@ -5,16 +5,6 @@
 #define AESLANIER_SECTOR_LENGTH    256
 #define AESLANIER_RECORD_SIZE      (AESLANIER_SECTOR_LENGTH + 5)
 
-class Sector;
-class Fluxmap;
-
-class AesLanierDecoder : public AbstractDecoder
-{
-public:
-    virtual ~AesLanierDecoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-};
+extern std::unique_ptr<Decoder> createAesLanierDecoder(const DecoderProto& config);
 
 #endif

arch/aeslanier/aeslanier.proto

@@ -0,0 +1,4 @@
+syntax = "proto2";
+
+message AesLanierDecoderProto {}
+

arch/aeslanier/decoder.cc

@@ -6,7 +6,6 @@
 #include "decoders/fluxmapreader.h"
 #include "sector.h"
 #include "bytes.h"
-#include "record.h"
 #include "fmt/format.h"
 #include <string.h>
 
@@ -14,52 +13,54 @@ static const FluxPattern SECTOR_PATTERN(32, AESLANIER_RECORD_SEPARATOR);
 
 /* This is actually M2FM, rather than MFM, but it our MFM/FM decoder copes fine with it. */
 
-static Bytes reverse_bits(const Bytes& input)
+class AesLanierDecoder : public Decoder
 {
-    Bytes output;
-    ByteWriter bw(output);
+public:
+	AesLanierDecoder(const DecoderProto& config):
+		Decoder(config)
+	{}
 
-    for (uint8_t b : input)
-        bw.write_8(reverse_bits(b));
-    return output;
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(SECTOR_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		/* Skip ID mark (we know it's a AESLANIER_RECORD_SEPARATOR). */
+
+		readRawBits(16);
+
+		const auto& rawbits = readRawBits(AESLANIER_RECORD_SIZE*16);
+		const auto& bytes = decodeFmMfm(rawbits).slice(0, AESLANIER_RECORD_SIZE);
+		const auto& reversed = bytes.reverseBits();
+
+		_sector->logicalTrack = reversed[1];
+		_sector->logicalSide = 0;
+		_sector->logicalSector = reversed[2];
+
+		/* Check header 'checksum' (which seems far too simple to mean much). */
+
+		{
+			uint8_t wanted = reversed[3];
+			uint8_t got = reversed[1] + reversed[2];
+			if (wanted != got)
+				return;
+		}
+
+		/* Check data checksum, which also includes the header and is
+			* significantly better. */
+
+		_sector->data = reversed.slice(1, AESLANIER_SECTOR_LENGTH);
+		uint16_t wanted = reversed.reader().seek(0x101).read_le16();
+		uint16_t got = crc16ref(MODBUS_POLY_REF, _sector->data);
+		_sector->status = (wanted == got) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+};
+
+std::unique_ptr<Decoder> createAesLanierDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new AesLanierDecoder(config));
 }
 
-AbstractDecoder::RecordType AesLanierDecoder::advanceToNextRecord()
-{
-    _sector->clock = _fmr->seekToPattern(SECTOR_PATTERN);
-    if (_fmr->eof() || !_sector->clock)
-        return UNKNOWN_RECORD;
-    return SECTOR_RECORD;
-}
 
-void AesLanierDecoder::decodeSectorRecord()
-{
-    /* Skip ID mark. */
-
-    readRawBits(16);
-
-    const auto& rawbits = readRawBits(AESLANIER_RECORD_SIZE*16);
-    const auto& bytes = decodeFmMfm(rawbits).slice(0, AESLANIER_RECORD_SIZE);
-    const auto& reversed = reverse_bits(bytes);
-
-    _sector->logicalTrack = reversed[1];
-    _sector->logicalSide = 0;
-    _sector->logicalSector = reversed[2];
-
-    /* Check header 'checksum' (which seems far too simple to mean much). */
-
-    {
-        uint8_t wanted = reversed[3];
-        uint8_t got = reversed[1] + reversed[2];
-        if (wanted != got)
-            return;
-    }
-
-    /* Check data checksum, which also includes the header and is
-        * significantly better. */
-
-    _sector->data = reversed.slice(1, AESLANIER_SECTOR_LENGTH);
-    uint16_t wanted = reversed.reader().seek(0x101).read_le16();
-    uint16_t got = crc16ref(MODBUS_POLY_REF, _sector->data);
-    _sector->status = (wanted == got) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/agat/agat.cc

@@ -0,0 +1,22 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "agat.h"
+#include "bytes.h"
+#include "fmt/format.h"
+
+uint8_t agatChecksum(const Bytes& bytes)
+{
+    uint16_t checksum = 0;
+
+	for (uint8_t b : bytes)
+	{
+		if (checksum > 0xff)
+			checksum = (checksum + 1) & 0xff;
+
+		checksum += b;
+	}
+
+	return checksum & 0xff;
+}
+
+

arch/agat/agat.h

@@ -0,0 +1,11 @@
+#ifndef AGAT_H
+#define AGAT_H
+
+#define AGAT_SECTOR_SIZE 256
+
+extern std::unique_ptr<Decoder> createAgatDecoder(const DecoderProto& config);
+
+extern uint8_t agatChecksum(const Bytes& bytes);
+
+#endif
+

arch/agat/agat.proto

@@ -0,0 +1,5 @@
+syntax = "proto2";
+
+message AgatDecoderProto {}
+
+

arch/agat/decoder.cc

@@ -0,0 +1,97 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "agat.h"
+#include "crc.h"
+#include "fluxmap.h"
+#include "decoders/fluxmapreader.h"
+#include "sector.h"
+#include "bytes.h"
+#include "fmt/format.h"
+#include <string.h>
+
+/*
+ * data:    X  X  X  X   X  X  X  X   X  -  -  X   -  X  -  X   -  X  X  -   X  -  X  -  = 0xff956a
+ * flux:   01 01 01 01  01 01 01 01  01 00 10 01  00 01 00 01  00 01 01 00  01 00 01 00  = 0x555549111444
+ * 
+ * data:    X  X  X  X   X  X  X  X   -  X  X  -   X  -  X  -   X  -  -  X   -  X  -  X  = 0xff6a95
+ * flux:   01 01 01 01  01 01 01 01  00 01 01 00  01 00 01 00  01 00 10 01  00 01 00 01  = 0x555514444911
+ * 
+ * Each pattern is prefixed with this one:
+ *
+ * data:          -  -   -  X   -  -   X  - = 0x12
+ * flux:    (10) 10 10  10 01  00 10  01 00 = 0xa924
+ * magic:   (10) 10 00  10 01  00 10  01 00 = 0x8924
+ *                  ^
+ *
+ * This seems to be generated by emitting A4 in MFM and then a single 0 bit to
+ * shift it out of phase, so the data bits become clock bits and vice versa.
+ *
+ *           X - X - - X - -  = 0xA4
+ *          0100010010010010  = MFM encoded
+ *           1000100100100100 = with trailing zero
+ *            - - - X - - X - = effective bitstream = 0x12
+ *
+ */
+
+static const uint64_t SECTOR_ID = 0x8924555549111444;
+static const FluxPattern SECTOR_PATTERN(64, SECTOR_ID);
+
+static const uint64_t DATA_ID = 0x8924555514444911;
+static const FluxPattern DATA_PATTERN(64, DATA_ID);
+
+static const FluxMatchers ALL_PATTERNS = {
+	&SECTOR_PATTERN,
+	&DATA_PATTERN
+};
+
+class AgatDecoder : public Decoder
+{
+public:
+	AgatDecoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(ALL_PATTERNS);
+	}
+
+    void decodeSectorRecord() override
+	{
+		if (readRaw64() != SECTOR_ID)
+			return;
+
+		auto bytes = decodeFmMfm(readRawBits(64)).slice(0, 4);
+		if (bytes[3] != 0x5a)
+			return;
+
+		_sector->logicalTrack = bytes[1] >> 1;
+		_sector->logicalSector = bytes[2];
+		_sector->logicalSide = bytes[1] & 1;
+		_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+	}
+
+	void decodeDataRecord() override
+	{
+		if (readRaw64() != DATA_ID)
+			return;
+
+		Bytes bytes = decodeFmMfm(readRawBits((AGAT_SECTOR_SIZE+2)*16)).slice(0, AGAT_SECTOR_SIZE+2);
+
+		if (bytes[AGAT_SECTOR_SIZE+1] != 0x5a)
+			return;
+
+		_sector->data = bytes.slice(0, AGAT_SECTOR_SIZE);
+		uint8_t wantChecksum = bytes[AGAT_SECTOR_SIZE];
+		uint8_t gotChecksum = agatChecksum(_sector->data);
+		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+};
+
+std::unique_ptr<Decoder> createAgatDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new AgatDecoder(config));
+}
+
+
+

arch/amiga/amiga.cc

@@ -0,0 +1,100 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "amiga.h"
+#include "bytes.h"
+#include "fmt/format.h"
+
+uint32_t amigaChecksum(const Bytes& bytes)
+{
+    ByteReader br(bytes);
+    uint32_t checksum = 0;
+
+    assert((bytes.size() & 3) == 0);
+    while (!br.eof())
+        checksum ^= br.read_be32();
+
+    return checksum & 0x55555555;
+}
+
+static uint8_t everyother(uint16_t x)
+{
+	                  /* aabb ccdd eeff gghh */
+	x &= 0x6666;      /* 0ab0 0cd0 0ef0 0gh0 */
+	x >>= 1;          /* 00ab 00cd 00ef 00gh */
+	x |= x << 2;      /* abab cdcd efef ghgh */
+	x &= 0x3c3c;      /* 00ab cd00 00ef gh00 */
+	x >>= 2;          /* 0000 abcd 0000 efgh */
+	x |= x >> 4;      /* 0000 abcd abcd efgh */
+	return x;
+}
+
+Bytes amigaInterleave(const Bytes& input)
+{
+	Bytes output;
+	ByteWriter bw(output);
+
+	/* Write all odd bits. (Numbering starts at 0...) */
+
+	{
+		ByteReader br(input);
+		while (!br.eof())
+		{
+			uint16_t x = br.read_be16();
+			x &= 0xaaaa;       /* a0b0 c0d0 e0f0 g0h0 */
+			x |= x >> 1;       /* aabb ccdd eeff gghh */
+			x = everyother(x); /* 0000 0000 abcd efgh */
+			bw.write_8(x);
+		}
+	}
+
+	/* Write all even bits. */
+
+	{
+		ByteReader br(input);
+		while (!br.eof())
+		{
+			uint16_t x = br.read_be16();
+			x &= 0x5555;       /* 0a0b 0c0d 0e0f 0g0h */
+			x |= x << 1;       /* aabb ccdd eeff gghh */
+			x = everyother(x); /* 0000 0000 abcd efgh */
+			bw.write_8(x);
+		}
+	}
+
+	return output;
+}
+
+Bytes amigaDeinterleave(const uint8_t*& input, size_t len)
+{
+    assert(!(len & 1));
+    const uint8_t* odds = &input[0];
+    const uint8_t* evens = &input[len/2];
+    Bytes output;
+    ByteWriter bw(output);
+
+    for (size_t i=0; i<len/2; i++)
+    {
+        uint8_t o = *odds++;
+        uint8_t e = *evens++;
+
+        /* This is the 'Interleave bits with 64-bit multiply' technique from
+         * http://graphics.stanford.edu/~seander/bithacks.html#InterleaveBMN
+         */
+        uint16_t result =
+            (((e * 0x0101010101010101ULL & 0x8040201008040201ULL)
+                * 0x0102040810204081ULL >> 49) & 0x5555) |
+            (((o * 0x0101010101010101ULL & 0x8040201008040201ULL)
+                * 0x0102040810204081ULL >> 48) & 0xAAAA);
+        
+        bw.write_be16(result);
+    }
+
+    input += len;
+    return output;
+}
+
+Bytes amigaDeinterleave(const Bytes& input)
+{
+	const uint8_t* ptr = input.cbegin();
+	return amigaDeinterleave(ptr, input.size());
+}

arch/amiga/amiga.h

@@ -1,20 +1,20 @@
 #ifndef AMIGA_H
 #define AMIGA_H
 
+#include "encoders/encoders.h"
+
 #define AMIGA_SECTOR_RECORD 0xaaaa44894489LL
 
-#define AMIGA_RECORD_SIZE 0x21f
+#define AMIGA_TRACKS_PER_DISK 80
+#define AMIGA_SECTORS_PER_TRACK 11
+#define AMIGA_RECORD_SIZE 0x21c
 
-class Sector;
-class Fluxmap;
+extern std::unique_ptr<Decoder> createAmigaDecoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createAmigaEncoder(const EncoderProto& config);
 
-class AmigaDecoder : public AbstractDecoder
-{
-public:
-    virtual ~AmigaDecoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-};
+extern uint32_t amigaChecksum(const Bytes& bytes);
+extern Bytes amigaInterleave(const Bytes& input);
+extern Bytes amigaDeinterleave(const uint8_t*& input, size_t len);
+extern Bytes amigaDeinterleave(const Bytes& input);
 
 #endif

arch/amiga/amiga.proto

@@ -0,0 +1,13 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message AmigaDecoderProto {}
+
+message AmigaEncoderProto {
+	optional double clock_rate_us = 1
+		[default=2.00, (help)="Encoded data clock rate."];
+	optional double post_index_gap_ms = 2
+		[default=0.5, (help)="Post-index gap before first sector header."];
+}
+

arch/amiga/decoder.cc

@@ -2,12 +2,12 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "amiga.h"
 #include "bytes.h"
 #include "fmt/format.h"
+#include "lib/decoders/decoders.pb.h"
 #include <string.h>
 #include <algorithm>
 
@@ -21,79 +21,60 @@
          
 static const FluxPattern SECTOR_PATTERN(48, AMIGA_SECTOR_RECORD);
 
-static Bytes deinterleave(const uint8_t*& input, size_t len)
+class AmigaDecoder : public Decoder
 {
-    assert(!(len & 1));
-    const uint8_t* odds = &input[0];
-    const uint8_t* evens = &input[len/2];
-    Bytes output;
-    ByteWriter bw(output);
+public:
+	AmigaDecoder(const DecoderProto& config):
+		Decoder(config),
+		_config(config.amiga())
+	{}
 
-    for (size_t i=0; i<len/2; i++)
-    {
-        uint8_t o = *odds++;
-        uint8_t e = *evens++;
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(SECTOR_PATTERN);
+	}
 
-        /* This is the 'Interleave bits with 64-bit multiply' technique from
-         * http://graphics.stanford.edu/~seander/bithacks.html#InterleaveBMN
-         */
-        uint16_t result =
-            (((e * 0x0101010101010101ULL & 0x8040201008040201ULL)
-                * 0x0102040810204081ULL >> 49) & 0x5555) |
-            (((o * 0x0101010101010101ULL & 0x8040201008040201ULL)
-                * 0x0102040810204081ULL >> 48) & 0xAAAA);
-        
-        bw.write_be16(result);
-    }
+    void decodeSectorRecord() override
+	{
+		if (readRaw48() != AMIGA_SECTOR_RECORD)
+			return;
+			
+		const auto& rawbits = readRawBits(AMIGA_RECORD_SIZE*16);
+		if (rawbits.size() < (AMIGA_RECORD_SIZE*16))
+			return;
+		const auto& rawbytes = toBytes(rawbits).slice(0, AMIGA_RECORD_SIZE*2);
+		const auto& bytes = decodeFmMfm(rawbits).slice(0, AMIGA_RECORD_SIZE);
 
-    input += len;
-    return output;
+		const uint8_t* ptr = bytes.begin();
+
+		Bytes header = amigaDeinterleave(ptr, 4);
+		Bytes recoveryinfo = amigaDeinterleave(ptr, 16);
+
+		_sector->logicalTrack = header[1] >> 1;
+		_sector->logicalSide = header[1] & 1;
+		_sector->logicalSector = header[2];
+
+		uint32_t wantedheaderchecksum = amigaDeinterleave(ptr, 4).reader().read_be32();
+		uint32_t gotheaderchecksum = amigaChecksum(rawbytes.slice(0, 40));
+		if (gotheaderchecksum != wantedheaderchecksum)
+			return;
+
+		uint32_t wanteddatachecksum = amigaDeinterleave(ptr, 4).reader().read_be32();
+		uint32_t gotdatachecksum = amigaChecksum(rawbytes.slice(56, 1024));
+
+		Bytes data;
+		data.writer().append(amigaDeinterleave(ptr, 512)).append(recoveryinfo);
+		_sector->data = data;
+		_sector->status = (gotdatachecksum == wanteddatachecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+
+private:
+	const AmigaDecoderProto& _config;
+	nanoseconds_t _clock;
+};
+
+std::unique_ptr<Decoder> createAmigaDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new AmigaDecoder(config));
 }
 
-static uint32_t checksum(const Bytes& bytes)
-{
-    ByteReader br(bytes);
-    uint32_t checksum = 0;
-
-    assert((bytes.size() & 3) == 0);
-    while (!br.eof())
-        checksum ^= br.read_be32();
-
-    return checksum & 0x55555555;
-}
-
-AbstractDecoder::RecordType AmigaDecoder::advanceToNextRecord()
-{
-    _sector->clock = _fmr->seekToPattern(SECTOR_PATTERN);
-    if (_fmr->eof() || !_sector->clock)
-        return UNKNOWN_RECORD;
-    return SECTOR_RECORD;
-}
-
-void AmigaDecoder::decodeSectorRecord()
-{
-    const auto& rawbits = readRawBits(AMIGA_RECORD_SIZE*16);
-    const auto& rawbytes = toBytes(rawbits).slice(0, AMIGA_RECORD_SIZE*2);
-    const auto& bytes = decodeFmMfm(rawbits).slice(0, AMIGA_RECORD_SIZE);
-
-    const uint8_t* ptr = bytes.begin() + 3;
-
-    Bytes header = deinterleave(ptr, 4);
-    Bytes recoveryinfo = deinterleave(ptr, 16);
-
-    _sector->logicalTrack = header[1] >> 1;
-    _sector->logicalSide = header[1] & 1;
-    _sector->logicalSector = header[2];
-
-    uint32_t wantedheaderchecksum = deinterleave(ptr, 4).reader().read_be32();
-    uint32_t gotheaderchecksum = checksum(rawbytes.slice(6, 40));
-    if (gotheaderchecksum != wantedheaderchecksum)
-        return;
-
-    uint32_t wanteddatachecksum = deinterleave(ptr, 4).reader().read_be32();
-    uint32_t gotdatachecksum = checksum(rawbytes.slice(62, 1024));
-
-    _sector->data.clear();
-    _sector->data.writer().append(deinterleave(ptr, 512)).append(recoveryinfo);
-    _sector->status = (gotdatachecksum == wanteddatachecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/amiga/encoder.cc

@@ -0,0 +1,149 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "amiga.h"
+#include "crc.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "arch/amiga/amiga.pb.h"
+#include "lib/encoders/encoders.pb.h"
+
+static bool lastBit;
+
+static int charToInt(char c)
+{
+    if (isdigit(c))
+        return c - '0';
+    return 10 + tolower(c) - 'a';
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+{
+    for (bool bit : src)
+    {
+        if (cursor < bits.size())
+            lastBit = bits[cursor++] = bit;
+    }
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+{
+    cursor += width;
+    lastBit = data & 1;
+    for (int i = 0; i < width; i++)
+    {
+        unsigned pos = cursor - i - 1;
+        if (pos < bits.size())
+            bits[pos] = data & 1;
+        data >>= 1;
+    }
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
+{
+    ByteReader br(bytes);
+    BitReader bitr(br);
+
+    while (!bitr.eof())
+    {
+        if (cursor < bits.size())
+            bits[cursor++] = bitr.get();
+    }
+}
+
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
+{
+    if ((sector->data.size() != 512) && (sector->data.size() != 528))
+        Error() << "unsupported sector size --- you must pick 512 or 528";
+
+    uint32_t checksum = 0;
+
+    auto write_interleaved_bytes = [&](const Bytes& bytes)
+    {
+        Bytes interleaved = amigaInterleave(bytes);
+        Bytes mfm = encodeMfm(interleaved, lastBit);
+        checksum ^= amigaChecksum(mfm);
+        checksum &= 0x55555555;
+        write_bits(bits, cursor, mfm);
+    };
+
+    auto write_interleaved_word = [&](uint32_t word)
+    {
+        Bytes b(4);
+        b.writer().write_be32(word);
+        write_interleaved_bytes(b);
+    };
+
+    write_bits(bits, cursor, 0xaaaa, 2 * 8);
+    write_bits(bits, cursor, AMIGA_SECTOR_RECORD, 6 * 8);
+
+    checksum = 0;
+    Bytes header = {0xff, /* Amiga 1.0 format byte */
+        (uint8_t)((sector->logicalTrack << 1) | sector->logicalSide),
+        (uint8_t)sector->logicalSector,
+        (uint8_t)(AMIGA_SECTORS_PER_TRACK - sector->logicalSector)};
+    write_interleaved_bytes(header);
+    Bytes recoveryInfo(16);
+    if (sector->data.size() == 528)
+        recoveryInfo = sector->data.slice(512, 16);
+    write_interleaved_bytes(recoveryInfo);
+    write_interleaved_word(checksum);
+
+    Bytes data = sector->data.slice(0, 512);
+    write_interleaved_word(
+        amigaChecksum(encodeMfm(amigaInterleave(data), lastBit)));
+    write_interleaved_bytes(data);
+}
+
+class AmigaEncoder : public Encoder
+{
+public:
+    AmigaEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.amiga())
+    {
+    }
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        /* Number of bits for one nominal revolution of a real 200ms Amiga disk. */
+        int bitsPerRevolution = 200e3 / _config.clock_rate_us();
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+        fillBitmapTo(bits,
+            cursor,
+            _config.post_index_gap_ms() * 1000 / _config.clock_rate_us(),
+            {true, false});
+        lastBit = false;
+
+        for (const auto& sector : sectors)
+            write_sector(bits, cursor, sector);
+
+        if (cursor >= bits.size())
+            Error() << "track data overrun";
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
+
+        auto fluxmap = std::make_unique<Fluxmap>();
+        fluxmap->appendBits(bits,
+            calculatePhysicalClockPeriod(
+                _config.clock_rate_us() * 1e3, 200e6));
+        return fluxmap;
+    }
+
+private:
+    const AmigaEncoderProto& _config;
+};
+
+std::unique_ptr<Encoder> createAmigaEncoder(const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new AmigaEncoder(config));
+}

arch/apple2/apple2.h

@@ -1,25 +1,20 @@
 #ifndef APPLE2_H
 #define APPLE2_H
 
+#include <memory.h>
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+
 #define APPLE2_SECTOR_RECORD   0xd5aa96
 #define APPLE2_DATA_RECORD     0xd5aaad
 
 #define APPLE2_SECTOR_LENGTH   256
 #define APPLE2_ENCODED_SECTOR_LENGTH 342
 
-class Sector;
-class Fluxmap;
-
-class Apple2Decoder : public AbstractDecoder
-{
-public:
-    virtual ~Apple2Decoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-    void decodeDataRecord();
-};
+#define APPLE2_SECTORS         16
 
+extern std::unique_ptr<Decoder> createApple2Decoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createApple2Encoder(const EncoderProto& config);
 
 #endif
 

arch/apple2/apple2.proto

@@ -0,0 +1,16 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message Apple2DecoderProto {}
+
+message Apple2EncoderProto
+{
+    /* 245kHz. */
+    optional double clock_period_us = 1
+        [ default = 4, (help) = "clock rate on the real device" ];
+    
+    /* Apple II disk drives spin at 300rpm. */
+    optional double rotational_period_ms = 2
+        [ default = 200.0, (help) = "rotational period on the real device" ];
+}

arch/apple2/decoder.cc

@@ -2,7 +2,6 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "apple2.h"
@@ -25,7 +24,7 @@ static int decode_data_gcr(uint8_t gcr)
 		#undef GCR_ENTRY
     }
     return -1;
-};
+}
 
 /* This is extremely inspired by the MESS implementation, written by Nathan Woods
  * and R. Belmont: https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp
@@ -60,53 +59,96 @@ static Bytes decode_crazy_data(const uint8_t* inp, Sector::Status& status)
     return output;
 }
 
-uint8_t combine(uint16_t word)
+static uint8_t combine(uint16_t word)
 {
     return word & (word >> 7);
 }
 
-AbstractDecoder::RecordType Apple2Decoder::advanceToNextRecord()
+class Apple2Decoder : public Decoder
 {
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
-	if (matcher == &SECTOR_RECORD_PATTERN)
-		return RecordType::SECTOR_RECORD;
-	if (matcher == &DATA_RECORD_PATTERN)
-		return RecordType::DATA_RECORD;
-	return RecordType::UNKNOWN_RECORD;
+public:
+	Apple2Decoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(ANY_RECORD_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		if (readRaw24() != APPLE2_SECTOR_RECORD)
+			return;
+
+		/* Read header. */
+
+		auto header = toBytes(readRawBits(8*8)).slice(0, 8);
+		ByteReader br(header);
+
+		uint8_t volume = combine(br.read_be16());
+		_sector->logicalTrack = combine(br.read_be16());
+		_sector->logicalSector = combine(br.read_be16());
+		uint8_t checksum = combine(br.read_be16());
+
+		// If the checksum is correct, upgrade the sector from MISSING
+		// to DATA_MISSING in anticipation of its data record
+		if (checksum == (volume ^ _sector->logicalTrack ^ _sector->logicalSector))
+			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+	}
+
+    void decodeDataRecord() override
+	{
+		/* Check ID. */
+
+		if (readRaw24() != APPLE2_DATA_RECORD)
+			return;
+
+		// Sometimes there's a 1-bit gap between APPLE2_DATA_RECORD and
+		// the data itself.  This has been seen on real world disks
+		// such as the Apple II Operating System Kit from Apple2Online.
+		// However, I haven't seen it described in any of the various
+		// references.
+		//
+		// This extra '0' bit would not affect the real disk interface,
+		// as it was a '1' reaching the top bit of a shift register
+		// that triggered a byte to be available, but it affects the
+		// way the data is read here.
+		//
+		// While the floppies tested only seemed to need this applied
+		// to the first byte of the data record, applying it
+		// consistently to all of them doesn't seem to hurt, and
+		// simplifies the code.
+
+		/* Read and decode data. */
+
+		auto readApple8 = [&]() {
+		    auto result = 0;
+		    while((result & 0x80) == 0) {
+			auto b = readRawBits(1);
+                        if(b.empty()) break;
+			result = (result << 1) | b[0];
+		    }
+		    return result;
+		};
+
+		constexpr unsigned recordLength = APPLE2_ENCODED_SECTOR_LENGTH+2;
+                uint8_t bytes[recordLength];
+                for(auto &byte : bytes) {
+                    byte = readApple8();
+                }
+
+		// Upgrade the sector from MISSING to BAD_CHECKSUM.
+		// If decode_crazy_data succeeds, it upgrades the sector to
+		// OK.
+		_sector->status = Sector::BAD_CHECKSUM;
+		_sector->data = decode_crazy_data(&bytes[0], _sector->status);
+	}
+};
+
+std::unique_ptr<Decoder> createApple2Decoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new Apple2Decoder(config));
 }
 
-void Apple2Decoder::decodeSectorRecord()
-{
-    /* Skip ID (as we know it's a APPLE2_SECTOR_RECORD). */
-    readRawBits(24);
 
-    /* Read header. */
-
-    auto header = toBytes(readRawBits(8*8)).slice(0, 8);
-    ByteReader br(header);
-
-    uint8_t volume = combine(br.read_be16());
-    _sector->logicalTrack = combine(br.read_be16());
-    _sector->logicalSector = combine(br.read_be16());
-    uint8_t checksum = combine(br.read_be16());
-    if (checksum == (volume ^ _sector->logicalTrack ^ _sector->logicalSector))
-        _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
-}
-
-void Apple2Decoder::decodeDataRecord()
-{
-    /* Check ID. */
-
-    Bytes bytes = toBytes(readRawBits(3*8)).slice(0, 3);
-    if (bytes.reader().read_be24() != APPLE2_DATA_RECORD)
-        return;
-
-    /* Read and decode data. */
-
-    unsigned recordLength = APPLE2_ENCODED_SECTOR_LENGTH + 2;
-    bytes = toBytes(readRawBits(recordLength*8)).slice(0, recordLength);
-
-    _sector->status = Sector::BAD_CHECKSUM;
-    _sector->data = decode_crazy_data(&bytes[0], _sector->status);
-}

arch/apple2/encoder.cc

@@ -0,0 +1,191 @@
+#include "globals.h"
+#include "arch/apple2/apple2.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "sector.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "fmt/format.h"
+#include "lib/encoders/encoders.pb.h"
+#include <ctype.h>
+#include "bytes.h"
+
+static int encode_data_gcr(uint8_t data)
+{
+    switch (data)
+    {
+#define GCR_ENTRY(gcr, data) \
+    case data:               \
+        return gcr;
+#include "data_gcr.h"
+#undef GCR_ENTRY
+    }
+    return -1;
+}
+
+class Apple2Encoder : public Encoder
+{
+public:
+    Apple2Encoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.apple2())
+    {
+    }
+
+private:
+    const Apple2EncoderProto& _config;
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        int bitsPerRevolution =
+            (_config.rotational_period_ms() * 1e3) / _config.clock_period_us();
+
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+        for (const auto& sector : sectors)
+            writeSector(bits, cursor, *sector);
+
+        if (cursor >= bits.size())
+            Error() << fmt::format(
+                "track data overrun by {} bits", cursor - bits.size());
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(bits,
+            calculatePhysicalClockPeriod(
+                _config.clock_period_us() * 1e3,
+                _config.rotational_period_ms() * 1e6));
+        return fluxmap;
+    }
+
+private:
+    uint8_t volume_id = 254;
+
+    /* This is extremely inspired by the MESS implementation, written by Nathan
+     * Woods and R. Belmont:
+     * https://github.com/mamedev/mame/blob/7914a6083a3b3a8c243ae6c3b8cb50b023f21e0e/src/lib/formats/ap2_dsk.cpp
+     * as well as Understanding the Apple II (1983) Chapter 9
+     * https://archive.org/details/Understanding_the_Apple_II_1983_Quality_Software/page/n230/mode/1up?view=theater
+     */
+
+    void writeSector(
+        std::vector<bool>& bits, unsigned& cursor, const Sector& sector) const
+    {
+        if ((sector.status == Sector::OK) or
+            (sector.status == Sector::BAD_CHECKSUM))
+        {
+            auto write_bit = [&](bool val)
+            {
+                if (cursor <= bits.size())
+                {
+                    bits[cursor] = val;
+                }
+                cursor++;
+            };
+
+            auto write_bits = [&](uint32_t bits, int width)
+            {
+                for (int i = width; i--;)
+                {
+                    write_bit(bits & (1u << i));
+                }
+            };
+
+            auto write_gcr44 = [&](uint8_t value)
+            {
+                write_bits((value << 7) | value | 0xaaaa, 16);
+            };
+
+            auto write_gcr6 = [&](uint8_t value)
+            {
+                write_bits(encode_data_gcr(value), 8);
+            };
+
+            // The special "FF40" sequence is used to synchronize the receiving
+            // shift register. It's written as "1111 1111 00"; FF indicates the
+            // 8 consecutive 1-bits, while "40" indicates the total number of
+            // microseconds.
+            auto write_ff40 = [&](int n = 1)
+            {
+                for (; n--;)
+                {
+                    write_bits(0xff << 2, 10);
+                }
+            };
+
+            // There is data to encode to disk.
+            if ((sector.data.size() != APPLE2_SECTOR_LENGTH))
+                Error() << fmt::format(
+                    "unsupported sector size {} --- you must pick 256",
+                    sector.data.size());
+
+            // Write address syncing leader : A sequence of "FF40"s; 5 of them
+            // are said to suffice to synchronize the decoder.
+            // "FF40" indicates that the actual data written is "1111
+            // 1111 00" i.e., 8 1s and a total of 40 microseconds
+            //
+            // In standard formatting, the first logical sector apparently gets
+            // extra padding.
+            write_ff40(sector.logicalSector == 0 ? 32 : 8);
+
+            // Write address field: APPLE2_SECTOR_RECORD + sector identifier +
+            // DE AA EB
+            write_bits(APPLE2_SECTOR_RECORD, 24);
+            write_gcr44(volume_id);
+            write_gcr44(sector.logicalTrack);
+            write_gcr44(sector.logicalSector);
+            write_gcr44(volume_id ^ sector.logicalTrack ^ sector.logicalSector);
+            write_bits(0xDEAAEB, 24);
+
+            // Write data syncing leader: FF40 + APPLE2_DATA_RECORD + sector
+            // data + sum + DE AA EB (+ mystery bits cut off of the scan?)
+            write_ff40(8);
+            write_bits(APPLE2_DATA_RECORD, 24);
+
+            // Convert the sector data to GCR, append the checksum, and write it
+            // out
+            constexpr auto TWOBIT_COUNT =
+                0x56; // Size of the 'twobit' area at the start of the GCR data
+            uint8_t checksum = 0;
+            for (int i = 0; i < APPLE2_ENCODED_SECTOR_LENGTH; i++)
+            {
+                int value;
+                if (i >= TWOBIT_COUNT)
+                {
+                    value = sector.data[i - TWOBIT_COUNT] >> 2;
+                }
+                else
+                {
+                    uint8_t tmp = sector.data[i];
+                    value = ((tmp & 1) << 1) | ((tmp & 2) >> 1);
+
+                    tmp = sector.data[i + TWOBIT_COUNT];
+                    value |= ((tmp & 1) << 3) | ((tmp & 2) << 1);
+
+                    if (i + 2 * TWOBIT_COUNT < APPLE2_SECTOR_LENGTH)
+                    {
+                        tmp = sector.data[i + 2 * TWOBIT_COUNT];
+                        value |= ((tmp & 1) << 5) | ((tmp & 2) << 3);
+                    }
+                }
+                checksum ^= value;
+                // assert(checksum & ~0x3f == 0);
+                write_gcr6(checksum);
+                checksum = value;
+            }
+            if (sector.status == Sector::BAD_CHECKSUM)
+                checksum ^= 0x3f;
+            write_gcr6(checksum);
+            write_bits(0xDEAAEB, 24);
+        }
+    }
+};
+
+std::unique_ptr<Encoder> createApple2Encoder(const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new Apple2Encoder(config));
+}

arch/brother/brother.h

@@ -9,31 +9,11 @@
 #define BROTHER_DATA_RECORD_CHECKSUM     3
 #define BROTHER_DATA_RECORD_ENCODED_SIZE 415
 
-#define BROTHER_TRACKS_PER_DISK          78
+#define BROTHER_TRACKS_PER_240KB_DISK    78
+#define BROTHER_TRACKS_PER_120KB_DISK    39
 #define BROTHER_SECTORS_PER_TRACK        12
 
-class Sector;
-class Fluxmap;
-
-class BrotherDecoder : public AbstractDecoder
-{
-public:
-    virtual ~BrotherDecoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-    void decodeDataRecord();
-};
-
-class BrotherEncoder : public AbstractEncoder
-{
-public:
-	virtual ~BrotherEncoder() {}
-
-public:
-    std::unique_ptr<Fluxmap> encode(int physicalTrack, int physicalSide, const SectorSet& allSectors);
-};
-
-extern FlagGroup brotherEncoderFlags;
+extern std::unique_ptr<Decoder> createBrotherDecoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createBrotherEncoder(const EncoderProto& config);
 
 #endif

arch/brother/brother.proto

@@ -0,0 +1,18 @@
+syntax = "proto2";
+
+message BrotherDecoderProto {}
+
+enum BrotherFormat {
+	BROTHER240 = 0;
+	BROTHER120 = 1;
+};
+
+message BrotherEncoderProto {
+	optional double clock_rate_us = 1 [default = 3.83];
+	optional double post_index_gap_ms = 2 [default = 1.0];
+	optional double sector_spacing_ms = 3 [default = 16.2];
+	optional double post_header_spacing_ms = 4 [default = 0.69];
+
+	optional BrotherFormat format = 6 [default = BROTHER240];
+}
+

arch/brother/brotherdecode.h

@@ -1,28 +0,0 @@
-#ifndef BROTHER_H
-#define BROTHER_H
-
-/* Brother word processor format (or at least, one of them) */
-
-#define BROTHER_SECTOR_RECORD 0xFFFFFD57
-#define BROTHER_DATA_RECORD   0xFFFFFDDB
-#define BROTHER_DATA_RECORD_PAYLOAD  256
-#define BROTHER_DATA_RECORD_CHECKSUM 3
-
-class Sector;
-class Fluxmap;
-
-class BrotherDecoder : public AbstractDecoder
-{
-public:
-    virtual ~BrotherDecoder() {}
-
-    SectorVector decodeToSectors(const RawRecordVector& rawRecords);
-    int recordMatcher(uint64_t fifo) const;
-};
-
-extern void writeBrotherSectorHeader(std::vector<bool>& bits, unsigned& cursor,
-		int track, int sector);
-extern void writeBrotherSectorData(std::vector<bool>& bits, unsigned& cursor,
-		const std::vector<uint8_t>& data);
-
-#endif

arch/brother/decoder.cc

@@ -1,10 +1,8 @@
 #include "globals.h"
-#include "sql.h"
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "decoders/decoders.h"
 #include "encoders/encoders.h"
-#include "record.h"
 #include "brother.h"
 #include "sector.h"
 #include "bytes.h"
@@ -40,7 +38,7 @@ static int decode_data_gcr(uint8_t gcr)
 		#undef GCR_ENTRY
     }
     return -1;
-};
+}
 
 static int decode_header_gcr(uint16_t word)
 {
@@ -52,58 +50,70 @@ static int decode_header_gcr(uint16_t word)
 		#undef GCR_ENTRY
 	}                       
 	return -1;             
+}
+
+class BrotherDecoder : public Decoder
+{
+public:
+    BrotherDecoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(ANY_RECORD_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		if (readRaw32() != BROTHER_SECTOR_RECORD)
+			return;
+
+		const auto& rawbits = readRawBits(32);
+		const auto& bytes = toBytes(rawbits).slice(0, 4);
+
+		ByteReader br(bytes);
+		_sector->logicalTrack = decode_header_gcr(br.read_be16());
+		_sector->logicalSector = decode_header_gcr(br.read_be16());
+
+		/* Sanity check the values read; there's no header checksum and
+			* occasionally we get garbage due to bit errors. */
+		if (_sector->logicalSector > 11)
+			return;
+		if (_sector->logicalTrack > 79)
+			return;
+
+		_sector->status = Sector::DATA_MISSING;
+	}
+	
+    void decodeDataRecord() override
+	{
+		if (readRaw32() != BROTHER_DATA_RECORD)
+			return;
+
+		const auto& rawbits = readRawBits(BROTHER_DATA_RECORD_ENCODED_SIZE*8);
+		const auto& rawbytes = toBytes(rawbits).slice(0, BROTHER_DATA_RECORD_ENCODED_SIZE);
+
+		Bytes bytes;
+		ByteWriter bw(bytes);
+		BitWriter bitw(bw);
+		for (uint8_t b : rawbytes)
+		{
+			uint32_t nibble = decode_data_gcr(b);
+			bitw.push(nibble, 5);
+		}
+		bitw.flush();
+
+		_sector->data = bytes.slice(0, BROTHER_DATA_RECORD_PAYLOAD);
+		uint32_t realCrc = crcbrother(_sector->data);
+		uint32_t wantCrc = bytes.reader().seek(BROTHER_DATA_RECORD_PAYLOAD).read_be24();
+		_sector->status = (realCrc == wantCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
 };
 
-AbstractDecoder::RecordType BrotherDecoder::advanceToNextRecord()
+std::unique_ptr<Decoder> createBrotherDecoder(const DecoderProto& config)
 {
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
-	if (matcher == &SECTOR_RECORD_PATTERN)
-		return RecordType::SECTOR_RECORD;
-	if (matcher == &DATA_RECORD_PATTERN)
-		return RecordType::DATA_RECORD;
-	return RecordType::UNKNOWN_RECORD;
+	return std::unique_ptr<Decoder>(new BrotherDecoder(config));
 }
 
-void BrotherDecoder::decodeSectorRecord()
-{
-	readRawBits(32);
-	const auto& rawbits = readRawBits(32);
-	const auto& bytes = toBytes(rawbits).slice(0, 4);
 
-	ByteReader br(bytes);
-	_sector->logicalTrack = decode_header_gcr(br.read_be16());
-	_sector->logicalSector = decode_header_gcr(br.read_be16());
-
-	/* Sanity check the values read; there's no header checksum and
-		* occasionally we get garbage due to bit errors. */
-	if (_sector->logicalSector > 11)
-		return;
-	if (_sector->logicalTrack > 79)
-		return;
-
-	_sector->status = Sector::DATA_MISSING;
-}
-
-void BrotherDecoder::decodeDataRecord()
-{
-	readRawBits(32);
-
-	const auto& rawbits = readRawBits(BROTHER_DATA_RECORD_ENCODED_SIZE*8);
-	const auto& rawbytes = toBytes(rawbits).slice(0, BROTHER_DATA_RECORD_ENCODED_SIZE);
-
-	Bytes bytes;
-	ByteWriter bw(bytes);
-	BitWriter bitw(bw);
-	for (uint8_t b : rawbytes)
-	{
-		uint32_t nibble = decode_data_gcr(b);
-		bitw.push(nibble, 5);
-	}
-	bitw.flush();
-
-	_sector->data = bytes.slice(0, BROTHER_DATA_RECORD_PAYLOAD);
-	uint32_t realCrc = crcbrother(_sector->data);
-	uint32_t wantCrc = bytes.reader().seek(BROTHER_DATA_RECORD_PAYLOAD).read_be24();
-	_sector->status = (realCrc == wantCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/brother/encoder.cc

@@ -1,167 +1,154 @@
 #include "globals.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "encoders/encoders.h"
 #include "brother.h"
 #include "crc.h"
-#include "sectorset.h"
-#include "writer.h"
-
-FlagGroup brotherEncoderFlags;
-
-static DoubleFlag clockRateUs(
-	{ "--clock-rate" },
-	"Encoded data clock rate (microseconds).",
-	3.83);
-
-static DoubleFlag postIndexGapMs(
-	{ "--post-index-gap" },
-	"Post-index gap before first sector header (milliseconds).",
-	1.0);
-
-static DoubleFlag sectorSpacingMs(
-	{ "--sector-spacing" },
-	"Time between successive sector headers (milliseconds).",
-	16.2);
-
-static DoubleFlag postHeaderSpacingMs(
-	{ "--post-header-spacing" },
-	"Time between a sector's header and data records (milliseconds).",
-	0.69);
-
-static StringFlag sectorSkew(
-	{ "--sector-skew" },
-	"Order in which to write sectors.",
-	"05a3816b4927");
+#include "readerwriter.h"
+#include "image.h"
+#include "arch/brother/brother.pb.h"
+#include "lib/encoders/encoders.pb.h"
 
 static int encode_header_gcr(uint16_t word)
 {
-	switch (word)
-	{
-		#define GCR_ENTRY(gcr, data) \
-			case data: return gcr;
-		#include "header_gcr.h"
-		#undef GCR_ENTRY
-	}                       
-	return -1;             
-};
+    switch (word)
+    {
+#define GCR_ENTRY(gcr, data) \
+    case data:               \
+        return gcr;
+#include "header_gcr.h"
+#undef GCR_ENTRY
+    }
+    return -1;
+}
 
 static int encode_data_gcr(uint8_t data)
 {
-	switch (data)
-	{
-		#define GCR_ENTRY(gcr, data) \
-			case data: return gcr;
-		#include "data_gcr.h"
-		#undef GCR_ENTRY
-	}                       
-	return -1;             
-};
-
-static void write_bits(std::vector<bool>& bits, unsigned& cursor, uint32_t data, int width)
-{
-	cursor += width;
-	for (int i=0; i<width; i++)
-	{
-		unsigned pos = cursor - i - 1;
-		if (pos < bits.size())
-			bits[pos] = data & 1;
-		data >>= 1;
-	}
+    switch (data)
+    {
+#define GCR_ENTRY(gcr, data) \
+    case data:               \
+        return gcr;
+#include "data_gcr.h"
+#undef GCR_ENTRY
+    }
+    return -1;
 }
 
-static void write_sector_header(std::vector<bool>& bits, unsigned& cursor,
-		int track, int sector)
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint32_t data, int width)
 {
-	write_bits(bits, cursor, 0xffffffff, 31);
-	write_bits(bits, cursor, BROTHER_SECTOR_RECORD, 32);
-	write_bits(bits, cursor, encode_header_gcr(track), 16);
-	write_bits(bits, cursor, encode_header_gcr(sector), 16);
-	write_bits(bits, cursor, encode_header_gcr(0x2f), 16);
+    cursor += width;
+    for (int i = 0; i < width; i++)
+    {
+        unsigned pos = cursor - i - 1;
+        if (pos < bits.size())
+            bits[pos] = data & 1;
+        data >>= 1;
+    }
 }
 
-static void write_sector_data(std::vector<bool>& bits, unsigned& cursor, const Bytes& data)
+static void write_sector_header(
+    std::vector<bool>& bits, unsigned& cursor, int track, int sector)
 {
-	write_bits(bits, cursor, 0xffffffff, 32);
-	write_bits(bits, cursor, BROTHER_DATA_RECORD, 32);
+    write_bits(bits, cursor, 0xffffffff, 31);
+    write_bits(bits, cursor, BROTHER_SECTOR_RECORD, 32);
+    write_bits(bits, cursor, encode_header_gcr(track), 16);
+    write_bits(bits, cursor, encode_header_gcr(sector), 16);
+    write_bits(bits, cursor, encode_header_gcr(0x2f), 16);
+}
 
-	uint16_t fifo = 0;
-	int width = 0;
+static void write_sector_data(
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& data)
+{
+    write_bits(bits, cursor, 0xffffffff, 32);
+    write_bits(bits, cursor, BROTHER_DATA_RECORD, 32);
 
-	if (data.size() != BROTHER_DATA_RECORD_PAYLOAD)
-		Error() << "unsupported sector size";
+    uint16_t fifo = 0;
+    int width = 0;
 
-	auto write_byte = [&](uint8_t byte)
-	{
-		fifo |= (byte << (8 - width));
-		width += 8;
+    if (data.size() != BROTHER_DATA_RECORD_PAYLOAD)
+        Error() << "unsupported sector size";
 
-		while (width >= 5)
-		{
-			uint8_t quintet = fifo >> 11;
-			fifo <<= 5;
-			width -= 5;
+    auto write_byte = [&](uint8_t byte)
+    {
+        fifo |= (byte << (8 - width));
+        width += 8;
 
-			write_bits(bits, cursor, encode_data_gcr(quintet), 8);
-		}
-	};
+        while (width >= 5)
+        {
+            uint8_t quintet = fifo >> 11;
+            fifo <<= 5;
+            width -= 5;
 
-	for (uint8_t byte : data)
-		write_byte(byte);
+            write_bits(bits, cursor, encode_data_gcr(quintet), 8);
+        }
+    };
 
-	uint32_t realCrc = crcbrother(data);
-	write_byte(realCrc>>16);
-	write_byte(realCrc>>8);
-	write_byte(realCrc);
-	write_byte(0x58); /* magic */
+    for (uint8_t byte : data)
+        write_byte(byte);
+
+    uint32_t realCrc = crcbrother(data);
+    write_byte(realCrc >> 16);
+    write_byte(realCrc >> 8);
+    write_byte(realCrc);
+    write_byte(0x58); /* magic */
     write_byte(0xd4);
     while (width != 0)
         write_byte(0);
 }
 
-static int charToInt(char c)
+class BrotherEncoder : public Encoder
 {
-	if (isdigit(c))
-		return c - '0';
-	return 10 + tolower(c) - 'a';
-}
+public:
+    BrotherEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.brother())
+    {
+    }
 
-std::unique_ptr<Fluxmap> BrotherEncoder::encode(
-	int physicalTrack, int physicalSide, const SectorSet& allSectors)
+public:
+    std::unique_ptr<Fluxmap> encode(
+		std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        int bitsPerRevolution = 200000.0 / _config.clock_rate_us();
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+		int sectorCount = 0;
+		for (const auto& sectorData : sectors)
+        {
+            double headerMs = _config.post_index_gap_ms() +
+                              sectorCount * _config.sector_spacing_ms();
+            unsigned headerCursor = headerMs * 1e3 / _config.clock_rate_us();
+            double dataMs = headerMs + _config.post_header_spacing_ms();
+            unsigned dataCursor = dataMs * 1e3 / _config.clock_rate_us();
+
+            fillBitmapTo(bits, cursor, headerCursor, {true, false});
+            write_sector_header(
+                bits, cursor, sectorData->logicalTrack, sectorData->logicalSector);
+            fillBitmapTo(bits, cursor, dataCursor, {true, false});
+            write_sector_data(bits, cursor, sectorData->data);
+
+			sectorCount++;
+        }
+
+        if (cursor >= bits.size())
+            Error() << "track data overrun";
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(bits, _config.clock_rate_us() * 1e3);
+        return fluxmap;
+    }
+
+private:
+    const BrotherEncoderProto& _config;
+};
+
+std::unique_ptr<Encoder> createBrotherEncoder(
+    const EncoderProto& config)
 {
-	if ((physicalTrack < 0) || (physicalTrack >= BROTHER_TRACKS_PER_DISK)
-        || (physicalSide != 0))
-		return std::unique_ptr<Fluxmap>();
-
-	int bitsPerRevolution = 200000.0 / clockRateUs;
-	const std::string& skew = sectorSkew.get();
-	std::vector<bool> bits(bitsPerRevolution);
-	unsigned cursor = 0;
-
-	for (int sectorCount=0; sectorCount<BROTHER_SECTORS_PER_TRACK; sectorCount++)
-	{
-		int sectorId = charToInt(skew.at(sectorCount));
-		double headerMs = postIndexGapMs + sectorCount*sectorSpacingMs;
-		unsigned headerCursor = headerMs*1e3 / clockRateUs;
-		double dataMs = headerMs + postHeaderSpacingMs;
-		unsigned dataCursor = dataMs*1e3 / clockRateUs;
-
-		const auto& sectorData = allSectors.get(physicalTrack, 0, sectorId);
-
-		fillBitmapTo(bits, cursor, headerCursor, { true, false });
-		write_sector_header(bits, cursor, physicalTrack, sectorId);
-		fillBitmapTo(bits, cursor, dataCursor, { true, false });
-		write_sector_data(bits, cursor, sectorData->data);
-	}
-
-	if (cursor > bits.size())
-		Error() << "track data overrun";
-	fillBitmapTo(bits, cursor, bits.size(), { true, false });
-
-	// The pre-index gap is not normally reported.
-	// std::cerr << "pre-index gap " << 200.0 - (double)cursor*clockRateUs/1e3 << std::endl;
-	
-	std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
-	fluxmap->appendBits(bits, clockRateUs*1e3);
-	return fluxmap;
+    return std::unique_ptr<Encoder>(new BrotherEncoder(config));
 }

arch/build.mk

@@ -0,0 +1,42 @@
+LIBARCH_SRCS = \
+	arch/aeslanier/decoder.cc \
+	arch/agat/agat.cc \
+	arch/agat/decoder.cc \
+	arch/amiga/amiga.cc \
+	arch/amiga/decoder.cc \
+	arch/amiga/encoder.cc \
+	arch/apple2/decoder.cc \
+	arch/apple2/encoder.cc \
+	arch/brother/decoder.cc \
+	arch/brother/encoder.cc \
+	arch/c64/c64.cc \
+	arch/c64/decoder.cc \
+	arch/c64/encoder.cc \
+	arch/f85/decoder.cc \
+	arch/fb100/decoder.cc \
+	arch/ibm/decoder.cc \
+	arch/ibm/encoder.cc \
+	arch/macintosh/decoder.cc \
+	arch/macintosh/encoder.cc \
+	arch/micropolis/decoder.cc \
+	arch/micropolis/encoder.cc \
+	arch/mx/decoder.cc \
+	arch/northstar/decoder.cc \
+	arch/northstar/encoder.cc \
+	arch/smaky6/decoder.cc \
+	arch/tids990/decoder.cc \
+	arch/tids990/encoder.cc \
+	arch/victor9k/decoder.cc \
+	arch/victor9k/encoder.cc \
+	arch/zilogmcz/decoder.cc \
+
+LIBARCH_OBJS = $(patsubst %.cc, $(OBJDIR)/%.o, $(LIBARCH_SRCS))
+OBJS += $(LIBARCH_OBJS)
+$(LIBARCH_SRCS): | $(PROTO_HDRS)
+$(LIBARCH_SRCS): CFLAGS += $(PROTO_CFLAGS)
+LIBARCH_LIB = $(OBJDIR)/libarch.a
+$(LIBARCH_LIB): $(LIBARCH_OBJS)
+
+LIBARCH_LDFLAGS = $(LIBARCH_LIB)
+
+$(call use-pkgconfig, $(LIBARCH_LIB), $(LIBARCH_OBJS), fmt)

arch/c64/c64.cc

@@ -0,0 +1,28 @@
+#include "globals.h"
+#include "c64.h"
+
+/*
+    *   Track   Sectors/track   # Sectors   Storage in Bytes   Clock rate
+    *   -----   -------------   ---------   ----------------   ----------
+    *    1-17        21            357           7820             3.25
+    *   18-24        19            133           7170             3.5
+    *   25-30        18            108           6300             3.75
+    *   31-40(*)     17             85           6020             4
+    *                              ---
+    *                              683 (for a 35 track image)
+    * 
+    * The clock rate is normalised for a 200ms drive.
+    */
+
+nanoseconds_t clockPeriodForC64Track(unsigned track)
+{
+    constexpr double BYTE_SIZE = 8.0;
+
+    if (track < 17)
+        return 26.0 / BYTE_SIZE;
+    if (track < 24)
+        return 28.0 / BYTE_SIZE;
+    if (track < 30)
+        return 30.0 / BYTE_SIZE;
+    return 32.0 / BYTE_SIZE;
+}

arch/c64/c64.h

@@ -1,21 +1,35 @@
 #ifndef C64_H
 #define C64_H
 
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+
 #define C64_SECTOR_RECORD    0xffd49
 #define C64_DATA_RECORD      0xffd57
 #define C64_SECTOR_LENGTH    256
 
-class Sector;
-class Fluxmap;
+/* Source: http://www.unusedino.de/ec64/technical/formats/g64.html 
+   1. Header sync       FF FF FF FF FF (40 'on' bits, not GCR)
+   2. Header info       52 54 B5 29 4B 7A 5E 95 55 55 (10 GCR bytes)
+   3. Header gap        55 55 55 55 55 55 55 55 55 (9 bytes, never read)
+   4. Data sync         FF FF FF FF FF (40 'on' bits, not GCR)
+   5. Data block        55...4A (325 GCR bytes)
+   6. Inter-sector gap  55 55 55 55...55 55 (4 to 12 bytes, never read)
+   1. Header sync       (SYNC for the next sector)
+*/
+#define C64_HEADER_DATA_SYNC        0xFF
+#define C64_HEADER_BLOCK_ID         0x08
+#define C64_DATA_BLOCK_ID           0x07
+#define C64_HEADER_GAP              0x55
+#define C64_INTER_SECTOR_GAP        0x55
+#define C64_PADDING                 0x0F
 
-class Commodore64Decoder : public AbstractDecoder
-{
-public:
-    virtual ~Commodore64Decoder() {}
+#define C64_TRACKS_PER_DISK         40
+#define C64_BAM_TRACK               17
 
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-    void decodeDataRecord();
-};
+extern std::unique_ptr<Decoder> createCommodore64Decoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createCommodore64Encoder(const EncoderProto& config);
+
+extern nanoseconds_t clockPeriodForC64Track(unsigned track);
 
 #endif

arch/c64/c64.proto

@@ -0,0 +1,11 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message Commodore64DecoderProto {}
+
+message Commodore64EncoderProto {
+	optional double post_index_gap_us = 1 [default=0.0,
+		(help) = "post-index gap before first sector header."];
+}
+

arch/c64/decoder.cc

@@ -2,7 +2,6 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "c64.h"
@@ -14,19 +13,21 @@
 
 const FluxPattern SECTOR_RECORD_PATTERN(20, C64_SECTOR_RECORD);
 const FluxPattern DATA_RECORD_PATTERN(20, C64_DATA_RECORD);
-const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+const FluxMatchers ANY_RECORD_PATTERN(
+    {&SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN});
 
 static int decode_data_gcr(uint8_t gcr)
 {
     switch (gcr)
     {
-		#define GCR_ENTRY(gcr, data) \
-			case gcr: return data;
-		#include "data_gcr.h"
-		#undef GCR_ENTRY
+#define GCR_ENTRY(gcr, data) \
+    case gcr:                \
+        return data;
+#include "data_gcr.h"
+#undef GCR_ENTRY
     }
     return -1;
-};
+}
 
 static Bytes decode(const std::vector<bool>& bits)
 {
@@ -38,11 +39,11 @@ static Bytes decode(const std::vector<bool>& bits)
     while (ii != bits.end())
     {
         uint8_t inputfifo = 0;
-        for (size_t i=0; i<5; i++)
+        for (size_t i = 0; i < 5; i++)
         {
             if (ii == bits.end())
                 break;
-            inputfifo = (inputfifo<<1) | *ii++;
+            inputfifo = (inputfifo << 1) | *ii++;
         }
 
         bitw.push(decode_data_gcr(inputfifo), 4);
@@ -52,41 +53,51 @@ static Bytes decode(const std::vector<bool>& bits)
     return output;
 }
 
-AbstractDecoder::RecordType Commodore64Decoder::advanceToNextRecord()
+class Commodore64Decoder : public Decoder
 {
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
-	if (matcher == &SECTOR_RECORD_PATTERN)
-		return RecordType::SECTOR_RECORD;
-	if (matcher == &DATA_RECORD_PATTERN)
-		return RecordType::DATA_RECORD;
-	return RecordType::UNKNOWN_RECORD;
-}
+public:
+    Commodore64Decoder(const DecoderProto& config): Decoder(config) {}
 
-void Commodore64Decoder::decodeSectorRecord()
+    nanoseconds_t advanceToNextRecord() override
+    {
+        return seekToPattern(ANY_RECORD_PATTERN);
+    }
+
+    void decodeSectorRecord() override
+    {
+        if (readRaw20() != C64_SECTOR_RECORD)
+            return;
+
+        const auto& bits = readRawBits(5 * 10);
+        const auto& bytes = decode(bits).slice(0, 5);
+
+        uint8_t checksum = bytes[0];
+        _sector->logicalSector = bytes[1];
+        _sector->logicalSide = 0;
+        _sector->logicalTrack = bytes[2] - 1;
+        if (checksum == xorBytes(bytes.slice(1, 4)))
+            _sector->status =
+                Sector::DATA_MISSING; /* unintuitive but correct */
+    }
+
+    void decodeDataRecord() override
+    {
+        if (readRaw20() != C64_DATA_RECORD)
+            return;
+
+        const auto& bits = readRawBits(259 * 10);
+        const auto& bytes = decode(bits).slice(0, 259);
+
+        _sector->data = bytes.slice(0, C64_SECTOR_LENGTH);
+        uint8_t gotChecksum = xorBytes(_sector->data);
+        uint8_t wantChecksum = bytes[256];
+        _sector->status =
+            (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
+};
+
+std::unique_ptr<Decoder> createCommodore64Decoder(
+    const DecoderProto& config)
 {
-    readRawBits(20);
-
-    const auto& bits = readRawBits(5*10);
-    const auto& bytes = decode(bits).slice(0, 5);
-
-    uint8_t checksum = bytes[0];
-    _sector->logicalSector = bytes[1];
-    _sector->logicalSide = 0;
-    _sector->logicalTrack = bytes[2] - 1;
-    if (checksum == xorBytes(bytes.slice(1, 4)))
-        _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
-}
-
-void Commodore64Decoder::decodeDataRecord()
-{
-    readRawBits(20);
-
-    const auto& bits = readRawBits(259*10);
-    const auto& bytes = decode(bits).slice(0, 259);
-
-    _sector->data = bytes.slice(0, C64_SECTOR_LENGTH);
-    uint8_t gotChecksum = xorBytes(_sector->data);
-    uint8_t wantChecksum = bytes[256];
-    _sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    return std::unique_ptr<Decoder>(new Commodore64Decoder(config));
 }

arch/c64/encoder.cc

@@ -0,0 +1,340 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "c64.h"
+#include "crc.h"
+#include "sector.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "fmt/format.h"
+#include "arch/c64/c64.pb.h"
+#include "lib/encoders/encoders.pb.h"
+#include "lib/layout.h"
+#include <ctype.h>
+#include "bytes.h"
+
+static bool lastBit;
+
+static int encode_data_gcr(uint8_t data)
+{
+    switch (data)
+    {
+#define GCR_ENTRY(gcr, data) \
+    case data:               \
+        return gcr;
+#include "data_gcr.h"
+#undef GCR_ENTRY
+    }
+    return -1;
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+{
+    for (bool bit : src) // Range-based for loop
+    {
+        if (cursor < bits.size())
+            bits[cursor++] = bit;
+    }
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+{
+    cursor += width;
+    for (int i = 0; i < width; i++)
+    {
+        unsigned pos = cursor - i - 1;
+        if (pos < bits.size())
+            bits[pos] = data & 1;
+        data >>= 1;
+    }
+}
+
+void bindump(std::ostream& stream, std::vector<bool>& buffer)
+{
+    size_t pos = 0;
+
+    while ((pos < buffer.size()) and (pos < 520))
+    {
+        stream << fmt::format("{:5d} : ", pos);
+        for (int i = 0; i < 40; i++)
+        {
+            if ((pos + i) < buffer.size())
+                stream << fmt::format("{:01b}", (buffer[pos + i]));
+            else
+                stream << "-- ";
+            if ((((pos + i + 1) % 8) == 0) and i != 0)
+                stream << "  ";
+        }
+        stream << std::endl;
+        pos += 40;
+    }
+}
+static std::vector<bool> encode_data(uint8_t input)
+{
+    /*
+     * Four 8-bit data bytes are converted to four 10-bit GCR bytes at a time by
+     * the 1541 DOS.  RAM is only an 8-bit storage device though. This hardware
+     * limitation prevents a 10-bit GCR byte from being stored in a single
+     * memory location. Four 10-bit GCR bytes total 40 bits - a number evenly
+     * divisible by our overriding 8-bit constraint. Commodore sub- divides the
+     * 40 GCR bits into five 8-bit bytes to solve this dilemma. This explains
+     * why four 8-bit data bytes are converted to GCR form at a time. The
+     * following step by step example demonstrates how this bit manipulation is
+     * performed by the DOS.
+     *
+     * STEP 1. Four 8-bit Data Bytes
+     * $08 $10 $00 $12
+     *
+     * STEP 2. Hexadecimal to Binary Conversion
+     * 1. Binary Equivalents
+     * $08       $10         $00         $12
+     * 00001000  00010000    00000000    00010010
+     *
+     * STEP 3. Binary to GCR Conversion
+     * 1. Four 8-bit Data Bytes
+     * 00001000 00010000 00000000 00010010
+     * 2. High and Low Nybbles
+     * 0000 1000 0001 0000 0000 0000 0001 0010
+     * 3. High and Low Nybble GCR Equivalents
+     * 01010 01001 01011 01010 01010 01010 01011 10010
+     * 4. Four 10-bit GCR Bytes
+     * 0101001001 0101101010 0101001010 0101110010
+     *
+     * STEP 4. 10-bit GCR to 8-bit GCR Conversion
+     *   1. Concatenate Four 10-bit GCR Bytes
+     *   0101001001010110101001010010100101110010
+     *   2. Five 8-bit Subdivisions
+     *   01010010 01010110 10100101 00101001 01110010
+     *
+     * STEP 5. Binary to Hexadecimal Conversion
+     * 1. Hexadecimal Equivalents
+     *   01010010    01010110    10100101    00101001    01110010
+     *   $52         $56         $A5         $29         $72
+     *
+     * STEP 6. Four 8-bit Data Bytes are Recorded as Five 8-bit GCR Bytes
+     *   $08 $10 $00 $12
+     *
+     * are recorded as
+     *   $52 $56 $A5 $29 $72
+     */
+
+    std::vector<bool> output(10, false);
+    uint8_t hi = 0;
+    uint8_t lo = 0;
+    uint8_t lo_GCR = 0;
+    uint8_t hi_GCR = 0;
+
+    // Convert the byte in high and low nibble
+    lo = input >> 4; // get the lo nibble shift the bits 4 to the right
+    hi = input & 15; // get the hi nibble bij masking the lo bits (00001111)
+
+    lo_GCR = encode_data_gcr(lo); // example value: 0000   GCR = 01010
+    hi_GCR = encode_data_gcr(hi); // example value: 1000   GCR = 01001
+    // output = [0,1,2,3,4,5,6,7,8,9]
+    // value  = [0,1,0,1,0,0,1,0,0,1]
+    //           01010 01001
+
+    int b = 4;
+    for (int i = 0; i < 10; i++)
+    {
+        if (i < 5)                        // 01234
+        {                                 // i = 0 op
+            output[4 - i] = (lo_GCR & 1); // 01010
+
+            // 01010 -> & 00001 -> 00000 output[4] = 0
+            // 00101 -> & 00001 -> 00001 output[3] = 1
+            // 00010 -> & 00001 -> 00000 output[2] = 0
+            // 00001 -> & 00001 -> 00001 output[1] = 1
+            // 00000 -> & 00001 -> 00000 output[0] = 0
+            lo_GCR >>= 1;
+        }
+        else
+        {
+            output[i + b] = (hi_GCR & 1); // 01001
+            // 01001 -> & 00001 -> 00001 output[9] = 1
+            // 00100 -> & 00001 -> 00000 output[8] = 0
+            // 00010 -> & 00001 -> 00000 output[7] = 0
+            // 00001 -> & 00001 -> 00001 output[6] = 1
+            // 00000 -> & 00001 -> 00000 output[5] = 0
+            hi_GCR >>= 1;
+            b = b - 2;
+        }
+    }
+    return output;
+}
+
+class Commodore64Encoder : public Encoder
+{
+public:
+    Commodore64Encoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.c64())
+    {
+    }
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        /* The format ID Character # 1 and # 2 are in the .d64 image only
+         * present in track 18 sector zero which contains the BAM info in byte
+         * 162 and 163. it is written in every header of every sector and track.
+         * headers are not stored in a d64 disk image so we have to get it from
+         * track 18 which contains the BAM.
+         */
+
+        const auto& sectorData = image.get(
+            C64_BAM_TRACK, 0, 0); // Read de BAM to get the DISK ID bytes
+        if (sectorData)
+        {
+            ByteReader br(sectorData->data);
+            br.seek(162); // goto position of the first Disk ID Byte
+            _formatByte1 = br.read_8();
+            _formatByte2 = br.read_8();
+        }
+        else
+            _formatByte1 = _formatByte2 = 0;
+
+        double clockRateUs = clockPeriodForC64Track(trackInfo->logicalTrack);
+        int bitsPerRevolution = 200000.0 / clockRateUs;
+
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+        fillBitmapTo(bits,
+            cursor,
+            _config.post_index_gap_us() / clockRateUs,
+            {true, false});
+        lastBit = false;
+
+        for (const auto& sector : sectors)
+            writeSector(bits, cursor, sector);
+
+        if (cursor >= bits.size())
+            Error() << fmt::format(
+                "track data overrun by {} bits", cursor - bits.size());
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(
+            bits, calculatePhysicalClockPeriod(clockRateUs * 1e3, 200e6));
+        return fluxmap;
+    }
+
+private:
+    void writeSector(std::vector<bool>& bits,
+        unsigned& cursor,
+        std::shared_ptr<const Sector> sector) const
+    {
+        /* Source: http://www.unusedino.de/ec64/technical/formats/g64.html
+         * 1. Header sync       FF FF FF FF FF (40 'on' bits, not GCR)
+         * 2. Header info       52 54 B5 29 4B 7A 5E 95 55 55 (10 GCR bytes)
+         * 3. Header gap        55 55 55 55 55 55 55 55 55 (9 bytes, never read)
+         * 4. Data sync         FF FF FF FF FF (40 'on' bits, not GCR)
+         * 5. Data block        55...4A (325 GCR bytes)
+         * 6. Inter-sector gap  55 55 55 55...55 55 (4 to 12 bytes, never read)
+         * 1. Header sync       (SYNC for the next sector)
+         */
+        if ((sector->status == Sector::OK) or
+            (sector->status == Sector::BAD_CHECKSUM))
+        {
+            // There is data to encode to disk.
+            if ((sector->data.size() != C64_SECTOR_LENGTH))
+                Error() << fmt::format(
+                    "unsupported sector size {} --- you must pick 256",
+                    sector->data.size());
+
+            // 1. Write header Sync (not GCR)
+            for (int i = 0; i < 6; i++)
+                write_bits(
+                    bits, cursor, C64_HEADER_DATA_SYNC, 1 * 8); /* sync */
+
+            // 2. Write Header info 10 GCR bytes
+            /*
+             * The 10 byte header info (#2) is GCR encoded and must be decoded
+             * to it's normal 8 bytes to be understood. Once decoded, its
+             * breakdown is as follows:
+             *
+             * Byte $00 - header block ID           ($08)
+             *   01 - header block checksum 16  (EOR of $02-$05)
+             *   02 - Sector
+             *   03 - Track
+             *   04 - Format ID byte #2
+             *   05 - Format ID byte #1
+             *   06-07 - $0F ("off" bytes)
+             */
+            uint8_t encodedTrack =
+                ((sector->logicalTrack) +
+                    1); // C64 track numbering starts with 1. Fluxengine with 0.
+            uint8_t encodedSector = sector->logicalSector;
+            // uint8_t formatByte1 = C64_FORMAT_ID_BYTE1;
+            // uint8_t formatByte2 = C64_FORMAT_ID_BYTE2;
+            uint8_t headerChecksum =
+                (encodedTrack ^ encodedSector ^ _formatByte1 ^ _formatByte2);
+            write_bits(bits, cursor, encode_data(C64_HEADER_BLOCK_ID));
+            write_bits(bits, cursor, encode_data(headerChecksum));
+            write_bits(bits, cursor, encode_data(encodedSector));
+            write_bits(bits, cursor, encode_data(encodedTrack));
+            write_bits(bits, cursor, encode_data(_formatByte2));
+            write_bits(bits, cursor, encode_data(_formatByte1));
+            write_bits(bits, cursor, encode_data(C64_PADDING));
+            write_bits(bits, cursor, encode_data(C64_PADDING));
+
+            // 3. Write header GAP not GCR
+            for (int i = 0; i < 9; i++)
+                write_bits(
+                    bits, cursor, C64_HEADER_GAP, 1 * 8); /* header gap */
+
+            // 4. Write Data sync not GCR
+            for (int i = 0; i < 6; i++)
+                write_bits(
+                    bits, cursor, C64_HEADER_DATA_SYNC, 1 * 8); /* sync */
+
+            // 5. Write data block 325 GCR bytes
+            /*
+             * The 325 byte data block (#5) is GCR encoded and must be  decoded
+             * to  its normal 260 bytes to be understood. The data block is made
+             * up of the following:
+             *
+             * Byte    $00 - data block ID ($07)
+             *      01-100 - 256 bytes data
+             *      101 - data block checksum (EOR of $01-100)
+             *      102-103 - $00 ("off" bytes, to make the sector size a
+             * multiple of 5)
+             */
+
+            write_bits(bits, cursor, encode_data(C64_DATA_BLOCK_ID));
+            uint8_t dataChecksum = xorBytes(sector->data);
+            ByteReader br(sector->data);
+            int i = 0;
+            for (i = 0; i < C64_SECTOR_LENGTH; i++)
+            {
+                uint8_t val = br.read_8();
+                write_bits(bits, cursor, encode_data(val));
+            }
+            write_bits(bits, cursor, encode_data(dataChecksum));
+            write_bits(bits, cursor, encode_data(C64_PADDING));
+            write_bits(bits, cursor, encode_data(C64_PADDING));
+
+            // 6. Write inter-sector gap 9 - 12 bytes nor gcr
+            for (int i = 0; i < 9; i++)
+                write_bits(
+                    bits, cursor, C64_INTER_SECTOR_GAP, 1 * 8); /* sync */
+        }
+    }
+
+private:
+    const Commodore64EncoderProto& _config;
+    uint8_t _formatByte1;
+    uint8_t _formatByte2;
+};
+
+std::unique_ptr<Encoder> createCommodore64Encoder(const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new Commodore64Encoder(config));
+}
+
+// vim: sw=4 ts=4 et

arch/f85/decoder.cc

@@ -2,7 +2,6 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "f85.h"
@@ -26,7 +25,7 @@ static int decode_data_gcr(uint8_t gcr)
 		#undef GCR_ENTRY
     }
     return -1;
-};
+}
 
 static Bytes decode(const std::vector<bool>& bits)
 {
@@ -52,49 +51,59 @@ static Bytes decode(const std::vector<bool>& bits)
     return output;
 }
 
-AbstractDecoder::RecordType DurangoF85Decoder::advanceToNextRecord()
+class DurangoF85Decoder : public Decoder
 {
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
-	if (matcher == &SECTOR_RECORD_PATTERN)
-		return RecordType::SECTOR_RECORD;
-	if (matcher == &DATA_RECORD_PATTERN)
-		return RecordType::DATA_RECORD;
-	return RecordType::UNKNOWN_RECORD;
+public:
+	DurangoF85Decoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(ANY_RECORD_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		/* Skip sync bits and ID byte. */
+
+		if (readRaw24() != F85_SECTOR_RECORD)
+			return;
+
+		/* Read header. */
+
+		const auto& bytes = decode(readRawBits(6*10));
+
+		_sector->logicalSector = bytes[2];
+		_sector->logicalSide = 0;
+		_sector->logicalTrack = bytes[0];
+
+		uint16_t wantChecksum = bytes.reader().seek(4).read_be16();
+		uint16_t gotChecksum = crc16(CCITT_POLY, 0xef21, bytes.slice(0, 4));
+		if (wantChecksum == gotChecksum)
+			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+	}
+
+    void decodeDataRecord() override
+	{
+		/* Skip sync bits ID byte. */
+
+		if (readRaw24() != F85_DATA_RECORD)
+			return;
+
+		const auto& bytes = decode(readRawBits((F85_SECTOR_LENGTH+3)*10))
+			.slice(0, F85_SECTOR_LENGTH+3);
+		ByteReader br(bytes);
+
+		_sector->data = br.read(F85_SECTOR_LENGTH);
+		uint16_t wantChecksum = br.read_be16();
+		uint16_t gotChecksum = crc16(CCITT_POLY, 0xbf84, _sector->data);
+		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+};
+
+std::unique_ptr<Decoder> createDurangoF85Decoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new DurangoF85Decoder(config));
 }
 
-void DurangoF85Decoder::decodeSectorRecord()
-{
-    /* Skip sync bits and ID byte. */
-
-    readRawBits(24);
-
-    /* Read header. */
-
-    const auto& bytes = decode(readRawBits(6*10));
-
-    _sector->logicalSector = bytes[2];
-    _sector->logicalSide = 0;
-    _sector->logicalTrack = bytes[0];
-
-    uint16_t wantChecksum = bytes.reader().seek(4).read_be16();
-    uint16_t gotChecksum = crc16(CCITT_POLY, 0xef21, bytes.slice(0, 4));
-    if (wantChecksum == gotChecksum)
-        _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
-}
-
-void DurangoF85Decoder::decodeDataRecord()
-{
-    /* Skip sync bits ID byte. */
-
-    readRawBits(24);
-
-    const auto& bytes = decode(readRawBits((F85_SECTOR_LENGTH+3)*10))
-        .slice(0, F85_SECTOR_LENGTH+3);
-    ByteReader br(bytes);
-
-    _sector->data = br.read(F85_SECTOR_LENGTH);
-    uint16_t wantChecksum = br.read_be16();
-    uint16_t gotChecksum = crc16(CCITT_POLY, 0xbf84, _sector->data);
-    _sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/f85/f85.h

@@ -5,17 +5,6 @@
 #define F85_DATA_RECORD 0xffffcb /* 1111 1111 1111 1111 1100 1101 */
 #define F85_SECTOR_LENGTH    512
 
-class Sector;
-class Fluxmap;
-
-class DurangoF85Decoder : public AbstractDecoder
-{
-public:
-    virtual ~DurangoF85Decoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-    void decodeDataRecord();
-};
+extern std::unique_ptr<Decoder> createDurangoF85Decoder(const DecoderProto& config);
 
 #endif

arch/f85/f85.proto

@@ -0,0 +1,4 @@
+syntax = "proto2";
+
+message F85DecoderProto {}
+

arch/fb100/decoder.cc

@@ -2,14 +2,12 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "fb100.h"
 #include "crc.h"
 #include "bytes.h"
 #include "decoders/rawbits.h"
-#include "track.h"
 #include "fmt/format.h"
 #include <string.h>
 #include <algorithm>
@@ -99,37 +97,48 @@ static uint16_t checksum(const Bytes& bytes)
     return (crchi << 8) | crclo;
 }
 
-AbstractDecoder::RecordType Fb100Decoder::advanceToNextRecord()
+class Fb100Decoder : public Decoder
 {
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(SECTOR_ID_PATTERN, matcher);
-    if (matcher == &SECTOR_ID_PATTERN)
-		return RecordType::SECTOR_RECORD;
-	return RecordType::UNKNOWN_RECORD;
+public:
+	Fb100Decoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(SECTOR_ID_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		auto rawbits = readRawBits(FB100_RECORD_SIZE*16);
+
+		const Bytes bytes = decodeFmMfm(rawbits).slice(0, FB100_RECORD_SIZE);
+		ByteReader br(bytes);
+		br.seek(1);
+		const Bytes id = br.read(FB100_ID_SIZE);
+		uint16_t wantIdCrc = br.read_be16();
+		uint16_t gotIdCrc = checksum(id);
+		const Bytes payload = br.read(FB100_PAYLOAD_SIZE);
+		uint16_t wantPayloadCrc = br.read_be16();
+		uint16_t gotPayloadCrc = checksum(payload);
+
+		if (wantIdCrc != gotIdCrc)
+			return;
+
+		uint8_t abssector = id[2];
+		_sector->logicalTrack = abssector >> 1;
+		_sector->logicalSide = 0;
+		_sector->logicalSector = abssector & 1;
+		_sector->data.writer().append(id.slice(5, 12)).append(payload);
+
+		_sector->status = (wantPayloadCrc == gotPayloadCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+};
+
+std::unique_ptr<Decoder> createFb100Decoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new Fb100Decoder(config));
 }
 
-void Fb100Decoder::decodeSectorRecord()
-{
-    auto rawbits = readRawBits(FB100_RECORD_SIZE*16);
 
-    const Bytes bytes = decodeFmMfm(rawbits).slice(0, FB100_RECORD_SIZE);
-    ByteReader br(bytes);
-    br.seek(1);
-    const Bytes id = br.read(FB100_ID_SIZE);
-    uint16_t wantIdCrc = br.read_be16();
-    uint16_t gotIdCrc = checksum(id);
-    const Bytes payload = br.read(FB100_PAYLOAD_SIZE);
-    uint16_t wantPayloadCrc = br.read_be16();
-    uint16_t gotPayloadCrc = checksum(payload);
-
-    if (wantIdCrc != gotIdCrc)
-        return;
-
-    uint8_t abssector = id[2];
-    _sector->logicalTrack = abssector >> 1;
-    _sector->logicalSide = 0;
-    _sector->logicalSector = abssector & 1;
-    _sector->data.writer().append(id.slice(5, 12)).append(payload);
-
-    _sector->status = (wantPayloadCrc == gotPayloadCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/fb100/fb100.h

@@ -5,18 +5,7 @@
 #define FB100_ID_SIZE 17
 #define FB100_PAYLOAD_SIZE 0x500
 
-class Sector;
-class Fluxmap;
-class Track;
-
-class Fb100Decoder : public AbstractDecoder
-{
-public:
-    virtual ~Fb100Decoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-};
+extern std::unique_ptr<Decoder> createFb100Decoder(const DecoderProto& config);
 
 #endif
 

arch/fb100/fb100.proto

@@ -0,0 +1,4 @@
+syntax = "proto2";
+
+message Fb100DecoderProto {}
+

arch/ibm/decoder.cc

@@ -5,25 +5,27 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "sector.h"
-#include "record.h"
+#include "arch/ibm/ibm.pb.h"
+#include "proto.h"
+#include "lib/layout.h"
 #include <string.h>
 
 static_assert(std::is_trivially_copyable<IbmIdam>::value,
-		"IbmIdam is not trivially copyable");
+    "IbmIdam is not trivially copyable");
 
 /*
  * The markers at the beginning of records are special, and have
  * missing clock pulses, allowing them to be found by the logic.
- * 
+ *
  * IAM record:
  * flux:   XXXX-XXX-XXXX-X- = 0xf77a
  * clock:  X X - X - X X X  = 0xd7
  * data:    X X X X X X - - = 0xfc
- * 
+ *
  * (We just ignore this one --- it's useless and optional.)
  */
 
-/* 
+/*
  * IDAM record:
  * flux:   XXXX-X-X-XXXXXX- = 0xf57e
  * clock:  X X - - - X X X  = 0xc7
@@ -31,7 +33,7 @@ static_assert(std::is_trivially_copyable<IbmIdam>::value,
  */
 const FluxPattern FM_IDAM_PATTERN(16, 0xf57e);
 
-/* 
+/*
  * DAM1 record:
  * flux:   XXXX-X-X-XX-X-X- = 0xf56a
  * clock:  X X - - - X X X  = 0xc7
@@ -39,7 +41,7 @@ const FluxPattern FM_IDAM_PATTERN(16, 0xf57e);
  */
 const FluxPattern FM_DAM1_PATTERN(16, 0xf56a);
 
-/* 
+/*
  * DAM2 record:
  * flux:   XXXX-X-X-XX-XXXX = 0xf56f
  * clock:  X X - - - X X X  = 0xc7
@@ -47,7 +49,7 @@ const FluxPattern FM_DAM1_PATTERN(16, 0xf56a);
  */
 const FluxPattern FM_DAM2_PATTERN(16, 0xf56f);
 
-/* 
+/*
  * TRS80DAM1 record:
  * flux:   XXXX-X-X-XX-X-XX = 0xf56b
  * clock:  X X - - - X X X  = 0xc7
@@ -55,13 +57,13 @@ const FluxPattern FM_DAM2_PATTERN(16, 0xf56f);
  */
 const FluxPattern FM_TRS80DAM1_PATTERN(16, 0xf56b);
 
-/* 
+/*
  * TRS80DAM2 record:
- * flux:   XXXX-X-X-XX-XXX- = 0xf56c
+ * flux:   XXXX-X-X-XX-XXX- = 0xf56e
  * clock:  X X - - - X X X  = 0xc7
  * data:    X X X X X - X - = 0xfa
  */
-const FluxPattern FM_TRS80DAM2_PATTERN(16, 0xf56c);
+const FluxPattern FM_TRS80DAM2_PATTERN(16, 0xf56e);
 
 /* MFM record separator:
  * 0xA1 is:
@@ -71,86 +73,165 @@ const FluxPattern FM_TRS80DAM2_PATTERN(16, 0xf56c);
  *                       ^^^^^
  * When shifted out of phase, the special 0xa1 byte becomes an illegal
  * encoding (you can't do 10 00). So this can't be spoofed by user data.
- * 
+ *
  * shifted: 10 00 10 01 00 01 00 1
+ *
+ * It's repeated three times.
  */
-const FluxPattern MFM_PATTERN(16, 0x4489);
+const FluxPattern MFM_PATTERN(48, 0x448944894489LL);
 
-const FluxMatchers ANY_RECORD_PATTERN(
+const FluxMatchers ANY_RECORD_PATTERN({
+    &MFM_PATTERN,
+    &FM_IDAM_PATTERN,
+    &FM_DAM1_PATTERN,
+    &FM_DAM2_PATTERN,
+    &FM_TRS80DAM1_PATTERN,
+    &FM_TRS80DAM2_PATTERN,
+});
+
+class IbmDecoder : public Decoder
+{
+public:
+    IbmDecoder(const DecoderProto& config):
+        Decoder(config),
+        _config(config.ibm())
     {
-        &MFM_PATTERN,
-        &FM_IDAM_PATTERN,
-        &FM_DAM1_PATTERN,
-        &FM_DAM2_PATTERN,
-        &FM_TRS80DAM1_PATTERN,
-        &FM_TRS80DAM2_PATTERN,
     }
-);
 
-AbstractDecoder::RecordType IbmDecoder::advanceToNextRecord()
-{
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
-
-    /* If this is the MFM prefix byte, the the decoder is going to expect three
-     * extra bytes on the front of the header. */
-    _currentHeaderLength = (matcher == &MFM_PATTERN) ? 3 : 0;
-
-    Fluxmap::Position here = tell();
-    if (_currentHeaderLength > 0)
-        readRawBits(_currentHeaderLength*16);
-    auto idbits = readRawBits(16);
-    uint8_t id = decodeFmMfm(idbits).slice(0, 1)[0];
-    seek(here);
-    
-    switch (id)
+    nanoseconds_t advanceToNextRecord() override
     {
-        case IBM_IDAM:
-            return RecordType::SECTOR_RECORD;
-
-        case IBM_DAM1:
-        case IBM_DAM2:
-        case IBM_TRS80DAM1:
-        case IBM_TRS80DAM2:
-            return RecordType::DATA_RECORD;
+        return seekToPattern(ANY_RECORD_PATTERN);
     }
-    return RecordType::UNKNOWN_RECORD;
-}
 
-void IbmDecoder::decodeSectorRecord()
+    void decodeSectorRecord() override
+    {
+        /* This is really annoying because the IBM record scheme has a
+         * variable-sized header _and_ the checksum covers this header too. So
+         * we have to read and decode a byte at a time until we know where the
+         * record itself starts, saving the bytes for the checksumming later.
+         */
+
+        Bytes bytes;
+        ByteWriter bw(bytes);
+
+        auto readByte = [&]()
+        {
+            auto bits = readRawBits(16);
+            auto bytes = decodeFmMfm(bits).slice(0, 1);
+            uint8_t byte = bytes[0];
+            bw.write_8(byte);
+            return byte;
+        };
+
+        uint8_t id = readByte();
+        if (id == 0xa1)
+        {
+            readByte();
+            readByte();
+            id = readByte();
+        }
+        if (id != IBM_IDAM)
+            return;
+
+        ByteReader br(bytes);
+        br.seek(bw.pos);
+
+        auto bits = readRawBits(IBM_IDAM_LEN * 16);
+        bw += decodeFmMfm(bits).slice(0, IBM_IDAM_LEN);
+
+        IbmDecoderProto::TrackdataProto trackdata;
+        getTrackFormat(
+            trackdata, _sector->physicalTrack, _sector->physicalSide);
+
+        _sector->logicalTrack = br.read_8();
+        _sector->logicalSide = br.read_8();
+        _sector->logicalSector = br.read_8();
+        _currentSectorSize = 1 << (br.read_8() + 7);
+        uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, br.pos));
+        uint16_t wantCrc = br.read_be16();
+        if (wantCrc == gotCrc)
+            _sector->status =
+                Sector::DATA_MISSING; /* correct but unintuitive */
+
+        if (trackdata.ignore_side_byte())
+            _sector->logicalSide =
+                Layout::remapSidePhysicalToLogical(_sector->physicalSide);
+        _sector->logicalSide ^= trackdata.invert_side_byte();
+        if (trackdata.ignore_track_byte())
+            _sector->logicalTrack = _sector->physicalTrack;
+
+        for (int sector : trackdata.ignore_sector())
+            if (_sector->logicalSector == sector)
+            {
+                _sector->status = Sector::MISSING;
+                break;
+            }
+    }
+
+    void decodeDataRecord() override
+    {
+        /* This is the same deal as the sector record. */
+
+        Bytes bytes;
+        ByteWriter bw(bytes);
+
+        auto readByte = [&]()
+        {
+            auto bits = readRawBits(16);
+            auto bytes = decodeFmMfm(bits).slice(0, 1);
+            uint8_t byte = bytes[0];
+            bw.write_8(byte);
+            return byte;
+        };
+
+        uint8_t id = readByte();
+        if (id == 0xa1)
+        {
+            readByte();
+            readByte();
+            id = readByte();
+        }
+        if ((id != IBM_DAM1) && (id != IBM_DAM2) && (id != IBM_TRS80DAM1) &&
+            (id != IBM_TRS80DAM2))
+            return;
+
+        ByteReader br(bytes);
+        br.seek(bw.pos);
+
+        auto bits = readRawBits((_currentSectorSize + 2) * 16);
+        bw += decodeFmMfm(bits).slice(0, _currentSectorSize + 2);
+
+        _sector->data = br.read(_currentSectorSize);
+        uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, br.pos));
+        uint16_t wantCrc = br.read_be16();
+        _sector->status =
+            (wantCrc == gotCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
+
+private:
+    void getTrackFormat(IbmDecoderProto::TrackdataProto& trackdata,
+        unsigned track,
+        unsigned head) const
+    {
+        trackdata.Clear();
+        for (const auto& f : _config.trackdata())
+        {
+            if (f.has_track() && (f.track() != track))
+                continue;
+            if (f.has_head() && (f.head() != head))
+                continue;
+
+            trackdata.MergeFrom(f);
+        }
+    }
+
+private:
+    const IbmDecoderProto& _config;
+    unsigned _currentSectorSize;
+    unsigned _currentHeaderLength;
+};
+
+std::unique_ptr<Decoder> createIbmDecoder(const DecoderProto& config)
 {
-    unsigned recordSize = _currentHeaderLength + IBM_IDAM_LEN;
-    auto bits = readRawBits(recordSize*16);
-    auto bytes = decodeFmMfm(bits).slice(0, recordSize);
-
-    ByteReader br(bytes);
-    br.seek(_currentHeaderLength);
-    br.read_8(); /* skip ID byte */
-    _sector->logicalTrack = br.read_8();
-    _sector->logicalSide = br.read_8();
-    _sector->logicalSector = br.read_8() - _sectorBase;
-    _currentSectorSize = 1 << (br.read_8() + 7);
-    uint16_t wantCrc = br.read_be16();
-    uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, _currentHeaderLength + 5));
-    if (wantCrc == gotCrc)
-        _sector->status = Sector::DATA_MISSING; /* correct but unintuitive */
-
-    if (_ignoreSideByte)
-        _sector->logicalSide = _sector->physicalSide;
-}
-
-void IbmDecoder::decodeDataRecord()
-{
-    unsigned recordLength = _currentHeaderLength + _currentSectorSize + 3;
-    auto bits = readRawBits(recordLength*16);
-    auto bytes = decodeFmMfm(bits).slice(0, recordLength);
-
-    ByteReader br(bytes);
-    br.seek(_currentHeaderLength);
-    br.read_8(); /* skip ID byte */
-
-    _sector->data = br.read(_currentSectorSize);
-    uint16_t wantCrc = br.read_be16();
-    uint16_t gotCrc = crc16(CCITT_POLY, bytes.slice(0, recordLength-2));
-    _sector->status = (wantCrc == gotCrc) ? Sector::OK : Sector::BAD_CHECKSUM;
+    return std::unique_ptr<Decoder>(new IbmDecoder(config));
 }

arch/ibm/encoder.cc

@@ -0,0 +1,281 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "ibm.h"
+#include "crc.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "arch/ibm/ibm.pb.h"
+#include "lib/encoders/encoders.pb.h"
+#include "fmt/format.h"
+#include "lib/proto.h"
+#include "lib/layout.h"
+#include <ctype.h>
+
+/* IAM record separator:
+ * 0xC2 is:
+ * data:    1  1  0  0  0  0  1  0  = 0xc2
+ * mfm:     01 01 00 10 10 10 01 00 = 0x5254
+ * special: 01 01 00 10 00 10 01 00 = 0x5224
+ */
+#define MFM_IAM_SEPARATOR 0x5224
+
+/* FM IAM record:
+ * flux:   XXXX-XXX-XXXX-X- = 0xf77a
+ * clock:  X X - X - X X X  = 0xd7
+ * data:    X X X X X X - - = 0xfc
+ */
+#define FM_IAM_RECORD 0xf77a
+
+/* MFM IAM record:
+ * data:   1  1  1  1  1  1  0  0  = 0xfc
+ * flux:   01 01 01 01 01 01 00 10 = 0x5552
+ */
+#define MFM_IAM_RECORD 0x5552
+
+/* MFM record separator:
+ * 0xA1 is:
+ * data:    1  0  1  0  0  0  0  1  = 0xa1
+ * mfm:     01 00 01 00 10 10 10 01 = 0x44a9
+ * special: 01 00 01 00 10 00 10 01 = 0x4489
+ *                       ^^^^^
+ * When shifted out of phase, the special 0xa1 byte becomes an illegal
+ * encoding (you can't do 10 00). So this can't be spoofed by user data.
+ *
+ * shifted: 10 00 10 01 00 01 00 1
+ *
+ * It's repeated three times.
+ */
+#define MFM_RECORD_SEPARATOR 0x4489
+#define MFM_RECORD_SEPARATOR_BYTE 0xa1
+
+/* MFM IDAM byte:
+ * data:    1  1  1  1  1  1  1  0  = 0xfe
+ * mfm:     01 01 01 01 01 01 01 00 = 0x5554
+ */
+
+/* MFM DAM byte:
+ * data:    1  1  1  1  1  0  1  1  = 0xfb
+ * mfm:     01 01 01 01 01 00 01 01 = 0x5545
+ */
+
+static uint8_t decodeUint16(uint16_t raw)
+{
+    Bytes b;
+    ByteWriter bw(b);
+    bw.write_be16(raw);
+    return decodeFmMfm(b.toBits())[0];
+}
+
+class IbmEncoder : public Encoder
+{
+public:
+    IbmEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.ibm())
+    {
+    }
+
+private:
+    void writeRawBits(uint32_t data, int width)
+    {
+        _cursor += width;
+        _lastBit = data & 1;
+        for (int i = 0; i < width; i++)
+        {
+            unsigned pos = _cursor - i - 1;
+            if (pos < _bits.size())
+                _bits[pos] = data & 1;
+            data >>= 1;
+        }
+    }
+
+    void getEncoderTrackData(IbmEncoderProto::TrackdataProto& trackdata,
+        unsigned track,
+        unsigned head)
+    {
+        trackdata.Clear();
+        for (const auto& f : _config.trackdata())
+        {
+            if (f.has_track() && (f.track() != track))
+                continue;
+            if (f.has_head() && (f.head() != head))
+                continue;
+
+            trackdata.MergeFrom(f);
+        }
+    }
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        IbmEncoderProto::TrackdataProto trackdata;
+        getEncoderTrackData(trackdata, trackInfo->logicalTrack, trackInfo->logicalSide);
+
+        auto trackLayout =
+            Layout::getLayoutOfTrack(trackInfo->logicalTrack, trackInfo->logicalSide);
+
+        auto writeBytes = [&](const Bytes& bytes)
+        {
+            if (trackdata.use_fm())
+                encodeFm(_bits, _cursor, bytes);
+            else
+                encodeMfm(_bits, _cursor, bytes, _lastBit);
+        };
+
+        auto writeFillerRawBytes = [&](int count, uint16_t byte)
+        {
+            for (int i = 0; i < count; i++)
+                writeRawBits(byte, 16);
+        };
+
+        auto writeFillerBytes = [&](int count, uint8_t byte)
+        {
+            Bytes b{byte};
+            for (int i = 0; i < count; i++)
+                writeBytes(b);
+        };
+
+        double clockRateUs = trackdata.target_clock_period_us();
+        if (!trackdata.use_fm())
+            clockRateUs /= 2.0;
+        int bitsPerRevolution =
+            (trackdata.target_rotational_period_ms() * 1000.0) / clockRateUs;
+        _bits.resize(bitsPerRevolution);
+        _cursor = 0;
+
+        uint8_t idamUnencoded = decodeUint16(trackdata.idam_byte());
+        uint8_t damUnencoded = decodeUint16(trackdata.dam_byte());
+
+        uint8_t sectorSize = 0;
+        {
+            int s = trackLayout->sectorSize >> 7;
+            while (s > 1)
+            {
+                s >>= 1;
+                sectorSize += 1;
+            }
+        }
+
+        uint16_t gapFill = trackdata.gap_fill_byte();
+
+        writeFillerRawBytes(trackdata.gap0(), gapFill);
+        if (trackdata.emit_iam())
+        {
+            writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
+            if (!trackdata.use_fm())
+            {
+                for (int i = 0; i < 3; i++)
+                    writeRawBits(MFM_IAM_SEPARATOR, 16);
+            }
+            writeRawBits(
+                trackdata.use_fm() ? FM_IAM_RECORD : MFM_IAM_RECORD, 16);
+            writeFillerRawBytes(trackdata.gap1(), gapFill);
+        }
+
+        bool first = true;
+        for (const auto& sectorData : sectors)
+        {
+            if (!first)
+                writeFillerRawBytes(trackdata.gap3(), gapFill);
+            first = false;
+
+            /* Writing the sector and data records are fantastically annoying.
+             * The CRC is calculated from the *very start* of the record, and
+             * include the malformed marker bytes. Our encoder doesn't know
+             * about this, of course, with the result that we have to construct
+             * the unencoded header, calculate the checksum, and then use the
+             * same logic to emit the bytes which require special encoding
+             * before encoding the rest of the header normally. */
+
+            {
+                Bytes header;
+                ByteWriter bw(header);
+
+                writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
+                if (!trackdata.use_fm())
+                {
+                    for (int i = 0; i < 3; i++)
+                        bw.write_8(MFM_RECORD_SEPARATOR_BYTE);
+                }
+                bw.write_8(idamUnencoded);
+                bw.write_8(sectorData->logicalTrack);
+                bw.write_8(
+                    sectorData->logicalSide ^ trackdata.invert_side_byte());
+                bw.write_8(sectorData->logicalSector);
+                bw.write_8(sectorSize);
+                uint16_t crc = crc16(CCITT_POLY, header);
+                bw.write_be16(crc);
+
+                int conventionalHeaderStart = 0;
+                if (!trackdata.use_fm())
+                {
+                    for (int i = 0; i < 3; i++)
+                        writeRawBits(MFM_RECORD_SEPARATOR, 16);
+                    conventionalHeaderStart += 3;
+                }
+                writeRawBits(trackdata.idam_byte(), 16);
+                conventionalHeaderStart += 1;
+
+                writeBytes(header.slice(conventionalHeaderStart));
+            }
+
+            writeFillerRawBytes(trackdata.gap2(), gapFill);
+
+            {
+                Bytes data;
+                ByteWriter bw(data);
+
+                writeFillerBytes(trackdata.use_fm() ? 6 : 12, 0x00);
+                if (!trackdata.use_fm())
+                {
+                    for (int i = 0; i < 3; i++)
+                        bw.write_8(MFM_RECORD_SEPARATOR_BYTE);
+                }
+                bw.write_8(damUnencoded);
+
+                Bytes truncatedData =
+                    sectorData->data.slice(0, trackLayout->sectorSize);
+                bw += truncatedData;
+                uint16_t crc = crc16(CCITT_POLY, data);
+                bw.write_be16(crc);
+
+                int conventionalHeaderStart = 0;
+                if (!trackdata.use_fm())
+                {
+                    for (int i = 0; i < 3; i++)
+                        writeRawBits(MFM_RECORD_SEPARATOR, 16);
+                    conventionalHeaderStart += 3;
+                }
+                writeRawBits(trackdata.dam_byte(), 16);
+                conventionalHeaderStart += 1;
+
+                writeBytes(data.slice(conventionalHeaderStart));
+            }
+        }
+
+        if (_cursor >= _bits.size())
+            Error() << "track data overrun";
+        while (_cursor < _bits.size())
+            writeFillerRawBytes(1, gapFill);
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(_bits,
+            calculatePhysicalClockPeriod(clockRateUs * 1e3,
+                trackdata.target_rotational_period_ms() * 1e6));
+        return fluxmap;
+    }
+
+private:
+    const IbmEncoderProto& _config;
+    std::vector<bool> _bits;
+    unsigned _cursor;
+    bool _lastBit;
+};
+
+std::unique_ptr<Encoder> createIbmEncoder(const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new IbmEncoder(config));
+}

arch/ibm/ibm.h

@@ -1,98 +1,39 @@
 #ifndef IBM_H
 #define IBM_H
 
-#include "decoders/decoders.h"
-
 /* IBM format (i.e. ordinary PC floppies). */
 
-#define IBM_MFM_SYNC   0xA1   /* sync byte for MFM */
-#define IBM_IAM        0xFC   /* start-of-track record */
-#define IBM_IAM_LEN    1      /* plus prologue */
-#define IBM_IDAM       0xFE   /* sector header */
-#define IBM_IDAM_LEN   7      /* plus prologue */
-#define IBM_DAM1       0xF8   /* sector data (type 1) */
-#define IBM_DAM2       0xFB   /* sector data (type 2) */
-#define IBM_TRS80DAM1  0xF9   /* sector data (TRS-80 directory) */
-#define IBM_TRS80DAM2  0xFA   /* sector data (TRS-80 directory) */
-#define IBM_DAM_LEN    1      /* plus prologue and user data */
+#define IBM_MFM_SYNC 0xA1  /* sync byte for MFM */
+#define IBM_IAM 0xFC       /* start-of-track record */
+#define IBM_IAM_LEN 1      /* plus prologue */
+#define IBM_IDAM 0xFE      /* sector header */
+#define IBM_IDAM_LEN 7     /* plus prologue */
+#define IBM_DAM1 0xF8      /* sector data (type 1) */
+#define IBM_DAM2 0xFB      /* sector data (type 2) */
+#define IBM_TRS80DAM1 0xF9 /* sector data (TRS-80 directory) */
+#define IBM_TRS80DAM2 0xFA /* sector data (TRS-80 directory) */
+#define IBM_DAM_LEN 1      /* plus prologue and user data */
 
 /* Length of a DAM record is determined by the previous sector header. */
 
 struct IbmIdam
 {
     uint8_t id;
-    uint8_t cylinder;
+    uint8_t track;
     uint8_t side;
     uint8_t sector;
     uint8_t sectorSize;
     uint8_t crc[2];
 };
 
-class IbmDecoder : public AbstractDecoder
-{
-public:
-    IbmDecoder(unsigned sectorBase, bool ignoreSideByte=false):
-        _sectorBase(sectorBase),
-        _ignoreSideByte(ignoreSideByte)
-    {}
+class Encoder;
+class Decoder;
+class DecoderProto;
+class EncoderProto;
 
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-    void decodeDataRecord();
-
-private:
-    unsigned _sectorBase;
-    bool _ignoreSideByte;
-    unsigned _currentSectorSize;
-    unsigned _currentHeaderLength;
-};
-
-#if 0
-class AbstractIbmDecoder : public AbstractSoftSectorDecoder
-{
-public:
-    AbstractIbmDecoder(unsigned sectorIdBase):
-        _sectorIdBase(sectorIdBase)
-    {}
-    virtual ~AbstractIbmDecoder() {}
-
-    SectorVector decodeToSectors(const RawRecordVector& rawRecords, unsigned physicalTrack, unsigned physicalSide);
-
-protected:
-    virtual int skipHeaderBytes() const = 0;
-
-private:
-    unsigned _sectorIdBase;
-};
-
-class IbmFmDecoder : public AbstractIbmDecoder
-{
-public:
-    IbmFmDecoder(unsigned sectorIdBase):
-        AbstractIbmDecoder(sectorIdBase)
-    {}
-
-    int recordMatcher(uint64_t fifo) const;
-
-protected:
-    int skipHeaderBytes() const
-    { return 0; }
-};
-
-class IbmMfmDecoder : public AbstractIbmDecoder
-{
-public:
-    IbmMfmDecoder(unsigned sectorIdBase):
-        AbstractIbmDecoder(sectorIdBase)
-    {}
-
-    nanoseconds_t guessClock(Fluxmap& fluxmap) const;
-    int recordMatcher(uint64_t fifo) const;
-
-protected:
-    int skipHeaderBytes() const
-    { return 3; }
-};
-#endif
+extern std::unique_ptr<Decoder> createIbmDecoder(
+    const DecoderProto& config);
+extern std::unique_ptr<Encoder> createIbmEncoder(
+    const EncoderProto& config);
 
 #endif

arch/ibm/ibm.proto

@@ -0,0 +1,43 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message IbmDecoderProto {
+	// Next: 11
+	message TrackdataProto {
+		optional int32 track = 7              [(help) = "if set, the format applies only to this track"];
+		optional int32 head = 8                  [(help) = "if set, the format applies only to this head"];
+
+		optional bool ignore_side_byte = 2       [default = false, (help) = "ignore side byte in sector header"];
+		optional bool ignore_track_byte = 6      [default = false, (help) = "ignore track byte in sector header"];
+		optional bool invert_side_byte = 4       [default = false, (help) = "invert the side byte in the sector header"];
+
+		repeated int32 ignore_sector = 10        [(help) = "sectors with these IDs will not be read"];
+	}
+
+	repeated TrackdataProto trackdata = 1;
+}
+
+message IbmEncoderProto {
+	// Next: 20
+	message TrackdataProto {
+		optional int32 track = 15        [(help) = "if set, the format applies only to this track"];
+		optional int32 head = 16            [(help) = "if set, the format applies only to this head"];
+
+		optional bool emit_iam = 3          [default=true, (help) = "whether to emit an IAM record"];
+		optional double target_clock_period_us = 5  [default=4, (help) = "data clock rate on target disk"];
+		optional bool use_fm = 6            [default=false, (help) = "whether to use FM encoding rather than MFM"];
+		optional int32 idam_byte = 7        [default=0x5554, (help) = "16-bit raw bit pattern of IDAM byte"];
+		optional int32 dam_byte = 8         [default=0x5545, (help) = "16-bit raw bit pattern of DAM byte"];
+		optional int32 gap0 = 9             [default=80, (help) = "size of gap 1 (the post-index gap)"];
+		optional int32 gap1 = 10            [default=50, (help) = "size of gap 2 (the post-ID gap)"];
+		optional int32 gap2 = 11            [default=22, (help) = "size of gap 3 (the pre-data gap)"];
+		optional int32 gap3 = 12            [default=80, (help) = "size of gap 4 (the post-data or format gap)"];
+		optional bool invert_side_byte = 19 [default=false, (help) = "invert the side byte before writing"];
+		optional int32 gap_fill_byte = 18   [default=0x9254, (help) = "16-bit raw bit pattern of gap fill byte"];
+		optional double target_rotational_period_ms = 1 [default=200, (help) = "rotational period of target disk"];
+	}
+
+	repeated TrackdataProto trackdata = 1;
+}
+

arch/macintosh/decoder.cc

@@ -2,10 +2,8 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
-#include "track.h"
 #include "macintosh.h"
 #include "bytes.h"
 #include "fmt/format.h"
@@ -26,7 +24,7 @@ static int decode_data_gcr(uint8_t gcr)
 		#undef GCR_ENTRY
     }
     return -1;
-};
+}
 
 /* This is extremely inspired by the MESS implementation, written by Nathan Woods
  * and R. Belmont: https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp
@@ -118,69 +116,76 @@ static Bytes decode_crazy_data(const Bytes& input, Sector::Status& status)
 uint8_t decode_side(uint8_t side)
 {
     /* Mac disks, being weird, use the side byte to encode both the side (in
-     * bit 5) and also whether we're above track 0x3f (in bit 6).
+     * bit 5) and also whether we're above track 0x3f (in bit 0).
      */
 
-    return !!(side & 0x40);
+    return !!(side & 0x20);
 }
 
-AbstractDecoder::RecordType MacintoshDecoder::advanceToNextRecord()
+class MacintoshDecoder : public Decoder
 {
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
-	if (matcher == &SECTOR_RECORD_PATTERN)
-		return SECTOR_RECORD;
-	if (matcher == &DATA_RECORD_PATTERN)
-		return DATA_RECORD;
-	return UNKNOWN_RECORD;
-}
+public:
+	MacintoshDecoder(const DecoderProto& config):
+		Decoder(config)
+	{}
 
-void MacintoshDecoder::decodeSectorRecord()
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(ANY_RECORD_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		if (readRaw24() != MAC_SECTOR_RECORD)
+			return;
+
+		/* Read header. */
+
+		auto header = toBytes(readRawBits(7*8)).slice(0, 7);
+					
+		uint8_t encodedTrack = decode_data_gcr(header[0]);
+		if (encodedTrack != (_sector->physicalTrack & 0x3f))
+			return;
+					
+		uint8_t encodedSector = decode_data_gcr(header[1]);
+		uint8_t encodedSide = decode_data_gcr(header[2]);
+		uint8_t formatByte = decode_data_gcr(header[3]);
+		uint8_t wantedsum = decode_data_gcr(header[4]);
+
+		if (encodedSector > 11)
+			return;
+
+		_sector->logicalTrack = _sector->physicalTrack;
+		_sector->logicalSide = decode_side(encodedSide);
+		_sector->logicalSector = encodedSector;
+		uint8_t gotsum = (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f;
+		if (wantedsum == gotsum)
+			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+	}
+
+    void decodeDataRecord() override
+	{
+		if (readRaw24() != MAC_DATA_RECORD)
+			return;
+
+		/* Read data. */
+
+		readRawBits(8); /* skip spare byte */
+		auto inputbuffer = toBytes(readRawBits(MAC_ENCODED_SECTOR_LENGTH*8))
+			.slice(0, MAC_ENCODED_SECTOR_LENGTH);
+
+		for (unsigned i=0; i<inputbuffer.size(); i++)
+			inputbuffer[i] = decode_data_gcr(inputbuffer[i]);
+			
+		_sector->status = Sector::BAD_CHECKSUM;
+		Bytes userData = decode_crazy_data(inputbuffer, _sector->status);
+		_sector->data.clear();
+		_sector->data.writer().append(userData.slice(12, 512)).append(userData.slice(0, 12));
+	}
+};
+
+std::unique_ptr<Decoder> createMacintoshDecoder(const DecoderProto& config)
 {
-    /* Skip ID (as we know it's a MAC_SECTOR_RECORD). */
-    readRawBits(24);
-
-    /* Read header. */
-
-    auto header = toBytes(readRawBits(7*8)).slice(0, 7);
-                
-    uint8_t encodedTrack = decode_data_gcr(header[0]);
-    if (encodedTrack != (_track->physicalTrack & 0x3f))
-        return;
-                
-    uint8_t encodedSector = decode_data_gcr(header[1]);
-    uint8_t encodedSide = decode_data_gcr(header[2]);
-    uint8_t formatByte = decode_data_gcr(header[3]);
-    uint8_t wantedsum = decode_data_gcr(header[4]);
-
-    if (encodedSector > 11)
-        return;
-
-    _sector->logicalTrack = _track->physicalTrack;
-    _sector->logicalSide = decode_side(encodedSide);
-    _sector->logicalSector = encodedSector;
-    uint8_t gotsum = (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f;
-    if (wantedsum == gotsum)
-        _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+	return std::unique_ptr<Decoder>(new MacintoshDecoder(config));
 }
 
-void MacintoshDecoder::decodeDataRecord()
-{
-    auto id = toBytes(readRawBits(24)).reader().read_be24();
-    if (id != MAC_DATA_RECORD)
-        return;
-
-    /* Read data. */
-
-    readRawBits(8); /* skip spare byte */
-    auto inputbuffer = toBytes(readRawBits(MAC_ENCODED_SECTOR_LENGTH*8))
-        .slice(0, MAC_ENCODED_SECTOR_LENGTH);
-
-    for (unsigned i=0; i<inputbuffer.size(); i++)
-        inputbuffer[i] = decode_data_gcr(inputbuffer[i]);
-        
-    _sector->status = Sector::BAD_CHECKSUM;
-    Bytes userData = decode_crazy_data(inputbuffer, _sector->status);
-    _sector->data.clear();
-    _sector->data.writer().append(userData.slice(12, 512)).append(userData.slice(0, 12));
-}

arch/macintosh/encoder.cc

@@ -0,0 +1,260 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "macintosh.h"
+#include "crc.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "fmt/format.h"
+#include "lib/encoders/encoders.pb.h"
+#include "lib/layout.h"
+#include "arch/macintosh/macintosh.pb.h"
+#include <ctype.h>
+
+static bool lastBit;
+
+static double clockRateUsForTrack(unsigned track)
+{
+    if (track < 16)
+        return 2.623;
+    if (track < 32)
+        return 2.861;
+    if (track < 48)
+        return 3.148;
+    if (track < 64)
+        return 3.497;
+    return 3.934;
+}
+
+static unsigned sectorsForTrack(unsigned track)
+{
+    if (track < 16)
+        return 12;
+    if (track < 32)
+        return 11;
+    if (track < 48)
+        return 10;
+    if (track < 64)
+        return 9;
+    return 8;
+}
+
+static int encode_data_gcr(uint8_t gcr)
+{
+    switch (gcr)
+    {
+#define GCR_ENTRY(gcr, data) \
+    case data:               \
+        return gcr;
+#include "data_gcr.h"
+#undef GCR_ENTRY
+    }
+    return -1;
+}
+
+/* This is extremely inspired by the MESS implementation, written by Nathan
+ * Woods and R. Belmont:
+ * https://github.com/mamedev/mame/blob/4263a71e64377db11392c458b580c5ae83556bc7/src/lib/formats/ap_dsk35.cpp
+ */
+static Bytes encode_crazy_data(const Bytes& input)
+{
+    Bytes output;
+    ByteWriter bw(output);
+    ByteReader br(input);
+
+    uint8_t w1, w2, w3, w4;
+
+    static const int LOOKUP_LEN = MAC_SECTOR_LENGTH / 3;
+
+    uint8_t b1[LOOKUP_LEN + 1];
+    uint8_t b2[LOOKUP_LEN + 1];
+    uint8_t b3[LOOKUP_LEN + 1];
+
+    uint32_t c1 = 0;
+    uint32_t c2 = 0;
+    uint32_t c3 = 0;
+    for (int j = 0;; j++)
+    {
+        c1 = (c1 & 0xff) << 1;
+        if (c1 & 0x0100)
+            c1++;
+
+        uint8_t val = br.read_8();
+        c3 += val;
+        if (c1 & 0x0100)
+        {
+            c3++;
+            c1 &= 0xff;
+        }
+        b1[j] = (val ^ c1) & 0xff;
+
+        val = br.read_8();
+        c2 += val;
+        if (c3 > 0xff)
+        {
+            c2++;
+            c3 &= 0xff;
+        }
+        b2[j] = (val ^ c3) & 0xff;
+
+        if (br.pos == 524)
+            break;
+
+        val = br.read_8();
+        c1 += val;
+        if (c2 > 0xff)
+        {
+            c1++;
+            c2 &= 0xff;
+        }
+        b3[j] = (val ^ c2) & 0xff;
+    }
+    uint32_t c4 = ((c1 & 0xc0) >> 6) | ((c2 & 0xc0) >> 4) | ((c3 & 0xc0) >> 2);
+    b3[LOOKUP_LEN] = 0;
+
+    for (int i = 0; i <= LOOKUP_LEN; i++)
+    {
+        w1 = b1[i] & 0x3f;
+        w2 = b2[i] & 0x3f;
+        w3 = b3[i] & 0x3f;
+        w4 = ((b1[i] & 0xc0) >> 2);
+        w4 |= ((b2[i] & 0xc0) >> 4);
+        w4 |= ((b3[i] & 0xc0) >> 6);
+
+        bw.write_8(w4);
+        bw.write_8(w1);
+        bw.write_8(w2);
+
+        if (i != LOOKUP_LEN)
+            bw.write_8(w3);
+    }
+
+    bw.write_8(c4 & 0x3f);
+    bw.write_8(c3 & 0x3f);
+    bw.write_8(c2 & 0x3f);
+    bw.write_8(c1 & 0x3f);
+
+    return output;
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+{
+    for (bool bit : src)
+    {
+        if (cursor < bits.size())
+            bits[cursor++] = bit;
+    }
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+{
+    cursor += width;
+    for (int i = 0; i < width; i++)
+    {
+        unsigned pos = cursor - i - 1;
+        if (pos < bits.size())
+            bits[pos] = data & 1;
+        data >>= 1;
+    }
+}
+
+static uint8_t encode_side(uint8_t track, uint8_t side)
+{
+    /* Mac disks, being weird, use the side byte to encode both the side (in
+     * bit 5) and also whether we're above track 0x3f (in bit 0).
+     */
+
+    return (side ? 0x20 : 0x00) | ((track > 0x3f) ? 0x01 : 0x00);
+}
+
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
+{
+    if ((sector->data.size() != 512) && (sector->data.size() != 524))
+        Error() << "unsupported sector size --- you must pick 512 or 524";
+
+    write_bits(bits, cursor, 0xff, 1 * 8); /* pad byte */
+    for (int i = 0; i < 7; i++)
+        write_bits(bits, cursor, 0xff3fcff3fcffLL, 6 * 8); /* sync */
+    write_bits(bits, cursor, MAC_SECTOR_RECORD, 3 * 8);
+
+    uint8_t encodedTrack = sector->logicalTrack & 0x3f;
+    uint8_t encodedSector = sector->logicalSector;
+    uint8_t encodedSide =
+        encode_side(sector->logicalTrack, sector->logicalSide);
+    uint8_t formatByte = MAC_FORMAT_BYTE;
+    uint8_t headerChecksum =
+        (encodedTrack ^ encodedSector ^ encodedSide ^ formatByte) & 0x3f;
+
+    write_bits(bits, cursor, encode_data_gcr(encodedTrack), 1 * 8);
+    write_bits(bits, cursor, encode_data_gcr(encodedSector), 1 * 8);
+    write_bits(bits, cursor, encode_data_gcr(encodedSide), 1 * 8);
+    write_bits(bits, cursor, encode_data_gcr(formatByte), 1 * 8);
+    write_bits(bits, cursor, encode_data_gcr(headerChecksum), 1 * 8);
+
+    write_bits(bits, cursor, 0xdeaaff, 3 * 8);
+    write_bits(bits, cursor, 0xff3fcff3fcffLL, 6 * 8); /* sync */
+    write_bits(bits, cursor, MAC_DATA_RECORD, 3 * 8);
+    write_bits(bits, cursor, encode_data_gcr(sector->logicalSector), 1 * 8);
+
+    Bytes wireData;
+    wireData.writer()
+        .append(sector->data.slice(512, 12))
+        .append(sector->data.slice(0, 512));
+    for (uint8_t b : encode_crazy_data(wireData))
+        write_bits(bits, cursor, encode_data_gcr(b), 1 * 8);
+
+    write_bits(bits, cursor, 0xdeaaff, 3 * 8);
+}
+
+class MacintoshEncoder : public Encoder
+{
+public:
+    MacintoshEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.macintosh())
+    {
+    }
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        double clockRateUs = clockRateUsForTrack(trackInfo->logicalTrack);
+        int bitsPerRevolution = 200000.0 / clockRateUs;
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+        fillBitmapTo(bits,
+            cursor,
+            _config.post_index_gap_us() / clockRateUs,
+            {true, false});
+        lastBit = false;
+
+        for (const auto& sector : sectors)
+            write_sector(bits, cursor, sector);
+
+        if (cursor >= bits.size())
+            Error() << fmt::format(
+                "track data overrun by {} bits", cursor - bits.size());
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(bits,
+            calculatePhysicalClockPeriod(clockRateUs * 1e3, 200e6));
+        return fluxmap;
+    }
+
+private:
+    const MacintoshEncoderProto& _config;
+};
+
+std::unique_ptr<Encoder> createMacintoshEncoder(
+    const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new MacintoshEncoder(config));
+}

arch/macintosh/macintosh.h

@@ -6,19 +6,17 @@
 
 #define MAC_SECTOR_LENGTH   524 /* yes, really */
 #define MAC_ENCODED_SECTOR_LENGTH 703
+#define MAC_FORMAT_BYTE     0x22
 
-class Sector;
-class Fluxmap;
+#define MAC_TRACKS_PER_DISK 80
 
-class MacintoshDecoder : public AbstractDecoder
-{
-public:
-    virtual ~MacintoshDecoder() {}
+class Encoder;
+class Decoder;
+class DecoderProto;
+class EncoderProto;
 
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-    void decodeDataRecord();
-};
+extern std::unique_ptr<Decoder> createMacintoshDecoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createMacintoshEncoder(const EncoderProto& config);
 
 #endif
 

arch/macintosh/macintosh.proto

@@ -0,0 +1,11 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message MacintoshDecoderProto {}
+
+message MacintoshEncoderProto {
+	optional double post_index_gap_us = 1 [default = 0.0,
+		(help) = "post-index gap before first sector header (microseconds)."];
+}
+

arch/micropolis/decoder.cc

@@ -0,0 +1,185 @@
+#include "globals.h"
+#include "fluxmap.h"
+#include "decoders/fluxmapreader.h"
+#include "decoders/decoders.h"
+#include "sector.h"
+#include "micropolis.h"
+#include "bytes.h"
+#include "fmt/format.h"
+#include "lib/decoders/decoders.pb.h"
+
+/* The sector has a preamble of MFM 0x00s and uses 0xFF as a sync pattern.
+ *
+ * 00        00        00        F         F
+ * 0000 0000 0000 0000 0000 0000 0101 0101 0101 0101
+ * A    A    A    A    A    A    5    5    5    5
+ */
+static const FluxPattern SECTOR_SYNC_PATTERN(64, 0xAAAAAAAAAAAA5555LL);
+
+/* Pattern to skip past current SYNC. */
+static const FluxPattern SECTOR_ADVANCE_PATTERN(64, 0xAAAAAAAAAAAAAAAALL);
+
+/* Standard Micropolis checksum.  Adds all bytes, with carry. */
+uint8_t micropolisChecksum(const Bytes& bytes) {
+	ByteReader br(bytes);
+	uint16_t sum = 0;
+	while (!br.eof()) {
+		if (sum > 0xFF) {
+			sum -= 0x100 - 1;
+		}
+		sum += br.read_8();
+	}
+	/* The last carry is ignored */
+	return sum & 0xFF;
+}
+
+/* Vector MZOS does not use the standard Micropolis checksum.
+ * The checksum is initially 0.
+ * For each data byte in the 256-byte payload, rotate left,
+ * carrying bit 7 to bit 0.  XOR with the current checksum.
+ *
+ * Unlike the Micropolis checksum, this does not cover the 12-byte
+ * header (track, sector, 10 OS-specific bytes.)
+ */
+uint8_t mzosChecksum(const Bytes& bytes) {
+	ByteReader br(bytes);
+	uint8_t checksum = 0;
+	uint8_t databyte;
+
+	while (!br.eof()) {
+		databyte = br.read_8();
+	checksum ^= ((databyte << 1) | (databyte >> 7));
+	}
+
+	return checksum;
+}
+
+class MicropolisDecoder : public Decoder
+{
+public:
+	MicropolisDecoder(const DecoderProto& config):
+		Decoder(config),
+		_config(config.micropolis())
+	{
+		_checksumType = _config.checksum_type();
+	}
+
+	nanoseconds_t advanceToNextRecord() override
+	{
+		nanoseconds_t now = tell().ns();
+
+		/* For all but the first sector, seek to the next sector pulse.
+		 * The first sector does not contain the sector pulse in the fluxmap.
+		 */
+		if (now != 0) {
+			seekToIndexMark();
+			now = tell().ns();
+		}
+
+		/* Discard a possible partial sector at the end of the track.
+		 * This partial sector could be mistaken for a conflicted sector, if
+		 * whatever data read happens to match the checksum of 0, which is
+		 * rare, but has been observed on some disks.
+		 */
+		if (now > (getFluxmapDuration() - 12.5e6)) {
+			seekToIndexMark();
+			return 0;
+		}
+
+		nanoseconds_t clock = seekToPattern(SECTOR_SYNC_PATTERN);
+
+		auto syncDelta = tell().ns() - now;
+		/* Due to the weak nature of the Micropolis SYNC patern,
+		 * it's possible to detect a false SYNC during the gap
+		 * between the sector pulse and the write gate.  If the SYNC
+		 * is detected less than 100uS after the sector pulse, search
+		 * for another valid SYNC.
+		 *
+		 * Reference: Vector Micropolis Disk Controller Board Technical
+		 * Information Manual, pp. 1-16.
+		 */
+		if ((syncDelta > 0) && (syncDelta < 100e3)) {
+			seekToPattern(SECTOR_ADVANCE_PATTERN);
+			clock = seekToPattern(SECTOR_SYNC_PATTERN);
+		}
+
+		_sector->headerStartTime = tell().ns();
+
+		/* seekToPattern() can skip past the index hole, if this happens
+		 * too close to the end of the Fluxmap, discard the sector.
+		 */
+		if (_sector->headerStartTime > (getFluxmapDuration() - 12.5e6)) {
+			return 0;
+		}
+
+		return clock;
+	}
+
+	void decodeSectorRecord() override
+	{
+		readRawBits(48);
+		auto rawbits = readRawBits(MICROPOLIS_ENCODED_SECTOR_SIZE*16);
+		auto bytes = decodeFmMfm(rawbits).slice(0, MICROPOLIS_ENCODED_SECTOR_SIZE);
+		ByteReader br(bytes);
+
+		int syncByte = br.read_8();  /* sync */
+		if (syncByte != 0xFF)
+			return;
+
+		_sector->logicalTrack = br.read_8();
+		_sector->logicalSide = _sector->physicalSide;
+		_sector->logicalSector = br.read_8();
+		if (_sector->logicalSector > 15)
+			return;
+		if (_sector->logicalTrack > 76)
+			return;
+		if (_sector->logicalTrack != _sector->physicalTrack)
+			return;
+
+		br.read(10);  /* OS data or padding */
+		auto data = br.read(MICROPOLIS_PAYLOAD_SIZE);
+		uint8_t wantChecksum = br.read_8();
+
+		/* If not specified, automatically determine the checksum type.
+		* Once the checksum type is determined, it will be used for the
+		* entire disk.
+		*/
+		if (_checksumType == MicropolisDecoderProto::AUTO) {
+			/* Calculate both standard Micropolis (MDOS, CP/M, OASIS) and MZOS checksums */
+			if (wantChecksum == micropolisChecksum(bytes.slice(1, 2+266))) {
+				_checksumType = MicropolisDecoderProto::MICROPOLIS;
+			} else if (wantChecksum == mzosChecksum(bytes.slice(MICROPOLIS_HEADER_SIZE, MICROPOLIS_PAYLOAD_SIZE))) {
+				_checksumType = MicropolisDecoderProto::MZOS;
+				std::cout << "Note: MZOS checksum detected." << std::endl;
+			}
+		}
+
+		uint8_t gotChecksum;
+
+		if (_checksumType == MicropolisDecoderProto::MZOS) {
+			gotChecksum = mzosChecksum(bytes.slice(MICROPOLIS_HEADER_SIZE, MICROPOLIS_PAYLOAD_SIZE));
+		} else {
+			gotChecksum = micropolisChecksum(bytes.slice(1, 2+266));
+		}
+
+		br.read(5);  /* 4 byte ECC and ECC-present flag */
+
+		if (_config.sector_output_size() == MICROPOLIS_PAYLOAD_SIZE)
+			_sector->data = data;
+		else if (_config.sector_output_size() == MICROPOLIS_ENCODED_SECTOR_SIZE)
+			_sector->data = bytes;
+		else
+			Error() << "Sector output size may only be 256 or 275";
+		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+
+private:
+	const MicropolisDecoderProto& _config;
+	MicropolisDecoderProto_ChecksumType _checksumType;	/* -1 = auto, 1 = Micropolis, 2=MZOS */
+};
+
+std::unique_ptr<Decoder> createMicropolisDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new MicropolisDecoder(config));
+}
+

arch/micropolis/encoder.cc

@@ -0,0 +1,112 @@
+#include "globals.h"
+#include "micropolis.h"
+#include "sector.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "image.h"
+#include "lib/encoders/encoders.pb.h"
+
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
+{
+    if ((sector->data.size() != 256) &&
+        (sector->data.size() != MICROPOLIS_ENCODED_SECTOR_SIZE))
+        Error() << "unsupported sector size --- you must pick 256 or 275";
+
+    int fullSectorSize = 40 + MICROPOLIS_ENCODED_SECTOR_SIZE + 40 + 35;
+    auto fullSector = std::make_shared<std::vector<uint8_t>>();
+    fullSector->reserve(fullSectorSize);
+    /* sector preamble */
+    for (int i = 0; i < 40; i++)
+        fullSector->push_back(0);
+    Bytes sectorData;
+    if (sector->data.size() == MICROPOLIS_ENCODED_SECTOR_SIZE)
+    {
+        if (sector->data[0] != 0xFF)
+            Error() << "275 byte sector doesn't start with sync byte 0xFF. "
+                       "Corrupted sector";
+        uint8_t wantChecksum = sector->data[1 + 2 + 266];
+        uint8_t gotChecksum =
+            micropolisChecksum(sector->data.slice(1, 2 + 266));
+        if (wantChecksum != gotChecksum)
+            std::cerr << "Warning: checksum incorrect. Sector: "
+                      << sector->logicalSector << std::endl;
+        sectorData = sector->data;
+    }
+    else
+    {
+        ByteWriter writer(sectorData);
+        writer.write_8(0xff); /* Sync */
+        writer.write_8(sector->logicalTrack);
+        writer.write_8(sector->logicalSector);
+        for (int i = 0; i < 10; i++)
+            writer.write_8(0); /* Padding */
+        writer += sector->data;
+        writer.write_8(micropolisChecksum(sectorData.slice(1)));
+        for (int i = 0; i < 5; i++)
+            writer.write_8(0); /* 4 byte ECC and ECC not present flag */
+    }
+    for (uint8_t b : sectorData)
+        fullSector->push_back(b);
+    /* sector postamble */
+    for (int i = 0; i < 40; i++)
+        fullSector->push_back(0);
+    /* filler */
+    for (int i = 0; i < 35; i++)
+        fullSector->push_back(0);
+
+    if (fullSector->size() != fullSectorSize)
+        Error() << "sector mismatched length";
+    bool lastBit = false;
+    encodeMfm(bits, cursor, fullSector, lastBit);
+    /* filler */
+    for (int i = 0; i < 5; i++)
+    {
+        bits[cursor++] = 1;
+        bits[cursor++] = 0;
+    }
+}
+
+class MicropolisEncoder : public Encoder
+{
+public:
+    MicropolisEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.micropolis())
+    {
+    }
+
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        int bitsPerRevolution =
+            (_config.rotational_period_ms() * 1e3) / _config.clock_period_us();
+
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+        for (const auto& sectorData : sectors)
+            write_sector(bits, cursor, sectorData);
+
+        if (cursor != bits.size())
+            Error() << "track data mismatched length";
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(bits,
+            calculatePhysicalClockPeriod(
+                _config.clock_period_us() * 1e3,
+                _config.rotational_period_ms() * 1e6));
+        return fluxmap;
+    }
+
+private:
+    const MicropolisEncoderProto& _config;
+};
+
+std::unique_ptr<Encoder> createMicropolisEncoder(
+    const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new MicropolisEncoder(config));
+}

arch/micropolis/micropolis.h

@@ -0,0 +1,18 @@
+#ifndef MICROPOLIS_H
+#define MICROPOLIS_H
+
+#define MICROPOLIS_PAYLOAD_SIZE         (256)
+#define MICROPOLIS_HEADER_SIZE          (1+2+10)
+#define MICROPOLIS_ENCODED_SECTOR_SIZE  (MICROPOLIS_HEADER_SIZE + MICROPOLIS_PAYLOAD_SIZE + 6)
+
+class Decoder;
+class Encoder;
+class EncoderProto;
+class DecoderProto;
+
+extern std::unique_ptr<Decoder> createMicropolisDecoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createMicropolisEncoder(const EncoderProto& config);
+
+extern uint8_t micropolisChecksum(const Bytes& bytes);
+
+#endif

arch/micropolis/micropolis.proto

@@ -0,0 +1,24 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message MicropolisDecoderProto {
+	enum ChecksumType {
+		AUTO = 0;
+		MICROPOLIS = 1;
+		MZOS = 2;
+	}
+
+	optional int32 sector_output_size = 1 [default = 256,
+		(help) = "How much of the raw sector should be saved. Must be 256 or 275"];
+	optional ChecksumType checksum_type = 2 [default = AUTO,
+		(help) = "Checksum type to use: AUTO, MICROPOLIS, MZOS"];
+}
+
+message MicropolisEncoderProto {
+    optional double clock_period_us = 1
+        [ default = 2.0, (help) = "clock rate on the real device" ];
+    optional double rotational_period_ms = 2
+        [ default = 166.0, (help) = "rotational period on the real device" ];
+}
+

arch/mx/decoder.cc

@@ -5,8 +5,6 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "sector.h"
-#include "record.h"
-#include "track.h"
 #include <string.h>
 
 const int SECTOR_SIZE = 256;
@@ -18,58 +16,71 @@ const int SECTOR_SIZE = 256;
  */
 
 /* FM beginning of track marker:
+ *         0         0         f         3 decoded nibbles
+ *  0 0  0 0  0 0  0 0  1 1  1 1  0 0  1 1
  * 1010 1010 1010 1010 1111 1111 1010 1111
- *    a    a    a    a    f    f    a    f
+ *    a    a    a    a    f    f    a    f encoded nibbles
  */
 const FluxPattern ID_PATTERN(32, 0xaaaaffaf);
 
-void MxDecoder::beginTrack()
+class MxDecoder : public Decoder
 {
-    _currentSector = -1;
-    _clock = 0;
+public:
+	MxDecoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    void beginTrack() override
+	{
+		_clock = _sector->clock = seekToPattern(ID_PATTERN);
+		_currentSector = 0;
+	}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		if (_currentSector == 11)
+		{
+			/* That was the last sector on the disk. */
+			return 0;
+		}
+		else
+			return _clock;
+	}
+
+    void decodeSectorRecord() override
+	{
+		/* Skip the ID pattern and track word, which is only present on the
+		 * first sector. We don't trust the track word because some driver
+		 * don't write it correctly. */
+
+		if (_currentSector == 0)
+			readRawBits(64);
+
+		auto bits = readRawBits((SECTOR_SIZE+2)*16);
+		auto bytes = decodeFmMfm(bits).slice(0, SECTOR_SIZE+2);
+
+		uint16_t gotChecksum = 0;
+		ByteReader br(bytes);
+		for (int i=0; i<(SECTOR_SIZE/2); i++)
+			gotChecksum += br.read_be16();
+		uint16_t wantChecksum = br.read_be16();
+
+		_sector->logicalTrack = _sector->physicalTrack;
+		_sector->logicalSide = _sector->physicalSide;
+		_sector->logicalSector = _currentSector;
+		_sector->data = bytes.slice(0, SECTOR_SIZE).swab();
+		_sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+		_currentSector++;
+	}
+
+private:
+    nanoseconds_t _clock;
+    int _currentSector;
+};
+
+std::unique_ptr<Decoder> createMxDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new MxDecoder(config));
 }
 
-AbstractDecoder::RecordType MxDecoder::advanceToNextRecord()
-{
-    if (_currentSector == -1)
-    {
-        /* First sector in the track: look for the sync marker. */
-        const FluxMatcher* matcher = nullptr;
-        _sector->clock = _clock = _fmr->seekToPattern(ID_PATTERN, matcher);
-        readRawBits(32); /* skip the ID mark */
-        _logicalTrack = decodeFmMfm(readRawBits(32)).reader().read_be16();
-    }
-    else if (_currentSector == 10)
-    {
-        /* That was the last sector on the disk. */
-        return UNKNOWN_RECORD;
-    }
-    else
-    {
-        /* Otherwise we assume the clock from the first sector is still valid.
-         * The decoder framwork will automatically stop when we hit the end of
-         * the track. */
-        _sector->clock = _clock;
-    }
 
-    _currentSector++;
-    return SECTOR_RECORD;
-}
-
-void MxDecoder::decodeSectorRecord()
-{
-    auto bits = readRawBits((SECTOR_SIZE+2)*16);
-    auto bytes = decodeFmMfm(bits).slice(0, SECTOR_SIZE+2).swab();
-
-    uint16_t gotChecksum = 0;
-    ByteReader br(bytes);
-    for (int i=0; i<(SECTOR_SIZE/2); i++)
-        gotChecksum += br.read_le16();
-    uint16_t wantChecksum = br.read_le16();
-
-    _sector->logicalTrack = _logicalTrack;
-    _sector->logicalSide = _track->physicalSide;
-    _sector->logicalSector = _currentSector;
-    _sector->data = bytes.slice(0, SECTOR_SIZE);
-    _sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/mx/mx.h

@@ -3,19 +3,6 @@
 
 #include "decoders/decoders.h"
 
-class MxDecoder : public AbstractDecoder
-{
-public:
-    virtual ~MxDecoder() {}
-
-    void beginTrack();
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-
-private:
-    nanoseconds_t _clock;
-    int _currentSector;
-    int _logicalTrack;
-};
+extern std::unique_ptr<Decoder> createMxDecoder(const DecoderProto& config);
 
 #endif

arch/mx/mx.proto

@@ -0,0 +1,4 @@
+syntax = "proto2";
+
+message MxDecoderProto {}
+

arch/northstar/decoder.cc

@@ -0,0 +1,176 @@
+/* Decoder for North Star 10-sector hard-sectored disks.
+ *
+ * Supports both single- and double-density.  For the sector format and
+ * checksum algorithm, see pp. 33 of the North Star Double Density Controller
+ * manual:
+ *
+ * http://bitsavers.org/pdf/northstar/boards/Northstar_MDS-A-D_1978.pdf
+ *
+ * North Star disks do not contain any track/head/sector information
+ * encoded in the sector record.  For this reason, we have to be absolutely
+ * sure that the hardSectorId is correct.
+ */
+
+#include "globals.h"
+#include "fluxmap.h"
+#include "decoders/fluxmapreader.h"
+#include "decoders/decoders.h"
+#include "sector.h"
+#include "northstar.h"
+#include "bytes.h"
+#include "lib/decoders/decoders.pb.h"
+#include "fmt/format.h"
+
+#define MFM_ID 0xaaaaaaaaaaaa5545LL
+#define FM_ID  0xaaaaaaaaaaaaffefLL
+/*
+ * MFM sectors have 32 bytes of 00's followed by two sync characters,
+ * specified in the North Star MDS manual as 0xFBFB.
+ *
+ * This is true for most disks; however, I found a few disks, including an
+ * original North Star DOS/BASIC v2.2.1 DQ disk) that uses 0xFBnn, where
+ * nn is an incrementing pattern.
+ *
+ * 00        00        00        F         B
+ * 0000 0000 0000 0000 0000 0000 0101 0101 0100 0101
+ * A    A    A    A    A    A    5    5    4    5
+ */
+static const FluxPattern MFM_PATTERN(64, MFM_ID);
+
+/* FM sectors have 16 bytes of 00's followed by 0xFB.
+ * 00        FB
+ * 0000 0000 1111 1111 1110 1111
+ * A    A    F    F    E    F
+ */
+static const FluxPattern FM_PATTERN(64, FM_ID);
+
+const FluxMatchers ANY_SECTOR_PATTERN(
+	{
+		&MFM_PATTERN,
+		&FM_PATTERN,
+	}
+);
+
+/* Checksum is initially 0.
+ * For each data byte, XOR with the current checksum.
+ * Rotate checksum left, carrying bit 7 to bit 0.
+ */
+uint8_t northstarChecksum(const Bytes& bytes) {
+	ByteReader br(bytes);
+	uint8_t checksum = 0;
+
+	while (!br.eof()) {
+		checksum ^= br.read_8();
+		checksum = ((checksum << 1) | ((checksum >> 7)));
+	}
+
+	return checksum;
+}
+
+class NorthstarDecoder : public Decoder
+{
+public:
+	NorthstarDecoder(const DecoderProto& config):
+		Decoder(config),
+		_config(config.northstar())
+	{}
+
+	/* Search for FM or MFM sector record */
+	nanoseconds_t advanceToNextRecord() override
+	{
+		nanoseconds_t now = tell().ns();
+
+		/* For all but the first sector, seek to the next sector pulse.
+		 * The first sector does not contain the sector pulse in the fluxmap.
+		 */
+		if (now != 0) {
+			seekToIndexMark();
+			now = tell().ns();
+		}
+
+		/* Discard a possible partial sector at the end of the track.
+		 * This partial sector could be mistaken for a conflicted sector, if
+		 * whatever data read happens to match the checksum of 0, which is
+		 * rare, but has been observed on some disks.
+		 */
+		if (now > (getFluxmapDuration() - 21e6)) {
+			seekToIndexMark();
+			return 0;
+		}
+
+		int msSinceIndex = std::round(now / 1e6);
+
+		/* Note that the seekToPattern ignores the sector pulses, so if
+		 * a sector is not found for some reason, the seek will advance
+		 * past one or more sector pulses.  For this reason, calculate
+		 * _hardSectorId after the sector header is found.
+		 */
+		nanoseconds_t clock = seekToPattern(ANY_SECTOR_PATTERN);
+		_sector->headerStartTime = tell().ns();
+
+		/* Discard a possible partial sector. */
+		if (_sector->headerStartTime > (getFluxmapDuration() - 21e6)) {
+			return 0;
+		}
+
+		int sectorFoundTimeRaw = std::round(_sector->headerStartTime / 1e6);
+		int sectorFoundTime;
+
+		/* Round time to the nearest 20ms */
+		if ((sectorFoundTimeRaw % 20) < 10) {
+			sectorFoundTime = (sectorFoundTimeRaw / 20) * 20;
+		}
+		else {
+			sectorFoundTime = ((sectorFoundTimeRaw + 20) / 20) * 20;
+		}
+
+		/* Calculate the sector ID based on time since the index */
+		_hardSectorId = (sectorFoundTime / 20) % 10;
+
+		return clock;
+	}
+
+	void decodeSectorRecord() override
+	{
+		uint64_t id = toBytes(readRawBits(64)).reader().read_be64();
+		unsigned recordSize, payloadSize, headerSize;
+
+		if (id == MFM_ID) {
+			recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_DD;
+			payloadSize = NORTHSTAR_PAYLOAD_SIZE_DD;
+			headerSize = NORTHSTAR_HEADER_SIZE_DD;
+		}
+		else {
+			recordSize = NORTHSTAR_ENCODED_SECTOR_SIZE_SD;
+			payloadSize = NORTHSTAR_PAYLOAD_SIZE_SD;
+			headerSize = NORTHSTAR_HEADER_SIZE_SD;
+		}
+
+		auto rawbits = readRawBits(recordSize * 16);
+		auto bytes = decodeFmMfm(rawbits).slice(0, recordSize);
+		ByteReader br(bytes);
+
+		_sector->logicalSide = _sector->physicalSide;
+		_sector->logicalSector = _hardSectorId;
+		_sector->logicalTrack = _sector->physicalTrack;
+
+		if (headerSize == NORTHSTAR_HEADER_SIZE_DD) {
+			br.read_8();	/* MFM second Sync char, usually 0xFB */
+		}
+
+		_sector->data = br.read(payloadSize);
+		uint8_t wantChecksum = br.read_8();
+		uint8_t gotChecksum = northstarChecksum(bytes.slice(headerSize - 1, payloadSize));
+		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+
+private:
+	const NorthstarDecoderProto& _config;
+	uint8_t _hardSectorId;
+};
+
+std::unique_ptr<Decoder> createNorthstarDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new NorthstarDecoder(config));
+}
+

arch/northstar/encoder.cc

@@ -0,0 +1,168 @@
+#include "globals.h"
+#include "northstar.h"
+#include "sector.h"
+#include "bytes.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "image.h"
+#include "lib/encoders/encoders.pb.h"
+
+#define GAP_FILL_SIZE_SD 30
+#define PRE_HEADER_GAP_FILL_SIZE_SD 9
+#define GAP_FILL_SIZE_DD 62
+#define PRE_HEADER_GAP_FILL_SIZE_DD 16
+
+#define GAP1_FILL_BYTE (0x4F)
+#define GAP2_FILL_BYTE (0x4F)
+
+#define TOTAL_SECTOR_BYTES ()
+
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const std::shared_ptr<const Sector>& sector)
+{
+    int preambleSize = 0;
+    int encodedSectorSize = 0;
+    int gapFillSize = 0;
+    int preHeaderGapFillSize = 0;
+
+    bool doubleDensity;
+
+    switch (sector->data.size())
+    {
+        case NORTHSTAR_PAYLOAD_SIZE_SD:
+            preambleSize = NORTHSTAR_PREAMBLE_SIZE_SD;
+            encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_SD +
+                                NORTHSTAR_ENCODED_SECTOR_SIZE_SD +
+                                GAP_FILL_SIZE_SD;
+            gapFillSize = GAP_FILL_SIZE_SD;
+            preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_SD;
+            doubleDensity = false;
+            break;
+        case NORTHSTAR_PAYLOAD_SIZE_DD:
+            preambleSize = NORTHSTAR_PREAMBLE_SIZE_DD;
+            encodedSectorSize = PRE_HEADER_GAP_FILL_SIZE_DD +
+                                NORTHSTAR_ENCODED_SECTOR_SIZE_DD +
+                                GAP_FILL_SIZE_DD;
+            gapFillSize = GAP_FILL_SIZE_DD;
+            preHeaderGapFillSize = PRE_HEADER_GAP_FILL_SIZE_DD;
+            doubleDensity = true;
+            break;
+        default:
+            Error() << "unsupported sector size --- you must pick 256 or 512";
+            break;
+    }
+
+    int fullSectorSize = preambleSize + encodedSectorSize;
+    auto fullSector = std::make_shared<std::vector<uint8_t>>();
+    fullSector->reserve(fullSectorSize);
+
+    /* sector gap after index pulse */
+    for (int i = 0; i < preHeaderGapFillSize; i++)
+        fullSector->push_back(GAP1_FILL_BYTE);
+
+    /* sector preamble */
+    for (int i = 0; i < preambleSize; i++)
+        fullSector->push_back(0);
+
+    Bytes sectorData;
+    if (sector->data.size() == encodedSectorSize)
+        sectorData = sector->data;
+    else
+    {
+        ByteWriter writer(sectorData);
+        writer.write_8(0xFB); /* sync character */
+        if (doubleDensity == true)
+        {
+            writer.write_8(0xFB); /* Double-density has two sync characters */
+        }
+        writer += sector->data;
+        if (doubleDensity == true)
+        {
+            writer.write_8(northstarChecksum(sectorData.slice(2)));
+        }
+        else
+        {
+            writer.write_8(northstarChecksum(sectorData.slice(1)));
+        }
+    }
+    for (uint8_t b : sectorData)
+        fullSector->push_back(b);
+
+    if (sector->logicalSector != 9)
+    {
+        /* sector postamble */
+        for (int i = 0; i < gapFillSize; i++)
+            fullSector->push_back(GAP2_FILL_BYTE);
+
+        if (fullSector->size() != fullSectorSize)
+            Error() << "sector mismatched length (" << sector->data.size()
+                    << ") expected: " << fullSector->size() << " got "
+                    << fullSectorSize;
+    }
+    else
+    {
+        /* sector postamble */
+        for (int i = 0; i < gapFillSize; i++)
+            fullSector->push_back(GAP2_FILL_BYTE);
+    }
+
+    bool lastBit = false;
+
+    if (doubleDensity == true)
+    {
+        encodeMfm(bits, cursor, fullSector, lastBit);
+    }
+    else
+    {
+        encodeFm(bits, cursor, fullSector);
+    }
+}
+
+class NorthstarEncoder : public Encoder
+{
+public:
+    NorthstarEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.northstar())
+    {
+    }
+
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        int bitsPerRevolution = 100000;
+        double clockRateUs = _config.clock_period_us();
+
+        const auto& sector = *sectors.begin();
+        if (sector->data.size() == NORTHSTAR_PAYLOAD_SIZE_SD)
+            bitsPerRevolution /= 2; // FM
+        else
+            clockRateUs /= 2.00;
+
+        std::vector<bool> bits(bitsPerRevolution);
+        unsigned cursor = 0;
+
+        for (const auto& sectorData : sectors)
+            write_sector(bits, cursor, sectorData);
+
+        if (cursor > bits.size())
+            Error() << "track data overrun";
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(bits,
+            calculatePhysicalClockPeriod(
+                clockRateUs * 1e3, _config.rotational_period_ms() * 1e6));
+        return fluxmap;
+    }
+
+private:
+    const NorthstarEncoderProto& _config;
+};
+
+std::unique_ptr<Encoder> createNorthstarEncoder(
+    const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new NorthstarEncoder(config));
+}

arch/northstar/northstar.h

@@ -0,0 +1,35 @@
+#ifndef NORTHSTAR_H
+#define NORTHSTAR_H
+
+/* Northstar floppies are 10-hard sectored disks with a sector format as follows:
+ *
+ * |----------------------------------|
+ * | SYNC Byte  | Payload  | Checksum |
+ * |------------+----------+----------|
+ * | 1 (0xFB)   | 256 (SD) |    1     |
+ * | 2 (0xFBFB) | 512 (DD) |          |
+ * |----------------------------------|
+ *
+ */
+
+#define NORTHSTAR_PREAMBLE_SIZE_SD		(16)
+#define NORTHSTAR_PREAMBLE_SIZE_DD		(32)
+#define NORTHSTAR_HEADER_SIZE_SD		(1)
+#define NORTHSTAR_HEADER_SIZE_DD		(2)
+#define NORTHSTAR_PAYLOAD_SIZE_SD		(256)
+#define NORTHSTAR_PAYLOAD_SIZE_DD		(512)
+#define NORTHSTAR_CHECKSUM_SIZE		(1)
+#define NORTHSTAR_ENCODED_SECTOR_SIZE_SD	(NORTHSTAR_HEADER_SIZE_SD + NORTHSTAR_PAYLOAD_SIZE_SD + NORTHSTAR_CHECKSUM_SIZE)
+#define NORTHSTAR_ENCODED_SECTOR_SIZE_DD	(NORTHSTAR_HEADER_SIZE_DD + NORTHSTAR_PAYLOAD_SIZE_DD + NORTHSTAR_CHECKSUM_SIZE)
+
+class Decoder;
+class Encoder;
+class EncoderProto;
+class DecoderProto;
+
+extern uint8_t northstarChecksum(const Bytes& bytes);
+
+extern std::unique_ptr<Decoder> createNorthstarDecoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createNorthstarEncoder(const EncoderProto& config);
+
+#endif /* NORTHSTAR */

arch/northstar/northstar.proto

@@ -0,0 +1,13 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message NorthstarDecoderProto {}
+
+message NorthstarEncoderProto {
+    optional double clock_period_us = 1
+        [ default = 4.0, (help) = "clock rate on the real device (for FM)" ];
+    optional double rotational_period_ms = 2
+        [ default = 166.0, (help) = "rotational period on the real device" ];
+}
+

arch/smaky6/decoder.cc

@@ -0,0 +1,154 @@
+#include "globals.h"
+#include "fluxmap.h"
+#include "decoders/fluxmapreader.h"
+#include "protocol.h"
+#include "decoders/decoders.h"
+#include "sector.h"
+#include "smaky6.h"
+#include "bytes.h"
+#include "crc.h"
+#include "fmt/format.h"
+#include "lib/decoders/decoders.pb.h"
+#include <string.h>
+#include <algorithm>
+
+static const FluxPattern SECTOR_PATTERN(32, 0x54892aaa);
+
+class Smaky6Decoder : public Decoder
+{
+public:
+    Smaky6Decoder(const DecoderProto& config):
+        Decoder(config),
+        _config(config.smaky6())
+    {
+    }
+
+private:
+    /* Returns the sector ID of the _current_ sector. */
+    int advanceToNextSector()
+    {
+        auto previous = tell();
+        seekToIndexMark();
+        auto now = tell();
+        if ((now.ns() - previous.ns()) < 9e6)
+        {
+            seekToIndexMark();
+            auto next = tell();
+            if ((next.ns() - now.ns()) < 9e6)
+            {
+                /* We just found sector 0. */
+
+                _sectorId = 0;
+            }
+            else
+            {
+                /* Spurious... */
+
+                seek(now);
+            }
+        }
+
+        return _sectorId++;
+    }
+
+public:
+    void beginTrack() override
+    {
+        /* Find the start-of-track index marks, which will be an interval
+         * of about 6ms. */
+
+        seekToIndexMark();
+        _sectorId = 99;
+        for (;;)
+        {
+            auto pos = tell();
+            advanceToNextSector();
+            if (_sectorId < 99)
+            {
+                seek(pos);
+                break;
+            }
+
+            if (eof())
+                return;
+        }
+
+        /* Now we know where to start counting, start finding sectors. */
+
+        _sectorStarts.clear();
+        for (;;)
+        {
+            auto now = tell();
+            if (eof())
+                break;
+
+            int id = advanceToNextSector();
+            if (id < 16)
+                _sectorStarts.push_back(std::make_pair(id, now));
+        }
+
+        _sectorIndex = 0;
+    }
+
+    nanoseconds_t advanceToNextRecord() override
+    {
+        if (_sectorIndex == _sectorStarts.size())
+        {
+            seekToIndexMark();
+            return 0;
+        }
+
+        const auto& p = _sectorStarts[_sectorIndex++];
+        _sectorId = p.first;
+        seek(p.second);
+
+        nanoseconds_t clock = seekToPattern(SECTOR_PATTERN);
+        _sector->headerStartTime = tell().ns();
+
+        return clock;
+    }
+
+    void decodeSectorRecord() override
+    {
+        readRawBits(33);
+        const auto& rawbits = readRawBits(SMAKY6_RECORD_SIZE * 16);
+        if (rawbits.size() < SMAKY6_SECTOR_SIZE)
+            return;
+        const auto& rawbytes =
+            toBytes(rawbits).slice(0, SMAKY6_RECORD_SIZE * 16);
+
+        /* The Smaky bytes are stored backwards! Backwards! */
+
+        const auto& bytes =
+            decodeFmMfm(rawbits).slice(0, SMAKY6_RECORD_SIZE).reverseBits();
+        ByteReader br(bytes);
+
+        uint8_t track = br.read_8();
+        Bytes data = br.read(SMAKY6_SECTOR_SIZE);
+        uint8_t wantedChecksum = br.read_8();
+        uint8_t gotChecksum = sumBytes(data) & 0xff;
+
+        if (track != _sector->physicalTrack)
+            return;
+
+        _sector->logicalTrack = _sector->physicalTrack;
+        _sector->logicalSide = _sector->physicalSide;
+        _sector->logicalSector = _sectorId;
+
+        _sector->data = data;
+        _sector->status =
+            (wantedChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+    }
+
+private:
+    const Smaky6DecoderProto& _config;
+    nanoseconds_t _startOfTrack;
+    std::vector<std::pair<int, Fluxmap::Position>> _sectorStarts;
+    int _sectorId;
+    int _sectorIndex;
+};
+
+std::unique_ptr<Decoder> createSmaky6Decoder(const DecoderProto& config)
+{
+    return std::unique_ptr<Decoder>(new Smaky6Decoder(config));
+}

arch/smaky6/smaky6.h

@@ -0,0 +1,10 @@
+#ifndef SMAKY6_H
+#define SMAKY6_H
+
+#define SMAKY6_SECTOR_SIZE 256
+#define SMAKY6_RECORD_SIZE (1 + SMAKY6_SECTOR_SIZE + 1)
+
+extern std::unique_ptr<Decoder> createSmaky6Decoder(const DecoderProto& config);
+
+#endif
+

arch/smaky6/smaky6.proto

@@ -0,0 +1,6 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message Smaky6DecoderProto {}
+

arch/tids990/decoder.cc

@@ -0,0 +1,98 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "tids990/tids990.h"
+#include "crc.h"
+#include "fluxmap.h"
+#include "decoders/fluxmapreader.h"
+#include "sector.h"
+#include <string.h>
+#include <fmt/format.h>
+
+/* The Texas Instruments DS990 uses MFM with a scheme similar to a simplified
+ * version of the IBM record scheme (it's actually easier to parse than IBM).
+ * There are 26 sectors per track, each holding a rather weird 288 bytes.
+ */
+
+/*
+ * Sector record:
+ * data:    0  1  0  1  0  1  0  1 .0  0  0  0  1  0  1  0  = 0x550a
+ * mfm:     00 01 00 01 00 01 00 01.00 10 10 10 01 00 01 00 = 0x11112a44
+ * special: 00 01 00 01 00 01 00 01.00 10 00 10 01 00 01 00 = 0x11112244
+ *                                        ^^
+ * When shifted out of phase, the special 0xa1 byte becomes an illegal
+ * encoding (you can't do 10 00). So this can't be spoofed by user data.
+ */
+const uint16_t SECTOR_ID = 0x550a;
+const FluxPattern SECTOR_RECORD_PATTERN(32, 0x11112244);
+
+/*
+ * Data record:
+ * data:    0  1  0  1  0  1  0  1 .0  0  0  0  1  0  1  1  = 0x550b
+ * mfm:     00 01 00 01 00 01 00 01.00 10 10 10 01 00 01 01 = 0x11112a45
+ * special: 00 01 00 01 00 01 00 01.00 10 00 10 01 00 01 01 = 0x11112245
+ *                                        ^^
+ * When shifted out of phase, the special 0xa1 byte becomes an illegal
+ * encoding (you can't do 10 00). So this can't be spoofed by user data.
+ */
+const uint16_t DATA_ID = 0x550b;
+const FluxPattern DATA_RECORD_PATTERN(32, 0x11112245);
+
+const FluxMatchers ANY_RECORD_PATTERN({ &SECTOR_RECORD_PATTERN, &DATA_RECORD_PATTERN });
+
+class Tids990Decoder : public Decoder
+{
+public:
+	Tids990Decoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(ANY_RECORD_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		auto bits = readRawBits(TIDS990_SECTOR_RECORD_SIZE*16);
+		auto bytes = decodeFmMfm(bits).slice(0, TIDS990_SECTOR_RECORD_SIZE);
+
+		ByteReader br(bytes);
+		if (br.read_be16() != SECTOR_ID)
+			return;
+
+		uint16_t gotChecksum = crc16(CCITT_POLY, bytes.slice(1, TIDS990_SECTOR_RECORD_SIZE-3));
+
+		_sector->logicalSide = br.read_8() >> 3;
+		_sector->logicalTrack = br.read_8();
+		br.read_8(); /* number of sectors per track */
+		_sector->logicalSector = br.read_8();
+		br.read_be16(); /* sector size */
+		uint16_t wantChecksum = br.read_be16();
+
+		if (wantChecksum == gotChecksum)
+			_sector->status = Sector::DATA_MISSING; /* correct but unintuitive */
+	}
+
+	void decodeDataRecord() override
+	{
+		auto bits = readRawBits(TIDS990_DATA_RECORD_SIZE*16);
+		auto bytes = decodeFmMfm(bits).slice(0, TIDS990_DATA_RECORD_SIZE);
+
+		ByteReader br(bytes);
+		if (br.read_be16() != DATA_ID)
+			return;
+
+		uint16_t gotChecksum = crc16(CCITT_POLY, bytes.slice(1, TIDS990_DATA_RECORD_SIZE-3));
+
+		_sector->data = br.read(TIDS990_PAYLOAD_SIZE);
+		uint16_t wantChecksum = br.read_be16();
+		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+};
+
+std::unique_ptr<Decoder> createTids990Decoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new Tids990Decoder(config));
+}
+

arch/tids990/encoder.cc

@@ -0,0 +1,152 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "tids990.h"
+#include "crc.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "arch/tids990/tids990.pb.h"
+#include "lib/encoders/encoders.pb.h"
+#include <fmt/format.h>
+
+static int charToInt(char c)
+{
+    if (isdigit(c))
+        return c - '0';
+    return 10 + tolower(c) - 'a';
+}
+
+static uint8_t decodeUint16(uint16_t raw)
+{
+    Bytes b;
+    ByteWriter bw(b);
+    bw.write_be16(raw);
+    return decodeFmMfm(b.toBits())[0];
+}
+
+class Tids990Encoder : public Encoder
+{
+public:
+    Tids990Encoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.tids990())
+    {
+    }
+
+private:
+    void writeRawBits(uint32_t data, int width)
+    {
+        _cursor += width;
+        _lastBit = data & 1;
+        for (int i = 0; i < width; i++)
+        {
+            unsigned pos = _cursor - i - 1;
+            if (pos < _bits.size())
+                _bits[pos] = data & 1;
+            data >>= 1;
+        }
+    }
+
+    void writeBytes(const Bytes& bytes)
+    {
+        encodeMfm(_bits, _cursor, bytes, _lastBit);
+    }
+
+    void writeBytes(int count, uint8_t byte)
+    {
+        Bytes bytes = {byte};
+        for (int i = 0; i < count; i++)
+            writeBytes(bytes);
+    }
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        double clockRateUs = _config.clock_period_us() / 2.0;
+        int bitsPerRevolution =
+            (_config.rotational_period_ms() * 1000.0) / clockRateUs;
+        _bits.resize(bitsPerRevolution);
+        _cursor = 0;
+
+        uint8_t am1Unencoded = decodeUint16(_config.am1_byte());
+        uint8_t am2Unencoded = decodeUint16(_config.am2_byte());
+
+        writeBytes(_config.gap1_bytes(), 0x55);
+
+        bool first = true;
+        for (const auto& sectorData : sectors)
+        {
+            if (!first)
+                writeBytes(_config.gap3_bytes(), 0x55);
+            first = false;
+
+            /* Writing the sector and data records are fantastically annoying.
+             * The CRC is calculated from the *very start* of the record, and
+             * include the malformed marker bytes. Our encoder doesn't know
+             * about this, of course, with the result that we have to construct
+             * the unencoded header, calculate the checksum, and then use the
+             * same logic to emit the bytes which require special encoding
+             * before encoding the rest of the header normally. */
+
+            {
+                Bytes header;
+                ByteWriter bw(header);
+
+                writeBytes(12, 0x55);
+                bw.write_8(am1Unencoded);
+                bw.write_8(sectorData->logicalSide << 3);
+                bw.write_8(sectorData->logicalTrack);
+                bw.write_8(_config.sector_count());
+                bw.write_8(sectorData->logicalSector);
+                bw.write_be16(sectorData->data.size());
+                uint16_t crc = crc16(CCITT_POLY, header);
+                bw.write_be16(crc);
+
+                writeRawBits(_config.am1_byte(), 16);
+                writeBytes(header.slice(1));
+            }
+
+            writeBytes(_config.gap2_bytes(), 0x55);
+
+            {
+                Bytes data;
+                ByteWriter bw(data);
+
+                writeBytes(12, 0x55);
+                bw.write_8(am2Unencoded);
+
+                bw += sectorData->data;
+                uint16_t crc = crc16(CCITT_POLY, data);
+                bw.write_be16(crc);
+
+                writeRawBits(_config.am2_byte(), 16);
+                writeBytes(data.slice(1));
+            }
+        }
+
+        if (_cursor >= _bits.size())
+            Error() << "track data overrun";
+        while (_cursor < _bits.size())
+            writeBytes(1, 0x55);
+
+        auto fluxmap = std::make_unique<Fluxmap>();
+        fluxmap->appendBits(_bits,
+            calculatePhysicalClockPeriod(clockRateUs * 1e3,
+                _config.rotational_period_ms() * 1e6));
+        return fluxmap;
+    }
+
+private:
+    const Tids990EncoderProto& _config;
+    std::vector<bool> _bits;
+    unsigned _cursor;
+    bool _lastBit;
+};
+
+std::unique_ptr<Encoder> createTids990Encoder(
+    const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new Tids990Encoder(config));
+}

arch/tids990/tids990.h

@@ -0,0 +1,18 @@
+#ifndef TIDS990_H
+#define TIDS990_H
+
+#define TIDS990_PAYLOAD_SIZE       288 /* bytes */
+#define TIDS990_SECTOR_RECORD_SIZE 10 /* bytes */
+#define TIDS990_DATA_RECORD_SIZE   (TIDS990_PAYLOAD_SIZE + 4) /* bytes */
+
+class Encoder;
+class Decoder;
+class DecoderProto;
+class EncoderProto;
+
+extern std::unique_ptr<Decoder> createTids990Decoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createTids990Encoder(const EncoderProto& config);
+
+#endif
+
+

arch/tids990/tids990.proto

@@ -0,0 +1,25 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message Tids990DecoderProto {}
+
+message Tids990EncoderProto {
+	optional double rotational_period_ms = 1 [ default = 166,
+		(help) = "length of a track" ];
+	optional int32 sector_count = 2 [ default = 26,
+		(help) = "number of sectors per track" ];
+	optional double clock_period_us = 3 [ default = 2,
+		(help) = "clock rate of data to write" ];
+	optional int32 am1_byte = 4 [ default = 0x2244,
+		(help) = "16-bit RAW bit pattern to use for the AM1 ID byte" ];
+	optional int32 am2_byte = 5 [ default = 0x2245,
+		(help) = "16-bit RAW bit pattern to use for the AM2 ID byte" ];
+	optional int32 gap1_bytes = 6 [ default = 80,
+		(help) = "size of gap 1 (the post-index gap)" ];
+	optional int32 gap2_bytes = 7 [ default = 21,
+		(help) = "size of gap 2 (the post-ID gap)" ];
+	optional int32 gap3_bytes = 8 [ default = 51,
+		(help) = "size of gap 3 (the post-data or format gap)" ];
+}
+

arch/victor9k/decoder.cc

@@ -2,13 +2,11 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "victor9k.h"
 #include "crc.h"
 #include "bytes.h"
-#include "track.h"
 #include "fmt/format.h"
 #include <string.h>
 #include <algorithm>
@@ -27,7 +25,7 @@ static int decode_data_gcr(uint8_t gcr)
 		#undef GCR_ENTRY
     }
     return -1;
-};
+}
 
 static Bytes decode(const std::vector<bool>& bits)
 {
@@ -54,58 +52,66 @@ static Bytes decode(const std::vector<bool>& bits)
     return output;
 }
 
-AbstractDecoder::RecordType Victor9kDecoder::advanceToNextRecord()
+class Victor9kDecoder : public Decoder
 {
-	const FluxMatcher* matcher = nullptr;
-	_sector->clock = _fmr->seekToPattern(ANY_RECORD_PATTERN, matcher);
-	if (matcher == &SECTOR_RECORD_PATTERN)
-		return SECTOR_RECORD;
-	if (matcher == &DATA_RECORD_PATTERN)
-		return DATA_RECORD;
-	return UNKNOWN_RECORD;
+public:
+	Victor9kDecoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		return seekToPattern(ANY_RECORD_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		/* Check the ID. */
+
+		if (readRaw32() != VICTOR9K_SECTOR_RECORD)
+			return;
+
+		/* Read header. */
+
+		auto bytes = decode(readRawBits(3*10)).slice(0, 3);
+
+		uint8_t rawTrack = bytes[0];
+		_sector->logicalSector = bytes[1];
+		uint8_t gotChecksum = bytes[2];
+
+		_sector->logicalTrack = rawTrack & 0x7f;
+		_sector->logicalSide = rawTrack >> 7;
+		uint8_t wantChecksum = bytes[0] + bytes[1];
+		if ((_sector->logicalSector > 20) || (_sector->logicalTrack > 85) || (_sector->logicalSide > 1))
+			return;
+					
+		if (wantChecksum == gotChecksum)
+			_sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
+	}
+
+    void decodeDataRecord() override
+	{
+		/* Check the ID. */
+
+		if (readRaw32() != VICTOR9K_DATA_RECORD)
+			return;
+
+		/* Read data. */
+
+		auto bytes = decode(readRawBits((VICTOR9K_SECTOR_LENGTH+4)*10))
+			.slice(0, VICTOR9K_SECTOR_LENGTH+4);
+		ByteReader br(bytes);
+
+		_sector->data = br.read(VICTOR9K_SECTOR_LENGTH);
+		uint16_t gotChecksum = sumBytes(_sector->data);
+		uint16_t wantChecksum = br.read_le16();
+		_sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+};
+
+std::unique_ptr<Decoder> createVictor9kDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new Victor9kDecoder(config));
 }
 
-void Victor9kDecoder::decodeSectorRecord()
-{
-    /* Skip the sync marker bit. */
-    readRawBits(23);
 
-    /* Read header. */
-
-    auto bytes = decode(readRawBits(4*10)).slice(0, 4);
-
-    uint8_t rawTrack = bytes[1];
-    _sector->logicalSector = bytes[2];
-    uint8_t gotChecksum = bytes[3];
-
-    _sector->logicalTrack = rawTrack & 0x7f;
-    _sector->logicalSide = rawTrack >> 7;
-    uint8_t wantChecksum = bytes[1] + bytes[2];
-    if ((_sector->logicalSector > 20) || (_sector->logicalTrack > 85) || (_sector->logicalSide > 1))
-        return;
-                
-    if (wantChecksum == gotChecksum)
-        _sector->status = Sector::DATA_MISSING; /* unintuitive but correct */
-}
-
-void Victor9kDecoder::decodeDataRecord()
-{
-    /* Skip the sync marker bit. */
-    readRawBits(23);
-
-    /* Read data. */
-
-    auto bytes = decode(readRawBits((VICTOR9K_SECTOR_LENGTH+5)*10))
-        .slice(0, VICTOR9K_SECTOR_LENGTH+5);
-    ByteReader br(bytes);
-
-    /* Check that this is actually a data record. */
-    
-    if (br.read_8() != 8)
-        return;
-
-    _sector->data = br.read(VICTOR9K_SECTOR_LENGTH);
-    uint16_t gotChecksum = sumBytes(_sector->data);
-    uint16_t wantChecksum = br.read_le16();
-    _sector->status = (gotChecksum == wantChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/victor9k/encoder.cc

@@ -0,0 +1,211 @@
+#include "globals.h"
+#include "decoders/decoders.h"
+#include "encoders/encoders.h"
+#include "victor9k.h"
+#include "crc.h"
+#include "sector.h"
+#include "readerwriter.h"
+#include "image.h"
+#include "fmt/format.h"
+#include "arch/victor9k/victor9k.pb.h"
+#include "lib/encoders/encoders.pb.h"
+#include "lib/layout.h"
+#include <ctype.h>
+#include "bytes.h"
+
+static bool lastBit;
+
+static void write_zero_bits(
+    std::vector<bool>& bits, unsigned& cursor, unsigned count)
+{
+    while (count--)
+    {
+        if (cursor < bits.size())
+            lastBit = bits[cursor++] = 0;
+    }
+}
+
+static void write_one_bits(
+    std::vector<bool>& bits, unsigned& cursor, unsigned count)
+{
+    while (count--)
+    {
+        if (cursor < bits.size())
+            lastBit = bits[cursor++] = 1;
+    }
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const std::vector<bool>& src)
+{
+    for (bool bit : src)
+    {
+        if (cursor < bits.size())
+            lastBit = bits[cursor++] = bit;
+    }
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, uint64_t data, int width)
+{
+    cursor += width;
+    lastBit = data & 1;
+    for (int i = 0; i < width; i++)
+    {
+        unsigned pos = cursor - i - 1;
+        if (pos < bits.size())
+            bits[pos] = data & 1;
+        data >>= 1;
+    }
+}
+
+static void write_bits(
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
+{
+    ByteReader br(bytes);
+    BitReader bitr(br);
+
+    while (!bitr.eof())
+    {
+        if (cursor < bits.size())
+            bits[cursor++] = bitr.get();
+    }
+}
+
+static int encode_data_gcr(uint8_t data)
+{
+    switch (data & 0x0f)
+    {
+#define GCR_ENTRY(gcr, data) \
+    case data:               \
+        return gcr;
+#include "data_gcr.h"
+#undef GCR_ENTRY
+    }
+    return -1;
+}
+
+static void write_byte(std::vector<bool>& bits, unsigned& cursor, uint8_t b)
+{
+    write_bits(bits, cursor, encode_data_gcr(b >> 4), 5);
+    write_bits(bits, cursor, encode_data_gcr(b), 5);
+}
+
+static void write_bytes(
+    std::vector<bool>& bits, unsigned& cursor, const Bytes& bytes)
+{
+    for (uint8_t b : bytes)
+        write_byte(bits, cursor, b);
+}
+
+static void write_gap(std::vector<bool>& bits, unsigned& cursor, int length)
+{
+    for (int i = 0; i < length / 10; i++)
+        write_byte(bits, cursor, '0');
+}
+
+static void write_sector(std::vector<bool>& bits,
+    unsigned& cursor,
+    const Victor9kEncoderProto::TrackdataProto& trackdata,
+    const Sector& sector)
+{
+    write_one_bits(bits, cursor, trackdata.pre_header_sync_bits());
+    write_bits(bits, cursor, VICTOR9K_SECTOR_RECORD, 10);
+
+    uint8_t encodedTrack = sector.logicalTrack | (sector.logicalSide << 7);
+    uint8_t encodedSector = sector.logicalSector;
+    write_bytes(bits,
+        cursor,
+        Bytes{
+            encodedTrack,
+            encodedSector,
+            (uint8_t)(encodedTrack + encodedSector),
+        });
+
+    write_gap(bits, cursor, trackdata.post_header_gap_bits());
+
+    write_one_bits(bits, cursor, trackdata.pre_data_sync_bits());
+    write_bits(bits, cursor, VICTOR9K_DATA_RECORD, 10);
+
+    write_bytes(bits, cursor, sector.data);
+
+    Bytes checksum(2);
+    checksum.writer().write_le16(sumBytes(sector.data));
+    write_bytes(bits, cursor, checksum);
+    write_gap(bits, cursor, trackdata.post_data_gap_bits());
+}
+
+class Victor9kEncoder : public Encoder
+{
+public:
+    Victor9kEncoder(const EncoderProto& config):
+        Encoder(config),
+        _config(config.victor9k())
+    {
+    }
+
+private:
+    void getTrackFormat(Victor9kEncoderProto::TrackdataProto& trackdata,
+        unsigned track,
+        unsigned head)
+    {
+        trackdata.Clear();
+        for (const auto& f : _config.trackdata())
+        {
+            if (f.has_min_track() && (track < f.min_track()))
+                continue;
+            if (f.has_max_track() && (track > f.max_track()))
+                continue;
+            if (f.has_head() && (head != f.head()))
+                continue;
+
+            trackdata.MergeFrom(f);
+        }
+    }
+
+public:
+    std::unique_ptr<Fluxmap> encode(std::shared_ptr<const TrackInfo>& trackInfo,
+        const std::vector<std::shared_ptr<const Sector>>& sectors,
+        const Image& image) override
+    {
+        Victor9kEncoderProto::TrackdataProto trackdata;
+        getTrackFormat(trackdata, trackInfo->logicalTrack, trackInfo->logicalSide);
+
+        unsigned bitsPerRevolution = (trackdata.rotational_period_ms() * 1e3) /
+                                     trackdata.clock_period_us();
+        std::vector<bool> bits(bitsPerRevolution);
+        nanoseconds_t clockPeriod = calculatePhysicalClockPeriod(
+            trackdata.clock_period_us() * 1e3,
+            trackdata.rotational_period_ms() * 1e6);
+        unsigned cursor = 0;
+
+        fillBitmapTo(bits,
+            cursor,
+            trackdata.post_index_gap_us() * 1e3 / clockPeriod,
+            {true, false});
+        lastBit = false;
+
+        for (const auto& sector : sectors)
+            write_sector(bits, cursor, trackdata, *sector);
+
+        if (cursor >= bits.size())
+            Error() << fmt::format(
+                "track data overrun by {} bits", cursor - bits.size());
+        fillBitmapTo(bits, cursor, bits.size(), {true, false});
+
+        std::unique_ptr<Fluxmap> fluxmap(new Fluxmap);
+        fluxmap->appendBits(bits, clockPeriod);
+        return fluxmap;
+    }
+
+private:
+    const Victor9kEncoderProto& _config;
+};
+
+std::unique_ptr<Encoder> createVictor9kEncoder(
+    const EncoderProto& config)
+{
+    return std::unique_ptr<Encoder>(new Victor9kEncoder(config));
+}
+
+// vim: sw=4 ts=4 et

arch/victor9k/victor9k.h

@@ -1,22 +1,24 @@
 #ifndef VICTOR9K_H
 #define VICTOR9K_H
 
-#define VICTOR9K_SECTOR_RECORD 0xfffffeab
-#define VICTOR9K_DATA_RECORD   0xfffffea4
+class Encoder;
+class Decoder;
+class EncoderProto;
+class DecoderProto;
+
+/* ... 1101 0101 0111
+ *       ^^ ^^^^ ^^^^ ten bit IO byte */
+#define VICTOR9K_SECTOR_RECORD 0xfffffd57
+#define VICTOR9K_HEADER_ID 0x7
+
+/* ... 1101 0100 1001
+ *       ^^ ^^^^ ^^^^ ten bit IO byte */
+#define VICTOR9K_DATA_RECORD   0xfffffd49
+#define VICTOR9K_DATA_ID 0x8
 
 #define VICTOR9K_SECTOR_LENGTH 512
 
-class Sector;
-class Fluxmap;
-
-class Victor9kDecoder : public AbstractDecoder
-{
-public:
-    virtual ~Victor9kDecoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-    void decodeDataRecord();
-};
+extern std::unique_ptr<Decoder> createVictor9kDecoder(const DecoderProto& config);
+extern std::unique_ptr<Encoder> createVictor9kEncoder(const EncoderProto& config);
 
 #endif

arch/victor9k/victor9k.proto

@@ -0,0 +1,36 @@
+syntax = "proto2";
+
+import "lib/common.proto";
+
+message Victor9kDecoderProto {}
+
+// NEXT: 12
+message Victor9kEncoderProto
+{
+    message TrackdataProto
+    {
+        optional int32 min_track = 1
+            [ (help) = "minimum track this format applies to" ];
+        optional int32 max_track = 2
+            [ (help) = "maximum track this format applies to" ];
+        optional int32 head = 3
+            [ (help) = "which head this format applies to" ];
+
+        optional double rotational_period_ms = 4
+            [ (help) = "original rotational period of this track" ];
+        optional double clock_period_us = 5
+            [ (help) = "original data rate of this track" ];
+        optional double post_index_gap_us = 6
+            [ (help) = "size of post-index gap" ];
+        optional int32 pre_header_sync_bits = 10
+            [ (help) = "number of sync bits before the sector header" ];
+        optional int32 pre_data_sync_bits = 8
+            [ (help) = "number of sync bits before the sector data" ];
+        optional int32 post_data_gap_bits = 9
+            [ (help) = "size of gap between data and the next header" ];
+        optional int32 post_header_gap_bits = 11
+            [ (help) = "size of gap between header and the data" ];
+    }
+
+    repeated TrackdataProto trackdata = 1;
+}

arch/zilogmcz/decoder.cc

@@ -2,7 +2,6 @@
 #include "fluxmap.h"
 #include "decoders/fluxmapreader.h"
 #include "protocol.h"
-#include "record.h"
 #include "decoders/decoders.h"
 #include "sector.h"
 #include "zilogmcz.h"
@@ -14,35 +13,45 @@
 
 static const FluxPattern SECTOR_START_PATTERN(16, 0xaaab);
 
-AbstractDecoder::RecordType ZilogMczDecoder::advanceToNextRecord()
+class ZilogMczDecoder : public Decoder
 {
-	const FluxMatcher* matcher = nullptr;
-    _fmr->seekToIndexMark();
-	_sector->clock = _fmr->seekToPattern(SECTOR_START_PATTERN, matcher);
-	if (matcher == &SECTOR_START_PATTERN)
-		return SECTOR_RECORD;
-	return UNKNOWN_RECORD;
+public:
+	ZilogMczDecoder(const DecoderProto& config):
+		Decoder(config)
+	{}
+
+    nanoseconds_t advanceToNextRecord() override
+	{
+		seekToIndexMark();
+		return seekToPattern(SECTOR_START_PATTERN);
+	}
+
+    void decodeSectorRecord() override
+	{
+		readRawBits(14);
+
+		auto rawbits = readRawBits(140*16);
+		auto bytes = decodeFmMfm(rawbits).slice(0, 140);
+		ByteReader br(bytes);
+
+		_sector->logicalSector = br.read_8() & 0x1f;
+		_sector->logicalSide = 0;
+		_sector->logicalTrack = br.read_8() & 0x7f;
+		if (_sector->logicalSector > 31)
+			return;
+		if (_sector->logicalTrack > 80)
+			return;
+
+		_sector->data = br.read(132);
+		uint16_t wantChecksum = br.read_be16();
+		uint16_t gotChecksum = crc16(MODBUS_POLY, 0x0000, bytes.slice(0, 134));
+
+		_sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
+	}
+};
+
+std::unique_ptr<Decoder> createZilogMczDecoder(const DecoderProto& config)
+{
+	return std::unique_ptr<Decoder>(new ZilogMczDecoder(config));
 }
 
-void ZilogMczDecoder::decodeSectorRecord()
-{
-    readRawBits(14);
-
-    auto rawbits = readRawBits(140*16);
-    auto bytes = decodeFmMfm(rawbits).slice(0, 140);
-    ByteReader br(bytes);
-
-    _sector->logicalSector = br.read_8() & 0x1f;
-    _sector->logicalSide = 0;
-    _sector->logicalTrack = br.read_8() & 0x7f;
-    if (_sector->logicalSector > 31)
-        return;
-    if (_sector->logicalTrack > 80)
-        return;
-
-    _sector->data = br.read(132);
-    uint16_t wantChecksum = br.read_be16();
-    uint16_t gotChecksum = crc16(MODBUS_POLY, 0x0000, bytes.slice(0, 134));
-
-    _sector->status = (wantChecksum == gotChecksum) ? Sector::OK : Sector::BAD_CHECKSUM;
-}

arch/zilogmcz/zilogmcz.h

@@ -1,17 +1,7 @@
 #ifndef ZILOGMCZ_H
 #define ZILOGMCZ_H
 
-class Sector;
-class Fluxmap;
-
-class ZilogMczDecoder : public AbstractDecoder
-{
-public:
-    virtual ~ZilogMczDecoder() {}
-
-    RecordType advanceToNextRecord();
-    void decodeSectorRecord();
-};
+extern std::unique_ptr<Decoder> createZilogMczDecoder(const DecoderProto& config);
 
 #endif
 

arch/zilogmcz/zilogmcz.proto

@@ -0,0 +1,4 @@
+syntax = "proto2";
+
+message ZilogMczDecoderProto {}
+

build.lua

@@ -0,0 +1,192 @@
+vars.cflags = { "$(CFLAGS)" }
+vars.cxxflags = { "$(CXXFLAGS)" }
+vars.ldflags = { "-pthread" }
+
+include "build/protobuf.lua"
+include "build/dependency.lua"
+include "build/tests.lua"
+
+dependency {
+	name = "fmt_dep",
+	pkg_config = "fmt",
+}
+
+dependency {
+	name = "stb_dep",
+	pkg_config = "stb",
+	fallback = "dep/stb+stb"
+}
+
+dependency {
+	name = "protobuf_dep",
+	pkg_config = "protobuf"
+}
+
+dependency {
+	name = "zlib_dep",
+	pkg_config = "zlib"
+}
+
+proto_cc_library {
+	name = "config_lib",
+	srcs = {
+		"./lib/common.proto",
+		"./lib/config.proto",
+		"./lib/decoders/decoders.proto",
+		"./lib/drive.proto",
+		"./lib/encoders/encoders.proto",
+		"./lib/fl2.proto",
+		"./lib/fluxsink/fluxsink.proto",
+		"./lib/fluxsource/fluxsource.proto",
+		"./lib/imagereader/imagereader.proto",
+		"./lib/imagewriter/imagewriter.proto",
+		"./lib/mapper.proto",
+		"./lib/usb/usb.proto",
+		"./arch/aeslanier/aeslanier.proto",
+		"./arch/agat/agat.proto",
+		"./arch/amiga/amiga.proto",
+		"./arch/apple2/apple2.proto",
+		"./arch/brother/brother.proto",
+		"./arch/c64/c64.proto",
+		"./arch/f85/f85.proto",
+		"./arch/fb100/fb100.proto",
+		"./arch/ibm/ibm.proto",
+		"./arch/macintosh/macintosh.proto",
+		"./arch/micropolis/micropolis.proto",
+		"./arch/mx/mx.proto",
+		"./arch/northstar/northstar.proto",
+		"./arch/tids990/tids990.proto",
+		"./arch/victor9k/victor9k.proto",
+		"./arch/zilogmcz/zilogmcz.proto",
+	}
+}
+
+clibrary {
+	name = "protocol_lib",
+	hdrs = { "./protocol.h" }
+}
+
+clibrary {
+	name = "libfluxengine",
+	srcs = {
+		"./arch/aeslanier/decoder.cc",
+		"./arch/agat/agat.cc",
+		"./arch/agat/decoder.cc",
+		"./arch/amiga/amiga.cc",
+		"./arch/amiga/decoder.cc",
+		"./arch/amiga/encoder.cc",
+		"./arch/apple2/decoder.cc",
+		"./arch/apple2/encoder.cc",
+		"./arch/brother/decoder.cc",
+		"./arch/brother/encoder.cc",
+		"./arch/c64/c64.cc",
+		"./arch/c64/decoder.cc",
+		"./arch/c64/encoder.cc",
+		"./arch/f85/decoder.cc",
+		"./arch/fb100/decoder.cc",
+		"./arch/ibm/decoder.cc",
+		"./arch/ibm/encoder.cc",
+		"./arch/macintosh/decoder.cc",
+		"./arch/macintosh/encoder.cc",
+		"./arch/micropolis/decoder.cc",
+		"./arch/micropolis/encoder.cc",
+		"./arch/mx/decoder.cc",
+		"./arch/northstar/decoder.cc",
+		"./arch/northstar/encoder.cc",
+		"./arch/tids990/decoder.cc",
+		"./arch/tids990/encoder.cc",
+		"./arch/victor9k/decoder.cc",
+		"./arch/victor9k/encoder.cc",
+		"./arch/zilogmcz/decoder.cc",
+		"./lib/bitmap.cc",
+		"./lib/bytes.cc",
+		"./lib/crc.cc",
+		"./lib/csvreader.cc",
+		"./lib/decoders/decoders.cc",
+		"./lib/decoders/fluxdecoder.cc",
+		"./lib/decoders/fluxmapreader.cc",
+		"./lib/decoders/fmmfm.cc",
+		"./lib/encoders/encoders.cc",
+		"./lib/flags.cc",
+		"./lib/fluxmap.cc",
+		"./lib/fluxsink/aufluxsink.cc",
+		"./lib/fluxsink/fl2fluxsink.cc",
+		"./lib/fluxsink/fluxsink.cc",
+		"./lib/fluxsink/hardwarefluxsink.cc",
+		"./lib/fluxsink/scpfluxsink.cc",
+		"./lib/fluxsink/vcdfluxsink.cc",
+		"./lib/fluxsource/cwffluxsource.cc",
+		"./lib/fluxsource/erasefluxsource.cc",
+		"./lib/fluxsource/fl2fluxsource.cc",
+		"./lib/fluxsource/fluxsource.cc",
+		"./lib/fluxsource/hardwarefluxsource.cc",
+		"./lib/fluxsource/kryoflux.cc",
+		"./lib/fluxsource/kryofluxfluxsource.cc",
+		"./lib/fluxsource/scpfluxsource.cc",
+		"./lib/fluxsource/testpatternfluxsource.cc",
+		"./lib/globals.cc",
+		"./lib/hexdump.cc",
+		"./lib/image.cc",
+		"./lib/imagereader/d64imagereader.cc",
+		"./lib/imagereader/d88imagereader.cc",
+		"./lib/imagereader/dimimagereader.cc",
+		"./lib/imagereader/diskcopyimagereader.cc",
+		"./lib/imagereader/fdiimagereader.cc",
+		"./lib/imagereader/imagereader.cc",
+		"./lib/imagereader/imdimagereader.cc",
+		"./lib/imagereader/imgimagereader.cc",
+		"./lib/imagereader/jv3imagereader.cc",
+		"./lib/imagereader/nfdimagereader.cc",
+		"./lib/imagereader/nsiimagereader.cc",
+		"./lib/imagereader/td0imagereader.cc",
+		"./lib/imagewriter/d64imagewriter.cc",
+		"./lib/imagewriter/d88imagewriter.cc",
+		"./lib/imagewriter/diskcopyimagewriter.cc",
+		"./lib/imagewriter/imagewriter.cc",
+		"./lib/imagewriter/imgimagewriter.cc",
+		"./lib/imagewriter/ldbsimagewriter.cc",
+		"./lib/imagewriter/nsiimagewriter.cc",
+		"./lib/imagewriter/rawimagewriter.cc",
+		"./lib/imginputoutpututils.cc",
+		"./lib/ldbs.cc",
+		"./lib/logger.cc",
+		"./lib/mapper.cc",
+		"./lib/proto.cc",
+		"./lib/readerwriter.cc",
+		"./lib/sector.cc",
+		"./lib/usb/fluxengineusb.cc",
+		"./lib/usb/greaseweazle.cc",
+		"./lib/usb/greaseweazleusb.cc",
+		"./lib/usb/serial.cc",
+		"./lib/usb/usb.cc",
+		"./lib/usb/usbfinder.cc",
+		"./lib/utils.cc",
+		"protocol.h",
+	},
+	deps = {
+		"+config_lib",
+		"+protocol_lib",
+		"+fmt_dep",
+		"+protobuf_dep",
+		"+zlib_dep",
+		"dep/libusbp+libusbp",
+	},
+	dep_cflags = { "-Ilib", "-Iarch", "-I." },
+	vars = {
+		["+cflags"] = { "-Ilib", "-Iarch", "-I." }
+	}
+}
+
+installable {
+	name = "all",
+	map = {
+		["fluxengine"] = "src+fluxengine",
+		["fluxengine-gui"] = "src/gui+fluxengine",
+		["brother120tool"] = "tools+brother120tool",
+		["brother240tool"] = "tools+brother240tool",
+		["upgrade-flux-file"] = "tools+upgrade-flux-file",
+	}
+}
+
+include "tests/build.lua"
+

build/build.lua

@@ -0,0 +1,251 @@
+local OBJDIR = "$(OBJDIR)"
+
+local function objdir(e)
+	return concatpath(OBJDIR, e.cwd, e.name)
+end
+
+definerule("normalrule",
+	{
+		ins = { type="targets" },
+		deps = { type="targets", default={} },
+		outs = { type="targets", default={} },
+		outleaves = { type="strings" },
+		label = { type="string", optional=true },
+		objdir = { type="string", optional=true },
+		commands = { type="strings" },
+	},
+	function (e)
+		local dir = e.objdir or objdir(e)
+		local realouts = {}
+		for _, v in pairs(e.outleaves) do
+			realouts[#realouts+1] = concatpath(dir, v)
+		end
+
+		local vars = inherit(e.vars, {
+			dir = dir
+		})
+
+		local result = simplerule {
+			name = e.name,
+			ins = e.ins,
+			deps = e.deps,
+			outs = concat(realouts, filenamesof(e.outs)),
+			label = e.label,
+			commands = e.commands,
+			vars = vars,
+		}
+		result.dir = dir
+		return result
+	end
+)
+
+local function is_clike(f)
+	return f:find("%.c$") or f:find("%.cc$") or f:find("%.cpp$")
+end
+
+definerule("cfile",
+	{
+		srcs = { type="targets" },
+		deps = { type="targets", default={} }
+	},
+	function (e)
+		local cflags = e.vars.cflags
+		local cxxflags = e.vars.cxxflags
+		for _, target in ipairs(targetsof(e.deps)) do
+			if target.is.clibrary then
+				cflags = concat(cflags, target.dep_cflags)
+				cxxflags = concat(cxxflags, target.dep_cxxflags)
+			end
+		end
+
+		local src = filter(filenamesof(e.srcs), is_clike)
+		local cmd
+		local cxx = false
+		if src[1]:find("%.c$") then
+			cmd = "$(CC) -c -o %{outs[1]} %{ins[1]} %{hdrpaths} %{cflags}"
+		else
+			cmd = "$(CXX) -c -o %{outs[1]} %{ins[1]} %{hdrpaths} %{cflags} %{cxxflags}"
+			cxx = true
+		end
+
+		local outleaf = basename(e.name)..".o"
+		local rule = normalrule {
+			name = e.name,
+			cwd = e.cwd,
+			ins = e.srcs,
+			deps = e.deps,
+			outleaves = {outleaf},
+			label = e.label,
+			commands = cmd,
+			vars = {
+				hdrpaths = {},
+				cflags = cflags,
+				cxxflags = cxxflags,
+			}
+		}
+
+		rule.is.cxxfile = cxx
+		return rule
+	end
+)
+
+local function do_cfiles(e)
+	local outs = {}
+	local srcs = filenamesof(e.srcs)
+	for _, f in ipairs(sorted(filter(srcs, is_clike))) do
+		local ofile
+		if f:find(OBJDIR, 1, true) == 1 then
+			ofile = e.name.."/"..f:sub(#OBJDIR+1)..".o"
+		else
+			ofile = e.name.."/"..f..".o"
+		end
+		outs[#outs+1] = cfile {
+			name = ofile,
+			srcs = { f },
+			deps = e.deps
+		}
+	end
+	return outs
+end
+
+definerule("clibrary",
+	{
+		srcs = { type="targets", default={} },
+		deps = { type="targets", default={} },
+		hdrs = { type="targets", default={} },
+		dep_cflags = { type="strings", default={} },
+		dep_cxxflags = { type="strings", default={} },
+		dep_ldflags = { type="strings", default={} },
+		dep_libs = { type="strings", default={} },
+	},
+	function (e)
+		local ins = do_cfiles(e)
+		local cxx = false
+		for _, f in ipairs(ins) do
+			if f.is.cxxfile then
+				cxx = true
+				break
+			end
+		end
+
+		local mkdirs = {}
+		local copies = {}
+		local outs = {}
+		local function copy_file(src, dest)
+			mkdirs[#mkdirs+1] = "mkdir -p %{dir}/"..dirname(dest)
+			copies[#copies+1] = "cp "..src.." %{dir}/"..dest
+			outs[#outs+1] = objdir(e).."/"..dest
+		end
+
+		local deps = {}
+		for k, v in pairs(e.hdrs) do
+			deps[#deps+1] = v
+			if type(k) == "number" then
+				v = filenamesof(v)
+				for _, v in ipairs(v) do
+					if not startswith(e.cwd, v) then
+						error(string.format("filename '%s' is not local to '%s' --- "..
+							"you'll have to specify the output filename manually", v, e.cwd))
+					end
+					copy_file(v, v:gsub("^"..e.cwd, ""))
+				end
+			else
+				v = filenamesof(v)
+				if #v ~= 1 then
+					error("each mapped hdrs item can only cope with a single file")
+				end
+				copy_file(v[1], k)
+			end
+		end
+
+		ins = sorted(filenamesof(ins))
+		local has_ar = (#ins ~= 0)
+		local lib = normalrule {
+			name = e.name,
+			cwd = e.cwd,
+			ins = sorted(filenamesof(ins)),
+			deps = deps,
+			outs = outs,
+			outleaves = { e.name..".a" },
+			label = e.label,
+			commands = {
+				sorted(mkdirs),
+				sorted(copies),
+				has_ar and "rm -f %{outs[1]} && $(AR) cqs %{outs[1]} %{ins}" or {},
+			}
+		}
+		
+		lib.dep_cflags = concat(e.dep_cflags, "-I"..lib.dir)
+		lib.dep_cxxflags = e.dep_cxxflags
+		lib.dep_ldflags = e.dep_ldflags
+		lib.dep_libs = concat(e.dep_libs, has_ar and matching(filenamesof(lib), "%.a$") or {})
+		lib.dep_cxx = cxx
+
+		for _, d in pairs(targetsof(e.deps)) do
+			lib.dep_cflags = concat(lib.dep_cflags, d.dep_cflags)
+			lib.dep_cxxflags = concat(lib.dep_cxxflags, d.dep_cxxflags)
+			lib.dep_ldflags = concat(lib.dep_ldflags, d.dep_ldflags)
+			lib.dep_libs = concat(lib.dep_libs, d.dep_libs)
+			lib.dep_cxx = lib.dep_cxx or d.dep_cxx
+		end
+
+		return lib
+	end
+)
+
+definerule("cprogram",
+	{
+		srcs = { type="targets", default={} },
+		deps = { type="targets", default={} },
+	},
+	function (e)
+		local deps = e.deps
+		local ins = {}
+		local cxx = false
+
+		if (#e.srcs > 0) then
+			local objs = do_cfiles(e)
+			for _, obj in pairs(objs) do
+				if obj.is.cxxfile then
+					cxx = true
+				end
+				ins[#ins+1] = obj
+			end
+		end
+
+		local libs = {}
+		local cflags = {}
+		local cxxflags = {}
+		local ldflags = {}
+		for _, lib in pairs(e.deps) do
+			cflags = concat(cflags, lib.dep_cflags)
+			cxxflags = concat(cxxflags, lib.dep_cxxflags)
+			ldflags = concat(ldflags, lib.dep_ldflags)
+			libs = concat(libs, lib.dep_libs)
+			cxx = cxx or lib.dep_cxx
+		end
+
+		local command
+		if cxx then
+			command = "$(CXX) $(LDFLAGS) %{ldflags} -o %{outs[1]} %{ins} %{libs} %{libs}"
+		else
+			command = "$(CC) $(LDFLAGS) %{ldflags} -o %{outs[1]} %{ins} %{libs} %{libs}"
+		end
+
+		return normalrule {
+			name = e.name,
+			cwd = e.cwd,
+			deps = deps,
+			ins = ins,
+			outleaves = { e.name },
+			commands = { command },
+			vars = {
+				cflags = cflags,
+				cxxflags = cxxflags,
+				ldflags = ldflags,
+				libs = libs,
+			}
+		}
+	end
+)
+

build/tests.lua

@@ -0,0 +1,18 @@
+definerule("test",
+	{
+		srcs = { type="targets", default={} },
+	},
+	function (e)
+		if vars.TESTS == "yes" then
+			normalrule {
+				name = e.name,
+				ins = e.srcs,
+				outleaves = { "log.txt" },
+				commands = {
+					"%{ins} > %{outs}",
+				}
+			}
+		end
+	end
+)
+

dep/adflib/.gitignore

@@ -0,0 +1,45 @@
+# Object files
+*.o
+*.lo
+
+# Libraries
+.libs
+*.lib
+*.a
+*.la
+
+# Shared objects (inc. Windows DLLs)
+*.dll
+*.so
+*.so.*
+*.dylib
+
+# Executables
+*.exe
+*.out
+*.app
+
+# generated by autogen.sh
+INSTALL
+Makefile.in
+aclocal.m4
+autom4te.cache
+compile
+config.guess
+config.h.in
+config.sub
+configure
+depcomp
+install-sh
+ltmain.sh
+missing
+
+# generated by configure
+.deps
+Makefile
+adflib.pc
+config.h
+config.log
+config.status
+libtool
+stamp-h1

dep/adflib/AUTHORS

@@ -0,0 +1,13 @@
+
+The main developper is 
+ Laurent Clévy (laurent.clevy@club-internet.fr)
+
+Contributors are:
+ Bjarne Viksoe 
+   (C++ wrapper, lot of bug fixes)
+ Gary Harris 
+   (bug fixes and W32 support)
+ Dan Sutherland 
+   (bug fixes and W32 support)
+
+See CHANGES.txt for detailed contributions.

dep/adflib/COPYING

@@ -0,0 +1,339 @@
+		    GNU GENERAL PUBLIC LICENSE
+		       Version 2, June 1991
+
+ Copyright (C) 1989, 1991 Free Software Foundation, Inc.,
+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+			    Preamble
+
+  The licenses for most software are designed to take away your
+freedom to share and change it.  By contrast, the GNU General Public
+License is intended to guarantee your freedom to share and change free
+software--to make sure the software is free for all its users.  This
+General Public License applies to most of the Free Software
+Foundation's software and to any other program whose authors commit to
+using it.  (Some other Free Software Foundation software is covered by
+the GNU Lesser General Public License instead.)  You can apply it to
+your programs, too.
+
+  When we speak of free software, we are referring to freedom, not
+price.  Our General Public Licenses are designed to make sure that you
+have the freedom to distribute copies of free software (and charge for
+this service if you wish), that you receive source code or can get it
+if you want it, that you can change the software or use pieces of it
+in new free programs; and that you know you can do these things.
+
+  To protect your rights, we need to make restrictions that forbid
+anyone to deny you these rights or to ask you to surrender the rights.
+These restrictions translate to certain responsibilities for you if you
+distribute copies of the software, or if you modify it.
+
+  For example, if you distribute copies of such a program, whether
+gratis or for a fee, you must give the recipients all the rights that
+you have.  You must make sure that they, too, receive or can get the
+source code.  And you must show them these terms so they know their
+rights.
+
+  We protect your rights with two steps: (1) copyright the software, and
+(2) offer you this license which gives you legal permission to copy,
+distribute and/or modify the software.
+
+  Also, for each author's protection and ours, we want to make certain
+that everyone understands that there is no warranty for this free
+software.  If the software is modified by someone else and passed on, we
+want its recipients to know that what they have is not the original, so
+that any problems introduced by others will not reflect on the original
+authors' reputations.
+
+  Finally, any free program is threatened constantly by software
+patents.  We wish to avoid the danger that redistributors of a free
+program will individually obtain patent licenses, in effect making the
+program proprietary.  To prevent this, we have made it clear that any
+patent must be licensed for everyone's free use or not licensed at all.
+
+  The precise terms and conditions for copying, distribution and
+modification follow.
+
+		    GNU GENERAL PUBLIC LICENSE
+   TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+  0. This License applies to any program or other work which contains
+a notice placed by the copyright holder saying it may be distributed
+under the terms of this General Public License.  The "Program", below,
+refers to any such program or work, and a "work based on the Program"
+means either the Program or any derivative work under copyright law:
+that is to say, a work containing the Program or a portion of it,
+either verbatim or with modifications and/or translated into another
+language.  (Hereinafter, translation is included without limitation in
+the term "modification".)  Each licensee is addressed as "you".
+
+Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope.  The act of
+running the Program is not restricted, and the output from the Program
+is covered only if its contents constitute a work based on the
+Program (independent of having been made by running the Program).
+Whether that is true depends on what the Program does.
+
+  1. You may copy and distribute verbatim copies of the Program's
+source code as you receive it, in any medium, provided that you
+conspicuously and appropriately publish on each copy an appropriate
+copyright notice and disclaimer of warranty; keep intact all the
+notices that refer to this License and to the absence of any warranty;
+and give any other recipients of the Program a copy of this License
+along with the Program.
+
+You may charge a fee for the physical act of transferring a copy, and
+you may at your option offer warranty protection in exchange for a fee.
+
+  2. You may modify your copy or copies of the Program or any portion
+of it, thus forming a work based on the Program, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+    a) You must cause the modified files to carry prominent notices
+    stating that you changed the files and the date of any change.
+
+    b) You must cause any work that you distribute or publish, that in
+    whole or in part contains or is derived from the Program or any
+    part thereof, to be licensed as a whole at no charge to all third
+    parties under the terms of this License.
+
+    c) If the modified program normally reads commands interactively
+    when run, you must cause it, when started running for such
+    interactive use in the most ordinary way, to print or display an
+    announcement including an appropriate copyright notice and a
+    notice that there is no warranty (or else, saying that you provide
+    a warranty) and that users may redistribute the program under
+    these conditions, and telling the user how to view a copy of this
+    License.  (Exception: if the Program itself is interactive but
+    does not normally print such an announcement, your work based on
+    the Program is not required to print an announcement.)
+
+These requirements apply to the modified work as a whole.  If
+identifiable sections of that work are not derived from the Program,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works.  But when you
+distribute the same sections as part of a whole which is a work based
+on the Program, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Program.
+
+In addition, mere aggregation of another work not based on the Program
+with the Program (or with a work based on the Program) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+  3. You may copy and distribute the Program (or a work based on it,
+under Section 2) in object code or executable form under the terms of
+Sections 1 and 2 above provided that you also do one of the following:
+
+    a) Accompany it with the complete corresponding machine-readable
+    source code, which must be distributed under the terms of Sections
+    1 and 2 above on a medium customarily used for software interchange; or,
+
+    b) Accompany it with a written offer, valid for at least three
+    years, to give any third party, for a charge no more than your
+    cost of physically performing source distribution, a complete
+    machine-readable copy of the corresponding source code, to be
+    distributed under the terms of Sections 1 and 2 above on a medium
+    customarily used for software interchange; or,
+
+    c) Accompany it with the information you received as to the offer
+    to distribute corresponding source code.  (This alternative is
+    allowed only for noncommercial distribution and only if you
+    received the program in object code or executable form with such
+    an offer, in accord with Subsection b above.)
+
+The source code for a work means the preferred form of the work for
+making modifications to it.  For an executable work, complete source
+code means all the source code for all modules it contains, plus any
+associated interface definition files, plus the scripts used to
+control compilation and installation of the executable.  However, as a
+special exception, the source code distributed need not include
+anything that is normally distributed (in either source or binary
+form) with the major components (compiler, kernel, and so on) of the
+operating system on which the executable runs, unless that component
+itself accompanies the executable.
+
+If distribution of executable or object code is made by offering
+access to copy from a designated place, then offering equivalent
+access to copy the source code from the same place counts as
+distribution of the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+  4. You may not copy, modify, sublicense, or distribute the Program
+except as expressly provided under this License.  Any attempt
+otherwise to copy, modify, sublicense or distribute the Program is
+void, and will automatically terminate your rights under this License.
+However, parties who have received copies, or rights, from you under
+this License will not have their licenses terminated so long as such
+parties remain in full compliance.
+
+  5. You are not required to accept this License, since you have not
+signed it.  However, nothing else grants you permission to modify or
+distribute the Program or its derivative works.  These actions are
+prohibited by law if you do not accept this License.  Therefore, by
+modifying or distributing the Program (or any work based on the
+Program), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Program or works based on it.
+
+  6. Each time you redistribute the Program (or any work based on the
+Program), the recipient automatically receives a license from the
+original licensor to copy, distribute or modify the Program subject to
+these terms and conditions.  You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties to
+this License.
+
+  7. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License.  If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Program at all.  For example, if a patent
+license would not permit royalty-free redistribution of the Program by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Program.
+
+If any portion of this section is held invalid or unenforceable under
+any particular circumstance, the balance of the section is intended to
+apply and the section as a whole is intended to apply in other
+circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system, which is
+implemented by public license practices.  Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+  8. If the distribution and/or use of the Program is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Program under this License
+may add an explicit geographical distribution limitation excluding
+those countries, so that distribution is permitted only in or among
+countries not thus excluded.  In such case, this License incorporates
+the limitation as if written in the body of this License.
+
+  9. The Free Software Foundation may publish revised and/or new versions
+of the General Public License from time to time.  Such new versions will
+be similar in spirit to the present version, but may differ in detail to
+address new problems or concerns.
+
+Each version is given a distinguishing version number.  If the Program
+specifies a version number of this License which applies to it and "any
+later version", you have the option of following the terms and conditions
+either of that version or of any later version published by the Free
+Software Foundation.  If the Program does not specify a version number of
+this License, you may choose any version ever published by the Free Software
+Foundation.
+
+  10. If you wish to incorporate parts of the Program into other free
+programs whose distribution conditions are different, write to the author
+to ask for permission.  For software which is copyrighted by the Free
+Software Foundation, write to the Free Software Foundation; we sometimes
+make exceptions for this.  Our decision will be guided by the two goals
+of preserving the free status of all derivatives of our free software and
+of promoting the sharing and reuse of software generally.
+
+			    NO WARRANTY
+
+  11. BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY
+FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN
+OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES
+PROVIDE THE PROGRAM "AS IS" WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED
+OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS
+TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE
+PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING,
+REPAIR OR CORRECTION.
+
+  12. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING
+WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR
+REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES,
+INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING
+OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED
+TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY
+YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER
+PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGES.
+
+		     END OF TERMS AND CONDITIONS
+
+	    How to Apply These Terms to Your New Programs
+
+  If you develop a new program, and you want it to be of the greatest
+possible use to the public, the best way to achieve this is to make it
+free software which everyone can redistribute and change under these terms.
+
+  To do so, attach the following notices to the program.  It is safest
+to attach them to the start of each source file to most effectively
+convey the exclusion of warranty; and each file should have at least
+the "copyright" line and a pointer to where the full notice is found.
+
+    <one line to give the program's name and a brief idea of what it does.>
+    Copyright (C) <year>  <name of author>
+
+    This program is free software; you can redistribute it and/or modify
+    it under the terms of the GNU General Public License as published by
+    the Free Software Foundation; either version 2 of the License, or
+    (at your option) any later version.
+
+    This program is distributed in the hope that it will be useful,
+    but WITHOUT ANY WARRANTY; without even the implied warranty of
+    MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+    GNU General Public License for more details.
+
+    You should have received a copy of the GNU General Public License along
+    with this program; if not, write to the Free Software Foundation, Inc.,
+    51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.
+
+Also add information on how to contact you by electronic and paper mail.
+
+If the program is interactive, make it output a short notice like this
+when it starts in an interactive mode:
+
+    Gnomovision version 69, Copyright (C) year name of author
+    Gnomovision comes with ABSOLUTELY NO WARRANTY; for details type `show w'.
+    This is free software, and you are welcome to redistribute it
+    under certain conditions; type `show c' for details.
+
+The hypothetical commands `show w' and `show c' should show the appropriate
+parts of the General Public License.  Of course, the commands you use may
+be called something other than `show w' and `show c'; they could even be
+mouse-clicks or menu items--whatever suits your program.
+
+You should also get your employer (if you work as a programmer) or your
+school, if any, to sign a "copyright disclaimer" for the program, if
+necessary.  Here is a sample; alter the names:
+
+  Yoyodyne, Inc., hereby disclaims all copyright interest in the program
+  `Gnomovision' (which makes passes at compilers) written by James Hacker.
+
+  <signature of Ty Coon>, 1 April 1989
+  Ty Coon, President of Vice
+
+This General Public License does not permit incorporating your program into
+proprietary programs.  If your program is a subroutine library, you may
+consider it more useful to permit linking proprietary applications with the
+library.  If this is what you want to do, use the GNU Lesser General
+Public License instead of this License.

dep/adflib/README

@@ -0,0 +1,128 @@
+
+
+The ADFlib is a free, portable and open implementation of the Amiga filesystem.
+
+initial release in 1999
+
+It supports :
+- floppy dumps
+- multiple partitions harddisk dumps
+- UAE hardfiles
+- WinNT devices with the 'native driver' written by Dan Sutherland
+- mount/unmount/create a device (real one or a dump file),
+- mount/unmount/create a volume (partition),
+- create/open/close/delete/rename/undel a file,
+- read/write bytes from/to a file,
+- create/delete/rename/move/undel a directory,
+- get directory contents, change current directory, get parent directory
+- use dir cache to get directory contents.
+
+
+It is written in portable C, and support the WinNT platform to access
+real drives.
+
+See also : 
+https://packages.debian.org/source/sid/unadf
+https://www.cvedetails.com/cve/CVE-2016-1243/
+https://www.cvedetails.com/cve/CVE-2016-1244/
+
+---
+
+unADF is a unzip like for .ADF files :
+
+
+unadf [-lrcsp -v n] dumpname.adf [files-with-path] [-d extractdir]
+    -l : lists root directory contents
+    -r : lists directory tree contents
+    -c : use dircache data (must be used with -l)
+    -s : display entries logical block pointer (must be used with -l)
+    -m : display file comments, if exists (must be used with -l)
+
+    -v n : mount volume #n instead of default #0 volume
+
+    -p : send extracted files to pipe (unadf -p dump.adf Pics/pic1.gif | xv -)
+    -d dir : extract to 'dir' directory
+
+
+
+Credits:
+--------
+
+main design and code             Laurent Clevy
+Bug fixes and C++ wrapper        Bjarke Viksoe (adfwrapper.h)
+WinNT native driver              Dan Sutherland and Gary Harris
+
+
+New versions and contact e-mail can be found at : 
+
+http://lclevy.free.fr/adflib
+
+
+
+COMPILATION
+-----------
+
+The following commands should automatically detect the system 
+configuration and build the library and examples/unadf, 
+the ADF extractor binary.
+
+	./autogen.sh
+	./configure
+	make
+
+
+
+FEATURES NEEDING FURTHER TESTS
+------------------------------
+
+* Native driver
+
+The NATIV_DIR variable is used to choose the (only one) target platform
+of the native driver. The default is :
+
+NATIV_DIR = ./Generic
+
+This one do not give access to any real device. The other one available is
+Win32, to access real devices under WinNT.
+
+
+* Win32DLL
+
+The 'prefix.h' is used to create the Win32 DLL version of the library.
+If the WIN32DLL variable is defined in the library code, public functions
+are preceded by the '__declspec(dllexport)' directive. If this same
+variable is defined, the '__declspec(dllimport)' is put before the functions
+prototypes in the 'adflib.h' library include file.
+
+
+
+
+FILES
+-----
+
+AUTHORS   Contributors
+README			The file you are reading
+TODO			Future improvements and bugfixes
+CHANGES			Detailed changes
+src/			main library files
+src/win32/		WinNT native driver
+src/generic/		native files templates
+boot/			Bootblocks that might by used to put on floppy disks
+doc/			The library developpers documentation 
+doc/FAQ/		The Amiga Filesystem explained
+examples/		unadf.c
+
+
+Possible bugs
+-------------
+
+- in dircache updates
+- when a volume is becoming full
+- lost memory releases
+
+
+Please report any bugs or mistakes in the documentation !
+
+
+
+Have fun anyway !

dep/adflib/UPSTREAM.md

@@ -0,0 +1,2 @@
+This is head of git downloaded from https://github.com/lclevy/ADFlib on
+2022-08-28.

dep/adflib/adf_nativ.h

@@ -0,0 +1,37 @@
+#ifndef ADF_NATIV_H
+#define ADF_NATIV_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "adf_str.h"
+
+#define NATIVE_FILE 8001
+
+struct nativeDevice
+{
+	FILE* fd;
+};
+
+struct nativeFunctions
+{
+    /* called by adfMount() */
+    RETCODE (*adfInitDevice)(struct Device*, char*, BOOL);
+    /* called by adfReadBlock() */
+    RETCODE (*adfNativeReadSector)(struct Device*, int32_t, int, uint8_t*);
+    /* called by adfWriteBlock() */
+    RETCODE (*adfNativeWriteSector)(struct Device*, int32_t, int, uint8_t*);
+    /* called by adfMount() */
+    BOOL (*adfIsDevNative)(char*);
+    /* called by adfUnMount() */
+    RETCODE (*adfReleaseDevice)(struct Device*);
+};
+
+extern void adfInitNativeFct();
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif

dep/adflib/build.mk

@@ -0,0 +1,22 @@
+ADFLIB_SRCS = \
+	dep/adflib/src/adf_bitm.c \
+	dep/adflib/src/adf_cache.c \
+	dep/adflib/src/adf_dir.c \
+	dep/adflib/src/adf_disk.c \
+	dep/adflib/src/adf_dump.c \
+	dep/adflib/src/adf_env.c \
+	dep/adflib/src/adf_file.c \
+	dep/adflib/src/adf_hd.c \
+	dep/adflib/src/adf_link.c \
+	dep/adflib/src/adf_raw.c \
+	dep/adflib/src/adf_salv.c \
+	dep/adflib/src/adf_util.c \
+
+ADFLIB_OBJS = $(patsubst %.c, $(OBJDIR)/%.o, $(ADFLIB_SRCS))
+$(ADFLIB_OBJS): CFLAGS += -Idep/adflib/src -Idep/adflib
+ADFLIB_LIB = $(OBJDIR)/libadflib.a
+$(ADFLIB_LIB): $(ADFLIB_OBJS)
+ADFLIB_CFLAGS = -Idep/adflib/src
+ADFLIB_LDFLAGS = $(ADFLIB_LIB)
+OBJS += $(ADFLIB_OBJS)
+

dep/adflib/config.h

@@ -0,0 +1,2 @@
+/* empty config.h to keep the source happy */
+

dep/adflib/src/Makefile.am

@@ -0,0 +1,44 @@
+NATIVE_DIR = generic
+
+lib_LTLIBRARIES = libadf.la
+
+libadf_la_SOURCES = adf_hd.c \
+                    adf_disk.c \
+                    adf_raw.c \
+                    adf_bitm.c \
+                    adf_dump.c \
+                    adf_util.c \
+                    adf_env.c \
+                    $(NATIVE_DIR)/adf_nativ.c \
+                    adf_dir.c \
+                    adf_file.c \
+                    adf_cache.c \
+                    adf_link.c \
+                    adf_salv.c
+
+include_HEADERS = adf_defs.h \
+                  adf_blk.h \
+                  adf_err.h \
+                  adf_str.h \
+                  adflib.h \
+                  adf_bitm.h \
+                  adf_cache.h \
+                  adf_dir.h \
+                  adf_disk.h \
+                  adf_dump.h \
+                  adf_env.h \
+                  adf_file.h \
+                  adf_hd.h \
+                  adf_link.h \
+                  adf_raw.h \
+                  adf_salv.h \
+                  adf_util.h \
+                  defendian.h \
+                  hd_blk.h \
+                  prefix.h \
+                  $(NATIVE_DIR)/adf_nativ.h
+
+libadf_la_LDFLAGS = -version-info 0:12:0
+AM_CPPFLAGS = -D_XOPEN_SOURCE -D_SVID_SOURCE -D_BSD_SOURCE -D_DEFAULT_SOURCE -D_GNU_SOURCE -I$(srcdir) -I$(srcdir)/$(NATIVE_DIR)
+AM_CFLAGS = -std=c99 -pedantic -Wall
+

dep/adflib/src/adf_bitm.c

@@ -0,0 +1,561 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_bitm.c
+ *
+ *  $Id$
+ *
+ *  bitmap code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+#include <stdlib.h>
+#include <string.h>
+
+#include"adf_raw.h"
+#include"adf_bitm.h"
+#include"adf_err.h"
+#include"adf_disk.h"
+#include"adf_util.h"
+#include"defendian.h"
+
+extern uint32_t bitMask[32];
+
+extern struct Env adfEnv;
+
+/*
+ * adfUpdateBitmap
+ *
+ */
+RETCODE adfUpdateBitmap(struct Volume *vol)
+{
+	int i;
+    struct bRootBlock root;
+
+/*printf("adfUpdateBitmap\n");*/
+        
+    if (adfReadRootBlock(vol, vol->rootBlock,&root)!=RC_OK)
+		return RC_ERROR;
+
+    root.bmFlag = BM_INVALID;
+    if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK)
+		return RC_ERROR;
+
+    for(i=0; i<vol->bitmapSize; i++)
+    if (vol->bitmapBlocksChg[i]) {
+        if (adfWriteBitmapBlock(vol, vol->bitmapBlocks[i], vol->bitmapTable[i])!=RC_OK)
+			return RC_ERROR;
+  	    vol->bitmapBlocksChg[i] = FALSE;
+    }
+
+    root.bmFlag = BM_VALID;
+    adfTime2AmigaTime(adfGiveCurrentTime(),&(root.days),&(root.mins),&(root.ticks));
+    if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfCountFreeBlocks
+ *
+ */
+int32_t adfCountFreeBlocks(struct Volume* vol)
+{
+    int32_t freeBlocks;
+    int j;
+
+	freeBlocks = 0L;
+    for(j=vol->firstBlock+2; j<=(vol->lastBlock - vol->firstBlock); j++)
+        if ( adfIsBlockFree(vol,j) )
+            freeBlocks++;
+
+    return freeBlocks;
+}
+
+
+/*
+ * adfReadBitmap
+ *
+ */
+RETCODE adfReadBitmap(struct Volume* vol, int32_t nBlock, struct bRootBlock* root)
+{
+	int32_t mapSize, nSect;
+	int32_t j, i;
+	struct bBitmapExtBlock bmExt;
+
+    mapSize = nBlock / (127*32);
+    if ( (nBlock%(127*32))!=0 )
+        mapSize++;
+    vol->bitmapSize = mapSize;
+
+    vol->bitmapTable = (struct bBitmapBlock**) malloc(sizeof(struct bBitmapBlock*)*mapSize);
+    if (!vol->bitmapTable) { 
+		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapTable");
+        return RC_MALLOC;
+    }
+	vol->bitmapBlocks = (SECTNUM*) malloc(sizeof(SECTNUM)*mapSize);
+    if (!vol->bitmapBlocks) {
+        free(vol->bitmapTable);
+		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks");
+        return RC_MALLOC;
+    }
+	vol->bitmapBlocksChg = (BOOL*) malloc(sizeof(BOOL)*mapSize);
+    if (!vol->bitmapBlocksChg) { 
+        free(vol->bitmapTable); free(vol->bitmapBlocks);
+		(*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks");
+        return RC_MALLOC;
+    }
+    for(i=0; i<mapSize; i++) {
+        vol->bitmapBlocksChg[i] = FALSE;
+
+		vol->bitmapTable[i] = (struct bBitmapBlock*)malloc(sizeof(struct bBitmapBlock));
+		if (!vol->bitmapTable[i]) {
+            free(vol->bitmapBlocksChg); free(vol->bitmapBlocks);
+            for(j=0; j<i; j++) 
+                free(vol->bitmapTable[j]);
+            free(vol->bitmapTable);
+	        (*adfEnv.eFct)("adfReadBitmap : malloc, vol->bitmapBlocks");
+            return RC_MALLOC;
+        }
+    }
+
+	j=0; i=0;
+    /* bitmap pointers in rootblock : 0 <= i <BM_SIZE */
+	while(i<BM_SIZE && root->bmPages[i]!=0) {
+		vol->bitmapBlocks[j] = nSect = root->bmPages[i];
+        if ( !isSectNumValid(vol,nSect) ) {
+			(*adfEnv.wFct)("adfReadBitmap : sector out of range");
+        }
+
+		if (adfReadBitmapBlock(vol, nSect, vol->bitmapTable[j])!=RC_OK) {
+            adfFreeBitmap(vol);
+            return RC_ERROR;
+		}
+		j++; i++;
+	}
+	nSect = root->bmExt;
+	while(nSect!=0) {
+        /* bitmap pointers in bitmapExtBlock, j <= mapSize */
+        if (adfReadBitmapExtBlock(vol, nSect, &bmExt)!=RC_OK) {
+            adfFreeBitmap(vol);
+            return RC_ERROR;
+        }
+		i=0;
+		while(i<127 && j<mapSize) {
+            nSect = bmExt.bmPages[i];
+            if ( !isSectNumValid(vol,nSect) )
+                (*adfEnv.wFct)("adfReadBitmap : sector out of range");
+			vol->bitmapBlocks[j] = nSect;
+
+			if (adfReadBitmapBlock(vol, nSect, vol->bitmapTable[j])!=RC_OK) {
+                adfFreeBitmap(vol);
+                return RC_ERROR;
+            }
+			i++; j++;
+		}
+		nSect = bmExt.nextBlock;
+	}
+
+    return RC_OK;
+}
+
+
+/*
+ * adfIsBlockFree
+ *
+ */
+BOOL adfIsBlockFree(struct Volume* vol, SECTNUM nSect)
+{
+    int sectOfMap = nSect-2;
+    int block = sectOfMap/(127*32);
+    int indexInMap = (sectOfMap/32)%127;
+	
+/*printf("sect=%d block=%d ind=%d,  ",sectOfMap,block,indexInMap);
+printf("bit=%d,  ",sectOfMap%32);
+printf("bitm=%x,  ",bitMask[ sectOfMap%32]);
+printf("res=%x,  ",vol->bitmapTable[ block ]->map[ indexInMap ]
+        & bitMask[ sectOfMap%32 ]);
+*/
+    return ( (vol->bitmapTable[ block ]->map[ indexInMap ]
+        & bitMask[ sectOfMap%32 ])!=0 );
+}
+
+
+/*
+ * adfSetBlockFree OK
+ *
+ */
+void adfSetBlockFree(struct Volume* vol, SECTNUM nSect)
+{
+    uint32_t oldValue;
+    int sectOfMap = nSect-2;
+    int block = sectOfMap/(127*32);
+    int indexInMap = (sectOfMap/32)%127;
+
+/*printf("sect=%d block=%d ind=%d,  ",sectOfMap,block,indexInMap);
+printf("bit=%d,  ",sectOfMap%32);
+*printf("bitm=%x,  ",bitMask[ sectOfMap%32]);*/
+
+    oldValue = vol->bitmapTable[ block ]->map[ indexInMap ];
+/*printf("old=%x,  ",oldValue);*/
+    vol->bitmapTable[ block ]->map[ indexInMap ]
+	    = oldValue | bitMask[ sectOfMap%32 ];
+/*printf("new=%x,  ",vol->bitmapTable[ block ]->map[ indexInMap ]);*/
+
+    vol->bitmapBlocksChg[ block ] = TRUE;
+}
+
+
+/*
+ * adfSetBlockUsed
+ *
+ */
+void adfSetBlockUsed(struct Volume* vol, SECTNUM nSect)
+{
+    uint32_t oldValue;
+    int sectOfMap = nSect-2;
+    int block = sectOfMap/(127*32);
+    int indexInMap = (sectOfMap/32)%127;
+
+    oldValue = vol->bitmapTable[ block ]->map[ indexInMap ];
+
+    vol->bitmapTable[ block ]->map[ indexInMap ]
+	    = oldValue & (~bitMask[ sectOfMap%32 ]);
+    vol->bitmapBlocksChg[ block ] = TRUE;
+}
+
+
+/*
+ * adfGet1FreeBlock
+ *
+ */
+SECTNUM adfGet1FreeBlock(struct Volume *vol) {
+    SECTNUM block[1];
+    if (!adfGetFreeBlocks(vol,1,block))
+        return(-1);
+    else
+        return(block[0]);
+}
+
+/*
+ * adfGetFreeBlocks
+ *
+ */
+BOOL adfGetFreeBlocks(struct Volume* vol, int nbSect, SECTNUM* sectList)
+{
+	int i, j;
+    BOOL diskFull;
+    int32_t block = vol->rootBlock;
+
+    i = 0;
+    diskFull = FALSE;
+/*printf("lastblock=%ld\n",vol->lastBlock);*/
+	while( i<nbSect && !diskFull ) {
+        if ( adfIsBlockFree(vol, block) ) {
+            sectList[i] = block;
+			i++;
+        }
+/*        if ( block==vol->lastBlock )
+            block = vol->firstBlock+2;*/
+        if ( (block+vol->firstBlock)==vol->lastBlock )
+            block = 2;
+        else if (block==vol->rootBlock-1)
+            diskFull = TRUE;
+        else
+            block++;
+    }
+
+    if (!diskFull)
+        for(j=0; j<nbSect; j++)
+            adfSetBlockUsed( vol, sectList[j] );
+
+    return (i==nbSect);
+}
+
+
+/*
+ * adfCreateBitmap
+ *
+ * create bitmap structure in vol
+ */
+RETCODE adfCreateBitmap(struct Volume *vol)
+{
+    int32_t nBlock, mapSize ;
+    int i, j;
+
+    nBlock = vol->lastBlock - vol->firstBlock +1 - 2;
+
+    mapSize = nBlock / (127*32);
+    if ( (nBlock%(127*32))!=0 )
+        mapSize++;
+    vol->bitmapSize = mapSize;
+
+    vol->bitmapTable = (struct bBitmapBlock**)malloc( sizeof(struct bBitmapBlock*)*mapSize );
+    if (!vol->bitmapTable) {
+        (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapTable");
+        return RC_MALLOC;
+    }
+
+	vol->bitmapBlocksChg = (BOOL*) malloc(sizeof(BOOL)*mapSize);
+    if (!vol->bitmapBlocksChg) {
+        free(vol->bitmapTable);
+        (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapBlocksChg");
+        return RC_MALLOC;
+    }
+
+	vol->bitmapBlocks = (SECTNUM*) malloc(sizeof(SECTNUM)*mapSize);
+    if (!vol->bitmapBlocks) {
+        free(vol->bitmapTable); free(vol->bitmapBlocksChg);
+        (*adfEnv.eFct)("adfCreateBitmap : malloc, vol->bitmapBlocks");
+        return RC_MALLOC;
+    }
+
+    for(i=0; i<mapSize; i++) {
+        vol->bitmapTable[i] = (struct bBitmapBlock*)malloc(sizeof(struct bBitmapBlock));
+        if (!vol->bitmapTable[i]) {
+            free(vol->bitmapTable); free(vol->bitmapBlocksChg);
+            for(j=0; j<i; j++) 
+                free(vol->bitmapTable[j]);
+            free(vol->bitmapTable);
+			(*adfEnv.eFct)("adfCreateBitmap : malloc");
+            return RC_MALLOC;
+        }
+    }
+
+    for(i=vol->firstBlock+2; i<=(vol->lastBlock - vol->firstBlock); i++)
+        adfSetBlockFree(vol, i);
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteNewBitmap
+ *
+ * write ext blocks and bitmap
+ *
+ * uses vol->bitmapSize, 
+ */
+RETCODE adfWriteNewBitmap(struct Volume *vol)
+{
+    struct bBitmapExtBlock bitme;
+    SECTNUM *bitExtBlock;
+    int n, i, k;
+    int nExtBlock;
+    int nBlock;
+    SECTNUM *sectList;
+    struct bRootBlock root;
+
+    sectList=(SECTNUM*)malloc(sizeof(SECTNUM)*vol->bitmapSize);
+    if (!sectList) {
+		(*adfEnv.eFct)("adfCreateBitmap : sectList");
+        return RC_MALLOC;
+    }
+
+    if (!adfGetFreeBlocks(vol, vol->bitmapSize, sectList)) {
+        free(sectList);
+		return RC_ERROR;
+    }
+	
+    if (adfReadRootBlock(vol, vol->rootBlock, &root)!=RC_OK) {
+        free(sectList);
+		return RC_ERROR;
+    }
+    nBlock = 0;
+    n = min( vol->bitmapSize, BM_SIZE );
+    for(i=0; i<n; i++) {
+        root.bmPages[i] = vol->bitmapBlocks[i] = sectList[i];
+    }
+    nBlock = n;
+
+    /* for devices with more than 25*127 blocks == hards disks */
+    if (vol->bitmapSize>BM_SIZE) {
+
+        nExtBlock = (vol->bitmapSize-BM_SIZE)/127;
+        if ((vol->bitmapSize-BM_SIZE)%127)
+            nExtBlock++;
+
+        bitExtBlock=(SECTNUM*)malloc(sizeof(SECTNUM)*nExtBlock);
+        if (!bitExtBlock) {
+            free(sectList);
+			adfEnv.eFct("adfWriteNewBitmap : malloc failed");
+            return RC_MALLOC;
+        }
+
+        if (!adfGetFreeBlocks(vol, nExtBlock, bitExtBlock)) {  
+           free(sectList); free(bitExtBlock);
+           return RC_MALLOC;
+        }
+
+        k = 0;
+        root.bmExt = bitExtBlock[ k ];
+        while( nBlock<vol->bitmapSize ) {
+            i=0;
+            while( i<127 && nBlock<vol->bitmapSize ) {
+                bitme.bmPages[i] = vol->bitmapBlocks[nBlock] = sectList[i];
+                i++;
+                nBlock++;
+            }
+            if ( k+1<nExtBlock )
+                bitme.nextBlock = bitExtBlock[ k+1 ];
+            else
+                bitme.nextBlock = 0;
+            if (adfWriteBitmapExtBlock(vol, bitExtBlock[ k ], &bitme)!=RC_OK) {
+                free(sectList); free(bitExtBlock);
+				return RC_ERROR;
+            }
+            k++;
+        }
+        free( bitExtBlock );
+
+    }
+    free( sectList);
+
+    if (adfWriteRootBlock(vol,vol->rootBlock,&root)!=RC_OK)
+        return RC_ERROR;
+    
+    return RC_OK;
+}
+
+/*
+ * adfReadBitmapBlock
+ *
+ * ENDIAN DEPENDENT
+ */
+RETCODE
+adfReadBitmapBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapBlock* bitm)
+{
+	uint8_t buf[LOGICAL_BLOCK_SIZE];
+
+/*printf("bitmap %ld\n",nSect);*/
+	if (adfReadBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+
+	memcpy(bitm, buf, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    /* big to little = 68000 to x86 */
+    swapEndian((uint8_t*)bitm, SWBL_BITMAP);
+#endif
+
+	if (bitm->checkSum!=adfNormalSum(buf,0,LOGICAL_BLOCK_SIZE))
+		(*adfEnv.wFct)("adfReadBitmapBlock : invalid checksum");
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteBitmapBlock
+ *
+ * OK
+ */
+RETCODE
+adfWriteBitmapBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapBlock* bitm)
+{
+    uint8_t buf[LOGICAL_BLOCK_SIZE];
+	uint32_t newSum;
+	
+	memcpy(buf,bitm,LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    /* little to big */
+    swapEndian(buf, SWBL_BITMAP);
+#endif
+
+	newSum = adfNormalSum(buf, 0, LOGICAL_BLOCK_SIZE);
+    swLong(buf,newSum);
+
+/*	dumpBlock((uint8_t*)buf);*/
+	if (adfWriteBlock(vol, nSect, (uint8_t*)buf)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfReadBitmapExtBlock
+ *
+ * ENDIAN DEPENDENT
+ */
+RETCODE
+adfReadBitmapExtBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapExtBlock* bitme)
+{
+	uint8_t buf[LOGICAL_BLOCK_SIZE];
+
+	if (adfReadBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+
+	memcpy(bitme, buf, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    swapEndian((uint8_t*)bitme, SWBL_BITMAP);
+#endif
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteBitmapExtBlock
+ *
+ */
+RETCODE
+adfWriteBitmapExtBlock(struct Volume* vol, SECTNUM nSect, struct bBitmapExtBlock* bitme)
+{
+	uint8_t buf[LOGICAL_BLOCK_SIZE];
+	
+	memcpy(buf,bitme, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    /* little to big */
+    swapEndian(buf, SWBL_BITMAPE);
+#endif
+
+/*	dumpBlock((uint8_t*)buf);*/
+	if (adfWriteBlock(vol, nSect, (uint8_t*)buf)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfFreeBitmap
+ *
+ */
+void adfFreeBitmap(struct Volume* vol)
+{
+    int i;
+
+    for(i=0; i<vol->bitmapSize; i++)
+        free(vol->bitmapTable[i]);
+    vol->bitmapSize = 0;
+
+    free(vol->bitmapTable);
+	vol->bitmapTable = 0;
+
+    free(vol->bitmapBlocks);
+	vol->bitmapBlocks = 0;
+
+    free(vol->bitmapBlocksChg);
+	vol->bitmapBlocksChg = 0;
+}
+
+
+/*#######################################################################################*/

dep/adflib/src/adf_bitm.h

@@ -0,0 +1,52 @@
+#ifndef ADF_BITM_H
+#define ADF_BITM_H
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_bitm.h
+ *
+ *  $Id$
+ *
+ *  bitmap code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+#include"adf_str.h"
+#include"prefix.h"
+
+RETCODE adfReadBitmapBlock(struct Volume*, SECTNUM nSect, struct bBitmapBlock*);
+RETCODE adfWriteBitmapBlock(struct Volume*, SECTNUM nSect, struct bBitmapBlock*);
+RETCODE adfReadBitmapExtBlock(struct Volume*, SECTNUM nSect, struct bBitmapExtBlock*);
+RETCODE adfWriteBitmapExtBlock(struct Volume*, SECTNUM, struct bBitmapExtBlock* );
+
+SECTNUM adfGet1FreeBlock(struct Volume *vol);
+RETCODE adfUpdateBitmap(struct Volume *vol);
+PREFIX int32_t adfCountFreeBlocks(struct Volume* vol);
+RETCODE adfReadBitmap(struct Volume* , SECTNUM nBlock, struct bRootBlock* root);
+BOOL adfIsBlockFree(struct Volume* vol, SECTNUM nSect);
+void adfSetBlockFree(struct Volume* vol, SECTNUM nSect);
+void adfSetBlockUsed(struct Volume* vol, SECTNUM nSect);
+BOOL adfGetFreeBlocks(struct Volume* vol, int nbSect, SECTNUM* sectList);
+RETCODE adfCreateBitmap(struct Volume *vol);
+RETCODE adfWriteNewBitmap(struct Volume *vol);
+void adfFreeBitmap(struct Volume *vol);
+
+#endif /* ADF_BITM_H */
+
+/*#######################################################################################*/

dep/adflib/src/adf_blk.h

@@ -0,0 +1,288 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_blk.h
+ *
+ *  $Id$
+ *
+ *  general blocks structures
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+
+#ifndef ADF_BLK_H
+#define ADF_BLK_H 1
+
+#define ULONG   uint32_t
+#define USHORT  uint16_t
+#define UCHAR   uint8_t
+
+#define LOGICAL_BLOCK_SIZE    512
+
+/* ----- FILE SYSTEM ----- */
+
+#define FSMASK_FFS         1
+#define FSMASK_INTL        2
+#define FSMASK_DIRCACHE    4
+
+#define isFFS(c)           ((c)&FSMASK_FFS)
+#define isOFS(c)           (!((c)&FSMASK_FFS))
+#define isINTL(c)          ((c)&FSMASK_INTL)
+#define isDIRCACHE(c)      ((c)&FSMASK_DIRCACHE)
+
+
+/* ----- ENTRIES ----- */
+
+/* access constants */
+
+#define ACCMASK_D	(1<<0)
+#define ACCMASK_E	(1<<1)
+#define ACCMASK_W	(1<<2)
+#define ACCMASK_R	(1<<3)
+#define ACCMASK_A	(1<<4)
+#define ACCMASK_P	(1<<5)
+#define ACCMASK_S	(1<<6)
+#define ACCMASK_H	(1<<7)
+
+#define hasD(c)    ((c)&ACCMASK_D)
+#define hasE(c)    ((c)&ACCMASK_E)
+#define hasW(c)    ((c)&ACCMASK_W)
+#define hasR(c)    ((c)&ACCMASK_R)
+#define hasA(c)    ((c)&ACCMASK_A)
+#define hasP(c)	   ((c)&ACCMASK_P)
+#define hasS(c)    ((c)&ACCMASK_S)
+#define hasH(c)    ((c)&ACCMASK_H)
+
+
+/* ----- BLOCKS ----- */
+
+/* block constants */
+
+#define BM_VALID	-1
+#define BM_INVALID	0
+
+#define HT_SIZE		72
+#define BM_SIZE     25
+#define MAX_DATABLK	72
+
+#define MAXNAMELEN	30
+#define MAXCMMTLEN	79
+
+
+/* block primary and secondary types */
+
+#define T_HEADER	2
+#define ST_ROOT		1
+#define ST_DIR		2
+#define ST_FILE		-3
+#define ST_LFILE	-4
+#define ST_LDIR		4
+#define ST_LSOFT	3
+#define T_LIST		16
+#define T_DATA		8
+#define T_DIRC		33
+
+
+/*--- blocks structures --- */
+
+
+struct bBootBlock {
+/*000*/	char	dosType[4];
+/*004*/	ULONG	checkSum;
+/*008*/	int32_t	rootBlock;
+/*00c*/	UCHAR	data[500+512];
+};
+
+
+struct bRootBlock {
+/*000*/	int32_t	type;
+        int32_t	headerKey;
+        int32_t	highSeq;
+/*00c*/	int32_t	hashTableSize;
+        int32_t	firstData;
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	hashTable[HT_SIZE];		/* hash table */
+/*138*/	int32_t	bmFlag;				/* bitmap flag, -1 means VALID */
+/*13c*/	int32_t	bmPages[BM_SIZE];
+/*1a0*/	int32_t	bmExt;
+/*1a4*/	int32_t	cDays; 	/* creation date FFS and OFS */
+/*1a8*/	int32_t	cMins;
+/*1ac*/	int32_t	cTicks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char 	diskName[MAXNAMELEN+1];
+        char	r2[8];
+/*1d8*/	int32_t	days;		/* last access : days after 1 jan 1978 */
+/*1dc*/	int32_t	mins;		/* hours and minutes in minutes */
+/*1e0*/	int32_t	ticks;		/* 1/50 seconds */
+/*1e4*/	int32_t	coDays;	/* creation date OFS */
+/*1e8*/	int32_t	coMins;
+/*1ec*/	int32_t	coTicks;
+        int32_t	nextSameHash;	/* == 0 */
+        int32_t	parent;		/* == 0 */
+/*1f8*/	int32_t	extension;		/* FFS: first directory cache block */
+/*1fc*/	int32_t	secType;	/* == 1 */
+};
+
+
+struct bFileHeaderBlock {
+/*000*/	int32_t	type;		/* == 2 */
+/*004*/	int32_t	headerKey;	/* current block number */
+/*008*/	int32_t	highSeq;	/* number of data block in this hdr block */
+/*00c*/	int32_t	dataSize;	/* == 0 */
+/*010*/	int32_t	firstData;
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	dataBlocks[MAX_DATABLK];
+/*138*/	int32_t	r1;
+/*13c*/	int32_t	r2;
+/*140*/	int32_t	access;	/* bit0=del, 1=modif, 2=write, 3=read */
+/*144*/	uint32_t	byteSize;
+/*148*/	char	commLen;
+/*149*/	char	comment[MAXCMMTLEN+1];
+        char	r3[91-(MAXCMMTLEN+1)];
+/*1a4*/	int32_t	days;
+/*1a8*/	int32_t	mins;
+/*1ac*/	int32_t	ticks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char	fileName[MAXNAMELEN+1];
+        int32_t	r4;
+/*1d4*/	int32_t	real;		/* unused == 0 */
+/*1d8*/	int32_t	nextLink;	/* link chain */
+        int32_t	r5[5];
+/*1f0*/	int32_t	nextSameHash;	/* next entry with sane hash */
+/*1f4*/	int32_t	parent;		/* parent directory */
+/*1f8*/	int32_t	extension;	/* pointer to extension block */
+/*1fc*/	int32_t	secType;	/* == -3 */
+};
+
+
+/*--- file header extension block structure ---*/
+
+struct bFileExtBlock {
+/*000*/	int32_t	type;		/* == 0x10 */
+/*004*/	int32_t	headerKey;
+/*008*/	int32_t	highSeq;
+/*00c*/	int32_t	dataSize;	/* == 0 */
+/*010*/	int32_t	firstData;	/* == 0 */
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	dataBlocks[MAX_DATABLK];
+        int32_t	r[45];
+        int32_t	info;		/* == 0 */
+        int32_t	nextSameHash;	/* == 0 */
+/*1f4*/	int32_t	parent;		/* header block */
+/*1f8*/	int32_t	extension;	/* next header extension block */
+/*1fc*/	int32_t	secType;	/* -3 */	
+};
+
+
+
+struct bDirBlock {
+/*000*/	int32_t	type;		/* == 2 */
+/*004*/	int32_t	headerKey;
+/*008*/	int32_t	highSeq;	/* == 0 */
+/*00c*/	int32_t	hashTableSize;	/* == 0 */
+        int32_t	r1;		/* == 0 */
+/*014*/	ULONG	checkSum;
+/*018*/	int32_t	hashTable[HT_SIZE];		/* hash table */
+        int32_t	r2[2];
+/*140*/	int32_t	access;
+        int32_t	r4;		/* == 0 */
+/*148*/	char	commLen;
+/*149*/	char	comment[MAXCMMTLEN+1];
+        char	r5[91-(MAXCMMTLEN+1)];
+/*1a4*/	int32_t	days;		/* last access */
+/*1a8*/	int32_t	mins;
+/*1ac*/	int32_t	ticks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char 	dirName[MAXNAMELEN+1];
+        int32_t	r6;
+/*1d4*/	int32_t	real;		/* ==0 */
+/*1d8*/	int32_t	nextLink;	/* link list */
+        int32_t	r7[5];
+/*1f0*/	int32_t	nextSameHash;
+/*1f4*/	int32_t	parent;
+/*1f8*/	int32_t	extension;		/* FFS : first directory cache */
+/*1fc*/	int32_t	secType;	/* == 2 */
+};
+
+
+
+struct bOFSDataBlock{
+/*000*/	int32_t	type;		/* == 8 */
+/*004*/	int32_t	headerKey;	/* pointer to file_hdr block */
+/*008*/	int32_t	seqNum;	/* file data block number */
+/*00c*/	int32_t	dataSize;	/* <= 0x1e8 */
+/*010*/	int32_t	nextData;	/* next data block */
+/*014*/	ULONG	checkSum;
+/*018*/	UCHAR	data[488];
+/*200*/	};
+
+
+/* --- bitmap --- */
+
+struct bBitmapBlock {
+/*000*/	ULONG	checkSum;
+/*004*/	ULONG	map[127];
+	};
+
+
+struct bBitmapExtBlock {
+/*000*/	int32_t	bmPages[127];
+/*1fc*/	int32_t	nextBlock;
+	};
+
+
+struct bLinkBlock {
+/*000*/	int32_t	type;		/* == 2 */
+/*004*/	int32_t	headerKey;	/* self pointer */
+        int32_t	r1[3];
+/*014*/	ULONG	checkSum;
+/*018*/	char	realName[64];
+        int32_t	r2[83];
+/*1a4*/	int32_t	days;		/* last access */
+/*1a8*/	int32_t	mins;
+/*1ac*/	int32_t	ticks;
+/*1b0*/	char	nameLen;
+/*1b1*/	char 	name[MAXNAMELEN+1];
+        int32_t	r3;
+/*1d4*/	int32_t	realEntry;
+/*1d8*/	int32_t	nextLink;
+        int32_t	r4[5];
+/*1f0*/	int32_t	nextSameHash;
+/*1f4*/	int32_t	parent;	
+        int32_t	r5;
+/*1fc*/	int32_t	secType;	/* == -4, 4, 3 */
+	};
+
+
+
+/*--- directory cache block structure ---*/
+
+struct bDirCacheBlock {
+/*000*/	int32_t	type;		/* == 33 */
+/*004*/	int32_t	headerKey;
+/*008*/	int32_t	parent;
+/*00c*/	int32_t	recordsNb;
+/*010*/	int32_t	nextDirC;
+/*014*/	ULONG	checkSum;
+/*018*/	uint8_t records[488];
+	};
+
+
+#endif /* ADF_BLK_H */
+/*##########################################################################*/

dep/adflib/src/adf_cache.c

@@ -0,0 +1,615 @@
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_cache.c
+ *
+ *  $Id$
+ *
+ *  directory cache code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */ 
+
+#include<stdlib.h>
+#include<string.h>
+
+#include"adf_defs.h"
+#include"adf_str.h"
+#include"adf_err.h"
+#include"defendian.h"
+#include"adf_cache.h"
+#include"adf_raw.h"
+#include"adf_disk.h"
+#include"adf_bitm.h"
+#include"adf_util.h"
+#include"adf_dir.h"
+
+
+extern struct Env adfEnv;
+/*
+freeEntCache(struct CacheEntry *cEntry)
+{
+    if (cEntry->name!=NULL)
+        free(cEntry->name);
+    if (cEntry->comm!=NULL)
+        free(cEntry->comm);
+}
+*/
+
+/*
+ * adfGetDirEntCache
+ *
+ * replace 'adfGetDirEnt'. returns a the dir contents based on the dircache list
+ */
+struct List* adfGetDirEntCache(struct Volume *vol, SECTNUM dir, BOOL recurs)
+{
+	struct bEntryBlock parent;
+	struct bDirCacheBlock dirc;
+    int offset, n;
+    struct List *cell, *head;
+    struct CacheEntry caEntry;
+    struct Entry *entry;
+    SECTNUM nSect;
+
+    if (adfReadEntryBlock(vol,dir,&parent)!=RC_OK)
+        return NULL;
+
+    nSect = parent.extension;
+
+    cell = head = NULL;
+    do {
+        /* one loop per cache block */
+        n = offset = 0;
+	    if (adfReadDirCBlock(vol, nSect, &dirc)!=RC_OK)
+            return NULL;
+        while (n<dirc.recordsNb) {
+            /* one loop per record */
+            entry = (struct Entry*)malloc(sizeof(struct Entry));
+            if (!entry) {
+                adfFreeDirList(head);
+                return NULL;
+            }
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+
+            /* converts a cache entry into a dir entry */
+            entry->type = (int)caEntry.type;
+            entry->name = strdup(caEntry.name);
+            if (entry->name==NULL) {
+                free(entry); adfFreeDirList(head);
+                return NULL;
+            }
+            entry->sector = caEntry.header;
+            entry->comment = strdup(caEntry.comm);
+            if (entry->comment==NULL) {
+                free(entry->name); adfFreeDirList(head);
+                return NULL;
+            }
+            entry->size = caEntry.size;
+            entry->access = caEntry.protect;
+            adfDays2Date( caEntry.days, &(entry->year), &(entry->month), 
+                &(entry->days) );
+            entry->hour = caEntry.mins/60;
+            entry->mins = caEntry.mins%60;
+            entry->secs = caEntry.ticks/50;
+
+            /* add it into the linked list */
+            if (head==NULL)
+                head = cell = newCell(NULL, (void*)entry); 
+            else
+                cell = newCell(cell, (void*)entry); 
+
+            if (cell==NULL) {
+                adfFreeEntry(entry);
+                adfFreeDirList(head);
+                return NULL;
+            }
+
+            if (recurs && entry->type==ST_DIR)
+                 cell->subdir = adfGetDirEntCache(vol,entry->sector,recurs);
+
+            n++;
+        }
+        nSect = dirc.nextDirC;
+    }while (nSect!=0);
+    
+    return head;	
+}
+
+
+
+/*
+ * adfGetCacheEntry
+ *
+ * Returns a cache entry, starting from the offset p (the index into records[])
+ * This offset is updated to the end of the returned entry.
+ */
+void adfGetCacheEntry(struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry)
+{
+    int ptr;
+
+    ptr = *p;
+
+/*printf("p=%d\n",ptr);*/
+
+#ifdef LITT_ENDIAN
+    cEntry->header = swapLong(dirc->records+ptr);
+    cEntry->size = swapLong(dirc->records+ptr+4);
+    cEntry->protect = swapLong(dirc->records+ptr+8);
+    cEntry->days = swapShort(dirc->records+ptr+16);
+    cEntry->mins = swapShort(dirc->records+ptr+18);
+    cEntry->ticks = swapShort(dirc->records+ptr+20);
+#else
+    cEntry->header = Long(dirc->records+ptr);
+    cEntry->size = Long(dirc->records+ptr+4);
+    cEntry->protect = Long(dirc->records+ptr+8);
+    cEntry->days = Short(dirc->records+ptr+16);
+    cEntry->mins = Short(dirc->records+ptr+18);
+    cEntry->ticks = Short(dirc->records+ptr+20);
+#endif
+    cEntry->type =(signed char) dirc->records[ptr+22];
+
+    cEntry->nLen = dirc->records[ptr+23];
+/*    cEntry->name = (char*)malloc(sizeof(char)*(cEntry->nLen+1));
+    if (!cEntry->name)
+         return;
+*/    memcpy(cEntry->name, dirc->records+ptr+24, cEntry->nLen);
+    cEntry->name[(int)(cEntry->nLen)]='\0';
+
+    cEntry->cLen = dirc->records[ptr+24+cEntry->nLen];
+    if (cEntry->cLen>0) {
+/*        cEntry->comm =(char*)malloc(sizeof(char)*(cEntry->cLen+1));
+        if (!cEntry->comm) {
+            free( cEntry->name ); cEntry->name=NULL;
+            return;
+        }
+*/        memcpy(cEntry->comm,dirc->records+ptr+24+cEntry->nLen+1,cEntry->cLen);
+    }
+        cEntry->comm[(int)(cEntry->cLen)]='\0';
+/*printf("cEntry->nLen %d cEntry->cLen %d %s\n",cEntry->nLen,cEntry->cLen,cEntry->name);*/
+    *p  = ptr+24+cEntry->nLen+1+cEntry->cLen;
+
+    /* the starting offset of each record must be even (68000 constraint) */ 
+    if ((*p%2)!=0)
+        *p=(*p)+1;
+}
+
+
+/*
+ * adfPutCacheEntry
+ *
+ * remplaces one cache entry at the p offset, and returns its length
+ */
+int adfPutCacheEntry( struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry)
+{
+    int ptr, l;
+
+    ptr = *p;
+
+#ifdef LITT_ENDIAN
+    swLong(dirc->records+ptr, cEntry->header);
+    swLong(dirc->records+ptr+4, cEntry->size);
+    swLong(dirc->records+ptr+8, cEntry->protect);
+    swShort(dirc->records+ptr+16, cEntry->days);
+    swShort(dirc->records+ptr+18, cEntry->mins);
+    swShort(dirc->records+ptr+20, cEntry->ticks);
+#else
+    memcpy(dirc->records+ptr,&(cEntry->header),4);
+    memcpy(dirc->records+ptr+4,&(cEntry->size),4);
+    memcpy(dirc->records+ptr+8,&(cEntry->protect),4);
+    memcpy(dirc->records+ptr+16,&(cEntry->days),2);
+    memcpy(dirc->records+ptr+18,&(cEntry->mins),2);
+    memcpy(dirc->records+ptr+20,&(cEntry->ticks),2);
+#endif
+    dirc->records[ptr+22] =(signed char)cEntry->type;
+
+    dirc->records[ptr+23] = cEntry->nLen;
+    memcpy(dirc->records+ptr+24, cEntry->name, cEntry->nLen);
+
+    dirc->records[ptr+24+cEntry->nLen] = cEntry->cLen;
+    memcpy(dirc->records+ptr+24+cEntry->nLen+1, cEntry->comm, cEntry->cLen);
+
+/*puts("adfPutCacheEntry");*/
+
+    l = 25+cEntry->nLen+cEntry->cLen;
+    if ((l%2)==0)
+        return l;
+    else {
+        dirc->records[ptr+l] =(char)0;
+        return l+1;
+    }
+
+    /* ptr%2 must be == 0, if l%2==0, (ptr+l)%2==0 */ 
+}
+
+
+/*
+ * adfEntry2CacheEntry
+ *
+ * converts one dir entry into a cache entry, and return its future length in records[]
+ */
+int adfEntry2CacheEntry(struct bEntryBlock *entry, struct CacheEntry *newEntry)
+{
+    int entryLen;
+
+    /* new entry */
+    newEntry->header = entry->headerKey;
+    if (entry->secType==ST_FILE)
+        newEntry->size = entry->byteSize;
+    else
+        newEntry->size = 0L;
+    newEntry->protect = entry->access;
+    newEntry->days = (short)entry->days;
+    newEntry->mins = (short)entry->mins;
+    newEntry->ticks  = (short)entry->ticks;
+    newEntry->type = (signed char)entry->secType;
+    newEntry->nLen = entry->nameLen;
+    memcpy(newEntry->name, entry->name, newEntry->nLen);
+    newEntry->name[(int)(newEntry->nLen)] = '\0';
+    newEntry->cLen = entry->commLen;
+    if (newEntry->cLen>0)
+        memcpy(newEntry->comm, entry->comment, newEntry->cLen);
+
+    entryLen = 24+newEntry->nLen+1+newEntry->cLen;
+
+/*printf("entry->name %d entry->comment %d\n",entry->nameLen,entry->commLen);
+printf("newEntry->nLen %d newEntry->cLen %d\n",newEntry->nLen,newEntry->cLen);
+*/    if ((entryLen%2)==0)
+        return entryLen;
+    else
+        return entryLen+1;
+}
+
+
+/*
+ * adfDelFromCache
+ *
+ * delete one cache entry from its block. don't do 'records garbage collecting'
+ */
+RETCODE adfDelFromCache(struct Volume *vol, struct bEntryBlock *parent, 
+    SECTNUM headerKey)
+{
+    struct bDirCacheBlock dirc;
+    SECTNUM nSect, prevSect;
+    struct CacheEntry caEntry;
+    int offset, oldOffset, n;
+    BOOL found;
+    int entryLen;
+    int i;
+    RETCODE rc = RC_OK;
+
+    prevSect = -1;
+	nSect = parent->extension;
+    found = FALSE;
+    do {
+        adfReadDirCBlock(vol, nSect, &dirc);
+        offset = 0; n = 0;
+        while(n < dirc.recordsNb && !found) {
+            oldOffset = offset;
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+            found = (caEntry.header==headerKey);
+            if (found) {
+                entryLen = offset-oldOffset;
+                if (dirc.recordsNb>1 || prevSect==-1) {
+                    if (n<dirc.recordsNb-1) {
+                        /* not the last of the block : switch the following records */
+                        for(i=oldOffset; i<(488-entryLen); i++)
+                            dirc.records[i] = dirc.records[i+entryLen];
+                        /* and clear the following bytes */
+                        for(i=488-entryLen; i<488; i++)
+                            dirc.records[i] = 0;
+                    }
+                    else {
+                        /* the last record of this cache block */
+                        for(i=oldOffset; i<offset; i++)
+                            dirc.records[i] = 0;
+                    }
+                    dirc.recordsNb--;
+                    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+						return -1;
+                }
+                else {
+                    /* dirc.recordsNb ==1 or == 0 , prevSect!=-1 : 
+                    * the only record in this dirc block and a previous dirc block exists 
+                    */
+                    adfSetBlockFree(vol, dirc.headerKey);
+                    adfReadDirCBlock(vol, prevSect, &dirc);
+                    dirc.nextDirC = 0L;
+                    adfWriteDirCBlock(vol, prevSect, &dirc);
+
+                    adfUpdateBitmap(vol);
+                }
+            }
+            n++;
+        }
+        prevSect = nSect;
+        nSect = dirc.nextDirC;
+    }while(nSect!=0 && !found);
+
+    if (!found)
+        (*adfEnv.wFct)("adfUpdateCache : entry not found");
+
+    return rc;
+}
+
+
+/*
+ * adfAddInCache
+ *
+ */
+RETCODE adfAddInCache(struct Volume *vol, struct bEntryBlock *parent, 
+    struct bEntryBlock *entry)
+{
+    struct bDirCacheBlock dirc, newDirc;
+    SECTNUM nSect, nCache;
+    struct CacheEntry caEntry, newEntry;
+    int offset, n;
+    int entryLen;
+
+    entryLen = adfEntry2CacheEntry(entry, &newEntry);
+/*printf("adfAddInCache--%4ld %2d %6ld %8lx %4d %2d:%02d:%02d %30s %22s\n",
+    newEntry.header, newEntry.type, newEntry.size, newEntry.protect,
+    newEntry.days, newEntry.mins/60, newEntry.mins%60, 
+	newEntry.ticks/50,
+	newEntry.name, newEntry.comm);
+*/
+    nSect = parent->extension;
+    do {
+        if (adfReadDirCBlock(vol, nSect, &dirc)!=RC_OK)
+            return RC_ERROR;
+        offset = 0; n = 0;
+/*printf("parent=%4ld\n",dirc.parent);*/
+        while(n < dirc.recordsNb) {
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+/*printf("*%4ld %2d %6ld %8lx %4d %2d:%02d:%02d %30s %22s\n",
+    caEntry.header, caEntry.type, caEntry.size, caEntry.protect,
+    caEntry.days, caEntry.mins/60, caEntry.mins%60, 
+	caEntry.ticks/50,
+	caEntry.name, caEntry.comm);
+*/
+            n++;
+        }
+        
+/*        if (offset+entryLen<=488) {
+            adfPutCacheEntry(&dirc, &offset, &newEntry);
+            dirc.recordsNb++;
+            adfWriteDirCBlock(vol, dirc.headerKey, &dirc);
+            return rc;
+        }*/
+        nSect = dirc.nextDirC;
+    }while(nSect!=0);
+
+    /* in the last block */
+    if (offset+entryLen<=488) {
+        adfPutCacheEntry(&dirc, &offset, &newEntry);
+        dirc.recordsNb++;
+/*printf("entry name=%s\n",newEntry.name);*/
+    }
+    else {
+        /* request one new block free */
+        nCache = adfGet1FreeBlock(vol);
+        if (nCache==-1) {
+           (*adfEnv.wFct)("adfCreateDir : nCache==-1");
+           return RC_VOLFULL;
+        }
+
+        /* create a new dircache block */
+        memset(&newDirc,0,512);
+        if (parent->secType==ST_ROOT)
+            newDirc.parent = vol->rootBlock;
+        else if (parent->secType==ST_DIR)
+            newDirc.parent = parent->headerKey;
+        else
+            (*adfEnv.wFct)("adfAddInCache : unknown secType");
+        newDirc.recordsNb = 0L;
+        newDirc.nextDirC = 0L;
+
+        adfPutCacheEntry(&dirc, &offset, &newEntry);
+        newDirc.recordsNb++;
+        if (adfWriteDirCBlock(vol, nCache, &newDirc)!=RC_OK)
+			return RC_ERROR;
+        dirc.nextDirC = nCache;
+    }
+/*printf("dirc.headerKey=%ld\n",dirc.headerKey);*/
+    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+		return RC_ERROR;
+/*if (strcmp(entry->name,"file_5u")==0)
+dumpBlock(&dirc);
+*/
+    return RC_OK;
+}
+
+
+/*
+ * adfUpdateCache
+ *
+ */
+RETCODE adfUpdateCache(struct Volume *vol, struct bEntryBlock *parent, 
+    struct bEntryBlock *entry, BOOL entryLenChg)
+{
+    struct bDirCacheBlock dirc;
+    SECTNUM nSect;
+    struct CacheEntry caEntry, newEntry;
+    int offset, oldOffset, n;
+    BOOL found;
+    int i, oLen, nLen;
+    int sLen; /* shift length */
+
+    nLen = adfEntry2CacheEntry(entry, &newEntry);
+
+    nSect = parent->extension;
+    found = FALSE;
+    do {
+/*printf("dirc=%ld\n",nSect);*/
+        if (adfReadDirCBlock(vol, nSect, &dirc)!=RC_OK)
+			return RC_ERROR;
+        offset = 0; n = 0;
+        /* search entry to update with its header_key */
+        while(n < dirc.recordsNb && !found) {
+            oldOffset = offset;
+            /* offset is updated */
+            adfGetCacheEntry(&dirc, &offset, &caEntry);
+            oLen = offset-oldOffset;
+            sLen = oLen-nLen;
+/*printf("olen=%d nlen=%d\n",oLen,nLen);*/
+            found = (caEntry.header==newEntry.header);
+            if (found) {
+                if (!entryLenChg || oLen==nLen) {
+                    /* same length : remplace the old values */
+                    adfPutCacheEntry(&dirc, &oldOffset, &newEntry);
+/*if (entryLenChg) puts("oLen==nLen");*/
+                    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+                        return RC_ERROR;
+                }
+                else if (oLen>nLen) {
+/*puts("oLen>nLen");*/
+                    /* the new record is shorter, write it, 
+                     * then shift down the following records 
+                     */
+                    adfPutCacheEntry(&dirc, &oldOffset, &newEntry);
+                    for(i=oldOffset+nLen; i<(488-sLen); i++)
+                        dirc.records[i] = dirc.records[i+sLen];
+                    /* then clear the following bytes */
+                    for(i=488-sLen; i<488; i++)
+                        dirc.records[i] = (char)0;
+
+                    if (adfWriteDirCBlock(vol, dirc.headerKey, &dirc)!=RC_OK)
+                        return RC_ERROR;
+                }
+                else {
+                    /* the new record is larger */
+/*puts("oLen<nLen");*/
+                    adfDelFromCache(vol,parent,entry->headerKey);
+                    adfAddInCache(vol,parent,entry);
+/*puts("oLen<nLen end");*/
+
+                }
+            }
+            n++;
+        }
+        nSect = dirc.nextDirC;
+    }while(nSect!=0 && !found);
+
+    if (found) {
+        if (adfUpdateBitmap(vol)!=RC_OK)
+			return RC_ERROR;
+    }
+    else
+        (*adfEnv.wFct)("adfUpdateCache : entry not found");
+
+    return RC_OK;
+}
+
+
+/*
+ * adfCreateEmptyCache
+ *
+ */
+RETCODE adfCreateEmptyCache(struct Volume *vol, struct bEntryBlock *parent, SECTNUM nSect)
+{
+    struct bDirCacheBlock dirc;
+    SECTNUM nCache;
+
+    if (nSect==-1) {
+        nCache = adfGet1FreeBlock(vol);
+        if (nCache==-1) {
+           (*adfEnv.wFct)("adfCreateDir : nCache==-1");
+           return RC_VOLFULL;
+        }
+    }
+    else
+        nCache = nSect;
+
+    if (parent->extension==0)
+		parent->extension = nCache;
+
+    memset(&dirc,0, sizeof(struct bDirCacheBlock));
+
+    if (parent->secType==ST_ROOT)
+        dirc.parent = vol->rootBlock;
+    else if (parent->secType==ST_DIR)
+        dirc.parent = parent->headerKey;
+    else {
+        (*adfEnv.wFct)("adfCreateEmptyCache : unknown secType");
+/*printf("secType=%ld\n",parent->secType);*/
+    }
+        
+    dirc.recordsNb = 0;
+    dirc.nextDirC = 0;
+
+    if (adfWriteDirCBlock(vol, nCache, &dirc)!=RC_OK)
+		return RC_ERROR;
+
+    return RC_OK;
+}
+
+
+/*
+ * adfReadDirCBlock
+ *
+ */
+RETCODE adfReadDirCBlock(struct Volume *vol, SECTNUM nSect, struct bDirCacheBlock *dirc)
+{
+    uint8_t buf[512];
+
+    if (adfReadBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+
+    memcpy(dirc,buf,512);
+#ifdef LITT_ENDIAN
+    swapEndian((uint8_t*)dirc,SWBL_CACHE);
+#endif
+    if (dirc->checkSum!=adfNormalSum(buf,20,512))
+        (*adfEnv.wFct)("adfReadDirCBlock : invalid checksum");
+    if (dirc->type!=T_DIRC)
+        (*adfEnv.wFct)("adfReadDirCBlock : T_DIRC not found");
+    if (dirc->headerKey!=nSect)
+        (*adfEnv.wFct)("adfReadDirCBlock : headerKey!=nSect");
+
+    return RC_OK;
+}
+
+
+/*
+ * adfWriteDirCblock
+ *
+ */
+RETCODE adfWriteDirCBlock(struct Volume* vol, int32_t nSect, struct bDirCacheBlock* dirc)
+{
+    uint8_t buf[LOGICAL_BLOCK_SIZE];
+    uint32_t newSum;
+ 
+    dirc->type = T_DIRC;
+    dirc->headerKey = nSect; 
+
+    memcpy(buf, dirc, LOGICAL_BLOCK_SIZE);
+#ifdef LITT_ENDIAN
+    swapEndian(buf, SWBL_CACHE);
+#endif
+
+    newSum = adfNormalSum(buf, 20, LOGICAL_BLOCK_SIZE);
+    swLong(buf+20,newSum);
+/*    *(int32_t*)(buf+20) = swapLong((uint8_t*)&newSum);*/
+
+    if (adfWriteBlock(vol, nSect, buf)!=RC_OK)
+		return RC_ERROR;
+/*puts("adfWriteDirCBlock");*/
+
+    return RC_OK;
+}
+
+/*################################################################################*/

dep/adflib/src/adf_cache.h

@@ -0,0 +1,48 @@
+#ifndef _ADF_CACHE_H
+#define _ADF_CACHE_H 1
+/*
+ *  ADF Library. (C) 1997-2002 Laurent Clevy
+ *
+ *  adf_cache.h
+ *
+ *  $Id$
+ *
+ *  directory cache code
+ *
+ *  This file is part of ADFLib.
+ *
+ *  ADFLib is free software; you can redistribute it and/or modify
+ *  it under the terms of the GNU General Public License as published by
+ *  the Free Software Foundation; either version 2 of the License, or
+ *  (at your option) any later version.
+ *
+ *  ADFLib is distributed in the hope that it will be useful,
+ *  but WITHOUT ANY WARRANTY; without even the implied warranty of
+ *  MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ *  GNU General Public License for more details.
+ *
+ *  You should have received a copy of the GNU General Public License
+ *  along with Foobar; if not, write to the Free Software
+ *  Foundation, Inc., 51 Franklin St, Fifth Floor, Boston, MA  02110-1301  USA
+ *
+ */
+
+
+#include "adf_str.h"
+
+void adfGetCacheEntry(struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry);
+int adfPutCacheEntry( struct bDirCacheBlock *dirc, int *p, struct CacheEntry *cEntry);
+
+struct List* adfGetDirEntCache(struct Volume *vol, SECTNUM dir, BOOL recurs);
+
+RETCODE adfCreateEmptyCache(struct Volume *vol, struct bEntryBlock *parent, SECTNUM nSect);
+RETCODE adfAddInCache(struct Volume *vol, struct bEntryBlock *parent, struct bEntryBlock *entry);
+RETCODE adfUpdateCache(struct Volume *vol, struct bEntryBlock *parent, struct bEntryBlock *entry, BOOL);
+RETCODE adfDelFromCache(struct Volume *vol, struct bEntryBlock *parent, SECTNUM);
+
+RETCODE adfReadDirCBlock(struct Volume *vol, SECTNUM nSect, struct bDirCacheBlock *dirc);
+RETCODE adfWriteDirCBlock(struct Volume*, int32_t, struct bDirCacheBlock* dirc);
+
+#endif /* _ADF_CACHE_H */
+
+/*##########################################################################*/